Compare commits
No commits in common. "master" and "movelisten" have entirely different histories.
master
...
movelisten
113
.drone.yml
113
.drone.yml
|
@ -1,89 +1,44 @@
|
|||
---
|
||||
kind: pipeline
|
||||
type: docker
|
||||
name: linux-test
|
||||
workspace:
|
||||
base: /go
|
||||
path: src/cwtch.im/cwtch
|
||||
|
||||
steps:
|
||||
- name: fetch
|
||||
image: golang:1.21.5
|
||||
volumes:
|
||||
- name: deps
|
||||
path: /go
|
||||
pipeline:
|
||||
fetch:
|
||||
image: golang
|
||||
commands:
|
||||
- go install honnef.co/go/tools/cmd/staticcheck@latest
|
||||
- go install go.uber.org/nilaway/cmd/nilaway@latest
|
||||
- wget https://git.openprivacy.ca/openprivacy/buildfiles/raw/branch/master/tor/tor-0.4.8.9-linux-x86_64.tar.gz -O tor.tar.gz
|
||||
- tar -xzf tor.tar.gz
|
||||
- chmod a+x Tor/tor
|
||||
- export PATH=$PWD/Tor/:$PATH
|
||||
- export LD_LIBRARY_PATH=$PWD/Tor/
|
||||
- tor --version
|
||||
- export GO111MODULE=on
|
||||
- name: quality
|
||||
image: golang:1.21.5
|
||||
volumes:
|
||||
- name: deps
|
||||
path: /go
|
||||
- wget https://git.openprivacy.ca/openprivacy/buildfiles/raw/master/tor/tor
|
||||
- wget https://git.openprivacy.ca/openprivacy/buildfiles/raw/master/tor/torrc
|
||||
- chmod a+x tor
|
||||
- go list ./... | xargs go get
|
||||
- go get -u golang.org/x/lint/golint
|
||||
quality:
|
||||
image: golang
|
||||
commands:
|
||||
- ./testing/quality.sh
|
||||
- name: units-tests
|
||||
image: golang:1.21.5
|
||||
volumes:
|
||||
- name: deps
|
||||
path: /go
|
||||
- go list ./... | xargs go vet
|
||||
- go list ./... | xargs golint -set_exit_status
|
||||
units-tests:
|
||||
image: golang
|
||||
commands:
|
||||
- export PATH=`pwd`:$PATH
|
||||
- export PATH=$PATH:/go/src/cwtch.im/cwtch
|
||||
- sh testing/tests.sh
|
||||
- name: integ-test
|
||||
image: golang:1.21.5
|
||||
volumes:
|
||||
- name: deps
|
||||
path: /go
|
||||
integ-test:
|
||||
image: golang
|
||||
commands:
|
||||
- export PATH=$PWD/Tor/:$PATH
|
||||
- export LD_LIBRARY_PATH=$PWD/Tor/
|
||||
- tor --version
|
||||
- go test -timeout=30m -race -v cwtch.im/cwtch/testing/
|
||||
- name: filesharing-integ-test
|
||||
image: golang:1.21.5
|
||||
volumes:
|
||||
- name: deps
|
||||
path: /go
|
||||
commands:
|
||||
- export PATH=$PWD/Tor/:$PATH
|
||||
- export LD_LIBRARY_PATH=$PWD/Tor/
|
||||
- go test -timeout=20m -race -v cwtch.im/cwtch/testing/filesharing
|
||||
- name: filesharing-autodownload-integ-test
|
||||
image: golang:1.21.5
|
||||
volumes:
|
||||
- name: deps
|
||||
path: /go
|
||||
commands:
|
||||
- export PATH=$PWD/Tor/:$PATH
|
||||
- export LD_LIBRARY_PATH=$PWD/Tor/
|
||||
- go test -timeout=20m -race -v cwtch.im/cwtch/testing/autodownload
|
||||
- name: notify-gogs
|
||||
- ./tor -f ./torrc
|
||||
- sleep 15
|
||||
- go test -v cwtch.im/cwtch/testing
|
||||
notify-email:
|
||||
image: drillster/drone-email
|
||||
host: build.openprivacy.ca
|
||||
port: 25
|
||||
skip_verify: true
|
||||
from: drone@openprivacy.ca
|
||||
when:
|
||||
status: [ failure ]
|
||||
notify-gogs:
|
||||
image: openpriv/drone-gogs
|
||||
pull: if-not-exists
|
||||
when:
|
||||
event: pull_request
|
||||
status: [ success, changed, failure ]
|
||||
environment:
|
||||
GOGS_ACCOUNT_TOKEN:
|
||||
from_secret: gogs_account_token
|
||||
settings:
|
||||
gogs_url: https://git.openprivacy.ca
|
||||
|
||||
|
||||
volumes:
|
||||
# gopath where bin and pkg lives to persist across steps
|
||||
- name: deps
|
||||
temp: {}
|
||||
|
||||
trigger:
|
||||
repo: cwtch.im/cwtch
|
||||
branch: master
|
||||
event:
|
||||
- push
|
||||
- pull_request
|
||||
- tag
|
||||
secrets: [gogs_account_token]
|
||||
gogs_url: https://git.openprivacy.ca
|
||||
|
|
|
@ -7,32 +7,3 @@
|
|||
*/messages/*
|
||||
server/app/messages
|
||||
.reviewboardrc
|
||||
/vendor/
|
||||
/testing/tor/
|
||||
/storage/*/testing/
|
||||
/storage/testing/
|
||||
/testing/storage/
|
||||
ebusgraph.txt
|
||||
messages/
|
||||
serverMonitorReport.txt
|
||||
testing/cwtch.out.png
|
||||
testing/filesharing/storage
|
||||
testing/filesharing/tordir
|
||||
testing/filesharing/cwtch.out.png
|
||||
testing/filesharing/cwtch.out.png.manifest
|
||||
testing/cwtch.out.png.manifest
|
||||
testing/tordir/
|
||||
tokens-bak.db
|
||||
tokens.db
|
||||
tokens1.db
|
||||
arch/
|
||||
testing/encryptedstorage/encrypted_storage_profiles
|
||||
testing/encryptedstorage/tordir
|
||||
*.tar.gz
|
||||
data-dir-cwtchtool/
|
||||
tokens
|
||||
tordir/
|
||||
testing/autodownload/download_dir
|
||||
testing/autodownload/storage
|
||||
*.swp
|
||||
testing/managerstorage/*
|
|
@ -0,0 +1,78 @@
|
|||
FROM golang as server-build-stage
|
||||
ENV CGO_ENABLED=0 GOOS=linux
|
||||
|
||||
WORKDIR /go/src/cwtch.im/cwtch
|
||||
COPY . .
|
||||
|
||||
RUN go get -d -v ./...
|
||||
#RUN go install -v ./...
|
||||
WORKDIR /go/src/cwtch.im/cwtch/server/app/
|
||||
RUN go build -ldflags "-extldflags '-static'"
|
||||
|
||||
|
||||
|
||||
#----------------------------------------------
|
||||
FROM alpine:latest as tor-build-stage
|
||||
|
||||
# Install prerequisites
|
||||
RUN apk --no-cache add --update \
|
||||
gnupg \
|
||||
build-base \
|
||||
libevent \
|
||||
libevent-dev \
|
||||
libressl \
|
||||
libressl-dev \
|
||||
xz-libs \
|
||||
xz-dev \
|
||||
zlib \
|
||||
zlib-dev \
|
||||
zstd \
|
||||
zstd-dev \
|
||||
&& wget -q https://www.torproject.org/dist/tor-0.3.5.3-alpha.tar.gz \
|
||||
&& tar xf tor-0.3.5.3-alpha.tar.gz \
|
||||
&& cd tor-0.3.5.3-alpha \
|
||||
&& ./configure \
|
||||
&& make install \
|
||||
&& ls -R /usr/local/
|
||||
|
||||
FROM alpine:latest
|
||||
MAINTAINER Ablative Hosting <support@ablative.hosting>
|
||||
|
||||
#BSD habits die hard
|
||||
ENV TOR_USER=_tor
|
||||
|
||||
# Installing dependencies of Tor and pwgen
|
||||
RUN apk --no-cache add --update \
|
||||
libevent \
|
||||
libressl \
|
||||
xz-libs \
|
||||
zlib \
|
||||
zstd \
|
||||
zstd-dev \
|
||||
pwgen
|
||||
|
||||
# Copy Tor
|
||||
COPY --from=tor-build-stage /usr/local/ /usr/local/
|
||||
|
||||
# Create an unprivileged tor user
|
||||
RUN addgroup -S $TOR_USER && adduser -G $TOR_USER -S $TOR_USER && adduser -G _tor -S cwtchd && mkdir /run/tor
|
||||
|
||||
# Copy Tor configuration file
|
||||
COPY ./server/docker/torrc /etc/tor/torrc
|
||||
|
||||
# Copy docker-entrypoint
|
||||
COPY ./server/docker/docker-entrypoint /usr/local/bin/
|
||||
|
||||
# Copy across cwtch
|
||||
COPY --from=server-build-stage /go/src/cwtch.im/cwtch/server/app/app /usr/local/bin/cwtch_server
|
||||
|
||||
# Persist data
|
||||
VOLUME /etc/tor /var/lib/tor /etc/cwtch
|
||||
|
||||
ENTRYPOINT ["docker-entrypoint"]
|
||||
|
||||
#cwtchd is in the _tor group so can access the socket but that's it
|
||||
#USER cwtchd
|
||||
|
||||
#Launches the cwtchd daemon
|
||||
CMD ["/usr/local/bin/cwtch_server"]
|
|
@ -19,7 +19,7 @@ We seek to protect the following communication contexts:
|
|||
Beyond individual conversations, we also seek to defend against context correlation attacks, whereby multiple conversations are analyzed to derive higher level information:
|
||||
|
||||
* **Relationships** - Discovering social relationships between parties by analyzing the frequency and length of their communications over a period of time. (Carol and Eve call each other every single day for multiple hours at a time.)
|
||||
* **Cliques** - Discovering social relationships between multiple parties by deriving casual communication chains from their communication metadata (e.g. everytime Alice talks to Bob she talks to Carol almost immediately after.)
|
||||
* **Cliques** - Discovering social relationships between multiple parties by deriving casual communication chains from their communication metadata (e.g. everytime Alice talks to Bob she talks to Carol almost immediately after.)
|
||||
* **Pattern of Life** - Discovering which communications are cyclical and predictable. (e.g. Alice calls Eve every Monday evening for around an hour.)
|
||||
|
||||
|
||||
|
@ -30,12 +30,9 @@ Development and Contributing information in [CONTRIBUTING.md](https://git.openpr
|
|||
## Running Cwtch
|
||||
### Server
|
||||
#### Docker
|
||||
|
||||
### NOTE: The following section is out of date. The new Cwtch server is available from https://git.openprivacy.ca/cwtch.im/server, but there is no current docker container for it.
|
||||
|
||||
This repository contains a `Dockerfile` allowing you to build and run the server as a [docker](https://www.docker.com/) container.
|
||||
|
||||
To get started issue `docker build -t openpriv/cwtch-server:latest .`, this will create 2 temporary docker containers, one to build the Tor daemon and one to build Cwtch. The compiled binaries will then be bundled into a new image and tagged as `openpriv/cwtch-server:latest`.
|
||||
To get started issue `docker build -t openpriv/cwtch-server:latest`, this will create 2 temporary docker containers, one to build the Tor daemon and one to build Cwtch. The compiled binaries will then be bundled into a new image and tagged as `openpriv/cwtch-server:latest`.
|
||||
|
||||
To run Cwtch in the foreground execute `docker run openpriv/cwtch-server:latest`, you will see a small amount of output from Tor and then Cwtch will output your server address. When you `Ctrl + C` the container will terminate. To run Cwtch in the background execute `docker run --name my-cwtch-server -d openpriv/cwtch-server:latest`. To get your Cwtch server address issue `docker logs my-cwtch-server`.
|
||||
|
||||
|
|
672
app/app.go
672
app/app.go
|
@ -1,599 +1,173 @@
|
|||
package app
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/app/plugins"
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/extensions"
|
||||
"cwtch.im/cwtch/functionality/filesharing"
|
||||
"cwtch.im/cwtch/functionality/servers"
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/model/attr"
|
||||
"cwtch.im/cwtch/model/constants"
|
||||
"crypto/rand"
|
||||
"cwtch.im/cwtch/peer"
|
||||
"cwtch.im/cwtch/protocol/connections"
|
||||
"cwtch.im/cwtch/settings"
|
||||
"cwtch.im/cwtch/storage"
|
||||
"git.openprivacy.ca/openprivacy/connectivity"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"encoding/hex"
|
||||
"fmt"
|
||||
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||
"io/ioutil"
|
||||
"log"
|
||||
"os"
|
||||
path "path/filepath"
|
||||
"strconv"
|
||||
"path"
|
||||
"path/filepath"
|
||||
"sync"
|
||||
)
|
||||
|
||||
type application struct {
|
||||
eventBuses map[string]event.Manager
|
||||
directory string
|
||||
|
||||
peers map[string]peer.CwtchPeer
|
||||
acn connectivity.ACN
|
||||
plugins sync.Map //map[string] []plugins.Plugin
|
||||
|
||||
engines map[string]connections.Engine
|
||||
appBus event.Manager
|
||||
eventQueue event.Queue
|
||||
appmutex sync.Mutex
|
||||
engineHooks connections.EngineHooks
|
||||
|
||||
settings *settings.GlobalSettingsFile
|
||||
}
|
||||
|
||||
func (app *application) IsFeatureEnabled(experiment string) bool {
|
||||
globalSettings := app.ReadSettings()
|
||||
if globalSettings.ExperimentsEnabled {
|
||||
if status, exists := globalSettings.Experiments[experiment]; exists {
|
||||
return status
|
||||
}
|
||||
}
|
||||
return false
|
||||
peers map[string]peer.CwtchPeer
|
||||
acn connectivity.ACN
|
||||
directory string
|
||||
mutex sync.Mutex
|
||||
primaryonion string
|
||||
storage map[string]storage.ProfileStore
|
||||
}
|
||||
|
||||
// Application is a full cwtch peer application. It allows management, usage and storage of multiple peers
|
||||
type Application interface {
|
||||
LoadProfiles(password string)
|
||||
CreateProfile(name string, password string, autostart bool)
|
||||
InstallEngineHooks(engineHooks connections.EngineHooks)
|
||||
ImportProfile(exportedCwtchFile string, password string) (peer.CwtchPeer, error)
|
||||
EnhancedImportProfile(exportedCwtchFile string, password string) string
|
||||
DeleteProfile(onion string, currentPassword string)
|
||||
AddPeerPlugin(onion string, pluginID plugins.PluginID)
|
||||
|
||||
GetPrimaryBus() event.Manager
|
||||
GetEventBus(onion string) event.Manager
|
||||
QueryACNStatus()
|
||||
QueryACNVersion()
|
||||
|
||||
ConfigureConnections(onion string, doListn, doPeers, doServers bool)
|
||||
ActivatePeerEngine(onion string)
|
||||
DeactivatePeerEngine(onion string)
|
||||
|
||||
ReadSettings() settings.GlobalSettings
|
||||
UpdateSettings(settings settings.GlobalSettings)
|
||||
IsFeatureEnabled(experiment string) bool
|
||||
|
||||
ShutdownPeer(string)
|
||||
Shutdown()
|
||||
SaveProfile(cwtchPeer peer.CwtchPeer)
|
||||
LoadProfiles(password string) error
|
||||
CreatePeer(name string, password string) (peer.CwtchPeer, error)
|
||||
|
||||
PrimaryIdentity() peer.CwtchPeer
|
||||
GetPeer(onion string) peer.CwtchPeer
|
||||
ListProfiles() []string
|
||||
}
|
||||
ListPeers() map[string]string
|
||||
LaunchPeers()
|
||||
|
||||
// LoadProfileFn is the function signature for a function in an app that loads a profile
|
||||
type LoadProfileFn func(profile peer.CwtchPeer)
|
||||
//GetTorStatus() (map[string]string, error)
|
||||
|
||||
func LoadAppSettings(appDirectory string) *settings.GlobalSettingsFile {
|
||||
log.Debugf("NewApp(%v)\n", appDirectory)
|
||||
os.MkdirAll(path.Join(appDirectory, "profiles"), 0700)
|
||||
|
||||
// Note: we basically presume this doesn't fail. If the file doesn't exist we create it, and as such the
|
||||
// only plausible error conditions are related to file create e.g. low disk space. If that is the case then
|
||||
// many other parts of Cwtch are likely to fail also.
|
||||
globalSettingsFile, err := settings.InitGlobalSettingsFile(appDirectory, DefactoPasswordForUnencryptedProfiles)
|
||||
if err != nil {
|
||||
log.Errorf("error initializing global globalSettingsFile file %s. Global globalSettingsFile might not be loaded or saved", err)
|
||||
}
|
||||
return globalSettingsFile
|
||||
Shutdown()
|
||||
}
|
||||
|
||||
// NewApp creates a new app with some environment awareness and initializes a Tor Manager
|
||||
func NewApp(acn connectivity.ACN, appDirectory string, settings *settings.GlobalSettingsFile) Application {
|
||||
|
||||
app := &application{engines: make(map[string]connections.Engine), eventBuses: make(map[string]event.Manager), directory: appDirectory, appBus: event.NewEventManager(), settings: settings, eventQueue: event.NewQueue()}
|
||||
app.peers = make(map[string]peer.CwtchPeer)
|
||||
app.engineHooks = connections.DefaultEngineHooks{}
|
||||
app.acn = acn
|
||||
statusHandler := app.getACNStatusHandler()
|
||||
acn.SetStatusCallback(statusHandler)
|
||||
acn.SetVersionCallback(app.getACNVersionHandler())
|
||||
prog, status := acn.GetBootstrapStatus()
|
||||
statusHandler(prog, status)
|
||||
|
||||
app.GetPrimaryBus().Subscribe(event.ACNStatus, app.eventQueue)
|
||||
go app.eventHandler()
|
||||
|
||||
func NewApp(acn connectivity.ACN, appDirectory string) Application {
|
||||
log.Printf("NewApp(%v)\n", appDirectory)
|
||||
app := &application{peers: make(map[string]peer.CwtchPeer), storage: make(map[string]storage.ProfileStore), directory: appDirectory, acn: acn}
|
||||
os.Mkdir(path.Join(app.directory, "profiles"), 0700)
|
||||
return app
|
||||
}
|
||||
|
||||
func (app *application) InstallEngineHooks(engineHooks connections.EngineHooks) {
|
||||
app.appmutex.Lock()
|
||||
defer app.appmutex.Unlock()
|
||||
app.engineHooks = engineHooks
|
||||
func generateRandomFilename() string {
|
||||
randBytes := make([]byte, 16)
|
||||
rand.Read(randBytes)
|
||||
return filepath.Join(hex.EncodeToString(randBytes))
|
||||
}
|
||||
|
||||
func (app *application) ReadSettings() settings.GlobalSettings {
|
||||
app.appmutex.Lock()
|
||||
defer app.appmutex.Unlock()
|
||||
return app.settings.ReadGlobalSettings()
|
||||
func (app *application) SaveProfile(p peer.CwtchPeer) {
|
||||
app.mutex.Lock()
|
||||
defer app.mutex.Unlock()
|
||||
app.peers[p.GetProfile().Onion] = p
|
||||
app.storage[p.GetProfile().Onion].Save(p)
|
||||
}
|
||||
|
||||
func (app *application) UpdateSettings(settings settings.GlobalSettings) {
|
||||
// don't allow any other application changes while settings update
|
||||
app.appmutex.Lock()
|
||||
defer app.appmutex.Unlock()
|
||||
app.settings.WriteGlobalSettings(settings)
|
||||
// NewProfile creates a new cwtchPeer with a given name.
