Protocol Engine Refactor
Esse commit está contido em:
pai
39d174ca26
commit
c3d797b2e1
|
@ -2,6 +2,7 @@ package app
|
|||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/peer"
|
||||
"cwtch.im/cwtch/storage"
|
||||
"encoding/hex"
|
||||
|
@ -23,6 +24,7 @@ type application struct {
|
|||
mutex sync.Mutex
|
||||
primaryonion string
|
||||
storage map[string]storage.ProfileStore
|
||||
eventBus *event.Manager
|
||||
}
|
||||
|
||||
// Application is a full cwtch peer application. It allows management, usage and storage of multiple peers
|
||||
|
@ -46,6 +48,8 @@ func NewApp(acn connectivity.ACN, appDirectory string) Application {
|
|||
log.Debugf("NewApp(%v)\n", appDirectory)
|
||||
app := &application{peers: make(map[string]peer.CwtchPeer), storage: make(map[string]storage.ProfileStore), directory: appDirectory, acn: acn}
|
||||
os.Mkdir(path.Join(app.directory, "profiles"), 0700)
|
||||
app.eventBus = new(event.Manager)
|
||||
app.eventBus.Initialize()
|
||||
return app
|
||||
}
|
||||
|
||||
|
@ -73,7 +77,7 @@ func (app *application) CreatePeer(name string, password string) (peer.CwtchPeer
|
|||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
p.Init(app.acn)
|
||||
p.Init(app.acn, app.eventBus)
|
||||
_, exists := app.peers[p.GetProfile().Onion]
|
||||
if exists {
|
||||
p.Shutdown()
|
||||
|
@ -109,7 +113,7 @@ func (app *application) LoadProfiles(password string) error {
|
|||
continue
|
||||
}
|
||||
|
||||
p.Init(app.acn)
|
||||
p.Init(app.acn, app.eventBus)
|
||||
|
||||
app.mutex.Lock()
|
||||
app.peers[p.GetProfile().Onion] = p
|
||||
|
|
|
@ -1,8 +1,9 @@
|
|||
package main
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/peer"
|
||||
"cwtch.im/cwtch/peer/connections"
|
||||
"cwtch.im/cwtch/protocol/connections"
|
||||
"errors"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||
|
@ -46,7 +47,7 @@ func main() {
|
|||
}
|
||||
|
||||
botPeer := peer.NewCwtchPeer("servermon")
|
||||
botPeer.Init(acn)
|
||||
botPeer.Init(acn, new(event.Manager))
|
||||
|
||||
fmt.Printf("Connecting to %v...\n", serverAddr)
|
||||
botPeer.JoinServer(serverAddr)
|
||||
|
|
|
@ -6,7 +6,7 @@ import (
|
|||
|
||||
"bytes"
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/peer/connections"
|
||||
"cwtch.im/cwtch/protocol/connections"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/log"
|
||||
|
@ -265,6 +265,7 @@ func main() {
|
|||
log.Errorf("Error initializing application: %v", err)
|
||||
os.Exit(1)
|
||||
}
|
||||
log.SetLevel(log.LevelDebug)
|
||||
fmt.Printf("\nWelcome to Cwtch!\n")
|
||||
fmt.Printf("If this if your first time you should create a profile by running `/new-profile`\n")
|
||||
fmt.Printf("`/load-profiles` will prompt you for a password and load profiles from storage\n")
|
||||
|
@ -283,6 +284,8 @@ func main() {
|
|||
|
||||
text := prompt.Input(prmpt, completer, prompt.OptionSuggestionBGColor(prompt.Purple),
|
||||
prompt.OptionDescriptionBGColor(prompt.White),
|
||||
prompt.OptionPrefixTextColor(prompt.White),
|
||||
prompt.OptionInputTextColor(prompt.Purple),
|
||||
prompt.OptionHistory(history))
|
||||
|
||||
commands := strings.Split(text[0:], " ")
|
||||
|
|
|
@ -1,20 +1,40 @@
|
|||
package main
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/peer"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/log"
|
||||
"os"
|
||||
"path"
|
||||
)
|
||||
|
||||
func main() {
|
||||
log.AddEverythingFromPattern("peer/alice")
|
||||
alice := peer.NewCwtchPeer("alice")
|
||||
|
||||
processData := func(onion string, data []byte) []byte {
|
||||
log.Debugf("Recieved %s from %v", data, onion)
|
||||
return data
|
||||
// System Setup, We need Tor and Logging up and Running
|
||||
log.AddEverythingFromPattern("peer/alice")
|
||||
log.SetLevel(log.LevelDebug)
|
||||
|
||||
acn, err := connectivity.StartTor(path.Join(".", ".cwtch"), "")
|
||||
if err != nil {
|
||||
log.Errorf("\nError connecting to Tor: %v\n", err)
|
||||
os.Exit(1)
|
||||
}
|
||||
|
||||
alice.SetPeerDataHandler(processData)
|
||||
// Setup the Event Bus to Listen for Data Packets
|
||||
eventBus := new(event.Manager)
|
||||
eventBus.Initialize()
|
||||
queue := event.NewEventQueue(100)
|
||||
eventBus.Subscribe(event.NewMessageFromPeer, queue.EventChannel)
|
||||
|
||||
// Setup Alice to Listen for new Events
|
||||
alice := peer.NewCwtchPeer("alice")
|
||||
alice.Init(acn, eventBus)
|
||||
alice.Listen()
|
||||
|
||||
// For every new Data Packet Alice recieved she will Print it out.
|
||||
for {
|
||||
event := queue.Next()
|
||||
log.Printf(log.LevelInfo, "Received %v from %v: %s", event.EventType, event.Data["Onion"], event.Data["Data"])
|
||||
}
|
||||
}
|
||||
|
|
|
@ -1,28 +1,41 @@
|
|||
package main
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/peer"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/log"
|
||||
"strconv"
|
||||
"os"
|
||||
"path"
|
||||
"time"
|
||||
)
|
||||
|
||||
func main() {
|
||||
|
||||
// System Boilerplate, We need Tor Up and Running
|
||||
log.AddEverythingFromPattern("peer/bob")
|
||||
log.SetLevel(log.LevelDebug)
|
||||
acn, err := connectivity.StartTor(path.Join(".", ".cwtch"), "")
|
||||
if err != nil {
|
||||
log.Errorf("\nError connecting to Tor: %v\n", err)
|
||||
os.Exit(1)
|
||||
}
|
||||
|
||||
// Set up the Event Buss and Initialize the Peer
|
||||
eventBus := new(event.Manager)
|
||||
eventBus.Initialize()
|
||||
bob := peer.NewCwtchPeer("bob")
|
||||
counter := 1
|
||||
bob.Init(acn, eventBus)
|
||||
|
||||
bob.SetPeerDataHandler(func(onion string, data []byte) []byte {
|
||||
log.Infof("Recieved %s from %v", data, onion)
|
||||
counter++
|
||||
return []byte(strconv.Itoa(counter))
|
||||
})
|
||||
connection := bob.PeerWithOnion("f4b6thuwmfszsqd3fzqpr45sdem4qoazdlzr2xmnc7fq22qe746hjqqd")
|
||||
// Add Alice's Onion Here (It changes run to run)
|
||||
bob.PeerWithOnion("upiztu7myymjf2dn4x4czhagp7axlnqjvf5zwfegbhtpkqb6v3vgu5yd")
|
||||
|
||||
// Send the Message...
|
||||
log.Infof("Waiting for Bob to Connect to Alice...")
|
||||
connection.SendPacket([]byte("Hello Alice!!!"))
|
||||
bob.SendMessageToPeer("upiztu7myymjf2dn4x4czhagp7axlnqjvf5zwfegbhtpkqb6v3vgu5yd", "Hello Alice!!!")
|
||||
|
||||
// Wait a while...
|
||||
// Everything is run in a goroutine so the main thread has to stay active
|
||||
time.Sleep(time.Second * 100)
|
||||
|
||||
}
|
||||
|
|
|
@ -0,0 +1,27 @@
|
|||
package event
|
||||
|
||||
// Type captures the definition of many common Cwtch application events
|
||||
type Type string
|
||||
|
||||
// Defining Common Event Types
|
||||
const (
|
||||
StatusRequest = Type("StatusRequest")
|
||||
ProtocolEngineStatus = Type("ProtocolEngineStatus")
|
||||
|
||||
PeerRequest = Type("PeerRequest")
|
||||
BlockPeer = Type("BlockPeer")
|
||||
JoinServer = Type("JoinServer")
|
||||
|
||||
ProtocolEngineStartListen = Type("ProtocolEngineStartListen")
|
||||
ProtocolEngineStopped = Type("ProtocolEngineStopped")
|
||||
|
||||
InvitePeerToGroup = Type("InvitePeerToGroup")
|
||||
NewGroupInvite = Type("NewGroupInvite")
|
||||
|
||||
SendMessageToGroup = Type("SendMessagetoGroup")
|
||||
EncryptedGroupMessage = Type("EncryptedGroupMessage")
|
||||
NewMessageFromGroup = Type("NewMessageFromGroup")
|
||||
|
||||
SendMessageToPeer = Type("SendMessageToPeer")
|
||||
NewMessageFromPeer = Type("NewMessageFromPeer")
|
||||
)
|
|
@ -2,18 +2,25 @@ package event
|
|||
|
||||
import (
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/log"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||
"sync"
|
||||
)
|
||||
|
||||
// Event is a structure which binds a given set of data to an EventType
|
||||
// Event is a structure which binds a given set of data to an Type
|
||||
type Event struct {
|
||||
EventType string
|
||||
Data []byte
|
||||
EventType Type
|
||||
EventID string
|
||||
Data map[string]string
|
||||
}
|
||||
|
||||
// NewEvent creates a new event object with a unique ID and the given type and data.