|
||||
func (app *application) CreatePeer(name string, password string) (peer.CwtchPeer, error) {
|
||||
log.Printf("CreatePeer(%v)\n", name)
|
||||
|
||||
for _, profile := range app.peers {
|
||||
profile.UpdateExperiments(settings.ExperimentsEnabled, settings.Experiments)
|
||||
randomFileName := generateRandomFilename()
|
||||
fileStore := storage.CreateFileProfileStore(path.Join(app.directory, "profiles", randomFileName), password)
|
||||
p := peer.NewCwtchPeer(name)
|
||||
err := fileStore.Save(p)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
p.Init(app.acn)
|
||||
p.Listen()
|
||||
_, exists := app.peers[p.GetProfile().Onion]
|
||||
if exists {
|
||||
p.Shutdown()
|
||||
return nil, fmt.Errorf("Error: profile for onion %v already exists", p.GetProfile().Onion)
|
||||
}
|
||||
app.mutex.Lock()
|
||||
app.peers[p.GetProfile().Onion] = p
|
||||
app.storage[p.GetProfile().Onion] = fileStore
|
||||
app.mutex.Unlock()
|
||||
|
||||
// Explicitly toggle blocking/unblocking of unknown connections for profiles
|
||||
// that have been loaded.
|
||||
if settings.BlockUnknownConnections {
|
||||
profile.BlockUnknownConnections()
|
||||
} else {
|
||||
profile.AllowUnknownConnections()
|
||||
return p, nil
|
||||
}
|
||||
|
||||
func (app *application) LoadProfiles(password string) error {
|
||||
files, err := ioutil.ReadDir(path.Join(app.directory, "profiles"))
|
||||
if err != nil {
|
||||
return fmt.Errorf("Error: cannot read profiles directory: %v", err)
|
||||
}
|
||||
|
||||
for _, file := range files {
|
||||
|
||||
fileStore := storage.CreateFileProfileStore(path.Join(app.directory, "profiles", file.Name()), password)
|
||||
|
||||
p, err := fileStore.Load()
|
||||
if err != nil {
|
||||
continue
|
||||
}
|
||||
|
||||
profile.NotifySettingsUpdate(settings)
|
||||
_, exists := app.peers[p.GetProfile().Onion]
|
||||
if exists {
|
||||
p.Shutdown()
|
||||
log.Printf("Error: profile for onion %v already exists", p.GetProfile().Onion)
|
||||
continue
|
||||
}
|
||||
|
||||
p.Init(app.acn)
|
||||
|
||||
app.mutex.Lock()
|
||||
app.peers[p.GetProfile().Onion] = p
|
||||
app.storage[p.GetProfile().Onion] = fileStore
|
||||
if app.primaryonion == "" {
|
||||
app.primaryonion = p.GetProfile().Onion
|
||||
}
|
||||
app.mutex.Unlock()
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (app *application) LaunchPeers() {
|
||||
for _, p := range app.peers {
|
||||
if !p.IsStarted() {
|
||||
app.startPeer(p)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// ListProfiles returns a map of onions to their profile's Name
|
||||
func (app *application) ListProfiles() []string {
|
||||
var keys []string
|
||||
func (app *application) startPeer(peer peer.CwtchPeer) {
|
||||
go func() {
|
||||
peer.Listen()
|
||||
}()
|
||||
}
|
||||
|
||||
app.appmutex.Lock()
|
||||
defer app.appmutex.Unlock()
|
||||
for handle := range app.peers {
|
||||
keys = append(keys, handle)
|
||||
// ListPeers returns a map of onions to their profile's Name
|
||||
func (app *application) ListPeers() map[string]string {
|
||||
keys := map[string]string{}
|
||||
for k, p := range app.peers {
|
||||
keys[k] = p.GetProfile().Name
|
||||
}
|
||||
return keys
|
||||
}
|
||||
|
||||
// PrimaryIdentity returns a cwtchPeer for a given onion address
|
||||
func (app *application) PrimaryIdentity() peer.CwtchPeer {
|
||||
return app.peers[app.primaryonion]
|
||||
}
|
||||
|
||||
// GetPeer returns a cwtchPeer for a given onion address
|
||||
func (app *application) GetPeer(onion string) peer.CwtchPeer {
|
||||
app.appmutex.Lock()
|
||||
defer app.appmutex.Unlock()
|
||||
if profile, ok := app.peers[onion]; ok {
|
||||
return profile
|
||||
if peer, ok := app.peers[onion]; ok {
|
||||
return peer
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (app *application) AddPlugin(peerid string, id plugins.PluginID, bus event.Manager, acn connectivity.ACN) {
|
||||
if _, exists := app.plugins.Load(peerid); !exists {
|
||||
app.plugins.Store(peerid, []plugins.Plugin{})
|
||||
}
|
||||
/*
|
||||
// GetTorStatus returns tor control port bootstrap-phase status info in a map
|
||||
func (app *application) GetTorStatus() (map[string]string, error) {
|
||||
return app.torManager.GetStatus()
|
||||
}*/
|
||||
|
||||
pluginsinf, _ := app.plugins.Load(peerid)
|
||||
peerPlugins := pluginsinf.([]plugins.Plugin)
|
||||
|
||||
for _, plugin := range peerPlugins {
|
||||
if plugin.Id() == id {
|
||||
log.Errorf("trying to add second instance of plugin %v to peer %v", id, peerid)
|
||||
return
|
||||
}
|
||||
}
|
||||
|
||||
newp, err := plugins.Get(id, bus, acn, peerid)
|
||||
if err == nil {
|
||||
newp.Start()
|
||||
peerPlugins = append(peerPlugins, newp)
|
||||
log.Debugf("storing plugin for %v %v", peerid, peerPlugins)
|
||||
app.plugins.Store(peerid, peerPlugins)
|
||||
} else {
|
||||
log.Errorf("error adding plugin: %v", err)
|
||||
}
|
||||
}
|
||||
|
||||
func (app *application) CreateProfile(name string, password string, autostart bool) {
|
||||
autostartVal := constants.True
|
||||
if !autostart {
|
||||
autostartVal = constants.False
|
||||
}
|
||||
tagVal := constants.ProfileTypeV1Password
|
||||
if password == DefactoPasswordForUnencryptedProfiles {
|
||||
tagVal = constants.ProfileTypeV1DefaultPassword
|
||||
}
|
||||
|
||||
app.CreatePeer(name, password, map[attr.ZonedPath]string{
|
||||
attr.ProfileZone.ConstructZonedPath(constants.Tag): tagVal,
|
||||
attr.ProfileZone.ConstructZonedPath(constants.PeerAutostart): autostartVal,
|
||||
})
|
||||
}
|
||||
|
||||
func (app *application) setupPeer(profile peer.CwtchPeer) {
|
||||
eventBus := event.NewEventManager()
|
||||
app.eventBuses[profile.GetOnion()] = eventBus
|
||||
|
||||
// Initialize the Peer with the Given Event Bus
|
||||
app.peers[profile.GetOnion()] = profile
|
||||
profile.Init(eventBus)
|
||||
|
||||
// Update the Peer with the Most Recent Experiment State...
|
||||
globalSettings := app.settings.ReadGlobalSettings()
|
||||
profile.UpdateExperiments(globalSettings.ExperimentsEnabled, globalSettings.Experiments)
|
||||
app.registerHooks(profile)
|
||||
|
||||
// Register the Peer With Application Plugins..
|
||||
app.AddPeerPlugin(profile.GetOnion(), plugins.CONNECTIONRETRY) // Now Mandatory
|
||||
app.AddPeerPlugin(profile.GetOnion(), plugins.HEARTBEAT) // Now Mandatory
|
||||
|
||||
}
|
||||
|
||||
func (app *application) CreatePeer(name string, password string, attributes map[attr.ZonedPath]string) {
|
||||
app.appmutex.Lock()
|
||||
defer app.appmutex.Unlock()
|
||||
|
||||
profileDirectory := path.Join(app.directory, "profiles", model.GenerateRandomID())
|
||||
|
||||
profile, err := peer.CreateEncryptedStorePeer(profileDirectory, name, password)
|
||||
if err != nil {
|
||||
log.Errorf("Error Creating Peer: %v", err)
|
||||
app.appBus.Publish(event.NewEventList(event.PeerError, event.Error, err.Error()))
|
||||
return
|
||||
}
|
||||
|
||||
app.setupPeer(profile)
|
||||
|
||||
for zp, val := range attributes {
|
||||
zone, key := attr.ParseZone(zp.ToString())
|
||||
profile.SetScopedZonedAttribute(attr.LocalScope, zone, key, val)
|
||||
}
|
||||
|
||||
app.appBus.Publish(event.NewEvent(event.NewPeer, map[event.Field]string{event.Identity: profile.GetOnion(), event.Created: event.True}))
|
||||
}
|
||||
|
||||
func (app *application) DeleteProfile(onion string, password string) {
|
||||
log.Debugf("DeleteProfile called on %v\n", onion)
|
||||
app.appmutex.Lock()
|
||||
defer app.appmutex.Unlock()
|
||||
|
||||
// short circuit to prevent nil-pointer panic if this function is called twice (or incorrectly)
|
||||
peer := app.peers[onion]
|
||||
if peer == nil {
|
||||
log.Errorf("shutdownPeer called with invalid onion %v", onion)
|
||||
return
|
||||
}
|
||||
|
||||
// allow a blank password to delete "unencrypted" accounts...
|
||||
if password == "" {
|
||||
password = DefactoPasswordForUnencryptedProfiles
|
||||
}
|
||||
|
||||
if peer.CheckPassword(password) {
|
||||
// soft-shutdown
|
||||
peer.Shutdown()
|
||||
// delete the underlying storage
|
||||
peer.Delete()
|
||||
// hard shutdown / remove from app
|
||||
app.shutdownPeer(onion)
|
||||
|
||||
// Shutdown and Remove the Engine
|
||||
log.Debugf("Delete peer for %v Done\n", onion)
|
||||
app.appBus.Publish(event.NewEventList(event.PeerDeleted, event.Identity, onion))
|
||||
return
|
||||
}
|
||||
app.appBus.Publish(event.NewEventList(event.AppError, event.Error, event.PasswordMatchError, event.Identity, onion))
|
||||
}
|
||||
|
||||
func (app *application) AddPeerPlugin(onion string, pluginID plugins.PluginID) {
|
||||
app.AddPlugin(onion, pluginID, app.eventBuses[onion], app.acn)
|
||||
}
|
||||
|
||||
func (app *application) ImportProfile(exportedCwtchFile string, password string) (peer.CwtchPeer, error) {
|
||||
profileDirectory := path.Join(app.directory, "profiles")
|
||||
profile, err := peer.ImportProfile(exportedCwtchFile, profileDirectory, password)
|
||||
if profile != nil || err == nil {
|
||||
app.installProfile(profile)
|
||||
}
|
||||
return profile, err
|
||||
}
|
||||
|
||||
func (app *application) EnhancedImportProfile(exportedCwtchFile string, password string) string {
|
||||
_, err := app.ImportProfile(exportedCwtchFile, password)
|
||||
if err == nil {
|
||||
return ""
|
||||
}
|
||||
return err.Error()
|
||||
}
|
||||
|
||||
// LoadProfiles takes a password and attempts to load any profiles it can from storage with it and create Peers for them
|
||||
func (app *application) LoadProfiles(password string) {
|
||||
count := 0
|
||||
migrating := false
|
||||
|
||||
files, err := os.ReadDir(path.Join(app.directory, "profiles"))
|
||||
if err != nil {
|
||||
log.Errorf("error: cannot read profiles directory: %v", err)
|
||||
return
|
||||
}
|
||||
|
||||
for _, file := range files {
|
||||
// Attempt to load an encrypted database
|
||||
profileDirectory := path.Join(app.directory, "profiles", file.Name())
|
||||
profile, err := peer.FromEncryptedDatabase(profileDirectory, password)
|
||||
loaded := false
|
||||
if err == nil {
|
||||
// return the load the profile...
|
||||
log.Infof("loading profile from new-type storage database...")
|
||||
loaded = app.installProfile(profile)
|
||||
} else { // On failure attempt to load a legacy profile
|
||||
profileStore, err := storage.LoadProfileWriterStore(profileDirectory, password)
|
||||
if err != nil {
|
||||
continue
|
||||
}
|
||||
log.Infof("found legacy profile. importing to new database structure...")
|
||||
legacyProfile := profileStore.GetProfileCopy(true)
|
||||
if !migrating {
|
||||
migrating = true
|
||||
app.appBus.Publish(event.NewEventList(event.StartingStorageMiragtion))
|
||||
}
|
||||
|
||||
cps, err := peer.CreateEncryptedStore(profileDirectory, password)
|
||||
if err != nil {
|
||||
log.Errorf("error creating encrypted store: %v", err)
|
||||
continue
|
||||
}
|
||||
profile := peer.ImportLegacyProfile(legacyProfile, cps)
|
||||
loaded = app.installProfile(profile)
|
||||
}
|
||||
if loaded {
|
||||
count++
|
||||
}
|
||||
}
|
||||
if count == 0 {
|
||||
message := event.NewEventList(event.AppError, event.Error, event.AppErrLoaded0)
|
||||
app.appBus.Publish(message)
|
||||
}
|
||||
if migrating {
|
||||
app.appBus.Publish(event.NewEventList(event.DoneStorageMigration))
|
||||
}
|
||||
}
|
||||
|
||||
func (app *application) registerHooks(profile peer.CwtchPeer) {
|
||||
// Register Hooks
|
||||
profile.RegisterHook(extensions.ProfileValueExtension{})
|
||||
profile.RegisterHook(extensions.SendWhenOnlineExtension{})
|
||||
profile.RegisterHook(new(filesharing.Functionality))
|
||||
profile.RegisterHook(new(filesharing.ImagePreviewsFunctionality))
|
||||
profile.RegisterHook(new(servers.Functionality))
|
||||
// Ensure that Profiles have the Most Up to Date Settings...
|
||||
profile.NotifySettingsUpdate(app.settings.ReadGlobalSettings())
|
||||
}
|
||||
|
||||
// installProfile takes a profile and if it isn't loaded in the app, installs it and returns true
|
||||
func (app *application) installProfile(profile peer.CwtchPeer) bool {
|
||||
app.appmutex.Lock()
|
||||
defer app.appmutex.Unlock()
|
||||
|
||||
// Only attempt to finalize the profile if we don't have one loaded...
|
||||
if app.peers[profile.GetOnion()] == nil {
|
||||
app.setupPeer(profile)
|
||||
// Finalize the Creation of Peer / Notify any Interfaces..
|
||||
app.appBus.Publish(event.NewEvent(event.NewPeer, map[event.Field]string{event.Identity: profile.GetOnion(), event.Created: event.False}))
|
||||
return true
|
||||
}
|
||||
// Otherwise shutdown the connections
|
||||
profile.Shutdown()
|
||||
return false
|
||||
}
|
||||
|
||||
// ActivatePeerEngine creates a peer engine for use with an ACN, should be called once the underlying ACN is online
|
||||
func (app *application) ActivatePeerEngine(onion string) {
|
||||
profile := app.GetPeer(onion)
|
||||
if profile != nil {
|
||||
if _, exists := app.engines[onion]; !exists {
|
||||
eventBus, exists := app.eventBuses[profile.GetOnion()]
|
||||
|
||||
if !exists {
|
||||
// todo handle this case?
|
||||
log.Errorf("cannot activate peer engine without an event bus")
|
||||
return
|
||||
}
|
||||
|
||||
engine, err := profile.GenerateProtocolEngine(app.acn, eventBus, app.engineHooks)
|
||||
if err == nil {
|
||||
log.Debugf("restartFlow: Creating a New Protocol Engine...")
|
||||
app.engines[profile.GetOnion()] = engine
|
||||
eventBus.Publish(event.NewEventList(event.ProtocolEngineCreated))
|
||||
app.QueryACNStatus()
|
||||
} else {
|
||||
log.Errorf("corrupted profile detected for %v", onion)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// ConfigureConnections autostarts the given kinds of connections.
|
||||
func (app *application) ConfigureConnections(onion string, listen bool, peers bool, servers bool) {
|
||||
profile := app.GetPeer(onion)
|
||||
if profile != nil {
|
||||
|
||||
profileBus, exists := app.eventBuses[profile.GetOnion()]
|
||||
if exists {
|
||||
// if we are making a decision to ignore
|
||||
if !peers || !servers {
|
||||
profileBus.Publish(event.NewEventList(event.PurgeRetries))
|
||||
}
|
||||
|
||||
// enable the engine if it doesn't exist...
|
||||
// note: this function is idempotent
|
||||
app.ActivatePeerEngine(onion)
|
||||
if listen {
|
||||
profile.Listen()
|
||||
}
|
||||
|
||||
profileBus.Publish(event.NewEventList(event.ResumeRetries))
|
||||
// do this in the background, for large contact lists it can take a long time...