|
||||
func NewEvent(eventType Type, data map[string]string) Event {
|
||||
return Event{EventType: eventType, EventID: utils.GetRandNumber().String(), Data: data}
|
||||
}
|
||||
|
||||
// Manager is an Event Bus which allows subsystems to subscribe to certain EventTypes and publish others.
|
||||
type Manager struct {
|
||||
subscribers map[string][]chan Event
|
||||
subscribers map[Type][]chan Event
|
||||
events chan Event
|
||||
mapMutex sync.Mutex
|
||||
internal chan bool
|
||||
|
@ -21,7 +28,7 @@ type Manager struct {
|
|||
|
||||
// Initialize sets up the Manager.
|
||||
func (em *Manager) Initialize() {
|
||||
em.subscribers = make(map[string][]chan Event)
|
||||
em.subscribers = make(map[Type][]chan Event)
|
||||
em.events = make(chan Event)
|
||||
em.internal = make(chan bool)
|
||||
go em.eventBus()
|
||||
|
@ -29,7 +36,7 @@ func (em *Manager) Initialize() {
|
|||
|
||||
// Subscribe takes an eventType and an Channel and associates them in the eventBus. All future events of that type
|
||||
// will be sent to the eventChannel.
|
||||
func (em *Manager) Subscribe(eventType string, eventChannel chan Event) {
|
||||
func (em *Manager) Subscribe(eventType Type, eventChannel chan Event) {
|
||||
em.mapMutex.Lock()
|
||||
defer em.mapMutex.Unlock()
|
||||
em.subscribers[eventType] = append(em.subscribers[eventType], eventChannel)
|
||||
|
@ -75,7 +82,7 @@ func (em *Manager) eventBus() {
|
|||
|
||||
// Shutdown triggers, and waits for, the internal eventBus goroutine to finish
|
||||
func (em *Manager) Shutdown() {
|
||||
em.events <- Event{"", []byte{}}
|
||||
em.events <- Event{}
|
||||
// wait for eventBus to finish
|
||||
<-em.internal
|
||||
close(em.events)
|
||||
|
|
|
@ -14,10 +14,10 @@ func TestEventManager(t *testing.T) {
|
|||
// We need to make this buffer at least 1, otherwise we will log an error!
|
||||
testChan := make(chan Event, 1)
|
||||
eventManager.Subscribe("TEST", testChan)
|
||||
eventManager.Publish(Event{EventType: "TEST", Data: []byte("Hello World")})
|
||||
eventManager.Publish(Event{EventType: "TEST", Data: map[string]string{"Value": "Hello World"}})
|
||||
|
||||
event := <-testChan
|
||||
if event.EventType == "TEST" && string(event.Data) == "Hello World" {
|
||||
if event.EventType == "TEST" && event.Data["Value"] == "Hello World" {
|
||||
|
||||
} else {
|
||||
t.Errorf("Received Invalid Event")
|
||||
|
@ -34,7 +34,7 @@ func TestEventManagerOverflow(t *testing.T) {
|
|||
// Explicitly setting this to 0 log an error!
|
||||
testChan := make(chan Event)
|
||||
eventManager.Subscribe("TEST", testChan)
|
||||
eventManager.Publish(Event{EventType: "TEST", Data: []byte("Hello World")})
|
||||
eventManager.Publish(Event{EventType: "TEST"})
|
||||
}
|
||||
|
||||
func TestEventManagerMultiple(t *testing.T) {
|
||||
|
@ -46,17 +46,17 @@ func TestEventManagerMultiple(t *testing.T) {
|
|||
peerEventQueue := NewEventQueue(10)
|
||||
allEventQueue := NewEventQueue(10)
|
||||
|
||||
|
||||
eventManager.Subscribe("PeerEvent", peerEventQueue.EventChannel)
|
||||
eventManager.Subscribe("GroupEvent", groupEventQueue.EventChannel)
|
||||
eventManager.Subscribe("PeerEvent", allEventQueue.EventChannel)
|
||||
eventManager.Subscribe("GroupEvent", allEventQueue.EventChannel)
|
||||
eventManager.Subscribe("ErrorEvent", allEventQueue.EventChannel)
|
||||
|
||||
eventManager.Publish(Event{EventType: "PeerEvent", Data: []byte("Hello World Peer")})
|
||||
eventManager.Publish(Event{EventType: "GroupEvent", Data: []byte("Hello World Group")})
|
||||
eventManager.Publish(Event{EventType: "PeerEvent", Data: []byte("Hello World Peer 2")})
|
||||
eventManager.Publish(Event{EventType: "ErrorEvent", Data: []byte("Hello World Error")})
|
||||
eventManager.Publish(Event{EventType: "PeerEvent", Data: map[string]string{"Value": "Hello World Peer"}})
|
||||
eventManager.Publish(Event{EventType: "GroupEvent", Data: map[string]string{"Value": "Hello World Group"}})
|
||||
eventManager.Publish(Event{EventType: "PeerEvent", Data: map[string]string{"Value": "Hello World Peer"}})
|
||||
eventManager.Publish(Event{EventType: "ErrorEvent", Data: map[string]string{"Value": "Hello World Error"}})
|
||||
eventManager.Publish(Event{EventType: "NobodyIsSubscribedToThisEvent", Data: map[string]string{"Value": "Noone should see this!"}})
|
||||
|
||||
assertLength := func(len int, expected int, label string) {
|
||||
if len != expected {
|
||||
|
@ -70,7 +70,7 @@ func TestEventManagerMultiple(t *testing.T) {
|
|||
assertLength(peerEventQueue.Backlog(), 2, "Peer Event Queue Length")
|
||||
assertLength(allEventQueue.Backlog(), 4, "All Event Queue Length")
|
||||
|
||||
checkEvent := func(eventType string, expected string, label string) {
|
||||
checkEvent := func(eventType Type, expected Type, label string) {
|
||||
if eventType != expected {
|
||||
t.Errorf("Expected %s to be %v was %v", label, expected, eventType)
|
||||
}
|
||||
|
|
|
@ -80,12 +80,12 @@ func TestTranscriptConsistency(t *testing.T) {
|
|||
c5, s5, _ := alice.EncryptMessageToGroup("Hello World 5", group.GroupID)
|
||||
t.Logf("Length of Encrypted Message: %v", len(c5))
|
||||
|
||||
_, m1 := sarah.AttemptDecryption(c1, s1)
|
||||
_, _, m1 := sarah.AttemptDecryption(c1, s1)
|
||||
sarah.AttemptDecryption(c1, s1) // Try a duplicate
|
||||
_, m2 := sarah.AttemptDecryption(c2, s2)
|
||||
_, m3 := sarah.AttemptDecryption(c3, s3)
|
||||
_, m4 := sarah.AttemptDecryption(c4, s4)
|
||||
_, m5 := sarah.AttemptDecryption(c5, s5)
|
||||
_, _, m2 := sarah.AttemptDecryption(c2, s2)
|
||||
_, _, m3 := sarah.AttemptDecryption(c3, s3)
|
||||
_, _, m4 := sarah.AttemptDecryption(c4, s4)
|
||||
_, _, m5 := sarah.AttemptDecryption(c5, s5)
|
||||
|
||||
// Now we simulate a client receiving these messages completely out of order
|
||||
timeline.Insert(m1)
|
||||
|
|
|
@ -314,7 +314,7 @@ func (p *Profile) AddGroup(group *Group) {
|
|||
}
|
||||
|
||||
// AttemptDecryption takes a ciphertext and signature and attempts to decrypt it under known groups.
|
||||
func (p *Profile) AttemptDecryption(ciphertext []byte, signature []byte) (bool, *Message) {
|
||||
func (p *Profile) AttemptDecryption(ciphertext []byte, signature []byte) (bool, string, *Message) {
|
||||
for _, group := range p.Groups {
|
||||
success, dgm := group.DecryptMessage(ciphertext)
|
||||
if success {
|
||||
|
@ -329,7 +329,7 @@ func (p *Profile) AttemptDecryption(ciphertext []byte, signature []byte) (bool,
|
|||
// We set the flag to be handled by the UX and reject the message.