|
||||
go profile.StartConnections(peers, servers)
|
||||
}
|
||||
} else {
|
||||
log.Errorf("profile does not exist %v", onion)
|
||||
}
|
||||
}
|
||||
|
||||
// DeactivatePeerEngine shutsdown and cleans up a peer engine, should be called when an underlying ACN goes offline
|
||||
func (app *application) DeactivatePeerEngine(onion string) {
|
||||
if engine, exists := app.engines[onion]; exists {
|
||||
engine.Shutdown()
|
||||
delete(app.engines, onion)
|
||||
}
|
||||
}
|
||||
|
||||
// GetPrimaryBus returns the bus the Application uses for events that aren't peer specific
|
||||
func (app *application) GetPrimaryBus() event.Manager {
|
||||
return app.appBus
|
||||
}
|
||||
|
||||
// GetEventBus returns a cwtchPeer's event bus
|
||||
func (app *application) GetEventBus(onion string) event.Manager {
|
||||
if manager, ok := app.eventBuses[onion]; ok {
|
||||
return manager
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (app *application) getACNStatusHandler() func(int, string) {
|
||||
return func(progress int, status string) {
|
||||
progStr := strconv.Itoa(progress)
|
||||
app.appmutex.Lock()
|
||||
app.appBus.Publish(event.NewEventList(event.ACNStatus, event.Progress, progStr, event.Status, status))
|
||||
for _, bus := range app.eventBuses {
|
||||
bus.Publish(event.NewEventList(event.ACNStatus, event.Progress, progStr, event.Status, status))
|
||||
}
|
||||
app.appmutex.Unlock()
|
||||
}
|
||||
}
|
||||
|
||||
func (app *application) getACNVersionHandler() func(string) {
|
||||
return func(version string) {
|
||||
app.appmutex.Lock()
|
||||
defer app.appmutex.Unlock()
|
||||
app.appBus.Publish(event.NewEventList(event.ACNVersion, event.Data, version))
|
||||
}
|
||||
}
|
||||
|
||||
func (app *application) QueryACNStatus() {
|
||||
prog, status := app.acn.GetBootstrapStatus()
|
||||
app.getACNStatusHandler()(prog, status)
|
||||
}
|
||||
|
||||
func (app *application) QueryACNVersion() {
|
||||
version := app.acn.GetVersion()
|
||||
app.appBus.Publish(event.NewEventList(event.ACNVersion, event.Data, version))
|
||||
}
|
||||
|
||||
func (app *application) eventHandler() {
|
||||
acnStatus := -1
|
||||
for {
|
||||
e := app.eventQueue.Next()
|
||||
switch e.EventType {
|
||||
case event.ACNStatus:
|
||||
newAcnStatus, err := strconv.Atoi(e.Data[event.Progress])
|
||||
if err != nil {
|
||||
break
|
||||
}
|
||||
if newAcnStatus == 100 {
|
||||
if acnStatus != 100 {
|
||||
for _, onion := range app.ListProfiles() {
|
||||
profile := app.GetPeer(onion)
|
||||
if profile != nil {
|
||||
autostart, exists := profile.GetScopedZonedAttribute(attr.LocalScope, attr.ProfileZone, constants.PeerAutostart)
|
||||
appearOffline, appearOfflineExists := profile.GetScopedZonedAttribute(attr.LocalScope, attr.ProfileZone, constants.PeerAppearOffline)
|
||||
if !exists || autostart == "true" {
|
||||
if appearOfflineExists && appearOffline == "true" {
|
||||
// don't configure any connections...
|
||||
log.Infof("peer appearing offline, not launching listen threads or connecting jobs")
|
||||
app.ConfigureConnections(onion, false, false, false)
|
||||
} else {
|
||||
app.ConfigureConnections(onion, true, true, true)
|
||||
}
|
||||
}
|
||||
|
||||
}
|
||||
}
|
||||
}
|
||||
} else {
|
||||
if acnStatus == 100 {
|
||||
// just fell offline
|
||||
for _, onion := range app.ListProfiles() {
|
||||
app.DeactivatePeerEngine(onion)
|
||||
}
|
||||
}
|
||||
}
|
||||
acnStatus = newAcnStatus
|
||||
|
||||
default:
|
||||
// invalid event, signifies shutdown
|
||||
if e.EventType == "" {
|
||||
return
|
||||
}
|
||||
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// ShutdownPeer shuts down a peer and removes it from the app's management
|
||||
func (app *application) ShutdownPeer(onion string) {
|
||||
app.appmutex.Lock()
|
||||
defer app.appmutex.Unlock()
|
||||
app.shutdownPeer(onion)
|
||||
}
|
||||
|
||||
// shutdownPeer mutex unlocked helper shutdown peer
|
||||
//
|
||||
//nolint:nilaway
|
||||
func (app *application) shutdownPeer(onion string) {
|
||||
|
||||
// short circuit to prevent nil-pointer panic if this function is called twice (or incorrectly)
|
||||
onionEventBus := app.eventBuses[onion]
|
||||
onionPeer := app.peers[onion]
|
||||
if onionEventBus == nil || onionPeer == nil {
|
||||
log.Errorf("shutdownPeer called with invalid onion %v", onion)
|
||||
return
|
||||
}
|
||||
// we are an internal locked method, app.eventBuses[onion] cannot fail...
|
||||
onionEventBus.Publish(event.NewEventList(event.ShutdownPeer, event.Identity, onion))
|
||||
onionEventBus.Shutdown()
|
||||
|
||||
delete(app.eventBuses, onion)
|
||||
onionPeer.Shutdown()
|
||||
delete(app.peers, onion)
|
||||
if onionEngine, ok := app.engines[onion]; ok {
|
||||
onionEngine.Shutdown()
|
||||
delete(app.engines, onion)
|
||||
}
|
||||
log.Debugf("shutting down plugins for %v", onion)
|
||||
pluginsI, ok := app.plugins.Load(onion)
|
||||
if ok {
|
||||
appPlugins := pluginsI.([]plugins.Plugin)
|
||||
for _, plugin := range appPlugins {
|
||||
plugin.Shutdown()
|
||||
}
|
||||
}
|
||||
app.plugins.Delete(onion)
|
||||
}
|
||||
|
||||
// Shutdown shutsdown all peers of an app
|
||||
// Shutdown shutsdown all peers of an app and then the tormanager
|
||||
func (app *application) Shutdown() {
|
||||
app.appmutex.Lock()
|
||||
defer app.appmutex.Unlock()
|
||||
for id := range app.peers {
|
||||
log.Debugf("Shutting Down Peer %v", id)
|
||||
app.shutdownPeer(id)
|
||||
for _, peer := range app.peers {
|
||||
peer.Shutdown()
|
||||
}
|
||||
log.Debugf("Shutting Down App")
|
||||
app.eventQueue.Shutdown()
|
||||
app.appBus.Shutdown()
|
||||
log.Debugf("Shut Down Complete")
|
||||
}
|
||||
|
|
|
@ -1,6 +0,0 @@
|
|||
package app
|
||||
|
||||
// DefactoPasswordForUnencryptedProfiles is used to offer "un-passworded" profiles. Our storage encrypts everything with a password. We need an agreed upon
|
||||
// password to use in that case, that the app case use behind the scenes to password and unlock with
|
||||
// https://docs.openprivacy.ca/cwtch-security-handbook/profile_encryption_and_storage.html
|
||||
const DefactoPasswordForUnencryptedProfiles = "be gay do crime"
|
|
@ -0,0 +1,607 @@
|
|||
package main
|
||||
|
||||
import (
|
||||
app2 "cwtch.im/cwtch/app"
|
||||
peer2 "cwtch.im/cwtch/peer"
|
||||
|
||||
"bytes"
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/peer/connections"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||
"github.com/c-bata/go-prompt"
|
||||
"golang.org/x/crypto/ssh/terminal"
|
||||
"log"
|
||||
"os"
|
||||
"os/user"
|
||||
"path"
|
||||
"strings"
|
||||
"syscall"
|
||||
"time"
|
||||
)
|
||||
|
||||
var app app2.Application
|
||||
var peer peer2.CwtchPeer
|
||||
var group *model.Group
|
||||
var groupFollowBreakChan chan bool
|
||||
var prmpt string
|
||||
|
||||
var suggestionsBase = []prompt.Suggest{
|
||||
{Text: "/new-profile", Description: "create a new profile"},
|
||||
{Text: "/load-profiles", Description: "loads profiles with a password"},
|
||||
{Text: "/list-profiles", Description: "list active profiles"},
|
||||
{Text: "/select-profile", Description: "selects an active profile to use"},
|
||||
{Text: "/help", Description: "print list of commands"},
|
||||
{Text: "/quit", Description: "quit cwtch"},
|
||||
}
|
||||
|
||||
var suggestionsSelectedProfile = []prompt.Suggest{
|
||||
{Text: "/info", Description: "show user info"},
|
||||
{Text: "/list-contacts", Description: "retrieve a list of contacts"},
|
||||
{Text: "/list-groups", Description: "retrieve a list of groups"},
|
||||
{Text: "/new-group", Description: "create a new group on a server"},
|
||||
{Text: "/select-group", Description: "selects a group to follow"},
|
||||
{Text: "/unselect-group", Description: "stop following the current group"},
|
||||
{Text: "/invite", Description: "invite a new contact"},
|
||||
{Text: "/invite-to-group", Description: "invite an existing contact to join an existing group"},
|
||||
{Text: "/accept-invite", Description: "accept the invite of a group"},
|
||||
{Text: "/list-servers", Description: "retrieve a list of servers and their connection status"},
|
||||
{Text: "/list-peers", Description: "retrieve a list of peers and their connection status"},
|
||||
{Text: "/export-group", Description: "export a group invite: prints as a string"},
|
||||
{Text: "/trust", Description: "trust a peer"},
|
||||
{Text: "/block", Description: "block a peer - you will no longer see messages or connect to this peer"},
|
||||
}
|
||||
|
||||
var suggestions = suggestionsBase
|
||||
|
||||
var usages = map[string]string{
|
||||
"/new-profile": "/new-profile [name]",
|
||||
"/load-profiles": "/load-profiles",
|
||||
"/list-profiles": "",
|
||||
"/select-profile": "/select-profile [onion]",
|
||||
"/quit": "",
|
||||
"/list-servers": "",
|
||||
"/list-peers": "",
|
||||
"/list-contacts": "",
|
||||
"/list-groups": "",
|
||||
"/select-group": "/select-group [groupid]",
|
||||
"/unselect-group": "",
|
||||
"/export-group": "/export-group [groupid]",
|
||||
"/info": "",
|
||||
"/send": "/send [groupid] [message]",
|
||||
"/timeline": "/timeline [groupid]",
|
||||
"/accept-invite": "/accept-invite [groupid]",
|
||||
"/invite": "/invite [peerid]",
|
||||
"/invite-to-group": "/invite-to-group [groupid] [peerid]",
|
||||
"/new-group": "/new-group [server]",
|
||||
"/help": "",
|
||||
"/trust": "/trust [peerid]",
|
||||
"/block": "/block [peerid]",
|
||||
}
|
||||
|
||||
func printMessage(m model.Message) {
|
||||
p := peer.GetContact(m.PeerID)
|
||||
name := "unknown"
|
||||
if p != nil {
|
||||
name = p.Name
|
||||
} else if peer.GetProfile().Onion == m.PeerID {
|
||||
name = peer.GetProfile().Name
|
||||
}
|
||||
|
||||
fmt.Printf("%v %v (%v): %v\n", m.Timestamp, name, m.PeerID, m.Message)
|
||||
}
|
||||
|
||||
func startGroupFollow() {
|
||||
groupFollowBreakChan = make(chan bool)
|
||||
go func() {
|
||||
for {
|
||||
l := len(group.Timeline.GetMessages())
|
||||
select {
|
||||
case <-time.After(1 * time.Second):
|
||||
if group == nil {
|
||||
return
|
||||
}
|
||||
gms := group.Timeline.GetMessages()
|
||||
if len(gms) != l {
|
||||
fmt.Printf("\n")
|
||||
for ; l < len(gms); l++ {
|
||||
printMessage(gms[l])
|
||||
}
|
||||
fmt.Printf(prmpt)
|
||||
}
|
||||
case <-groupFollowBreakChan:
|
||||
return
|
||||
}
|
||||
}
|
||||
}()
|
||||
}
|
||||
|
||||
func stopGroupFollow() {
|
||||
if group != nil {
|
||||
groupFollowBreakChan <- true
|
||||
group = nil
|
||||
}
|
||||
}
|
||||
|
||||
func completer(d prompt.Document) []prompt.Suggest {
|
||||
|
||||
var s []prompt.Suggest
|
||||
|
||||
if d.FindStartOfPreviousWord() == 0 {
|
||||
return prompt.FilterHasPrefix(suggestions, d.GetWordBeforeCursor(), true)
|
||||
}
|
||||
|
||||
w := d.CurrentLine()
|
||||
|
||||
// Suggest a profile id
|
||||
if strings.HasPrefix(w, "/select-profile") {
|
||||
s = []prompt.Suggest{}
|
||||
peerlist := app.ListPeers()
|
||||
for onion, peername := range peerlist {
|
||||
s = append(s, prompt.Suggest{Text: onion, Description: peername})
|
||||
}
|
||||
}
|
||||
|
||||
if peer == nil {
|
||||
return s
|
||||
}
|
||||
|
||||
// Suggest groupid
|
||||
if /*strings.HasPrefix(w, "send") || strings.HasPrefix(w, "timeline") ||*/ strings.HasPrefix(w, "/export-group") || strings.HasPrefix(w, "/select-group") {
|
||||
s = []prompt.Suggest{}
|
||||
groups := peer.GetGroups()
|
||||
for _, groupID := range groups {
|
||||
group := peer.GetGroup(groupID)
|
||||
s = append(s, prompt.Suggest{Text: group.GroupID, Description: "Group owned by " + group.Owner + " on " + group.GroupServer})
|
||||
}
|
||||
return prompt.FilterHasPrefix(s, d.GetWordBeforeCursor(), true)
|
||||
}
|
||||
|
||||
// Suggest unaccepted group
|
||||
if strings.HasPrefix(w, "/accept-invite") {
|
||||
s = []prompt.Suggest{}
|
||||
groups := peer.GetGroups()
|
||||
for _, groupID := range groups {
|
||||
group := peer.GetGroup(groupID)
|
||||
if group.Accepted == false {
|
||||
s = append(s, prompt.Suggest{Text: group.GroupID, Description: "Group owned by " + group.Owner + " on " + group.GroupServer})
|
||||
}
|
||||
}
|
||||
return prompt.FilterHasPrefix(s, d.GetWordBeforeCursor(), true)
|
||||
}
|
||||
|
||||
// suggest groupid AND peerid
|
||||
if strings.HasPrefix(w, "/invite-to-group") {
|
||||
|
||||
if d.FindStartOfPreviousWordWithSpace() == 0 {
|
||||
s = []prompt.Suggest{}
|
||||
groups := peer.GetGroups()
|
||||
for _, groupID := range groups {
|
||||
group := peer.GetGroup(groupID)
|
||||
if group.Owner == "self" {
|
||||
s = append(s, prompt.Suggest{Text: group.GroupID, Description: "Group owned by " + group.Owner + " on " + group.GroupServer})
|
||||
}
|
||||
}
|
||||
return prompt.FilterHasPrefix(s, d.GetWordBeforeCursor(), true)
|
||||
}
|
||||
|
||||
s = []prompt.Suggest{}
|
||||
contacts := peer.GetContacts()
|
||||
for _, onion := range contacts {
|
||||
contact := peer.GetContact(onion)
|
||||
s = append(s, prompt.Suggest{Text: contact.Onion, Description: contact.Name})
|
||||
}
|
||||
return prompt.FilterHasPrefix(s, d.GetWordBeforeCursor(), true)
|
||||
}
|
||||
|
||||
// Suggest contact onion / peerid
|
||||
if strings.HasPrefix(w, "/block") || strings.HasPrefix(w, "/trust") || strings.HasPrefix(w, "/invite") {
|
||||
s = []prompt.Suggest{}
|
||||
contacts := peer.GetContacts()
|
||||
for _, onion := range contacts {
|
||||
contact := peer.GetContact(onion)
|
||||
s = append(s, prompt.Suggest{Text: contact.Onion, Description: contact.Name})
|
||||
}
|
||||
return prompt.FilterHasPrefix(s, d.GetWordBeforeCursor(), true)
|
||||
}
|
||||
|
||||
return s
|
||||
}
|
||||
|
||||
func main() {
|
||||
|
||||
cwtch :=
|
||||
`
|
||||
#, #'
|
||||
@@@@@@:
|
||||
@@@@@@.
|
||||
@'@@+#' @@@@+
|
||||
''''''@ #+@ :
|
||||
@''''+;+' . '
|
||||
@''@' :+' , ; ##, +'
|
||||
,@@ ;' #'#@''. #''@''#
|
||||
# ''''''#:,,#'''''@
|
||||
: @''''@ :+'''@
|
||||
' @;+'@ @'#
|
||||
.:# '#..# '# @
|
||||
@@@@@@
|
||||
@@@@@@
|
||||
'@@@@
|
||||
@# . .
|
||||
+++, #'@+'@
|
||||
''', ''''''#
|
||||
.#+# ''', @'''+,
|
||||
@''# ''', .#@
|
||||
:; '@''# .;. ''', ' : ;. ,
|
||||
@+'''@ '+'+ @++ @+'@+''''+@ #+'''#: ''';#''+@ @@@@ @@@@@@@@@ :@@@@#
|
||||
#''''''# +''. +'': +'''''''''+ @'''''''# '''+'''''@ @@@@ @@@@@@@@@@@@@@@@:
|
||||
@'''@@'''@ @''# ,'''@ ''+ @@''+#+ :'''@@+''' ''''@@'''' @@@@ @@@@@@@@@@@@@@@@@
|
||||
'''# @''# +''@ @'''# ;''@ +''+ @''@ ,+'', '''@ #'''. @@@@ @@@@ '@@@# @@@@
|
||||
;''' @@; '''# #'@'' @''@ @''+ +''# .@@ ''', '''. @@@@ @@@ @@@ .@@@
|
||||
@''# #'' ''#''#@''. #''# '''. '''. +'', @@@@ @@@ @@@ @@@
|
||||
@''# @''@'' #'@+'+ #''# '''. ''', +'', +@@@.@@@ @@@@ @@@, @@@ ,@@@
|
||||
;''+ @, +''@'# @'+''@ @''# +''; '+ ''', +'', @@@@@@@@# @@@@ @@@. .@@@ .@@@
|
||||
'''# ++'+ ''''@ ,''''# #''' @''@ '@''+ ''', ''', @@@@@@@@: @@@@ @@@; .@@@' ;@@@
|
||||
@'''@@'''@ #'''. +'''' ;'''#@ :'''#@+''+ ''', ''', @@@@@@# @@@@ @@@+ ,@@@. @@@@
|
||||
#''''''# @''+ @''+ +'''' @'''''''# ''', ''', #@@@. @@@@ @@@+ @@@ @@@@
|
||||
@+''+@ '++@ ;++@ '#''@ ##'''@: +++, +++, :@ @@@@ @@@' @@@ '@@@
|
||||
:' ' '`
|
||||
fmt.Printf("%v\n\n", cwtch)
|
||||
|
||||
quit := false
|
||||
|
||||
usr, err := user.Current()
|
||||
if err != nil {
|
||||
log.Fatalf("\nError: could not load current user: %v\n", err)
|
||||
}
|
||||
|
||||
acn, err := connectivity.StartTor(path.Join(usr.HomeDir, ".cwtch"), "")
|
||||
if err != nil {
|
||||
log.Fatalf("\nError connecting to Tor: %v\n", err)
|
||||
}
|
||||
app = app2.NewApp(acn, path.Join(usr.HomeDir, ".cwtch"))
|
||||
if err != nil {
|
||||
log.Fatalf("Error initializing application: %v", err)
|
||||
}
|
||||
fmt.Printf("\nWelcome to Cwtch!\n")
|
||||
fmt.Printf("If this if your first time you should create a profile by running `/new-profile`\n")
|
||||
fmt.Printf("`/load-profiles` will prompt you for a password and load profiles from storage\n")
|
||||
fmt.Printf("`/help` will show you other available commands\n")
|
||||
fmt.Printf("There is full [TAB] completion support\n\n")
|
||||
|
||||
var history []string
|
||||
for !quit {
|
||||
|
||||
prmpt = "cwtch> "
|
||||
if group != nil {
|
||||
prmpt = fmt.Sprintf("cwtch %v (%v) [%v] say> ", peer.GetProfile().Name, peer.GetProfile().Onion, group.GroupID)
|
||||
} else if peer != nil {
|
||||
prmpt = fmt.Sprintf("cwtch %v (%v)> ", peer.GetProfile().Name, peer.GetProfile().Onion)
|
||||
}
|
||||
|
||||
text := prompt.Input(prmpt, completer, prompt.OptionSuggestionBGColor(prompt.Purple),
|
||||
prompt.OptionDescriptionBGColor(prompt.White),
|
||||
prompt.OptionHistory(history))
|
||||
|
||||
commands := strings.Split(text[0:], " ")
|
||||
history = append(history, text)
|
||||
|
||||
if peer == nil {
|
||||
if commands[0] != "/help" && commands[0] != "/quit" && commands[0] != "/new-profile" && commands[0] != "/load-profiles" && commands[0] != "/select-profile" && commands[0] != "/list-profiles" {
|
||||
fmt.Printf("Profile needs to be set\n")
|
||||
continue
|
||||
}
|
||||
}
|
||||
|
||||
// Send
|
||||
if group != nil && !strings.HasPrefix(commands[0], "/") {
|
||||
err := peer.SendMessageToGroup(group.GroupID, text)
|
||||
if err != nil {
|
||||
fmt.Printf("Error sending message: %v\n", err)
|
||||
}
|
||||
}
|
||||
|
||||
switch commands[0] {
|
||||
case "/quit":
|
||||
quit = true
|
||||
case "/new-profile":
|
||||
if len(commands) == 2 {
|
||||
name := strings.Trim(commands[1], " ")
|
||||
if name == "" {
|
||||
fmt.Printf("Error creating profile, usage: %v\n", usages[commands[0]])
|
||||
break
|
||||
}
|
||||
|
||||
fmt.Print("** WARNING: PASSWORDS CANNOT BE RECOVERED! **\n")
|
||||
|
||||
password := ""
|
||||
failcount := 0
|
||||
for ; failcount < 3; failcount++ {
|
||||
fmt.Print("Enter a password to encrypt the profile: ")
|
||||
bytePassword, _ := terminal.ReadPassword(int(syscall.Stdin))
|
||||
if string(bytePassword) == "" {
|
||||
fmt.Print("\nBlank password not allowed.")
|
||||
continue
|
||||
}
|
||||
fmt.Print("\nRe-enter password: ")
|
||||
bytePassword2, _ := terminal.ReadPassword(int(syscall.Stdin))
|
||||
if bytes.Equal(bytePassword, bytePassword2) {
|
||||
password = string(bytePassword)
|
||||
break
|
||||
} else {
|
||||
fmt.Print("\nPASSWORDS DIDN'T MATCH! Try again.\n")
|
||||
}
|
||||
}
|
||||
|
||||
if failcount >= 3 {
|
||||
fmt.Printf("Error creating profile for %v: Your password entries must match!\n", name)
|
||||
} else {
|
||||
p, err := app.CreatePeer(name, password)
|
||||
if err == nil {
|
||||
stopGroupFollow()
|
||||
fmt.Printf("\nNew profile created for %v\n", name)
|
||||
peer = p
|
||||
suggestions = append(suggestionsBase, suggestionsSelectedProfile...)
|
||||
|
||||
} else {
|
||||
fmt.Printf("\nError creating profile for %v: %v\n", name, err)
|
||||
}
|
||||
}
|
||||
} else {
|
||||
fmt.Printf("Error creating New Profile, usage: %s\n", usages[commands[0]])
|
||||
}
|
||||
case "/load-profiles":
|
||||
fmt.Print("Enter a password to decrypt the profile: ")
|
||||
bytePassword, err := terminal.ReadPassword(int(syscall.Stdin))
|
||||
|
||||
err = app.LoadProfiles(string(bytePassword))
|
||||
if err == nil {
|
||||
profiles := app.ListPeers()
|
||||
fmt.Printf("\n%v profiles active now\n", len(profiles))
|
||||
fmt.Printf("You should run `select-profile` to use a profile or `list-profiles` to view loaded profiles\n")
|
||||
} else {
|
||||
fmt.Printf("\nError loading profiles: %v\n", err)
|
||||
}
|
||||
|
||||
case "/list-profiles":
|
||||
peerlist := app.ListPeers()
|
||||
for onion, peername := range peerlist {
|
||||
fmt.Printf(" %v\t%v\n", onion, peername)
|
||||
}
|
||||
case "/select-profile":
|
||||
if len(commands) == 2 {
|
||||
p := app.GetPeer(commands[1])
|
||||
if p == nil {
|
||||
fmt.Printf("Error: profile '%v' does not exist\n", commands[1])
|
||||
} else {
|
||||
stopGroupFollow()
|
||||
peer = p
|
||||
suggestions = append(suggestionsBase, suggestionsSelectedProfile...)
|
||||
}
|
||||
|
||||
// Auto cwtchPeer / Join Server
|
||||
// TODO There are some privacy implications with this that we should
|
||||
// think over.
|
||||
for _, name := range p.GetProfile().GetContacts() {
|
||||
profile := p.GetContact(name)
|
||||
if profile.Trusted && !profile.Blocked {
|
||||
p.PeerWithOnion(profile.Onion)
|
||||
}
|
||||
}
|
||||
|
||||
for _, groupid := range p.GetGroups() {
|
||||
group := p.GetGroup(groupid)
|
||||
if group.Accepted || group.Owner == "self" {
|
||||
p.JoinServer(group.GroupServer)
|
||||
}
|
||||
}
|
||||
|
||||
} else {
|
||||
fmt.Printf("Error selecting profile, usage: %s\n", usages[commands[0]])
|
||||
}
|
||||
case "/info":
|
||||
if peer != nil {
|
||||
fmt.Printf("Address cwtch:%v\n", peer.GetProfile().Onion)
|
||||
} else {
|
||||
fmt.Printf("Profile needs to be set\n")
|
||||
}
|
||||
case "/invite":
|
||||
if len(commands) == 2 {
|
||||
fmt.Printf("Inviting cwtch:%v\n", commands[1])
|
||||
peer.PeerWithOnion(commands[1])
|
||||
} else {
|
||||
fmt.Printf("Error inviting peer, usage: %s\n", usages[commands[0]])
|
||||
}
|
||||
case "/list-peers":
|
||||
peers := peer.GetPeers()
|
||||
for p, s := range peers {
|
||||
fmt.Printf("Name: %v Status: %v\n", p, connections.ConnectionStateName[s])
|
||||
}
|
||||
case "/list-servers":
|
||||
servers := peer.GetServers()
|
||||
for s, st := range servers {
|
||||
fmt.Printf("Name: %v Status: %v\n", s, connections.ConnectionStateName[st])
|
||||
}
|
||||
case "/list-contacts":
|
||||
contacts := peer.GetContacts()
|
||||
for _, onion := range contacts {
|
||||
c := peer.GetContact(onion)
|
||||
fmt.Printf("Name: %v Onion: %v Trusted: %v\n", c.Name, c.Onion, c.Trusted)
|
||||
}
|
||||
case "/list-groups":
|
||||
for _, gid := range peer.GetGroups() {
|
||||
g := peer.GetGroup(gid)
|
||||
fmt.Printf("Group Id: %v Owner: %v Accepted:%v\n", gid, g.Owner, g.Accepted)
|
||||
}
|
||||
case "/trust":
|
||||
if len(commands) == 2 {
|
||||
peer.TrustPeer(commands[1])
|
||||
} else {
|
||||
fmt.Printf("Error trusting peer, usage: %s\n", usages[commands[0]])
|
||||
}
|
||||
case "/block":
|
||||
if len(commands) == 2 {
|
||||
peer.BlockPeer(commands[1])
|
||||
} else {
|
||||
fmt.Printf("Error blocking peer, usage: %s\n", usages[commands[0]])
|
||||
}
|
||||
case "/accept-invite":
|
||||
if len(commands) == 2 {
|
||||
groupID := commands[1]
|
||||
err := peer.AcceptInvite(groupID)
|
||||
if err != nil {
|
||||
fmt.Printf("Error: %v\n", err)
|
||||
} else {
|
||||
group := peer.GetGroup(groupID)
|
||||
if group == nil {
|
||||
fmt.Printf("Error: group does not exist\n")
|
||||
} else {
|
||||
peer.JoinServer(group.GroupServer)
|
||||
}
|
||||
}
|
||||
} else {
|
||||
fmt.Printf("Error accepting invite, usage: %s\n", usages[commands[0]])
|
||||
}
|
||||
case "/invite-to-group":
|
||||
if len(commands) == 3 {
|
||||
fmt.Printf("Inviting %v to %v\n", commands[1], commands[2])
|
||||
err := peer.InviteOnionToGroup(commands[2], commands[1])
|
||||
if err != nil {
|
||||
fmt.Printf("Error: %v\n", err)
|
||||
}
|
||||
} else {
|
||||
fmt.Printf("Error inviting peer to group, usage: %s\n", usages[commands[0]])
|
||||
}
|
||||
case "/new-group":
|
||||
if len(commands) == 2 && commands[1] != "" {
|
||||
fmt.Printf("Setting up a new group on server:%v\n", commands[1])
|
||||
id, _, err := peer.StartGroup(commands[1])
|
||||
if err == nil {
|
||||
fmt.Printf("New Group [%v] created for server %v\n", id, commands[1])
|
||||
group := peer.GetGroup(id)
|
||||
if group == nil {
|
||||
fmt.Printf("Error: group does not exist\n")
|
||||
} else {
|
||||
peer.JoinServer(group.GroupServer)
|
||||
}
|
||||
} else {
|
||||
fmt.Printf("Error creating new group: %v", err)
|
||||
}
|
||||
} else {
|
||||
fmt.Printf("Error creating a new group, usage: %s\n", usages[commands[0]])
|
||||
}
|
||||
case "/select-group":
|
||||
if len(commands) == 2 {
|
||||
g := peer.GetGroup(commands[1])
|
||||
if g == nil {
|
||||
fmt.Printf("Error: group %s not found!\n", commands[1])
|
||||
} else {
|
||||
stopGroupFollow()
|
||||
group = g
|
||||
|
||||
fmt.Printf("--------------- %v ---------------\n", group.GroupID)
|
||||
gms := group.Timeline.Messages
|
||||
max := 20
|
||||
if len(gms) < max {
|
||||
max = len(gms)
|
||||
}
|
||||
for i := len(gms) - max; i < len(gms); i++ {
|
||||
printMessage(gms[i])
|
||||
}
|
||||
fmt.Printf("------------------------------\n")
|
||||
|
||||
startGroupFollow()
|
||||
}
|
||||
} else {
|
||||
fmt.Printf("Error selecting a group, usage: %s\n", usages[commands[0]])
|
||||
}
|
||||
case "/unselect-group":
|
||||
stopGroupFollow()
|
||||
case "/export-group":
|
||||
if len(commands) == 2 {
|
||||
group := peer.GetGroup(commands[1])
|
||||
if group == nil {
|
||||
fmt.Printf("Error: group does not exist\n")
|
||||
} else {
|
||||
invite, _ := peer.ExportGroup(commands[1])
|
||||
fmt.Printf("Invite: %v\n", invite)
|
||||
}
|
||||
} else {
|
||||
fmt.Printf("Error exporting group, usage: %s\n", usages[commands[0]])
|
||||
}
|
||||
case "/import-group":
|
||||
if len(commands) == 2 {
|
||||
groupID, err := peer.ImportGroup(commands[1])
|
||||
if err != nil {
|
||||
fmt.Printf("Error importing group: %v\n", err)
|
||||
} else {
|
||||
fmt.Printf("Imported group: %s\n", groupID)
|
||||
}
|
||||
} else {
|
||||
fmt.Printf("%v", commands)
|
||||
fmt.Printf("Error importing group, usage: %s\n", usages[commands[0]])
|
||||
}
|
||||
case "/save":
|
||||
app.SaveProfile(peer)
|
||||
case "/help":
|
||||
for _, command := range suggestions {
|
||||
fmt.Printf("%-18s%-56s%s\n", command.Text, command.Description, usages[command.Text])
|
||||
}
|
||||
case "/sendlots":
|
||||
if len(commands) == 2 {
|
||||
group := peer.GetGroup(commands[1])
|
||||
if group == nil {
|
||||
fmt.Printf("Error: group does not exist\n")
|
||||
} else {
|
||||
for i := 0; i < 100; i++ {
|
||||
fmt.Printf("Sending message: %v\n", i)
|
||||
err := peer.SendMessageToGroup(commands[1], fmt.Sprintf("this is message %v", i))
|
||||
if err != nil {
|
||||
fmt.Printf("could not send message %v because %v\n", i, err)
|
||||
}
|
||||
}
|
||||
fmt.Printf("Waiting 5 seconds for message to process...\n")
|
||||
time.Sleep(time.Second * 5)
|
||||
timeline := group.GetTimeline()
|
||||
totalLatency := time.Duration(0)
|
||||
maxLatency := time.Duration(0)
|
||||
totalMessages := 0
|
||||
for i := 0; i < 100; i++ {
|
||||
found := false
|
||||
for _, m := range timeline {
|
||||
if m.Message == fmt.Sprintf("this is message %v", i) && m.PeerID == peer.GetProfile().Onion {
|
||||
found = true
|
||||
latency := m.Received.Sub(m.Timestamp)
|
||||
fmt.Printf("Latency for Message %v was %v\n", i, latency)
|
||||
totalLatency = totalLatency + latency
|
||||
if maxLatency < latency {
|
||||
maxLatency = latency
|
||||
}
|
||||
totalMessages++
|
||||
}
|
||||
}
|
||||
|
||||
if !found {
|
||||
fmt.Printf("message %v was never received\n", i)
|
||||
}
|
||||
}
|
||||
|
||||
fmt.Printf("Average Latency for %v messages was: %vms\n", totalMessages, time.Duration(int64(totalLatency)/int64(totalMessages)))
|
||||
fmt.Printf("Max Latency for %v messages was: %vms\n", totalMessages, maxLatency)
|
||||
|
||||
}
|
||||
}
|
||||
}
|
||||
if peer != nil {
|
||||
app.SaveProfile(peer)
|
||||
}
|
||||
}
|
||||
|
||||
if peer != nil {
|
||||
app.SaveProfile(peer)
|
||||
}
|
||||
|
||||
app.Shutdown()
|
||||
acn.Close()
|
||||
os.Exit(0)
|
||||
}
|
|
@ -0,0 +1,194 @@
|
|||
package main
|
||||
|
||||
import (
|
||||
"bufio"
|
||||
"crypto/rand"
|
||||
libpeer "cwtch.im/cwtch/peer"
|
||||
storage2 "cwtch.im/cwtch/storage"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||
|
||||
"github.com/sethvargo/go-diceware/diceware"
|
||||
"golang.org/x/crypto/ed25519"
|
||||
"io/ioutil"
|
||||
"log"
|
||||
"os"
|
||||
"strconv"
|
||||
"strings"
|
||||
"time"
|
||||
)
|
||||
|
||||
func convertCwtchFile(filename string, password string) {
|
||||
fileStore := storage2.CreateFileProfileStore(filename, password)
|
||||
peer, err := fileStore.Load()
|
||||
if err != nil {
|
||||
log.Fatalf("%v", err)
|
||||
}
|
||||
|
||||
b := []byte("== ed25519v1-secret: type0 ==")
|
||||
b = append(b, peer.GetProfile().Ed25519PrivateKey...)
|
||||
err = ioutil.WriteFile("hs_ed25519_secret_key", b, 0600)
|
||||
if err != nil {
|
||||
log.Fatalf("%v", err)
|
||||
}
|
||||
|
||||
b = []byte("== ed25519v1-public: type0 ==")
|
||||
b = append(b, peer.GetProfile().Ed25519PublicKey...)
|
||||
err = ioutil.WriteFile("hs_ed25519_public_key", b, 0600)
|
||||
if err != nil {
|
||||
log.Fatalf("%v", err)
|
||||
}
|
||||
|
||||
b = []byte(peer.GetProfile().Onion + ".onion\n")
|
||||
err = ioutil.WriteFile("hostname", b, 0600)
|
||||
if err != nil {
|
||||
log.Fatalf("%v", err)
|
||||
}
|
||||
|
||||
fmt.Println("success!")