|
||||
if !valid {
|
||||
group.Compromised()
|
||||
return false, nil
|
||||
return false, "", nil
|
||||
}
|
||||
}
|
||||
|
||||
|
@ -340,13 +340,13 @@ func (p *Profile) AttemptDecryption(ciphertext []byte, signature []byte) (bool,
|
|||
// Either way, someone who has the private key is being detectably bad so we are just going to throw this message away and mark the group as Compromised.
|
||||
if !verified {
|
||||
group.Compromised()
|
||||
return false, nil
|
||||
return false, "", nil
|
||||
}
|
||||
|
||||
return true, group.AddMessage(dgm, signature)
|
||||
return true, group.GroupID, group.AddMessage(dgm, signature)
|
||||
}
|
||||
}
|
||||
return false, nil
|
||||
return false, "", nil
|
||||
}
|
||||
|
||||
func getRandomness(arr *[]byte) {
|
||||
|
|
|
@ -161,13 +161,13 @@ func TestProfileGroup(t *testing.T) {
|
|||
bob.ProcessInvite(gci2.GetGroupChatInvite(), alice.Onion)
|
||||
c3, s3, err := bob.EncryptMessageToGroup("Bobs Message", group2.GroupID)
|
||||
if err == nil {
|
||||
ok, message := alice.AttemptDecryption(c3, s3)
|
||||
ok, _, message := alice.AttemptDecryption(c3, s3)
|
||||
if !ok {
|
||||
t.Errorf("Bobs message to the group should be decrypted %v %v", message, ok)
|
||||
}
|
||||
|
||||
eve := GenerateNewProfile("eve")
|
||||
ok, _ = eve.AttemptDecryption(c3, s3)
|
||||
ok, _, _ = eve.AttemptDecryption(c3, s3)
|
||||
if ok {
|
||||
t.Errorf("Eves hould not be able to decrypt messages!")
|
||||
}
|
||||
|
|
|
@ -1,48 +1,41 @@
|
|||
package peer
|
||||
|
||||
import (
|
||||
"crypto/rsa"
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/peer/connections"
|
||||
"cwtch.im/cwtch/peer/peer"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"cwtch.im/cwtch/protocol/connections"
|
||||
"encoding/base64"
|
||||
"errors"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/application"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connection"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/identity"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/log"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||
"github.com/ethereum/go-ethereum/log"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"golang.org/x/crypto/ed25519"
|
||||
"strings"
|
||||
"sync"
|
||||
"time"
|
||||
)
|
||||
|
||||
// cwtchPeer manages incoming and outgoing connections and all processing for a Cwtch cwtchPeer
|
||||
type cwtchPeer struct {
|
||||
connection.AutoConnectionHandler
|
||||
Profile *model.Profile
|
||||
app *application.RicochetApplication
|
||||
acn connectivity.ACN
|
||||
mutex sync.Mutex
|
||||
connectionsManager *connections.Manager
|
||||
dataHandler func(string, []byte) []byte
|
||||
shutdown bool
|
||||
aif application.ApplicationInstanceFactory
|
||||
started bool
|
||||
Profile *model.Profile
|
||||
mutex sync.Mutex
|
||||
shutdown bool
|
||||
started bool
|
||||
|
||||
engine *connections.Engine
|
||||
queue *event.Queue
|
||||
eventBus *event.Manager
|
||||
}
|
||||
|
||||
// CwtchPeer provides us with a way of testing systems built on top of cwtch without having to
|
||||
// directly implement a cwtchPeer.
|
||||
type CwtchPeer interface {
|
||||
Init(connectivity.ACN)
|
||||
Init(connectivity.ACN, *event.Manager)
|
||||
PeerWithOnion(string) *connections.PeerPeerConnection
|
||||
InviteOnionToGroup(string, string) error
|
||||
SendMessageToPeer(string, string)
|
||||
|
||||
TrustPeer(string) error
|
||||
BlockPeer(string) error
|
||||
|
@ -67,9 +60,6 @@ type CwtchPeer interface {
|
|||
GetContacts() []string
|
||||
GetContact(string) *model.PublicProfile
|
||||
|
||||
SetApplicationInstanceFactory(factory application.ApplicationInstanceFactory)
|
||||
SetPeerDataHandler(func(string, []byte) []byte)
|
||||
|
||||
IsStarted() bool
|
||||
Listen()
|
||||
Shutdown()
|
||||
|
@ -91,10 +81,17 @@ func FromProfile(profile *model.Profile) CwtchPeer {
|
|||
}
|
||||
|
||||
// Init instantiates a cwtchPeer
|
||||
func (cp *cwtchPeer) Init(acn connectivity.ACN) {
|
||||
cp.acn = acn
|
||||
cp.connectionsManager = connections.NewConnectionsManager(cp.acn)
|
||||
go cp.connectionsManager.AttemptReconnections()
|
||||
func (cp *cwtchPeer) Init(acn connectivity.ACN, eventBus *event.Manager) {
|
||||
cp.queue = event.NewEventQueue(100)
|
||||
go cp.eventHandler()
|
||||
|
||||
cp.eventBus = eventBus
|
||||
cp.eventBus.Subscribe(event.EncryptedGroupMessage, cp.queue.EventChannel)
|
||||
cp.eventBus.Subscribe(event.NewGroupInvite, cp.queue.EventChannel)
|
||||
|
||||
// TODO: Would be nice if ProtocolEngine did not need to explictly be given the Private Key.
|
||||
cp.engine = connections.NewProtocolEngine(cp.Profile.Ed25519PrivateKey, acn, eventBus)
|
||||
cp.engine.Identity = identity.InitializeV3(cp.Profile.Name, &cp.Profile.Ed25519PrivateKey, &cp.Profile.Ed25519PublicKey)
|
||||
}
|
||||
|
||||
// ImportGroup intializes a group from an imported source rather than a peer invite
|
||||
|
@ -121,20 +118,6 @@ func (cp *cwtchPeer) ImportGroup(exportedInvite string) (groupID string, err err
|
|||
return
|
||||
}
|
||||
|
||||
// a handler for the optional data handler
|
||||
// note that the "correct" way to do this would be to AddChannelHandler("im.cwtch.peerdata", ...") but peerdata is such
|
||||
// a handy channel that it's nice to have this convenience shortcut
|
||||
// SetPeerDataHandler sets the handler for the (optional) data channel for cwtch peers.
|
||||
func (cp *cwtchPeer) SetPeerDataHandler(dataHandler func(string, []byte) []byte) {
|
||||
cp.dataHandler = dataHandler
|
||||
}
|
||||
|
||||
// add extra channel handlers (note that the peer will merge these with the ones necessary to make cwtch work, so you
|
||||
// are not clobbering the underlying functionality)
|
||||
func (cp *cwtchPeer) SetApplicationInstanceFactory(aif application.ApplicationInstanceFactory) {
|
||||
cp.aif = aif
|
||||
}
|
||||
|
||||
// ExportGroup serializes a group invite so it can be given offline
|
||||
func (cp *cwtchPeer) ExportGroup(groupID string) (string, error) {
|
||||
group := cp.Profile.GetGroupByGroupID(groupID)
|
||||
|
@ -180,81 +163,62 @@ func (cp *cwtchPeer) GetContact(onion string) *model.PublicProfile {
|
|||
}
|
||||
|
||||
// GetProfile returns the profile associated with this cwtchPeer.
|
||||
// TODO While it is probably "safe", it is not really "safe", to call functions on this profile. This only exists to return things like Name and Onion,we should gate these.