|
||||
}
|
||||
|
||||
func convertTorFile(filename string, password string) {
|
||||
log.Fatalf("this code doesn't work and can never work :( it's a math thing")
|
||||
|
||||
name, _ := diceware.Generate(2)
|
||||
sk, err := ioutil.ReadFile("hs_ed25519_secret_key")
|
||||
if err != nil {
|
||||
log.Fatalf("%v", err)
|
||||
}
|
||||
sk = sk[32:]
|
||||
|
||||
pk, err := ioutil.ReadFile("hs_ed25519_public_key")
|
||||
if err != nil {
|
||||
log.Fatalf("%v", err)
|
||||
}
|
||||
pk = pk[32:]
|
||||
|
||||
onion, err := ioutil.ReadFile("hostname")
|
||||
if err != nil {
|
||||
log.Fatalf("%v", err)
|
||||
}
|
||||
onion = onion[:56]
|
||||
|
||||
peer := libpeer.NewCwtchPeer(strings.Join(name, "-"))
|
||||
|
||||
fmt.Printf("%d %d %s\n", len(peer.GetProfile().Ed25519PublicKey), len(peer.GetProfile().Ed25519PrivateKey), peer.GetProfile().Onion)
|
||||
peer.GetProfile().Ed25519PrivateKey = sk
|
||||
peer.GetProfile().Ed25519PublicKey = pk
|
||||
peer.GetProfile().Onion = string(onion)
|
||||
fileStore := storage2.CreateFileProfileStore(filename, password)
|
||||
err = fileStore.Save(peer)
|
||||
if err != nil {
|
||||
log.Fatalf("%v", err)
|
||||
}
|
||||
|
||||
log.Printf("success! loaded %d byte pk and %d byte sk for %s.onion\n", len(pk), len(sk), onion)
|
||||
}
|
||||
|
||||
func vanity() {
|
||||
for {
|
||||
pk, sk, err := ed25519.GenerateKey(rand.Reader)
|
||||
if err != nil {
|
||||
continue
|
||||
}
|
||||
onion := utils.GetTorV3Hostname(pk)
|
||||
for i := 4; i < len(os.Args); i++ {
|
||||
if strings.HasPrefix(onion, os.Args[i]) {
|
||||
peer := libpeer.NewCwtchPeer(os.Args[i])
|
||||
peer.GetProfile().Ed25519PrivateKey = sk
|
||||
peer.GetProfile().Ed25519PublicKey = pk
|
||||
peer.GetProfile().Onion = onion
|
||||
fileStore := storage2.CreateFileProfileStore(os.Args[3], onion+".cwtch")
|
||||
err := fileStore.Save(peer)
|
||||
if err != nil {
|
||||
log.Fatalf("%v", err)
|
||||
}
|
||||
log.Printf("found %s.onion\n", onion)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func printHelp() {
|
||||
log.Println("usage: cwtchutil {help, convert-cwtch-file, convert-tor-file, changepw, vanity}")
|
||||
}
|
||||
|
||||
func main() {
|
||||
if len(os.Args) < 2 {
|
||||
printHelp()
|
||||
os.Exit(1)
|
||||
}
|
||||
|
||||
switch os.Args[1] {
|
||||
default:
|
||||
printHelp()
|
||||
case "help":
|
||||
printHelp()
|
||||
case "convert-cwtch-file":
|
||||
if len(os.Args) != 4 {
|
||||
log.Println("example: cwtchutil convert-cwtch-file ~/.cwtch/profiles/11ddd78a9918c064e742d5e36a8b8fd4 passw0rd")
|
||||
os.Exit(1)
|
||||
}
|
||||
convertCwtchFile(os.Args[2], os.Args[3])
|
||||
case "convert-tor-file":
|
||||
if len(os.Args) != 4 {
|
||||
log.Println("example: cwtchutil convert-tor-file /var/lib/tor/hs1 passw0rd")
|
||||
os.Exit(1)
|
||||
}
|
||||
convertTorFile(os.Args[2], os.Args[3])
|
||||
case "vanity":
|
||||
if len(os.Args) < 5 {
|
||||
log.Println("example: cwtchutil vanity 4 passw0rd erinn openpriv")
|
||||
os.Exit(1)
|
||||
}
|
||||
|
||||
goroutines, err := strconv.Atoi(os.Args[2])
|
||||
if err != nil {
|
||||
log.Printf("first parameter after vanity should be a number\n")
|
||||
os.Exit(1)
|
||||
}
|
||||
log.Println("searching. press ctrl+c to stop")
|
||||
for i := 0; i < goroutines; i++ {
|
||||
go vanity()
|
||||
}
|
||||
|
||||
for { // run until ctrl+c
|
||||
time.Sleep(time.Hour * 24)
|
||||
}
|
||||
case "changepw":
|
||||
if len(os.Args) != 3 {
|
||||
log.Fatalf("example: cwtch changepw ~/.cwtch/profiles/XXX")
|
||||
}
|
||||
|
||||
fmt.Printf("old password: ")
|
||||
reader := bufio.NewReader(os.Stdin)
|
||||
pw, err := reader.ReadString('\n')
|
||||
if err != nil {
|
||||
log.Fatalf("%v", err)
|
||||
}
|
||||
pw = pw[:len(pw)-1]
|
||||
|
||||
fileStore := storage2.CreateFileProfileStore(os.Args[2], pw)
|
||||
|
||||
peer, err := fileStore.Load()
|
||||
if err != nil {
|
||||
log.Fatalf("%v", err)
|
||||
}
|
||||
|
||||
fmt.Printf("new password: ")
|
||||
newpw1, err := reader.ReadString('\n')
|
||||
if err != nil {
|
||||
log.Fatalf("%v", err)
|
||||
}
|
||||
newpw1 = newpw1[:len(newpw1)-1] // fuck go with this linebreak shit ^ea
|
||||
|
||||
fileStore2 := storage2.CreateFileProfileStore(os.Args[2], newpw1)
|
||||
err = fileStore2.Save(peer)
|
||||
if err != nil {
|
||||
log.Fatalf("%v", err)
|
||||
}
|
||||
|
||||
log.Println("success!")
|
||||
|
||||
}
|
||||
}
|
|
@ -0,0 +1,18 @@
|
|||
package main
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/peer"
|
||||
"log"
|
||||
)
|
||||
|
||||
func main() {
|
||||
alice := peer.NewCwtchPeer("alice")
|
||||
|
||||
processData := func(onion string, data []byte) []byte {
|
||||
log.Printf("Recieved %s from %v", data, onion)
|
||||
return data
|
||||
}
|
||||
|
||||
alice.SetPeerDataHandler(processData)
|
||||
alice.Listen()
|
||||
}
|
|
@ -0,0 +1,27 @@
|
|||
package main
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/peer"
|
||||
"log"
|
||||
"strconv"
|
||||
"time"
|
||||
)
|
||||
|
||||
func main() {
|
||||
bob := peer.NewCwtchPeer("bob")
|
||||
counter := 1
|
||||
|
||||
bob.SetPeerDataHandler(func(onion string, data []byte) []byte {
|
||||
log.Printf("Recieved %s from %v", data, onion)
|
||||
counter++
|
||||
return []byte(strconv.Itoa(counter))
|
||||
})
|
||||
connection := bob.PeerWithOnion("f4b6thuwmfszsqd3fzqpr45sdem4qoazdlzr2xmnc7fq22qe746hjqqd")
|
||||
|
||||
log.Printf("Waiting for Bob to Connect to Alice...")
|
||||
connection.SendPacket([]byte("Hello Alice!!!"))
|
||||
|
||||
// Wait a while...
|
||||
time.Sleep(time.Second * 100)
|
||||
|
||||
}
|
|
@ -1,47 +0,0 @@
|
|||
package plugins
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"time"
|
||||
)
|
||||
|
||||
const antispamTickTime = 30 * time.Second
|
||||
|
||||
type antispam struct {
|
||||
bus event.Manager
|
||||
queue event.Queue
|
||||
breakChan chan bool
|
||||
}
|
||||
|
||||
func (a *antispam) Start() {
|
||||
go a.run()
|
||||
}
|
||||
|
||||
func (a *antispam) Id() PluginID {
|
||||
return ANTISPAM
|
||||
}
|
||||
|
||||
func (a *antispam) Shutdown() {
|
||||
a.breakChan <- true
|
||||
}
|
||||
|
||||
func (a *antispam) run() {
|
||||
log.Debugf("running antispam trigger plugin")
|
||||
for {
|
||||
select {
|
||||
case <-time.After(antispamTickTime):
|
||||
// no fuss, just trigger the check. Downstream will filter out superfluous actions
|
||||
a.bus.Publish(event.NewEvent(event.TriggerAntispamCheck, map[event.Field]string{}))
|
||||
continue
|
||||
case <-a.breakChan:
|
||||
return
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// NewAntiSpam returns a Plugin that when started will trigger antispam payments on a regular interval
|
||||
func NewAntiSpam(bus event.Manager) Plugin {
|
||||
cr := &antispam{bus: bus, queue: event.NewQueue(), breakChan: make(chan bool, 1)}
|
||||
return cr
|
||||
}
|
|
@ -1,519 +0,0 @@
|
|||
package plugins
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/protocol/connections"
|
||||
"git.openprivacy.ca/openprivacy/connectivity/tor"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"math"
|
||||
"strconv"
|
||||
"sync"
|
||||
"time"
|
||||
)
|
||||
|
||||
// Todo: Move to protocol/connections
|
||||
// This Plugin is now required and it makes more sense to run more integrated in engine
|
||||
|
||||
const tickTimeSec = 30
|
||||
const tickTime = tickTimeSec * time.Second
|
||||
|
||||
const circuitTimeoutSecs int = 120
|
||||
|
||||
const MaxBaseTimeoutSec = 5 * 60 // a max base time out of 5 min
|
||||
const maxFailedBackoff = 6 // 2^6 = 64 -> 64 * [2m to 5m] = 2h8m to 5h20m
|
||||
|
||||
const PriorityQueueTimeSinceQualifierHours float64 = 168
|
||||
|
||||
type connectionType int
|
||||
|
||||
const (
|
||||
peerConn connectionType = iota
|
||||
serverConn
|
||||
)
|
||||
|
||||
type contact struct {
|
||||
id string
|
||||
state connections.ConnectionState
|
||||
ctype connectionType
|
||||
|
||||
lastAttempt time.Time
|
||||
failedCount int
|
||||
|
||||
lastSeen time.Time
|
||||
queued bool
|
||||
}
|
||||
|
||||
// compare a to b
|
||||
// returns -1 if a < b
|
||||
//
|
||||
// 0 if a == b
|
||||
// +1 if a > b
|
||||
//
|
||||
// algo: sort by failedCount first favouring less attempts, then sort by lastSeen time favouring more recent connections
|
||||
func (a *contact) compare(b *contact) int {
|
||||
if a.failedCount < b.failedCount {
|
||||
return -1
|
||||
} else if a.failedCount > b.failedCount {
|
||||
return +1
|
||||
}
|
||||
|
||||
if a.lastSeen.After(b.lastSeen) {
|
||||
return -1
|
||||
} else if a.lastSeen.Before(b.lastSeen) {
|
||||
return +1
|
||||
}
|
||||
|
||||
return 0
|
||||
}
|
||||
|
||||
type connectionQueue struct {
|
||||
queue []*contact
|
||||
}
|
||||
|
||||
func newConnectionQueue() *connectionQueue {
|
||||
return &connectionQueue{queue: []*contact{}}
|
||||
}
|
||||
|
||||
func (cq *connectionQueue) insert(c *contact) {
|
||||
// find loc
|
||||
i := 0
|
||||
var b *contact
|
||||
for i, b = range cq.queue {
|
||||
if c.compare(b) >= 0 {
|
||||
break
|
||||
}
|
||||
}
|
||||
|
||||
// insert
|
||||
if len(cq.queue) == i { // nil or empty slice or after last element
|
||||
cq.queue = append(cq.queue, c)
|
||||
} else {
|
||||
cq.queue = append(cq.queue[:i+1], cq.queue[i:]...) // index < len(a)
|
||||
cq.queue[i] = c
|
||||
}
|
||||
|
||||
c.queued = true
|
||||
}
|
||||
|
||||
func (cq *connectionQueue) dequeue() *contact {
|
||||
if len(cq.queue) == 0 {
|
||||
return nil
|
||||
}
|
||||
c := cq.queue[0]
|
||||
cq.queue = cq.queue[1:]
|
||||
c.queued = false
|
||||
return c
|
||||
}
|
||||
|
||||
func (cq *connectionQueue) len() int {
|
||||
return len(cq.queue)
|
||||
}
|
||||
|
||||
type contactRetry struct {
|
||||
bus event.Manager
|
||||
queue event.Queue
|
||||
ACNUp bool
|
||||
ACNUpTime time.Time
|
||||
protocolEngine bool
|
||||
running bool
|
||||
breakChan chan bool
|
||||
onion string
|
||||
lastCheck time.Time
|
||||
acnProgress int
|
||||
|
||||
connections sync.Map //[string]*contact
|
||||
pendingQueue *connectionQueue
|
||||
priorityQueue *connectionQueue
|
||||
authorizedPeers sync.Map
|
||||
stallRetries bool
|
||||
}
|
||||
|
||||
// NewConnectionRetry returns a Plugin that when started will retry connecting to contacts with a failedCount timing
|
||||
func NewConnectionRetry(bus event.Manager, onion string) Plugin {
|
||||
cr := &contactRetry{bus: bus, queue: event.NewQueue(), breakChan: make(chan bool, 1), authorizedPeers: sync.Map{}, connections: sync.Map{}, stallRetries: true, ACNUp: false, ACNUpTime: time.Now(), protocolEngine: false, onion: onion, pendingQueue: newConnectionQueue(), priorityQueue: newConnectionQueue()}
|
||||
return cr
|
||||
}
|
||||
|
||||
// maxTorCircuitsPending a function to throttle access to tor network during start up
|
||||
func (cr *contactRetry) maxTorCircuitsPending() int {
|
||||
timeSinceStart := time.Since(cr.ACNUpTime)
|
||||
if timeSinceStart < 30*time.Second {
|
||||
return 4
|
||||
} else if timeSinceStart < 4*time.Minute {
|
||||
return 8
|
||||
} else if timeSinceStart < 8*time.Minute {
|
||||
return 16
|
||||
}
|
||||
return connections.TorMaxPendingConns
|
||||
}
|
||||
|
||||
func (cr *contactRetry) connectingCount() int {
|
||||
connecting := 0
|
||||
cr.connections.Range(func(k, v interface{}) bool {
|
||||
conn := v.(*contact)
|
||||
if conn.state == connections.CONNECTING {
|
||||
connecting++
|
||||
}
|
||||
return true
|
||||
})
|
||||
return connecting
|
||||
}
|
||||
|
||||
func (cr *contactRetry) Start() {
|
||||
if !cr.running {
|
||||
go cr.run()
|
||||
} else {
|
||||
log.Errorf("Attempted to start Contact Retry plugin twice for %v", cr.onion)
|
||||
}
|
||||
}
|
||||
|
||||
func (cr *contactRetry) Id() PluginID {
|
||||
return CONNECTIONRETRY
|
||||
}
|
||||
|
||||
func (cr *contactRetry) run() {
|
||||
cr.running = true
|
||||
cr.bus.Subscribe(event.PeerStateChange, cr.queue)
|
||||
cr.bus.Subscribe(event.ACNStatus, cr.queue)
|
||||
cr.bus.Subscribe(event.ServerStateChange, cr.queue)
|
||||
cr.bus.Subscribe(event.QueuePeerRequest, cr.queue)
|
||||
cr.bus.Subscribe(event.QueueJoinServer, cr.queue)
|
||||
cr.bus.Subscribe(event.DisconnectPeerRequest, cr.queue)
|
||||
cr.bus.Subscribe(event.DisconnectServerRequest, cr.queue)
|
||||
cr.bus.Subscribe(event.ProtocolEngineShutdown, cr.queue)
|
||||
cr.bus.Subscribe(event.ProtocolEngineCreated, cr.queue)
|
||||
cr.bus.Subscribe(event.DeleteContact, cr.queue)
|
||||
cr.bus.Subscribe(event.UpdateConversationAuthorization, cr.queue)
|
||||
cr.bus.Subscribe(event.PurgeRetries, cr.queue)
|
||||
cr.bus.Subscribe(event.ResumeRetries, cr.queue)
|
||||
for {
|
||||
// Only attempt connection if both the ACN and the Protocol Engines are Online...
|
||||
log.Debugf("restartFlow checking state")
|
||||
if cr.ACNUp && cr.protocolEngine && !cr.stallRetries {
|
||||
log.Debugf("restartFlow time to queue!!")
|
||||
cr.requeueReady()
|
||||
connectingCount := cr.connectingCount()
|
||||
|
||||
// do priority connections first...
|
||||
for connectingCount < cr.maxTorCircuitsPending() && len(cr.priorityQueue.queue) > 0 {
|
||||
contact := cr.priorityQueue.dequeue()
|
||||
if contact == nil {
|
||||
break
|
||||
}
|
||||
// could have received incoming connection while in queue, make sure still disconnected before trying
|
||||
if contact.state == connections.DISCONNECTED {
|
||||
cr.publishConnectionRequest(contact)
|
||||
connectingCount++
|
||||
}
|
||||
}
|
||||
|
||||
for connectingCount < cr.maxTorCircuitsPending() && len(cr.pendingQueue.queue) > 0 {
|
||||
contact := cr.pendingQueue.dequeue()
|
||||
if contact == nil {
|
||||
break
|
||||
}
|
||||
// could have received incoming connection while in queue, make sure still disconnected before trying
|
||||
if contact.state == connections.DISCONNECTED {
|
||||
cr.publishConnectionRequest(contact)
|
||||
connectingCount++
|
||||
}
|
||||
}
|
||||
cr.lastCheck = time.Now()
|
||||
}
|
||||
// regardless of if we're up, run manual force deconnectiong of timed out connections
|
||||
cr.connections.Range(func(k, v interface{}) bool {
|
||||
p := v.(*contact)
|
||||
if p.state == connections.CONNECTING && time.Since(p.lastAttempt) > time.Duration(circuitTimeoutSecs)*time.Second*2 {
|
||||
// we have been "connecting" for twice the circuttimeout so it's failed, we just didn't learn about it, manually disconnect
|
||||
cr.handleEvent(p.id, connections.DISCONNECTED, p.ctype)
|
||||
log.Errorf("had to manually set peer %v of profile %v to DISCONNECTED due to assumed circuit timeout (%v) seconds", p.id, cr.onion, circuitTimeoutSecs*2)
|
||||
}
|
||||
return true
|
||||
})
|
||||
|
||||
select {
|
||||
case e := <-cr.queue.OutChan():
|
||||
switch e.EventType {
|
||||
case event.PurgeRetries:
|
||||
// Purge All Authorized Peers
|
||||
cr.authorizedPeers.Range(func(key interface{}, value interface{}) bool {
|
||||
cr.authorizedPeers.Delete(key)
|
||||
return true
|
||||
})
|
||||
// Purge All Connection States
|
||||
cr.connections.Range(func(key interface{}, value interface{}) bool {
|
||||
cr.connections.Delete(key)
|
||||
return true
|
||||
})
|
||||
case event.ResumeRetries:
|
||||
log.Infof("resuming retries...")
|
||||
cr.stallRetries = false
|
||||
case event.DisconnectPeerRequest:
|
||||
peer := e.Data[event.RemotePeer]
|
||||
cr.authorizedPeers.Delete(peer)
|
||||
case event.DisconnectServerRequest:
|
||||
peer := e.Data[event.GroupServer]
|
||||
cr.authorizedPeers.Delete(peer)
|
||||
case event.DeleteContact:
|
||||
// this case covers both servers and peers (servers are peers, and go through the
|
||||
// same delete conversation flow)
|
||||
peer := e.Data[event.RemotePeer]
|
||||
cr.authorizedPeers.Delete(peer)
|
||||
case event.UpdateConversationAuthorization:
|
||||
// if we update the conversation authorization then we need to check if
|
||||
// we need to remove blocked conversations from the regular flow.
|
||||
peer := e.Data[event.RemotePeer]
|
||||
blocked := e.Data[event.Blocked]
|
||||
if blocked == "true" {
|
||||
cr.authorizedPeers.Delete(peer)
|
||||
}
|
||||
case event.PeerStateChange:
|
||||
state := connections.ConnectionStateToType()[e.Data[event.ConnectionState]]
|
||||
peer := e.Data[event.RemotePeer]
|
||||
// only handle state change events from pre-authorized peers;
|
||||
if _, exists := cr.authorizedPeers.Load(peer); exists {
|
||||
cr.handleEvent(peer, state, peerConn)
|
||||
}
|
||||
case event.ServerStateChange:
|
||||
state := connections.ConnectionStateToType()[e.Data[event.ConnectionState]]
|
||||
server := e.Data[event.GroupServer]
|
||||
// only handle state change events from pre-authorized servers;
|
||||
if _, exists := cr.authorizedPeers.Load(server); exists {
|
||||
cr.handleEvent(server, state, serverConn)
|
||||
}
|
||||
case event.QueueJoinServer:
|
||||
fallthrough
|
||||
case event.QueuePeerRequest:
|
||||
lastSeen, err := time.Parse(time.RFC3339Nano, e.Data[event.LastSeen])
|
||||
if err != nil {
|
||||
lastSeen = event.CwtchEpoch
|
||||
}
|
||||
|
||||
id := ""
|
||||
if peer, exists := e.Data[event.RemotePeer]; exists {
|
||||
id = peer
|
||||
cr.addConnection(peer, connections.DISCONNECTED, peerConn, lastSeen)
|
||||
} else if server, exists := e.Data[event.GroupServer]; exists {
|
||||
id = server
|
||||
cr.addConnection(server, connections.DISCONNECTED, serverConn, lastSeen)
|
||||
}
|
||||
// this was an authorized event, and so we store this peer.
|
||||
log.Debugf("authorizing id: %v", id)
|
||||
cr.authorizedPeers.Store(id, true)
|
||||
if c, ok := cr.connections.Load(id); ok {
|
||||
contact := c.(*contact)
|
||||
if contact.state == connections.DISCONNECTED {
|
||||
// prioritize connections made in the last week
|
||||
if time.Since(contact.lastSeen).Hours() < PriorityQueueTimeSinceQualifierHours {
|
||||
cr.priorityQueue.insert(contact)
|
||||
} else {
|
||||
cr.pendingQueue.insert(contact)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
case event.ProtocolEngineShutdown:
|
||||
cr.ACNUp = false
|
||||
cr.protocolEngine = false
|
||||
cr.stallRetries = true
|
||||
cr.connections.Range(func(k, v interface{}) bool {
|
||||
p := v.(*contact)
|
||||
if p.state == connections.AUTHENTICATED || p.state == connections.SYNCED {
|
||||
p.lastSeen = time.Now()
|
||||
}
|
||||
p.state = connections.DISCONNECTED
|
||||
p.failedCount = 0
|
||||
return true
|
||||
})
|
||||
case event.ProtocolEngineCreated:
|
||||
cr.protocolEngine = true
|
||||
cr.processStatus()
|
||||
|
||||
case event.ACNStatus:
|
||||
progData := e.Data[event.Progress]
|
||||
if prog, err := strconv.Atoi(progData); err == nil {
|
||||
cr.acnProgress = prog
|
||||
cr.processStatus()
|
||||
}
|
||||
}
|
||||
|
||||
case <-time.After(tickTime):
|
||||
continue
|
||||
|
||||
case <-cr.breakChan:
|
||||
cr.running = false
|
||||
return
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (cr *contactRetry) processStatus() {
|
||||
if !cr.protocolEngine {
|
||||
cr.ACNUp = false
|
||||
return
|
||||
}
|
||||
if cr.acnProgress == 100 && !cr.ACNUp {
|
||||
// ACN is up...at this point we need to completely reset our state
|
||||
// as there is no guarantee that the tor daemon shares our state anymore...
|
||||
cr.ACNUp = true
|
||||
cr.ACNUpTime = time.Now()
|
||||
|
||||
// reset all of the queues...
|
||||
cr.priorityQueue = newConnectionQueue()
|
||||
cr.pendingQueue = newConnectionQueue()
|
||||
|
||||
// Loop through connections. Reset state, and requeue...
|
||||
cr.connections.Range(func(k, v interface{}) bool {
|
||||
p := v.(*contact)
|
||||
|
||||
// only reload connections if they are on the authorized peers list
|
||||
if _, exists := cr.authorizedPeers.Load(p.id); exists {
|
||||
p.queued = true
|
||||
// prioritize connections made recently...
|
||||
log.Debugf("adding %v to queue", p.id)
|
||||
if time.Since(p.lastSeen).Hours() < PriorityQueueTimeSinceQualifierHours {
|
||||
cr.priorityQueue.insert(p)
|
||||
} else {
|
||||
cr.pendingQueue.insert(p)
|
||||
}
|
||||
}
|
||||
|
||||
return true
|
||||
})
|
||||
|
||||
} else if cr.acnProgress != 100 {
|
||||
cr.ACNUp = false
|
||||
cr.connections.Range(func(k, v interface{}) bool {
|
||||
p := v.(*contact)
|
||||
p.failedCount = 0
|
||||
p.queued = false
|
||||
p.state = connections.DISCONNECTED
|
||||
return true
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
func (cr *contactRetry) requeueReady() {
|
||||
if !cr.ACNUp {
|
||||
return
|
||||
}
|
||||
|
||||
var retryable []*contact
|
||||
|
||||
throughPutPerMin := int((float64(cr.maxTorCircuitsPending()) / float64(circuitTimeoutSecs)) * 60.0)
|
||||
queueCount := cr.priorityQueue.len() + cr.pendingQueue.len()
|
||||
// adjustedBaseTimeout = basetimeoust * (queuedItemsCount / throughPutPerMin)
|
||||
// when less items are queued than through put it'll lower adjustedBaseTimeOut, but that'll be reset in the next block
|
||||
// when more items are queued it will increase the timeout, to a max of MaxBaseTimeoutSec (enforced in the next block)
|
||||
adjustedBaseTimeout := circuitTimeoutSecs * (queueCount / throughPutPerMin)
|
||||
|
||||
// circuitTimeoutSecs (120s) < adjustedBaseTimeout < MaxBaseTimeoutSec (300s)
|
||||
if adjustedBaseTimeout < circuitTimeoutSecs {
|
||||
adjustedBaseTimeout = circuitTimeoutSecs
|
||||
} else if adjustedBaseTimeout > MaxBaseTimeoutSec {
|
||||
adjustedBaseTimeout = MaxBaseTimeoutSec
|
||||
}
|
||||
|
||||
cr.connections.Range(func(k, v interface{}) bool {
|
||||
p := v.(*contact)
|
||||
|
||||
// Don't retry anyone who isn't on the authorized peers list
|
||||
if _, exists := cr.authorizedPeers.Load(p.id); exists {
|
||||
if p.state == connections.DISCONNECTED && !p.queued {
|
||||
timeout := time.Duration((math.Pow(2, float64(p.failedCount)))*float64(adjustedBaseTimeout /*baseTimeoutSec*/)) * time.Second
|
||||
if time.Since(p.lastAttempt) > timeout {
|
||||
retryable = append(retryable, p)
|
||||
}
|
||||
}
|
||||
}
|
||||
return true
|
||||
})
|
||||
for _, contact := range retryable {
|
||||
if time.Since(contact.lastSeen).Hours() < PriorityQueueTimeSinceQualifierHours {
|
||||
cr.priorityQueue.insert(contact)
|
||||
} else {
|
||||
cr.pendingQueue.insert(contact)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (cr *contactRetry) publishConnectionRequest(contact *contact) {
|
||||
log.Debugf("RestartFlow Publish Connection Request listener %v", contact)
|
||||
if contact.ctype == peerConn {
|
||||
cr.bus.Publish(event.NewEvent(event.PeerRequest, map[event.Field]string{event.RemotePeer: contact.id}))
|
||||
}
|
||||
if contact.ctype == serverConn {
|
||||
cr.bus.Publish(event.NewEvent(event.RetryServerRequest, map[event.Field]string{event.GroupServer: contact.id}))
|
||||
}
|
||||
contact.state = connections.CONNECTING // Hacky but needed so we don't over flood waiting for PeerStateChange from engine
|
||||
contact.lastAttempt = time.Now()
|
||||
}
|
||||
|
||||
func (cr *contactRetry) addConnection(id string, state connections.ConnectionState, ctype connectionType, lastSeen time.Time) {
|
||||
// don't handle contact retries for ourselves
|
||||
if id == cr.onion {
|
||||
return
|
||||
}
|
||||
|
||||
if _, exists := cr.connections.Load(id); !exists {
|
||||
p := &contact{id: id, state: state, failedCount: 0, lastAttempt: event.CwtchEpoch, ctype: ctype, lastSeen: lastSeen, queued: false}
|
||||
cr.connections.Store(id, p)
|
||||
return
|
||||
} else {
|
||||
// we have rerequested this connnection, probably via an explicit ask, update it's state
|
||||
if c, ok := cr.connections.Load(id); ok {
|
||||
contact := c.(*contact)
|
||||
contact.state = state
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (cr *contactRetry) handleEvent(id string, state connections.ConnectionState, ctype connectionType) {
|
||||
log.Debugf("cr.handleEvent state to %v on id %v", connections.ConnectionStateName[state], id)
|
||||
|
||||
// don't handle contact retries for ourselves
|
||||
if id == cr.onion {
|
||||
return
|
||||
}
|
||||
|
||||
// reject events that contain invalid hostnames...we cannot connect to them
|
||||
// and they could result in spurious connection attempts...
|
||||
if !tor.IsValidHostname(id) {
|
||||
return
|
||||
}
|
||||
|
||||
if _, exists := cr.connections.Load(id); !exists {
|
||||
// We have an event for something we don't know about...
|
||||
// The only reason this should happen is if a *new* Peer/Server connection has changed.
|
||||
// Let's set the timeout to Now() to indicate that this is a fresh connection, and so should likely be prioritized.
|
||||
cr.addConnection(id, state, ctype, time.Now())
|
||||
return
|
||||
}
|
||||
|
||||
pinf, _ := cr.connections.Load(id)
|
||||
p := pinf.(*contact)
|
||||
log.Debugf(" managing state change for %v %v to %v by self %v", id, connections.ConnectionStateName[p.state], connections.ConnectionStateName[state], cr.onion)
|
||||
if state == connections.DISCONNECTED || state == connections.FAILED || state == connections.KILLED {
|
||||
if p.state == connections.SYNCED || p.state == connections.AUTHENTICATED {
|
||||
p.lastSeen = time.Now()
|
||||
} else {
|
||||
p.failedCount += 1
|
||||
}
|
||||
p.state = connections.DISCONNECTED
|
||||
p.lastAttempt = time.Now()
|
||||
if p.failedCount > maxFailedBackoff {
|
||||
p.failedCount = maxFailedBackoff
|
||||
}
|
||||
} else if state == connections.CONNECTING || state == connections.CONNECTED {
|
||||
p.state = state
|
||||
} else if state == connections.AUTHENTICATED || state == connections.SYNCED {
|
||||
p.state = state
|
||||
p.lastSeen = time.Now()
|
||||
p.failedCount = 0
|
||||
}
|
||||
}
|
||||
|
||||
func (cr *contactRetry) Shutdown() {
|
||||
cr.breakChan <- true
|
||||
cr.queue.Shutdown()
|
||||
}
|
|
@ -1,128 +0,0 @@
|
|||
package plugins
|
||||
|
||||
import (
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/protocol/connections"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
)
|
||||
|
||||
// TestContactRetryQueue simulates some basic connection queueing
|
||||
// NOTE: This whole test is a race condition, and does flag go's detector
|
||||
// We are invasively checking the internal state of the retry plugin and accessing pointers from another
|
||||
// thread.
|
||||
// We could build an entire thread safe monitoring functonality, but that would dramatically expand the scope of this test.
|
||||
|
||||
func TestContactRetryQueue(t *testing.T) {
|
||||
log.SetLevel(log.LevelDebug)
|
||||
bus := event.NewEventManager()
|
||||
cr := NewConnectionRetry(bus, "").(*contactRetry)
|
||||
cr.ACNUp = true // fake an ACN connection...
|
||||
cr.protocolEngine = true // fake protocol engine
|
||||
cr.stallRetries = false // fake not being in offline mode...
|
||||
go cr.run()
|
||||
|
||||
testOnion := "2wgvbza2mbuc72a4u6r6k4hc2blcvrmk4q26bfvlwbqxv2yq5k52fcqd"
|
||||
|
||||
t.Logf("contact plugin up and running..sending peer connection...")
|
||||
// Assert that there is a peer connection identified as "test"
|
||||
bus.Publish(event.NewEvent(event.QueuePeerRequest, map[event.Field]string{event.RemotePeer: testOnion, event.LastSeen: "test"}))
|
||||
|
||||
// Wait until the test actually exists, and is queued
|
||||
// This is the worst part of this test setup. Ideally we would sleep, or some other yielding, but
|
||||
// go test scheduling doesn't like that and even sleeping long periods won't cause the event thread to make
|
||||
// progress...
|
||||
setup := false
|
||||
for !setup {
|
||||
if _, exists := cr.connections.Load(testOnion); exists {
|
||||
if _, exists := cr.authorizedPeers.Load(testOnion); exists {
|
||||
t.Logf("authorized")
|
||||
setup = true
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// We should very quickly become connecting...
|
||||
time.Sleep(time.Second)
|
||||
pinf, _ := cr.connections.Load(testOnion)
|
||||
if pinf.(*contact).state != 1 {
|
||||
t.Fatalf("test connection should be in connecting after update, actually: %v", pinf.(*contact).state)
|
||||
}
|
||||
|
||||
// Asset that "test" is authenticated
|
||||
cr.handleEvent(testOnion, connections.AUTHENTICATED, peerConn)
|
||||
|
||||
// Assert that "test has a valid state"
|
||||
pinf, _ = cr.connections.Load(testOnion)
|
||||
if pinf.(*contact).state != 3 {
|
||||
t.Fatalf("test connection should be in authenticated after update, actually: %v", pinf.(*contact).state)
|
||||
}
|
||||
|
||||
// Publish an unrelated event to trigger the Plugin to go through a queuing cycle
|
||||
// If we didn't do this we would have to wait 30 seconds for a check-in
|
||||
bus.Publish(event.NewEvent(event.PeerStateChange, map[event.Field]string{event.RemotePeer: "test2", event.ConnectionState: "Disconnected"}))
|
||||
bus.Publish(event.NewEvent(event.QueuePeerRequest, map[event.Field]string{event.RemotePeer: testOnion, event.LastSeen: time.Now().Format(time.RFC3339Nano)}))
|
||||
|
||||
time.Sleep(time.Second)
|
||||
pinf, _ = cr.connections.Load(testOnion)
|
||||
if pinf.(*contact).state != 1 {
|
||||
t.Fatalf("test connection should be in connecting after update, actually: %v", pinf.(*contact).state)
|
||||
}
|
||||
|
||||
cr.Shutdown()
|
||||
}
|
||||
|
||||
// Takes around 4 min unless you adjust the consts for tickTimeSec and circuitTimeoutSecs
|
||||
/*
|
||||
func TestRetryEmission(t *testing.T) {
|
||||
log.SetLevel(log.LevelDebug)
|
||||
log.Infof("*** Starting TestRetryEmission! ***")
|
||||
bus := event.NewEventManager()
|
||||
|
||||
testQueue := event.NewQueue()
|
||||
bus.Subscribe(event.PeerRequest, testQueue)
|
||||
|
||||
cr := NewConnectionRetry(bus, "").(*contactRetry)
|
||||
cr.Start()
|
||||
time.Sleep(100 * time.Millisecond)
|
||||
|
||||
bus.Publish(event.NewEventList(event.ACNStatus, event.Progress, "100"))
|
||||
bus.Publish(event.NewEventList(event.ProtocolEngineCreated))
|
||||
|
||||
pub, _, _ := ed25519.GenerateKey(rand.Reader)
|
||||
peerAddr := tor.GetTorV3Hostname(pub)
|
||||
|
||||
bus.Publish(event.NewEventList(event.QueuePeerRequest, event.RemotePeer, peerAddr, event.LastSeen, time.Now().Format(time.RFC3339Nano)))
|
||||
|
||||
log.Infof("Fetching 1st event")
|
||||
ev := testQueue.Next()
|
||||
if ev.EventType != event.PeerRequest {
|
||||
t.Errorf("1st event emitted was %v, expected %v", ev.EventType, event.PeerRequest)
|
||||
}
|
||||
log.Infof("1st event: %v", ev)
|
||||
|
||||
bus.Publish(event.NewEventList(event.PeerStateChange, event.RemotePeer, peerAddr, event.ConnectionState, connections.ConnectionStateName[connections.DISCONNECTED]))
|
||||
|
||||
log.Infof("fetching 2nd event")
|
||||
ev = testQueue.Next()
|
||||
log.Infof("2nd event: %v", ev)
|
||||
if ev.EventType != event.PeerRequest {
|
||||
t.Errorf("2nd event emitted was %v, expected %v", ev.EventType, event.PeerRequest)
|
||||
}
|
||||
|
||||
bus.Publish(event.NewEventList(event.PeerStateChange, event.RemotePeer, peerAddr, event.ConnectionState, connections.ConnectionStateName[connections.CONNECTED]))
|
||||
time.Sleep(100 * time.Millisecond)
|
||||
bus.Publish(event.NewEventList(event.PeerStateChange, event.RemotePeer, peerAddr, event.ConnectionState, connections.ConnectionStateName[connections.DISCONNECTED]))
|
||||
|
||||
log.Infof("fetching 3rd event")
|
||||
ev = testQueue.Next()
|
||||
log.Infof("3nd event: %v", ev)
|
||||
if ev.EventType != event.PeerRequest {
|
||||
t.Errorf("3nd event emitted was %v, expected %v", ev.EventType, event.PeerRequest)
|
||||
}
|
||||
|
||||
cr.Shutdown()
|
||||
}
|
||||
*/
|
|
@ -1,49 +0,0 @@
|
|||
package plugins
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"time"
|
||||
)
|
||||
|
||||
const heartbeatTickTime = 60 * time.Second
|
||||
|
||||
type heartbeat struct {
|
||||
bus event.Manager
|
||||
queue event.Queue
|
||||
breakChan chan bool
|
||||
}
|
||||
|
||||
func (hb *heartbeat) Start() {
|
||||
go hb.run()
|
||||
}
|
||||
|
||||
func (hb *heartbeat) Id() PluginID {
|
||||
return HEARTBEAT
|
||||
}
|
||||
|
||||
func (hb *heartbeat) Shutdown() {
|
||||
hb.breakChan <- true
|
||||
hb.queue.Shutdown()
|
||||
}
|
||||
|
||||
func (hb *heartbeat) run() {
|
||||
log.Debugf("running heartbeat trigger plugin")
|
||||
for {
|
||||
select {
|
||||
case <-time.After(heartbeatTickTime):
|
||||
// no fuss, just trigger the beat.