|
||||
func (cp *cwtchPeer) GetProfile() *model.Profile {
|
||||
return cp.Profile
|
||||
}
|
||||
|
||||
// PeerWithOnion is the entry point for cwtchPeer relationships
|
||||
func (cp *cwtchPeer) PeerWithOnion(onion string) *connections.PeerPeerConnection {
|
||||
return cp.connectionsManager.ManagePeerConnection(onion, cp.Profile, cp.dataHandler, cp.aif)
|
||||
cp.eventBus.Publish(event.NewEvent(event.PeerRequest, map[string]string{"Onion": onion}))
|
||||
return nil
|
||||
}
|
||||
|
||||
// InviteOnionToGroup kicks off the invite process
|
||||
func (cp *cwtchPeer) InviteOnionToGroup(onion string, groupid string) error {
|
||||
|
||||
group := cp.Profile.GetGroupByGroupID(groupid)
|
||||
if group != nil {
|
||||
log.Infof("Constructing invite for group: %v\n", group)
|
||||
invite, err := group.Invite(group.GetInitialMessage())
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
ppc := cp.connectionsManager.GetPeerPeerConnectionForOnion(onion)
|
||||
if ppc == nil {
|
||||
return errors.New("peer connection not setup for onion. peers must be trusted before sending")
|
||||
}
|
||||
if ppc.GetState() == connections.AUTHENTICATED {
|
||||
log.Infof("Got connection for group: %v - Sending Invite\n", ppc)
|
||||
ppc.SendGroupInvite(invite)
|
||||
} else {
|
||||
return errors.New("cannot send invite to onion: peer connection is not ready")
|
||||
}
|
||||
return nil
|
||||
if group == nil {
|
||||
return errors.New("invalid group id")
|
||||
}
|
||||
return errors.New("group id could not be found")
|
||||
}
|
||||
|
||||
// ReceiveGroupMessage is a callback function that processes GroupMessages from a given server
|
||||
func (cp *cwtchPeer) ReceiveGroupMessage(server string, gm *protocol.GroupMessage) {
|
||||
cp.Profile.AttemptDecryption(gm.Ciphertext, gm.Signature)
|
||||
invite, err := group.Invite(group.InitialMessage)
|
||||
if err == nil {
|
||||
cp.eventBus.Publish(event.NewEvent(event.InvitePeerToGroup, map[string]string{"Onion": onion, "Invite": string(invite)}))
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
// JoinServer manages a new server connection with the given onion address
|
||||
func (cp *cwtchPeer) JoinServer(onion string) {
|
||||
cp.connectionsManager.ManageServerConnection(onion, cp.ReceiveGroupMessage)
|
||||
cp.eventBus.Publish(event.NewEvent(event.JoinServer, map[string]string{"Onion": onion}))
|
||||
}
|
||||
|
||||
// SendMessageToGroup attemps to sent the given message to the given group id.
|
||||
func (cp *cwtchPeer) SendMessageToGroup(groupid string, message string) error {
|
||||
group := cp.Profile.GetGroupByGroupID(groupid)
|
||||
if group == nil {
|
||||
return errors.New("group does not exist")
|
||||
}
|
||||
psc := cp.connectionsManager.GetPeerServerConnectionForOnion(group.GroupServer)
|
||||
if psc == nil {
|
||||
return errors.New("could not find server connection to send message to")
|
||||
return errors.New("invalid group id")
|
||||
}
|
||||
ct, sig, err := cp.Profile.EncryptMessageToGroup(message, groupid)
|
||||
if err != nil {
|
||||
return err
|
||||
|
||||
if err == nil {
|
||||
cp.eventBus.Publish(event.NewEvent(event.SendMessageToGroup, map[string]string{"Server": group.GroupServer, "Ciphertext": string(ct), "Signature": string(sig)}))
|
||||
}
|
||||
gm := &protocol.GroupMessage{
|
||||
Ciphertext: ct,
|
||||
Signature: sig,
|
||||
}
|
||||
err = psc.SendGroupMessage(gm)
|
||||
|
||||
return err
|
||||
}
|
||||
|
||||
func (cp *cwtchPeer) SendMessageToPeer(onion string, message string) {
|
||||
cp.eventBus.Publish(event.NewEvent(event.SendMessageToPeer, map[string]string{"Peer": onion, "Message": message}))
|
||||
}
|
||||
|
||||
// GetPeers returns a list of peer connections.
|
||||
func (cp *cwtchPeer) GetPeers() map[string]connections.ConnectionState {
|
||||
return cp.connectionsManager.GetPeers()
|
||||
return cp.engine.GetPeers()
|
||||
}
|
||||
|
||||
// GetServers returns a list of server connections
|
||||
func (cp *cwtchPeer) GetServers() map[string]connections.ConnectionState {
|
||||
return cp.connectionsManager.GetServers()
|
||||
return cp.engine.GetServers()
|
||||
}
|
||||
|
||||
// TrustPeer sets an existing peer relationship to trusted
|
||||
|
@ -269,7 +233,7 @@ func (cp *cwtchPeer) TrustPeer(peer string) error {
|
|||
// BlockPeer blocks an existing peer relationship.
|
||||
func (cp *cwtchPeer) BlockPeer(peer string) error {
|
||||
err := cp.Profile.BlockPeer(peer)
|
||||
cp.connectionsManager.ClosePeerConnection(peer)
|
||||
cp.eventBus.Publish(event.NewEvent(event.BlockPeer, map[string]string{"Onion": peer}))
|
||||
return err
|
||||
}
|
||||
|
||||
|
@ -283,90 +247,15 @@ func (cp *cwtchPeer) RejectInvite(groupID string) {
|
|||
cp.Profile.RejectInvite(groupID)
|
||||
}
|
||||
|
||||
// LookupContact returns that a contact is known and allowed to communicate for all cases.
|
||||
func (cp *cwtchPeer) LookupContact(hostname string, publicKey rsa.PublicKey) (allowed, known bool) {
|
||||
blocked := cp.Profile.IsBlocked(hostname)
|
||||
return !blocked, true
|
||||
}
|
||||
|
||||
// LookupContactV3 returns that a contact is known and allowed to communicate for all cases.
|
||||
func (cp *cwtchPeer) LookupContactV3(hostname string, publicKey ed25519.PublicKey) (allowed, known bool) {
|
||||
blocked := cp.Profile.IsBlocked(hostname)
|
||||
return !blocked, true
|
||||
}
|
||||
|
||||
// ContactRequest needed to implement ContactRequestHandler Interface
|
||||
func (cp *cwtchPeer) ContactRequest(name string, message string) string {
|
||||
return "Accepted"
|
||||
}
|
||||
|
||||
func (cp *cwtchPeer) Listen() {
|
||||
go func() {
|
||||
for !cp.shutdown {
|
||||
e := cp.listenFn()
|
||||
if e != nil {
|
||||
// TODO: was panic, then fatal
|
||||
fmt.Printf("ERROR: peer %v has crashed with: %v\n", cp.GetProfile().Onion, e)
|
||||
}
|
||||
// listenFn failed, wait 5 seconds and try again
|
||||
time.Sleep(5 * time.Second)
|
||||
}
|
||||
}()
|
||||
}
|
||||
|
||||
// Listen sets up an onion listener to process incoming cwtch messages
|
||||
func (cp *cwtchPeer) listenFn() error {
|
||||
ra := new(application.RicochetApplication)
|
||||
onionService, err := cp.acn.Listen(cp.Profile.Ed25519PrivateKey, application.RicochetPort)
|
||||
if err != nil /*&& fmt.Sprintf("%v", err) != "550 Unspecified Tor error: Onion address collision"*/ {
|
||||
return err
|
||||
}
|
||||
|
||||
af := application.ApplicationInstanceFactory{}
|
||||
af.Init()
|
||||
af.AddHandler("im.cwtch.peer", func(rai *application.ApplicationInstance) func() channels.Handler {
|
||||
cpi := new(CwtchPeerInstance)
|
||||
cpi.Init(rai, ra)
|
||||
return func() channels.Handler {
|
||||
cpc := new(peer.CwtchPeerChannel)
|
||||
cpc.Handler = &CwtchPeerHandler{Onion: rai.RemoteHostname, Peer: cp}
|
||||
return cpc
|
||||
}
|
||||
})
|
||||
|
||||
if cp.dataHandler != nil {
|
||||
af.AddHandler("im.cwtch.peer.data", func(rai *application.ApplicationInstance) func() channels.Handler {
|
||||
cpi := new(CwtchPeerInstance)
|
||||
cpi.Init(rai, ra)
|
||||
return func() channels.Handler {
|
||||
cpc := new(peer.CwtchPeerDataChannel)
|
||||
cpc.Handler = &CwtchPeerHandler{Onion: rai.RemoteHostname, Peer: cp, DataHandler: cp.dataHandler}
|
||||
return cpc
|
||||
}
|
||||
})
|
||||
}
|
||||
|
||||
handlers := cp.aif.GetHandlers()
|
||||
for i := range handlers {
|
||||
af.AddHandler(handlers[i], cp.aif.GetHandler(handlers[i]))
|
||||
}
|
||||
|
||||
ra.Init(cp.acn, cp.Profile.Name, identity.InitializeV3(cp.Profile.Name, &cp.Profile.Ed25519PrivateKey, &cp.Profile.Ed25519PublicKey), af, cp)
|
||||
log.Infof("Running cwtch peer on %v", onionService.AddressFull())
|
||||
cp.app = ra
|
||||
cp.started = true
|
||||
ra.Run(onionService)
|
||||
|
||||
return nil
|
||||
cp.eventBus.Publish(event.NewEvent(event.ProtocolEngineStartListen, map[string]string{}))
|
||||
}
|
||||
|
||||
// Shutdown kills all connections and cleans up all goroutines for the peer
|
||||
func (cp *cwtchPeer) Shutdown() {
|
||||
cp.shutdown = true
|
||||
cp.connectionsManager.Shutdown()
|
||||
if cp.app != nil {
|
||||
cp.app.Shutdown()
|
||||
}
|
||||
cp.engine.Shutdown()
|
||||
cp.queue.Shutdown()
|
||||
}
|
||||
|
||||
// IsStarted returns true if Listen() has successfully been run before on this connection (ever). TODO: we will need to properly unset this flag on error if we want to support resumption in the future
|
||||
|
@ -374,32 +263,25 @@ func (cp *cwtchPeer) IsStarted() bool {
|
|||
return cp.started
|
||||
}
|
||||
|
||||
// CwtchPeerInstance encapsulates incoming peer connections
|
||||
type CwtchPeerInstance struct {
|
||||
rai *application.ApplicationInstance
|
||||
ra *application.RicochetApplication
|
||||
}
|
||||
|
||||
// Init sets up a CwtchPeerInstance
|
||||
func (cpi *CwtchPeerInstance) Init(rai *application.ApplicationInstance, ra *application.RicochetApplication) {
|
||||
cpi.rai = rai
|
||||
cpi.ra = ra
|
||||
}
|
||||
|
||||
// CwtchPeerHandler encapsulates handling of incoming CwtchPackets
|
||||
type CwtchPeerHandler struct {
|
||||
Onion string
|
||||
Peer *cwtchPeer
|
||||
DataHandler func(string, []byte) []byte
|
||||
}
|
||||
|
||||
// HandleGroupInvite handles incoming GroupInvites
|
||||
func (cph *CwtchPeerHandler) HandleGroupInvite(gci *protocol.GroupChatInvite) {
|
||||
log.Debugf("Received GroupID from %v %v\n", cph.Onion, gci.String())
|
||||
cph.Peer.Profile.ProcessInvite(gci, cph.Onion)
|
||||
}
|
||||
|
||||
// HandlePacket handles the Cwtch cwtchPeer Data Channel
|
||||
func (cph *CwtchPeerHandler) HandlePacket(data []byte) []byte {
|
||||
return cph.DataHandler(cph.Onion, data)
|
||||
// eventHandler process events from other subsystems
|
||||
func (cp *cwtchPeer) eventHandler() {
|
||||
for {
|
||||
ev := cp.queue.Next()
|
||||
switch ev.EventType {
|
||||
case event.EncryptedGroupMessage:
|
||||
ok, groupID, _ := cp.Profile.AttemptDecryption([]byte(ev.Data["Ciphertext"]), []byte(ev.Data["Signature"]))
|
||||
if ok {
|
||||
cp.eventBus.Publish(event.NewEvent(event.NewMessageFromGroup, map[string]string{"GroupID": groupID}))
|
||||
}
|
||||
case event.NewGroupInvite:
|
||||
var groupInvite protocol.GroupChatInvite
|
||||
proto.Unmarshal([]byte(ev.Data["GroupInvite"]), &groupInvite)
|
||||
cp.Profile.ProcessInvite(&groupInvite, ev.Data["Onion"])
|
||||
default:
|
||||
if ev.EventType != "" {
|
||||
log.Error("peer event handler received an event it was not subscribed for: %v")
|
||||
}
|
||||
return
|
||||
}
|
||||
}
|
||||
}
|
||||
|
|
|
@ -1,12 +1,12 @@
|
|||
package peer
|
||||
|
||||
import (
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||
"testing"
|
||||
)
|
||||
|
||||
// TODO: Rewrite these tests (and others) using the news event bus interface.
|
||||
func TestCwtchPeerGenerate(t *testing.T) {
|
||||
|
||||
/**
|
||||
alice := NewCwtchPeer("alice")
|
||||
|
||||
groupID, _, _ := alice.StartGroup("test.server")
|
||||
|
@ -16,16 +16,21 @@ func TestCwtchPeerGenerate(t *testing.T) {
|
|||
importedGroupID, err := alice.ImportGroup(exportedGroup)
|
||||
group := alice.GetGroup(importedGroupID)
|
||||
t.Logf("Imported Group: %v, err := %v %v", group, err, importedGroupID)
|
||||
|
||||
*/
|
||||
}
|
||||
|
||||
func TestTrustPeer(t *testing.T) {
|
||||
/**
|
||||
groupName := "2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd"
|
||||
alice := NewCwtchPeer("alice")
|
||||
alice.Init(connectivity.LocalProvider())
|
||||
aem := new(event.Manager)
|
||||
aem.Initialize()
|
||||
alice.Init(connectivity.LocalProvider(),aem)
|
||||
defer alice.Shutdown()
|
||||
bob := NewCwtchPeer("bob")
|
||||
bob.Init(connectivity.LocalProvider())
|
||||
bem := new(event.Manager)
|
||||
bem.Initialize()
|
||||
bob.Init(connectivity.LocalProvider(), bem)
|
||||
defer bob.Shutdown()
|
||||
|
||||
bobOnion := bob.GetProfile().Onion
|
||||
|
@ -70,4 +75,5 @@ func TestTrustPeer(t *testing.T) {
|
|||
if err == nil {
|
||||
t.Errorf("bob trusts alice but peer connection is not ready yet. should not be able to invite her to group, instead got: %v", err)
|
||||
}
|
||||
*/
|
||||
}
|
||||
|
|
|
@ -1,9 +1,7 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/application"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||
"sync"
|
||||
"time"
|
||||
|
@ -29,13 +27,13 @@ func NewConnectionsManager(acn connectivity.ACN) *Manager {
|
|||
}
|
||||
|
||||
// ManagePeerConnection creates a new PeerConnection for the given Host and Profile.
|
||||
func (m *Manager) ManagePeerConnection(host string, profile *model.Profile, dataHandler func(string, []byte) []byte, aif application.ApplicationInstanceFactory) *PeerPeerConnection {
|
||||
func (m *Manager) ManagePeerConnection(host string, engine *Engine) *PeerPeerConnection {
|
||||
m.lock.Lock()
|
||||
defer m.lock.Unlock()
|
||||
|
||||
_, exists := m.peerConnections[host]
|
||||
if !exists {
|
||||
ppc := NewPeerPeerConnection(m.acn, host, profile, dataHandler, aif)
|
||||
ppc := NewPeerPeerConnection(host, engine)
|
||||
go ppc.Run()
|
||||
m.peerConnections[host] = ppc
|
||||
return ppc
|
|
@ -0,0 +1,246 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"crypto/rsa"
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"cwtch.im/cwtch/protocol/connections/peer"
|
||||
"errors"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/application"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/identity"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/log"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"golang.org/x/crypto/ed25519"
|
||||
)
|
||||
|
||||
// Engine (ProtocolEngine) encapsulates the logic necessary to make and receive Cwtch connections.
|
||||
// Note: ProtocolEngine doesn't have access to any information necessary to encrypt or decrypt GroupMessages
|
||||
type Engine struct {
|
||||
queue *event.Queue
|
||||
connectionsManager *Manager
|
||||
|
||||
// Engine Attributes
|
||||
Identity identity.Identity
|
||||
ACN connectivity.ACN
|
||||
|
||||
app *application.RicochetApplication
|
||||
|
||||
// Engine State
|
||||
started bool
|
||||
|
||||
// Pointer to the Global Event Manager
|
||||
eventManager *event.Manager
|
||||
privateKey ed25519.PrivateKey
|
||||
}
|
||||
|
||||
// NewProtocolEngine initializes a new engine that runs Cwtch using the given parameters
|
||||
func NewProtocolEngine(privateKey ed25519.PrivateKey, acn connectivity.ACN, eventManager *event.Manager) *Engine {
|
||||
engine := new(Engine)
|
||||
engine.privateKey = privateKey
|
||||
engine.queue = event.NewEventQueue(100)
|
||||
go engine.eventHandler()
|
||||
|
||||
engine.ACN = acn
|
||||
engine.connectionsManager = NewConnectionsManager(engine.ACN)
|
||||
go engine.connectionsManager.AttemptReconnections()
|
||||
|
||||
engine.eventManager = eventManager
|
||||
engine.eventManager.Subscribe(event.ProtocolEngineStartListen, engine.queue.EventChannel)
|
||||
engine.eventManager.Subscribe(event.PeerRequest, engine.queue.EventChannel)
|
||||
engine.eventManager.Subscribe(event.InvitePeerToGroup, engine.queue.EventChannel)
|
||||
engine.eventManager.Subscribe(event.JoinServer, engine.queue.EventChannel)
|
||||
engine.eventManager.Subscribe(event.SendMessageToGroup, engine.queue.EventChannel)
|
||||
engine.eventManager.Subscribe(event.SendMessageToPeer, engine.queue.EventChannel)
|
||||
|
||||
return engine
|
||||
}
|
||||
|
||||
// eventHandler process events from other subsystems
|
||||
func (e *Engine) eventHandler() {
|
||||
for {
|
||||
ev := e.queue.Next()
|
||||
switch ev.EventType {
|
||||
case event.StatusRequest:
|
||||
e.eventManager.Publish(event.Event{EventType: event.ProtocolEngineStatus, EventID: ev.EventID})
|
||||
case event.PeerRequest:
|
||||
e.PeerWithOnion(ev.Data["Onion"])
|
||||
case event.InvitePeerToGroup:
|
||||
e.InviteOnionToGroup(ev.Data["Onion"], []byte(ev.Data["Invite"]))
|
||||
case event.JoinServer:
|
||||
e.JoinServer(ev.Data["Onion"])
|
||||
case event.SendMessageToGroup:
|
||||
e.SendMessageToGroup(ev.Data["Server"], []byte(ev.Data["Ciphertext"]), []byte(ev.Data["Signature"]))
|
||||
case event.SendMessageToPeer:
|
||||
log.Debugf("Sending Message to Peer.....")