|
||||
hb.bus.Publish(event.NewEvent(event.Heartbeat, map[event.Field]string{}))
|
||||
continue
|
||||
case <-hb.breakChan:
|
||||
log.Debugf("shutting down heartbeat plugin")
|
||||
return
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// NewHeartbeat returns a Plugin that when started will trigger heartbeat checks on a regular interval
|
||||
func NewHeartbeat(bus event.Manager) Plugin {
|
||||
cr := &heartbeat{bus: bus, queue: event.NewQueue(), breakChan: make(chan bool, 1)}
|
||||
return cr
|
||||
}
|
|
@ -1,156 +0,0 @@
|
|||
package plugins
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/protocol/connections"
|
||||
"cwtch.im/cwtch/utils"
|
||||
"git.openprivacy.ca/openprivacy/connectivity"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"sync"
|
||||
"time"
|
||||
)
|
||||
|
||||
// NetworkCheckError is a status for when the NetworkCheck Plugin has had an error making an out going connection indicating it may be offline
|
||||
const NetworkCheckError = "Error"
|
||||
|
||||
// NetworkCheckSuccess is a status for when the NetworkCheck Plugin has had a successful message from a peer, indicating it is online right now
|
||||
const NetworkCheckSuccess = "Success"
|
||||
|
||||
const NetworkCheckPeriod = time.Minute
|
||||
|
||||
// networkCheck is a convenience plugin for testing high level availability of onion services
|
||||
type networkCheck struct {
|
||||
bus event.Manager
|
||||
queue event.Queue
|
||||
onion string
|
||||
acn connectivity.ACN
|
||||
breakChan chan bool
|
||||
running bool
|
||||
offline bool
|
||||
offlineLock sync.Mutex
|
||||
}
|
||||
|
||||
// NewNetworkCheck returns a Plugin that when started will attempt various network tests
|
||||
func NewNetworkCheck(onion string, bus event.Manager, acn connectivity.ACN) Plugin {
|
||||
nc := &networkCheck{onion: onion, bus: bus, acn: acn, queue: event.NewQueue(), breakChan: make(chan bool, 1)}
|
||||
return nc
|
||||
}
|
||||
|
||||
func (nc *networkCheck) Start() {
|
||||
go nc.run()
|
||||
}
|
||||
|
||||
func (nc *networkCheck) Id() PluginID {
|
||||
return NETWORKCHECK
|
||||
}
|
||||
|
||||
func (nc *networkCheck) run() {
|
||||
nc.running = true
|
||||
nc.offline = true
|
||||
nc.bus.Subscribe(event.ProtocolEngineStartListen, nc.queue)
|
||||
nc.bus.Subscribe(event.NewMessageFromPeer, nc.queue)
|
||||
nc.bus.Subscribe(event.PeerAcknowledgement, nc.queue)
|
||||
nc.bus.Subscribe(event.EncryptedGroupMessage, nc.queue)
|
||||
nc.bus.Subscribe(event.PeerStateChange, nc.queue)
|
||||
nc.bus.Subscribe(event.ServerStateChange, nc.queue)
|
||||
nc.bus.Subscribe(event.NewGetValMessageFromPeer, nc.queue)
|
||||
nc.bus.Subscribe(event.NewRetValMessageFromPeer, nc.queue)
|
||||
var lastMessageReceived = time.Now()
|
||||
for {
|
||||
select {
|
||||
case <-nc.breakChan:
|
||||
nc.running = false
|
||||
return
|
||||
case e := <-nc.queue.OutChan():
|
||||
switch e.EventType {
|
||||
// On receipt of a Listen request for an onion service we will add the onion to our list
|
||||
// and then we will wait a minute and check the connection for the first time (the onion should be up)
|
||||
// under normal operating circumstances
|
||||
case event.ProtocolEngineStartListen:
|
||||
if nc.onion == (e.Data[event.Onion]) {
|
||||
log.Debugf("initiating connection check for %v", e.Data[event.Onion])
|
||||
if time.Since(lastMessageReceived) > time.Minute {
|
||||
nc.selfTest()
|
||||
}
|
||||
} else {
|
||||
log.Errorf("network check plugin received an event for a different profile than it was started with. Internal wiring is probably wrong.")
|
||||
}
|
||||
case event.PeerStateChange:
|
||||
fallthrough
|
||||
case event.ServerStateChange:
|
||||
// if we successfully connect / authenticated to a remote server / peer then we obviously have internet
|
||||
connectionState := e.Data[event.ConnectionState]
|
||||
nc.offlineLock.Lock()
|
||||
if connectionState == connections.ConnectionStateName[connections.AUTHENTICATED] || connectionState == connections.ConnectionStateName[connections.CONNECTED] {
|
||||
lastMessageReceived = time.Now()
|
||||
|
||||
if nc.offline {
|
||||
nc.bus.Publish(event.NewEvent(event.NetworkStatus, map[event.Field]string{event.Error: "", event.Status: NetworkCheckSuccess}))
|
||||
nc.offline = false
|
||||
}
|
||||
}
|
||||
nc.offlineLock.Unlock()
|
||||
default:
|
||||
// if we receive either an encrypted group message or a peer acknowledgement we can assume the network
|
||||
// is up and running (our onion service might still not be available, but we would aim to detect that
|
||||
// through other actions
|
||||
// we reset out timer
|
||||
lastMessageReceived = time.Now()
|
||||
nc.offlineLock.Lock()
|
||||
if nc.offline {
|
||||
nc.bus.Publish(event.NewEvent(event.NetworkStatus, map[event.Field]string{event.Error: "", event.Status: NetworkCheckSuccess}))
|
||||
nc.offline = false
|
||||
}
|
||||
nc.offlineLock.Unlock()
|
||||
}
|
||||
case <-time.After(NetworkCheckPeriod):
|
||||
// if we haven't received an action in the last minute...kick off a set of testing
|
||||
if time.Since(lastMessageReceived) > time.Minute {
|
||||
nc.selfTest()
|
||||
lastMessageReceived = time.Now()
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (nc *networkCheck) Shutdown() {
|
||||
if nc.running {
|
||||
nc.queue.Shutdown()
|
||||
log.Debugf("shutting down network status plugin")
|
||||
nc.breakChan <- true
|
||||
}
|
||||
}
|
||||
|
||||
func (nc *networkCheck) selfTest() {
|
||||
go nc.checkConnection(nc.onion)
|
||||
}
|
||||
|
||||
func (nc *networkCheck) checkConnection(onion string) {
|
||||
progress, _ := nc.acn.GetBootstrapStatus()
|
||||
if progress != 100 {
|
||||
return
|
||||
}
|
||||
|
||||
// we want to definitively time these actions out faster than tor will, because these onions should definitely be
|
||||
// online
|
||||
ClientTimeout := utils.TimeoutPolicy(time.Second * 60)
|
||||
err := ClientTimeout.ExecuteAction(func() error {
|
||||
conn, _, err := nc.acn.Open(onion)
|
||||
if err == nil {
|
||||
_ = conn.Close()
|
||||
}
|
||||
return err
|
||||
})
|
||||
nc.offlineLock.Lock()
|
||||
defer nc.offlineLock.Unlock()
|
||||
// regardless of the outcome we want to report a status to let anyone who might care know that we did do a check
|
||||
if err != nil {
|
||||
log.Debugf("publishing network error for %v -- %v\n", onion, err)
|
||||
nc.bus.Publish(event.NewEvent(event.NetworkStatus, map[event.Field]string{event.Onion: onion, event.Error: err.Error(), event.Status: NetworkCheckError}))
|
||||
nc.offline = true
|
||||
} else {
|
||||
log.Debugf("publishing network success for %v", onion)
|
||||
nc.bus.Publish(event.NewEvent(event.NetworkStatus, map[event.Field]string{event.Onion: onion, event.Error: "", event.Status: NetworkCheckSuccess}))
|
||||
nc.offline = false
|
||||
}
|
||||
}
|
|
@ -1,41 +0,0 @@
|
|||
package plugins
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/openprivacy/connectivity"
|
||||
)
|
||||
|
||||
// PluginID is used as an ID for signaling plugin activities
|
||||
type PluginID int
|
||||
|
||||
// These are the plugin IDs for the supplied plugins
|
||||
const (
|
||||
CONNECTIONRETRY PluginID = iota
|
||||
NETWORKCHECK
|
||||
ANTISPAM
|
||||
HEARTBEAT
|
||||
)
|
||||
|
||||
// Plugin is the interface for a plugin
|
||||
type Plugin interface {
|
||||
Start()
|
||||
Shutdown()
|
||||
Id() PluginID
|
||||
}
|
||||
|
||||
// Get is a plugin factory for the requested plugin
|
||||
func Get(id PluginID, bus event.Manager, acn connectivity.ACN, onion string) (Plugin, error) {
|
||||
switch id {
|
||||
case CONNECTIONRETRY:
|
||||
return NewConnectionRetry(bus, onion), nil
|
||||
case NETWORKCHECK:
|
||||
return NewNetworkCheck(onion, bus, acn), nil
|
||||
case ANTISPAM:
|
||||
return NewAntiSpam(bus), nil
|
||||
case HEARTBEAT:
|
||||
return NewHeartbeat(bus), nil
|
||||
}
|
||||
|
||||
return nil, fmt.Errorf("plugin not defined %v", id)
|
||||
}
|
28
app/utils.go
28
app/utils.go
|
@ -1,28 +0,0 @@
|
|||
package app
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/model/attr"
|
||||
"cwtch.im/cwtch/model/constants"
|
||||
"cwtch.im/cwtch/peer"
|
||||
"time"
|
||||
)
|
||||
|
||||
// WaitGetPeer is a helper function for utility apps not written using the event bus
|
||||
// Proper use of an App is to call CreatePeer and then process the NewPeer event
|
||||
// however for small utility use, this function which polls the app until the peer is created
|
||||
// may fill that usecase better
|
||||
func WaitGetPeer(app Application, name string) peer.CwtchPeer {
|
||||
for {
|
||||
for _, handle := range app.ListProfiles() {
|
||||
peer := app.GetPeer(handle)
|
||||
if peer == nil {
|
||||
continue
|
||||
}
|
||||
localName, _ := peer.GetScopedZonedAttribute(attr.PublicScope, attr.ProfileZone, constants.Name)
|
||||
if localName == name {
|
||||
return peer
|
||||
}
|
||||
}
|
||||
time.Sleep(100 * time.Millisecond)
|
||||
}
|
||||
}
|
364
event/common.go
364
event/common.go
|
@ -1,364 +0,0 @@
|
|||
package event
|
||||
|
||||
import "time"
|
||||
|
||||
var CwtchEpoch = time.Date(2020, 6, 1, 0, 0, 0, 0, time.UTC)
|
||||
|
||||
// Type captures the definition of many common Cwtch application events
|
||||
type Type string
|
||||
|
||||
// Defining Common Event Types
|
||||
const (
|
||||
StatusRequest = Type("StatusRequest")
|
||||
ProtocolEngineStatus = Type("ProtocolEngineStatus")
|
||||
|
||||
// Attempt to outbound peer with a given remote peer
|
||||
// attributes:
|
||||
// RemotePeer: [eg "chpr7qm6op5vfcg2pi4vllco3h6aa7exexc4rqwnlupqhoogx2zgd6qd"
|
||||
PeerRequest = Type("PeerRequest")
|
||||
|
||||
// QueuePeerRequest
|
||||
// When peer has too many peers to try and wants to ease off Tor throttling, use this to notify ContactRetry plugin to schedule a peer for later try
|
||||
// LastSeen: last seen time of the contact
|
||||
// And one of
|
||||
// RemotePeer
|
||||
// GroupServer
|
||||
QueuePeerRequest = Type("QueuePeerRequest")
|
||||
|
||||
// Disconnect*Request
|
||||
// Close active connections and prevent new connections
|
||||
DisconnectPeerRequest = Type("DisconnectPeerRequest")
|
||||
DisconnectServerRequest = Type("DisconnectServerRequest")
|
||||
|
||||
// Events to Manage Retry Contacts
|
||||
PurgeRetries = Type("PurgeRetries")
|
||||
ResumeRetries = Type("ResumeRetries")
|
||||
|
||||
// RetryServerRequest
|
||||
// Asks CwtchPeer to retry a server connection...
|
||||
// GroupServer: [eg "chpr7qm6op5vfcg2pi4vllco3h6aa7exexc4rqwnlupqhoogx2zgd6qd"
|
||||
RetryServerRequest = Type("RetryServerRequest")
|
||||
|
||||
// RemotePeer
|
||||
// ConversationID
|
||||
// Accepted
|
||||
// Blocked
|
||||
UpdateConversationAuthorization = Type("UpdateConversationAuthorization")
|
||||
|
||||
// Turn on/off blocking of unknown peers (if peers aren't in the contact list then they will be autoblocked
|
||||
BlockUnknownPeers = Type("BlockUnknownPeers")
|
||||
AllowUnknownPeers = Type("AllowUnknownPeers")
|
||||
|
||||
// GroupServer
|
||||
QueueJoinServer = Type("QueueJoinServer")
|
||||
JoinServer = Type("JoinServer")
|
||||
|
||||
// attributes GroupServer - the onion of the server to leave
|
||||
LeaveServer = Type("LeaveServer")
|
||||
|
||||
ProtocolEngineCreated = Type("ProtocolEngineCreated")
|
||||
ProtocolEngineShutdown = Type("ProtocolEngineShutdown")
|
||||
ProtocolEngineStartListen = Type("ProtocolEngineStartListen")
|
||||
ProtocolEngineStopped = Type("ProtocolEngineStopped")
|
||||
|
||||
InvitePeerToGroup = Type("InvitePeerToGroup")
|
||||
|
||||
// a group invite has been received from a remote peer
|
||||
// attributes:
|
||||
// TimestampReceived [eg time.Now().Format(time.RFC3339Nano)]
|
||||
// RemotePeer: [eg "chpr7qm6op5vfcg2pi4vllco3h6aa7exexc4rqwnlupqhoogx2zgd6qd"]
|
||||
// GroupInvite: [eg "torv3....."]
|
||||
// Imported
|
||||
NewGroupInvite = Type("NewGroupInvite")
|
||||
|
||||
// Inform the UI about a new group
|
||||
// GroupID: groupID (allows them to fetch from the peer)
|
||||
NewGroup = Type("NewGroup")
|
||||
|
||||
SendMessageToGroup = Type("SendMessagetoGroup")
|
||||
|
||||
//Ciphertext, Signature:
|
||||
EncryptedGroupMessage = Type("EncryptedGroupMessage")
|
||||
//TimestampReceived, TimestampSent, Data(Message), GroupID, Signature, PreviousSignature, RemotePeer
|
||||
NewMessageFromGroup = Type("NewMessageFromGroup")
|
||||
|
||||
// Sent if a Group Key is detected as being used outside of expected parameters (e.g. with tampered signatures)
|
||||
// GroupID: The ID of the Group that is presumed compromised
|
||||
GroupCompromised = Type("GroupCompromised")
|
||||
|
||||
// an error was encountered trying to send a particular Message to a group
|
||||
// attributes:
|
||||
// GroupServer: The server the Message was sent to
|
||||
// Signature: The signature of the Message that failed to send
|
||||
// Error: string describing the error
|
||||
SendMessageToGroupError = Type("SendMessageToGroupError")
|
||||
|
||||
SendMessageToPeer = Type("SendMessageToPeer")
|
||||
NewMessageFromPeer = Type("NewMessageFromPeer")
|
||||
NewMessageFromPeerEngine = Type("NewMessageFromPeerEngine")
|
||||
|
||||
// RemotePeer, scope, path
|
||||
NewGetValMessageFromPeer = Type("NewGetValMessageFromPeer")
|
||||
|
||||
// RemotePeer, val, exists
|
||||
SendRetValMessageToPeer = Type("SendRetValMessageToPeer")
|
||||
|
||||
// RemotePeer, scope, val
|
||||
SendGetValMessageToPeer = Type("SendGetValMessageToPeer")
|
||||
|
||||
// RemotePeer, scope, path, data, exists
|
||||
NewRetValMessageFromPeer = Type("NewRetValMessageFromPeer")
|
||||
|
||||
// Peer acknowledges a previously sent message
|
||||
// attributes
|
||||
// EventID: The original event id that the peer is responding too.