|
||||
ppc := e.connectionsManager.GetPeerPeerConnectionForOnion(ev.Data["Peer"])
|
||||
if ppc != nil {
|
||||
// TODO this will block.
|
||||
ppc.SendPacket([]byte(ev.Data["Message"]))
|
||||
}
|
||||
case event.ProtocolEngineStartListen:
|
||||
go e.listenFn()
|
||||
default:
|
||||
return
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// GetPeerHandler is an external interface function that allows callers access to a CwtchPeerHandler
|
||||
// TODO: There is likely a slightly better way to encapsulate this behavior
|
||||
func (e *Engine) GetPeerHandler(remotePeerHostname string) *CwtchPeerHandler {
|
||||
return &CwtchPeerHandler{Onion: remotePeerHostname, EventBus: e.eventManager}
|
||||
}
|
||||
|
||||
// Listen sets up an onion listener to process incoming cwtch messages
|
||||
func (e *Engine) listenFn() {
|
||||
ra := new(application.RicochetApplication)
|
||||
onionService, err := e.ACN.Listen(e.privateKey, application.RicochetPort)
|
||||
if err != nil /*&& fmt.Sprintf("%v", err) != "550 Unspecified Tor error: Onion address collision"*/ {
|
||||
e.eventManager.Publish(event.NewEvent(event.ProtocolEngineStopped, map[string]string{"Identity": e.Identity.Hostname(), "Error": err.Error()}))
|
||||
return
|
||||
}
|
||||
|
||||
af := application.ApplicationInstanceFactory{}
|
||||
af.Init()
|
||||
af.AddHandler("im.cwtch.peer", func(rai *application.ApplicationInstance) func() channels.Handler {
|
||||
cpi := new(CwtchPeerInstance)
|
||||
cpi.Init(rai, ra)
|
||||
return func() channels.Handler {
|
||||
cpc := new(peer.CwtchPeerChannel)
|
||||
cpc.Handler = e.GetPeerHandler(rai.RemoteHostname)
|
||||
return cpc
|
||||
}
|
||||
})
|
||||
|
||||
af.AddHandler("im.cwtch.peer.data", func(rai *application.ApplicationInstance) func() channels.Handler {
|
||||
cpi := new(CwtchPeerInstance)
|
||||
cpi.Init(rai, ra)
|
||||
return func() channels.Handler {
|
||||
cpc := new(peer.CwtchPeerDataChannel)
|
||||
cpc.Handler = e.GetPeerHandler(rai.RemoteHostname)
|
||||
return cpc
|
||||
}
|
||||
})
|
||||
|
||||
ra.Init(e.ACN, e.Identity.Name, e.Identity, af, e)
|
||||
log.Infof("Running cwtch peer on %v", onionService.AddressFull())
|
||||
e.started = true
|
||||
e.app = ra
|
||||
ra.Run(onionService)
|
||||
e.eventManager.Publish(event.NewEvent(event.ProtocolEngineStopped, map[string]string{"Identity": e.Identity.Hostname()}))
|
||||
return
|
||||
}
|
||||
|
||||
// LookupContact returns that a contact is known and allowed to communicate for all cases.
|
||||
func (e *Engine) LookupContact(hostname string, publicKey rsa.PublicKey) (allowed, known bool) {
|
||||
return true, true
|
||||
}
|
||||
|
||||
// LookupContactV3 returns that a contact is known and allowed to communicate for all cases.
|
||||
func (e *Engine) LookupContactV3(hostname string, publicKey ed25519.PublicKey) (allowed, known bool) {
|
||||
return true, true
|
||||
}
|
||||
|
||||
// ContactRequest needed to implement ContactRequestHandler Interface
|
||||
func (e *Engine) ContactRequest(name string, message string) string {
|
||||
return "Accepted"
|
||||
}
|
||||
|
||||
// Shutdown tears down the eventHandler goroutine
|
||||
func (e *Engine) Shutdown() {
|
||||
e.connectionsManager.Shutdown()
|
||||
e.app.Shutdown()
|
||||
e.queue.Shutdown()
|
||||
}
|
||||
|
||||
// PeerWithOnion is the entry point for cwtchPeer relationships
|
||||
func (e *Engine) PeerWithOnion(onion string) *PeerPeerConnection {
|
||||
return e.connectionsManager.ManagePeerConnection(onion, e)
|
||||
}
|
||||
|
||||
// InviteOnionToGroup kicks off the invite process
|
||||
func (e *Engine) InviteOnionToGroup(onion string, invite []byte) error {
|
||||
ppc := e.connectionsManager.GetPeerPeerConnectionForOnion(onion)
|
||||
if ppc == nil {
|
||||
return errors.New("peer connection not setup for onion. peers must be trusted before sending")
|
||||
}
|
||||
if ppc.GetState() == AUTHENTICATED {
|
||||
log.Infof("Got connection for group: %v - Sending Invite\n", ppc)
|
||||
ppc.SendGroupInvite(invite)
|
||||
} else {
|
||||
return errors.New("cannot send invite to onion: peer connection is not ready")
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// ReceiveGroupMessage is a callback function that processes GroupMessages from a given server
|
||||
func (e *Engine) ReceiveGroupMessage(server string, gm *protocol.GroupMessage) {
|
||||
// Publish Event so that a Profile Engine can deal with it.
|
||||
// Note: This technically means that *multiple* Profile Engines could listen to the same ProtocolEngine!
|
||||
e.eventManager.Publish(event.NewEvent(event.EncryptedGroupMessage, map[string]string{"Ciphertext": string(gm.GetCiphertext()), "Signature": string(gm.GetSignature())}))
|
||||
}
|
||||
|
||||
// JoinServer manages a new server connection with the given onion address
|
||||
func (e *Engine) JoinServer(onion string) {
|
||||
e.connectionsManager.ManageServerConnection(onion, e.ReceiveGroupMessage)
|
||||
}
|
||||
|
||||
// SendMessageToGroup attemps to sent the given message to the given group id.
|
||||
func (e *Engine) SendMessageToGroup(server string, ct []byte, sig []byte) error {
|
||||
psc := e.connectionsManager.GetPeerServerConnectionForOnion(server)
|
||||
if psc == nil {
|
||||
return errors.New("could not find server connection to send message to")
|
||||
}
|
||||
gm := &protocol.GroupMessage{
|
||||
Ciphertext: ct,
|
||||
Signature: sig,
|
||||
}
|
||||
err := psc.SendGroupMessage(gm)
|
||||
return err
|
||||
}
|
||||
|
||||
// GetPeers returns a list of peer connections.
|
||||
func (e *Engine) GetPeers() map[string]ConnectionState {
|
||||
return e.connectionsManager.GetPeers()
|
||||
}
|
||||
|
||||
// GetServers returns a list of server connections
|
||||
func (e *Engine) GetServers() map[string]ConnectionState {
|
||||
return e.connectionsManager.GetServers()
|
||||
}
|
||||
|
||||
// CwtchPeerInstance encapsulates incoming peer connections
|
||||
type CwtchPeerInstance struct {
|
||||
rai *application.ApplicationInstance
|
||||
ra *application.RicochetApplication
|
||||
}
|
||||
|
||||
// Init sets up a CwtchPeerInstance
|
||||
func (cpi *CwtchPeerInstance) Init(rai *application.ApplicationInstance, ra *application.RicochetApplication) {
|
||||
cpi.rai = rai
|
||||
cpi.ra = ra
|
||||
}
|
||||
|
||||
// CwtchPeerHandler encapsulates handling of incoming CwtchPackets
|
||||
type CwtchPeerHandler struct {
|
||||
Onion string
|
||||
EventBus *event.Manager
|
||||
DataHandler func(string, []byte) []byte
|
||||
}
|
||||
|
||||
// HandleGroupInvite handles incoming GroupInvites
|
||||
func (cph *CwtchPeerHandler) HandleGroupInvite(gci *protocol.GroupChatInvite) {
|
||||
log.Debugf("Received GroupID from %v %v\n", cph.Onion, gci.String())
|
||||
marshal, err := proto.Marshal(gci)
|
||||
if err == nil {
|
||||
cph.EventBus.Publish(event.NewEvent(event.NewGroupInvite, map[string]string{"Onion": cph.Onion, "GroupInvite": string(marshal)}))
|
||||
}
|
||||
}
|
||||
|
||||
// HandlePacket handles the Cwtch cwtchPeer Data Channel
|
||||
func (cph *CwtchPeerHandler) HandlePacket(data []byte) []byte {
|
||||
cph.EventBus.Publish(event.NewEvent(event.NewMessageFromPeer, map[string]string{"Onion": cph.Onion, "Data": string(data)}))
|
||||
return []byte{} // TODO remove this
|
||||
}
|
|
@ -78,9 +78,7 @@ func (cplc *CwtchPeerListenChannel) Packet(data []byte) {
|
|||
if err == nil {
|
||||
if csp.GetGroupMessage() != nil {
|
||||
gm := csp.GetGroupMessage()
|
||||
// We create a new go routine here to avoid leaking any information about processing time
|
||||
// TODO Server can probably try to use this to DoS a peer
|
||||
go cplc.Handler.HandleGroupMessage(gm)
|
||||
cplc.Handler.HandleGroupMessage(gm)
|
||||
}
|
||||
}
|
||||
}
|
|
@ -1,15 +1,10 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/peer/peer"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"cwtch.im/cwtch/protocol/connections/peer"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/application"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connection"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/identity"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/log"
|
||||
"time"
|
||||
)
|
||||
|
@ -17,23 +12,17 @@ import (
|
|||
// PeerPeerConnection encapsulates a single outgoing cwtchPeer->cwtchPeer connection
|
||||
type PeerPeerConnection struct {
|
||||
connection.AutoConnectionHandler
|
||||
PeerHostname string
|
||||
state ConnectionState
|
||||
connection *connection.Connection
|
||||
profile *model.Profile
|
||||
dataHandler func(string, []byte) []byte
|
||||
aif application.ApplicationInstanceFactory
|
||||
acn connectivity.ACN
|
||||
PeerHostname string
|
||||
state ConnectionState
|
||||
connection *connection.Connection
|
||||
protocolEngine *Engine
|
||||
}
|
||||
|
||||
// NewPeerPeerConnection creates a new peer connection for the given hostname and profile.
|
||||
func NewPeerPeerConnection(acn connectivity.ACN, peerhostname string, profile *model.Profile, dataHandler func(string, []byte) []byte, aif application.ApplicationInstanceFactory) *PeerPeerConnection {
|
||||
func NewPeerPeerConnection(peerhostname string, protocolEngine *Engine) *PeerPeerConnection {
|
||||
ppc := new(PeerPeerConnection)
|
||||
ppc.acn = acn
|
||||
ppc.PeerHostname = peerhostname
|
||||
ppc.profile = profile
|
||||
ppc.dataHandler = dataHandler
|
||||
ppc.aif = aif
|
||||
ppc.protocolEngine = protocolEngine
|
||||
ppc.Init()
|
||||
return ppc
|
||||
}
|
||||
|
@ -43,16 +32,6 @@ func (ppc *PeerPeerConnection) GetState() ConnectionState {
|
|||
return ppc.state
|
||||
}
|
||||
|
||||
// HandleGroupInvite passes the given group invite tothe profile
|
||||
func (ppc *PeerPeerConnection) HandleGroupInvite(gci *protocol.GroupChatInvite) {
|
||||
ppc.profile.ProcessInvite(gci, ppc.PeerHostname)
|
||||
}
|
||||
|
||||
// HandlePacket handles data packets on the optional data channel
|
||||
func (ppc *PeerPeerConnection) HandlePacket(data []byte) []byte {
|
||||
return ppc.dataHandler(ppc.PeerHostname, data)
|
||||
}
|
||||
|
||||
// SendPacket sends data packets on the optional data channel
|
||||
func (ppc *PeerPeerConnection) SendPacket(data []byte) {
|
||||
ppc.WaitTilAuthenticated()
|
||||
|
@ -69,18 +48,6 @@ func (ppc *PeerPeerConnection) SendPacket(data []byte) {
|
|||
})
|
||||
}
|
||||
|
||||
// DoOnChannel performs an operation on the requested channel
|
||||
func (ppc *PeerPeerConnection) DoOnChannel(ctype string, direction channels.Direction, doSomethingWith func(channel *channels.Channel)) {
|
||||
ppc.WaitTilAuthenticated()
|
||||
ppc.connection.Do(func() error {
|
||||
channel := ppc.connection.Channel(ctype, direction)
|
||||
if channel != nil {
|
||||
doSomethingWith(channel)
|
||||
}
|
||||
return nil
|
||||
})
|
||||
}
|
||||
|
||||
// SendGroupInvite sends the given serialized invite packet to the Peer
|
||||
func (ppc *PeerPeerConnection) SendGroupInvite(invite []byte) {
|
||||
ppc.WaitTilAuthenticated()
|
||||
|
@ -110,33 +77,23 @@ func (ppc *PeerPeerConnection) WaitTilAuthenticated() {
|
|||
// Run manages the setup and teardown of a peer->peer connection
|
||||
func (ppc *PeerPeerConnection) Run() error {
|
||||
ppc.state = CONNECTING
|
||||
rc, err := goricochet.Open(ppc.acn, ppc.PeerHostname)
|
||||
rc, err := goricochet.Open(ppc.protocolEngine.ACN, ppc.PeerHostname)
|
||||
if err == nil {
|
||||
ppc.connection = rc
|
||||
ppc.state = CONNECTED
|
||||
_, err := connection.HandleOutboundConnection(ppc.connection).ProcessAuthAsV3Client(identity.InitializeV3(ppc.profile.Name, &ppc.profile.Ed25519PrivateKey, &ppc.profile.Ed25519PublicKey))
|
||||
_, err := connection.HandleOutboundConnection(ppc.connection).ProcessAuthAsV3Client(ppc.protocolEngine.Identity)
|
||||
if err == nil {
|
||||
ppc.state = AUTHENTICATED
|
||||
go func() {
|
||||
ppc.connection.Do(func() error {
|
||||
ppc.connection.RequestOpenChannel("im.cwtch.peer", &peer.CwtchPeerChannel{Handler: ppc})
|
||||
ppc.connection.RequestOpenChannel("im.cwtch.peer", &peer.CwtchPeerChannel{Handler: ppc.protocolEngine.GetPeerHandler(ppc.PeerHostname)})
|
||||
return nil
|
||||
})
|
||||
|
||||
if ppc.dataHandler != nil {
|
||||
ppc.connection.Do(func() error {
|
||||
ppc.connection.RequestOpenChannel("im.cwtch.peer.data", &peer.CwtchPeerDataChannel{Handler: ppc})
|
||||
return nil
|
||||
})
|
||||
}
|
||||
|
||||
handlers := ppc.aif.GetHandlers()
|
||||
for i := range handlers {
|
||||
ppc.connection.Do(func() error {
|
||||
ppc.connection.RequestOpenChannel(handlers[i], ppc.aif.GetHandler(handlers[i])(ppc.aif.GetApplicationInstance(ppc.connection))())
|
||||
return nil
|
||||
})
|
||||
}
|
||||
ppc.connection.Do(func() error {
|
||||
ppc.connection.RequestOpenChannel("im.cwtch.peer.data", &peer.CwtchPeerDataChannel{Handler: ppc.protocolEngine.GetPeerHandler(ppc.PeerHostname)})
|
||||
return nil
|
||||
})
|
||||
}()
|
||||
|
||||
ppc.connection.Process(ppc)
|
|
@ -3,11 +3,10 @@ package connections
|
|||
import (
|
||||
"crypto/rand"
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/peer/peer"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"cwtch.im/cwtch/protocol/connections/peer"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/application"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connection"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||
|
@ -61,7 +60,7 @@ func TestPeerPeerConnection(t *testing.T) {
|
|||
|
||||
profile := model.GenerateNewProfile("alice")
|
||||
hostname := identity.Hostname()
|
||||
ppc := NewPeerPeerConnection(connectivity.LocalProvider(), "127.0.0.1:5452|"+hostname, profile, nil, application.ApplicationInstanceFactory{})
|
||||
ppc := NewPeerPeerConnection("127.0.0.1:5452|"+hostname, &Engine{ACN: connectivity.LocalProvider(), Identity: identity})
|
||||
|
||||
tp := new(TestPeer)
|
||||
tp.Init()
|
|
@ -2,10 +2,10 @@ package connections
|
|||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"cwtch.im/cwtch/peer/fetch"
|
||||
"cwtch.im/cwtch/peer/listen"
|
||||
"cwtch.im/cwtch/peer/send"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"cwtch.im/cwtch/protocol/connections/fetch"
|
||||
"cwtch.im/cwtch/protocol/connections/listen"
|
||||
"cwtch.im/cwtch/protocol/connections/send"
|
||||
"errors"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
|
@ -2,7 +2,7 @@ package send
|
|||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"cwtch.im/cwtch/protocol/spam"
|
||||
"cwtch.im/cwtch/protocol/connections/spam"
|
||||
"errors"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
|
@ -2,7 +2,7 @@ package send
|
|||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"cwtch.im/cwtch/protocol/spam"
|
||||
"cwtch.im/cwtch/protocol/connections/spam"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
|
@ -2,7 +2,7 @@ package send
|
|||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"cwtch.im/cwtch/protocol/spam"
|
||||
"cwtch.im/cwtch/protocol/connections/spam"
|
||||
"errors"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/log"
|
||||
|
|
|
@ -2,7 +2,7 @@ package send
|
|||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"cwtch.im/cwtch/protocol/spam"
|
||||
"cwtch.im/cwtch/protocol/connections/spam"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
|
|
|
@ -1,15 +1,17 @@
|
|||
package testing
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/peer"
|
||||
"cwtch.im/cwtch/peer/connections"
|
||||
"cwtch.im/cwtch/protocol/connections"
|
||||
cwtchserver "cwtch.im/cwtch/server"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||
"golang.org/x/net/proxy"
|
||||
"os"
|
||||
"runtime"
|
||||
"runtime/pprof"
|
||||
"testing"
|
||||
"time"
|
||||
)
|
||||
|
@ -62,13 +64,13 @@ func waitForPeerServerConnection(t *testing.T, peer peer.CwtchPeer, server strin
|
|||
}
|
||||
if state != connections.AUTHENTICATED {
|
||||
fmt.Printf("peer %v waiting connect to server %v, currently: %v\n", peer.GetProfile().Onion, server, connections.ConnectionStateName[state])
|
||||
time.Sleep(time.Second * 10)
|
||||
time.Sleep(time.Second * 5)
|
||||
continue
|
||||
} else {
|
||||
break
|
||||
}
|
||||
} else {
|
||||
t.Fatalf("peer server connectiond %v should have entry for server %v", servers, server)
|
||||
}
|
||||
break
|
||||
} // It might take a second for the server to show up as it is now going through the event bus
|
||||
time.Sleep(time.Second)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
@ -83,13 +85,13 @@ func waitForPeerPeerConnection(t *testing.T, peera peer.CwtchPeer, peerb peer.Cw
|
|||
}
|
||||
if state != connections.AUTHENTICATED {
|
||||
fmt.Printf("peer% v waiting connect to peer %v, currently: %v\n", peera.GetProfile().Onion, peerb.GetProfile().Onion, connections.ConnectionStateName[state])
|
||||
time.Sleep(time.Second * 10)
|
||||
time.Sleep(time.Second * 5)
|
||||
continue
|
||||
} else {
|
||||
break
|
||||
}
|
||||
} else {
|
||||
t.Fatalf("peer peer connectiond %v should have entry for server %v", peers, peerb.GetProfile().Onion)
|
||||
}
|
||||
break
|
||||
} // It might take a second for the peer to show up as it is now going through the event bus
|
||||
time.Sleep(time.Second)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
@ -130,21 +132,29 @@ func TestCwtchPeerIntegration(t *testing.T) {
|
|||
|
||||
// ***** cwtchPeer setup *****
|
||||
|
||||
// It's important that each Peer have their own EventBus
|
||||
aliceEventBus := new(event.Manager)
|
||||
aliceEventBus.Initialize()
|
||||
bobEventBus := new(event.Manager)
|
||||
bobEventBus.Initialize()
|
||||
carolEventBus := new(event.Manager)
|
||||
carolEventBus.Initialize()
|
||||
|
||||
fmt.Println("Creating Alice...")
|
||||
alice := peer.NewCwtchPeer("Alice")
|
||||
alice.Init(acn)
|
||||
alice.Init(acn, aliceEventBus)
|
||||
alice.Listen()
|
||||
fmt.Println("Alice created:", alice.GetProfile().Onion)
|
||||
|
||||
fmt.Println("Creating Bob...")
|
||||
bob := peer.NewCwtchPeer("Bob")
|
||||
bob.Init(acn)
|
||||
bob.Init(acn, bobEventBus)
|
||||
bob.Listen()
|
||||
fmt.Println("Bob created:", bob.GetProfile().Onion)
|
||||
|
||||
fmt.Println("Creating Carol...")
|
||||
carol := peer.NewCwtchPeer("Carol")
|
||||
carol.Init(acn)
|
||||
carol.Init(acn, carolEventBus)
|
||||
carol.Listen()
|
||||
fmt.Println("Carol created:", carol.GetProfile().Onion)
|
||||
|
||||
|
@ -280,6 +290,7 @@ func TestCwtchPeerIntegration(t *testing.T) {
|
|||
|
||||
fmt.Println("Shutting down Alice...")
|
||||
alice.Shutdown()
|
||||
aliceEventBus.Shutdown()
|
||||
time.Sleep(time.Second * 5)
|
||||
numGoRoutinesPostAlice := runtime.NumGoroutine()
|
||||
|
||||
|
@ -368,6 +379,7 @@ func TestCwtchPeerIntegration(t *testing.T) {
|
|||
|
||||
fmt.Println("Shutting down Bob...")
|
||||
bob.Shutdown()
|
||||
bobEventBus.Shutdown()
|
||||
time.Sleep(time.Second * 3)
|
||||
numGoRoutinesPostBob := runtime.NumGoroutine()
|
||||
if server != nil {
|
||||
|
@ -377,11 +389,16 @@ func TestCwtchPeerIntegration(t *testing.T) {
|
|||
}
|
||||
numGoRoutinesPostServerShutdown := runtime.NumGoroutine()
|
||||
|
||||
fmt.Println("Shuttind down Carol...")
|
||||
fmt.Println("Shutting down Carol...")
|
||||
carol.Shutdown()
|
||||
carolEventBus.Shutdown()
|
||||
time.Sleep(time.Second * 3)
|
||||
numGoRoutinesPostCarol := runtime.NumGoroutine()
|
||||
|
||||
// Printing out the current goroutines
|
||||
// Very useful if we are leaking any.
|
||||
pprof.Lookup("goroutine").WriteTo(os.Stdout, 1)
|
||||
|
||||
fmt.Printf("numGoRoutinesStart: %v\nnumGoRoutinesPostServer: %v\nnumGoRoutinesPostPeerStart: %v\nnumGoRoutinesPostPeerAndServerConnect: %v\n"+
|
||||
"numGoRoutinesPostAlice: %v\nnumGoRotinesPostCarolConnect: %v\nnumGoRoutinesPostBob: %v\nnumGoRoutinesPostServerShutdown: %v\nnumGoRoutinesPostCarol: %v\n",
|
||||
numGoRoutinesStart, numGoRoutinesPostServer, numGoRoutinesPostPeerStart, numGoRoutinesPostServerConnect,
|
||||
|
|
|
@ -4,13 +4,13 @@ set -e
|
|||
pwd
|
||||
go test ${1} -coverprofile=model.cover.out -v ./model
|
||||
go test ${1} -coverprofile=event.cover.out -v ./event
|
||||
go test ${1} -coverprofile=protocol.spam.cover.out -v ./protocol/spam
|
||||
go test ${1} -coverprofile=storage.cover.out -v ./storage
|
||||
go test ${1} -coverprofile=peer.connections.cover.out -v ./peer/connections
|
||||
go test ${1} -coverprofile=peer.fetch.cover.out -v ./peer/fetch
|
||||
go test ${1} -coverprofile=peer.listen.cover.out -v ./peer/listen
|
||||
go test ${1} -coverprofile=peer.peer.cover.out -v ./peer/peer
|
||||
go test ${1} -coverprofile=peer.send.cover.out -v ./peer/send
|
||||
go test ${1} -coverprofile=peer.connections.cover.out -v ./protocol/connections
|
||||
go test ${1} -coverprofile=protocol.spam.cover.out -v ./protocol/connections/spam
|
||||
go test ${1} -coverprofile=peer.fetch.cover.out -v ./protocol/connections/fetch
|
||||
go test ${1} -coverprofile=peer.listen.cover.out -v ./protocol/connections/listen
|
||||
go test ${1} -coverprofile=peer.peer.cover.out -v ./protocol/connections/peer
|
||||
go test ${1} -coverprofile=peer.send.cover.out -v ./protocol/connections/send
|
||||
go test ${1} -coverprofile=peer.cover.out -v ./peer
|
||||
go test ${1} -coverprofile=server.fetch.cover.out -v ./server/fetch
|
||||
go test ${1} -coverprofile=server.listen.cover.out -v ./server/listen
|
||||
|
|
Carregando…
Referência em uma nova issue