|
||||
// RemotePeer: The peer associated with the acknowledgement
|
||||
PeerAcknowledgement = Type("PeerAcknowledgement")
|
||||
|
||||
// Like PeerAcknowledgement but with message index instead of event ID
|
||||
// attributes
|
||||
// Index: The original index of the message that the peer is responding too.
|
||||
// RemotePeer: The peer associated with the acknowledgement
|
||||
IndexedAcknowledgement = Type("IndexedAcknowledgement")
|
||||
|
||||
// Like PeerAcknowledgement but with message index instead of event ID
|
||||
// attributes
|
||||
// Index: The original index of the message that the peer is responding too.
|
||||
// RemotePeer: The peer associated with the acknowledgement
|
||||
IndexedFailure = Type("IndexedFailure")
|
||||
|
||||
// attributes:
|
||||
// RemotePeer: [eg "chpr7qm6op5vfcg2pi4vllco3h6aa7exexc4rqwnlupqhoogx2zgd6qd"]
|
||||
// Error: string describing the error
|
||||
SendMessageToPeerError = Type("SendMessageToPeerError")
|
||||
|
||||
// REQUESTS TO STORAGE ENGINE
|
||||
|
||||
// a peer contact has been added
|
||||
// attributes:
|
||||
// RemotePeer [eg ""]
|
||||
ContactCreated = Type("ContactCreated")
|
||||
|
||||
// Password, NewPassword
|
||||
ChangePassword = Type("ChangePassword")
|
||||
|
||||
// a group has been successfully added or newly created
|
||||
// attributes:
|
||||
// Data [serialized *model.Group]
|
||||
GroupCreated = Type("GroupCreated")
|
||||
|
||||
// RemotePeer
|
||||
DeleteContact = Type("DeleteContact")
|
||||
|
||||
// PeerStateChange servers as a new incoming connection message as well, and can/is consumed by frontends to alert of new p2p connections
|
||||
// RemotePeer
|
||||
// ConnectionState
|
||||
PeerStateChange = Type("PeerStateChange")
|
||||
|
||||
// GroupServer
|
||||
// ConnectionState
|
||||
ServerStateChange = Type("ServerStateChange")
|
||||
|
||||
/***** Application client / service messages *****/
|
||||
|
||||
// app: Identity(onion), Created(bool)
|
||||
// service -> client: Identity(localId), Password, [Status(new/default=blank || from reload='running')], Created(bool)
|
||||
NewPeer = Type("NewPeer")
|
||||
|
||||
// Identity(onion)
|
||||
DeletePeer = Type("DeletePeer")
|
||||
// Identity(onion)
|
||||
PeerDeleted = Type("PeerDeleted")
|
||||
|
||||
// Identity(onion)
|
||||
ShutdownPeer = Type("ShutdownPeer")
|
||||
|
||||
Shutdown = Type("Shutdown")
|
||||
|
||||
// Error(err)
|
||||
// Error creating peer
|
||||
PeerError = Type("PeerError")
|
||||
|
||||
// Error(err)
|
||||
AppError = Type("AppError")
|
||||
|
||||
// Progress, Status
|
||||
ACNStatus = Type("ACNStatus")
|
||||
|
||||
// ID, Key, Data
|
||||
ACNInfo = Type("ACNInfo")
|
||||
|
||||
// Data
|
||||
ACNVersion = Type("ACNVersion")
|
||||
|
||||
// Network Status
|
||||
// Status: Success || Error
|
||||
// Error: Description of the Error
|
||||
// Onion: the local onion we attempt to check
|
||||
NetworkStatus = Type("NetworkError")
|
||||
|
||||
// For debugging. Allows test to emit a Syn and get a response Ack(eventID) when the subsystem is done processing a queue
|
||||
Syn = Type("Syn")
|
||||
Ack = Type("Ack")
|
||||
|
||||
// File Handling Events
|
||||
StopFileShare = Type("StopFileShare")
|
||||
StopAllFileShares = Type("StopAllFileShares")
|
||||
ShareManifest = Type("ShareManifest")
|
||||
ManifestSizeReceived = Type("ManifestSizeReceived")
|
||||
ManifestError = Type("ManifestError")
|
||||
ManifestReceived = Type("ManifestReceived")
|
||||
ManifestSaved = Type("ManifestSaved")
|
||||
FileDownloadProgressUpdate = Type("FileDownloadProgressUpdate")
|
||||
FileDownloaded = Type("FileDownloaded")
|
||||
FileVerificationFailed = Type("FileVerificationFailed")
|
||||
|
||||
// Profile Attribute Event
|
||||
UpdatedProfileAttribute = Type("UpdatedProfileAttribute")
|
||||
// Conversation Attribute Update...
|
||||
UpdatedConversationAttribute = Type("UpdatedConversationAttribute")
|
||||
StartingStorageMiragtion = Type("StartingStorageMigration")
|
||||
DoneStorageMigration = Type("DoneStorageMigration")
|
||||
|
||||
TokenManagerInfo = Type("TokenManagerInfo")
|
||||
TriggerAntispamCheck = Type("TriggerAntispamCheck")
|
||||
MakeAntispamPayment = Type("MakeAntispamPayment")
|
||||
|
||||
// Heartbeat is used to trigger actions that need to happen every so often...
|
||||
Heartbeat = Type("Heartbeat")
|
||||
|
||||
// Conversation Search
|
||||
SearchResult = Type("SearchResult")
|
||||
SearchCancelled = Type("SearchCancelled")
|
||||
)
|
||||
|
||||
// Field defines common event attributes
|
||||
type Field string
|
||||
|
||||
// Defining Common Field Types
|
||||
const (
|
||||
|
||||
// A peers local onion address
|
||||
Onion = Field("Onion")
|
||||
ProfileOnion = Field("ProfileOnion")
|
||||
|
||||
RemotePeer = Field("RemotePeer")
|
||||
LastSeen = Field("LastSeen")
|
||||
Ciphertext = Field("Ciphertext")
|
||||
Signature = Field("Signature")
|
||||
CachedTokens = Field("CachedTokens")
|
||||
PreviousSignature = Field("PreviousSignature")
|
||||
TimestampSent = Field("TimestampSent")
|
||||
TimestampReceived = Field("TimestampReceived")
|
||||
|
||||
Identity = Field("Identity")
|
||||
|
||||
ConversationID = Field("ConversationID")
|
||||
GroupID = Field("GroupID")
|
||||
GroupServer = Field("GroupServer")
|
||||
GroupName = Field("GroupName")
|
||||
ServerTokenY = Field("ServerTokenY")
|
||||
ServerTokenOnion = Field("ServerTokenOnion")
|
||||
GroupInvite = Field("GroupInvite")
|
||||
ServerTokenCount = Field("ServerTokenCount")
|
||||
|
||||
ProfileName = Field("ProfileName")
|
||||
Password = Field("Password")
|
||||
NewPassword = Field("NewPassword")
|
||||
|
||||
Created = Field("Created")
|
||||
|
||||
ConnectionState = Field("ConnectionState")
|
||||
|
||||
Key = Field("Key")
|
||||
Data = Field("Data")
|
||||
Scope = Field("Scope")
|
||||
Path = Field("Path")
|
||||
Exists = Field("Exists")
|
||||
|
||||
Salt = Field("Salt")
|
||||
|
||||
Error = Field("Error")
|
||||
|
||||
Progress = Field("Progress")
|
||||
Status = Field("Status")
|
||||
EventID = Field("EventID")
|
||||
EventContext = Field("EventContext")
|
||||
Index = Field("Index")
|
||||
RowIndex = Field("RowIndex")
|
||||
ContentHash = Field("ContentHash")
|
||||
|
||||
// Handle denotes a contact handle of any type.
|
||||
Handle = Field("Handle")
|
||||
|
||||
// Flags denotes a set of message flags
|
||||
Flags = Field("Flags")
|
||||
|
||||
Accepted = Field("Accepted")
|
||||
Blocked = Field("Blocked")
|
||||
|
||||
KeyBundle = Field("KeyBundle")
|
||||
|
||||
// Indicate whether an event was triggered by a user import
|
||||
Imported = Field("Imported")
|
||||
|
||||
Source = Field("Source")
|
||||
|
||||
FileKey = Field("FileKey")
|
||||
FileSizeInChunks = Field("FileSizeInChunks")
|
||||
ManifestSize = Field("ManifestSize")
|
||||
SerializedManifest = Field("SerializedManifest")
|
||||
TempFile = Field("TempFile")
|
||||
FilePath = Field("FilePath")
|
||||
FileDownloadFinished = Field("FileDownloadFinished")
|
||||
NameSuggestion = Field("NameSuggestion")
|
||||
|
||||
SearchID = Field("SearchID")
|
||||
)
|
||||
|
||||
// Defining Common errors
|
||||
const (
|
||||
AppErrLoaded0 = "Loaded 0 profiles"
|
||||
PasswordMatchError = "Password did not match"
|
||||
)
|
||||
|
||||
// Defining Protocol Contexts
|
||||
const (
|
||||
ContextAck = "im.cwtch.acknowledgement"
|
||||
ContextInvite = "im.cwtch.invite"
|
||||
ContextRaw = "im.cwtch.raw"
|
||||
ContextGetVal = "im.cwtch.getVal"
|
||||
ContextVersion = "im.cwtch.version"
|
||||
ContextRetVal = "im.cwtch.retVal"
|
||||
ContextRequestManifest = "im.cwtch.file.request.manifest"
|
||||
ContextSendManifest = "im.cwtch.file.send.manifest"
|
||||
ContextRequestFile = "im.cwtch.file.request.chunk"
|
||||
ContextSendFile = "im.cwtch.file.send.chunk"
|
||||
)
|
||||
|
||||
// Define Attribute Keys related to history preservation
|
||||
const (
|
||||
PreserveHistoryDefaultSettingKey = "SaveHistoryDefault" // profile level default
|
||||
SaveHistoryKey = "SavePeerHistory" // peer level setting
|
||||
)
|
||||
|
||||
// Define Default Attribute Values
|
||||
const (
|
||||
// Save History has 3 distinct states. By default we refer to the profile level
|
||||
// attribute PreserveHistoryDefaultSettingKey ( default: false i.e. DefaultDeleteHistory),
|
||||
// For each contact, if the profile owner confirms deletion we change to DeleteHistoryConfirmed,
|
||||
// if the profile owner confirms they want to save history then this becomes SaveHistoryConfirmed
|
||||
// These settings are set at the UI level using Get/SetScopeZoneAttribute with scoped zone: local.profile.*
|
||||
SaveHistoryConfirmed = "SaveHistory"
|
||||
DeleteHistoryConfirmed = "DeleteHistoryConfirmed"
|
||||
|
||||
// NOTE: While this says "[DeleteHistory]Default", The actual behaviour will now depend on the
|
||||
// global app/profile value of PreserveHistoryDefaultSettingKey
|
||||
DeleteHistoryDefault = "DefaultDeleteHistory"
|
||||
)
|
||||
|
||||
// Bool strings
|
||||
const (
|
||||
True = "true"
|
||||
False = "false"
|
||||
)
|
|
@ -1,65 +0,0 @@
|
|||
package event
|
||||
|
||||
import (
|
||||
"sync"
|
||||
)
|
||||
|
||||
type queue struct {
|
||||
infChan infiniteChannel
|
||||
lock sync.Mutex
|
||||
closed bool
|
||||
}
|
||||
|
||||
// Queue is a wrapper around a channel for handling Events in a consistent way across subsystems.
|
||||
// The expectation is that each subsystem in Cwtch will manage a given an event.Queue fed from
|
||||
// the event.Manager.
|
||||
type Queue interface {
|
||||
Publish(event Event)
|
||||
Next() Event
|
||||
Shutdown()
|
||||
OutChan() <-chan Event
|
||||
Len() int
|
||||
}
|
||||
|
||||
// NewQueue initializes an event.Queue
|
||||
func NewQueue() Queue {
|
||||
queue := &queue{infChan: *newInfiniteChannel()}
|
||||
return queue
|
||||
}
|
||||
|
||||
func (iq *queue) inChan() chan<- Event {
|
||||
return iq.infChan.In()
|
||||
}
|
||||
|
||||
func (iq *queue) OutChan() <-chan Event {
|
||||
return iq.infChan.Out()
|
||||
}
|
||||
|
||||
// Next returns the next available event from the front of the queue
|
||||
func (iq *queue) Next() Event {
|
||||
event := <-iq.infChan.Out()
|
||||
return event
|
||||
}
|
||||
|
||||
func (iq *queue) Len() int {
|
||||
return iq.infChan.Len()
|
||||
}
|
||||
|
||||
// Shutdown closes our eventChannel
|
||||
func (iq *queue) Shutdown() {
|
||||
iq.lock.Lock()
|
||||
if !iq.closed {
|
||||
iq.closed = true
|
||||
iq.infChan.Close()
|
||||
}
|
||||
iq.lock.Unlock()
|
||||
|
||||
}
|
||||
|
||||
func (iq *queue) Publish(event Event) {
|
||||
iq.lock.Lock()
|
||||
if !iq.closed {
|
||||
iq.inChan() <- event
|
||||
}
|
||||
iq.lock.Unlock()
|
||||
}
|
|
@ -1,183 +0,0 @@
|
|||
package event
|
||||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"math"
|
||||
"math/big"
|
||||
"os"
|
||||
"runtime"
|
||||
"strings"
|
||||
"sync"
|
||||
)
|
||||
|
||||
// Event is the core struct type passed around between various subsystems. Events consist of a type which can be
|
||||
// filtered on, an event ID for tracing and a map of Fields to string values.
|
||||
type Event struct {
|
||||
EventType Type
|
||||
EventID string
|
||||
Data map[Field]string
|
||||
}
|
||||
|
||||
// GetRandNumber is a helper function which returns a random integer, this is
|
||||
// currently mostly used to generate message IDs
|
||||
func GetRandNumber() *big.Int {
|
||||
num, err := rand.Int(rand.Reader, big.NewInt(math.MaxUint32))
|
||||
// If we can't generate random numbers then panicking is probably
|
||||
// the best option.
|
||||
if err != nil {
|
||||
panic(err.Error())
|
||||
}
|
||||
return num
|
||||
}
|
||||
|
||||
// NewEvent creates a new event object with a unique ID and the given type and data.
|
||||
func NewEvent(eventType Type, data map[Field]string) Event {
|
||||
return Event{EventType: eventType, EventID: GetRandNumber().String(), Data: data}
|
||||
}
|
||||
|
||||
// NewEventList creates a new event object with a unique ID and the given type and data supplied in a list format and composed into a map of Type:string
|
||||
func NewEventList(eventType Type, args ...interface{}) Event {
|
||||
data := map[Field]string{}
|
||||
for i := 0; i < len(args); i += 2 {
|
||||
key, kok := args[i].(Field)
|
||||
val, vok := args[i+1].(string)
|
||||
if kok && vok {
|
||||
data[key] = val
|
||||
} else {
|
||||
log.Errorf("attempted to send a field that could not be parsed to a string: %v %v", args[i], args[i+1])
|
||||
}
|
||||
}
|
||||
return Event{EventType: eventType, EventID: GetRandNumber().String(), Data: data}
|
||||
}
|
||||
|
||||
// Manager is an Event Bus which allows subsystems to subscribe to certain EventTypes and publish others.
|
||||
type manager struct {
|
||||
subscribers map[Type][]Queue
|
||||
events chan []byte
|
||||
mapMutex sync.Mutex
|
||||
chanMutex sync.Mutex
|
||||
internal chan bool
|
||||
closed bool
|
||||
trace bool
|
||||
}
|
||||
|
||||
// Manager is an interface for an event bus
|
||||
type Manager interface {
|
||||
Subscribe(Type, Queue)
|
||||
Publish(Event)
|
||||
Shutdown()
|
||||
}
|
||||
|
||||
// NewEventManager returns an initialized EventManager
|
||||
func NewEventManager() Manager {
|
||||
em := &manager{}
|
||||
em.initialize()
|
||||
return em
|
||||
}
|
||||
|
||||
// Initialize sets up the Manager.
|
||||
func (em *manager) initialize() {
|
||||
em.subscribers = make(map[Type][]Queue)
|
||||
em.events = make(chan []byte)
|
||||
em.internal = make(chan bool)
|
||||
em.closed = false
|
||||
|
||||
_, em.trace = os.LookupEnv("CWTCH_EVENT_SOURCE")
|
||||
|
||||
go em.eventBus()
|
||||
}
|
||||
|
||||
// Subscribe takes an eventType and an Channel and associates them in the eventBus. All future events of that type
|
||||
// will be sent to the eventChannel.
|
||||
func (em *manager) Subscribe(eventType Type, queue Queue) {
|
||||
em.mapMutex.Lock()
|
||||
defer em.mapMutex.Unlock()
|
||||
for _, sub := range em.subscribers[eventType] {
|
||||
if sub == queue {
|
||||
return // don't add the same queue for the same event twice...
|
||||
}
|
||||
}
|
||||
em.subscribers[eventType] = append(em.subscribers[eventType], queue)
|
||||
}
|
||||
|
||||
// Publish takes an Event and sends it to the internal eventBus where it is distributed to all Subscribers
|
||||
func (em *manager) Publish(event Event) {
|
||||
em.chanMutex.Lock()
|
||||
defer em.chanMutex.Unlock()
|
||||
if event.EventType != "" && !em.closed {
|
||||
|
||||
// Debug Events for Tracing, locked behind an environment variable
|
||||
// for now.
|
||||
if em.trace {
|
||||
pc, _, _, _ := runtime.Caller(1)
|
||||
funcName := runtime.FuncForPC(pc).Name()
|
||||
lastSlash := strings.LastIndexByte(funcName, '/')
|
||||
if lastSlash < 0 {
|
||||
lastSlash = 0
|
||||
}
|
||||
lastDot := strings.LastIndexByte(funcName[lastSlash:], '.') + lastSlash
|
||||
event.Data[Source] = fmt.Sprintf("%v.%v", funcName[:lastDot], funcName[lastDot+1:])
|
||||
}
|
||||
|
||||
// Deep Copy the Event...
|
||||
eventJSON, err := json.Marshal(event)
|
||||
if err != nil {
|
||||
log.Errorf("Error serializing event: %v", event)
|
||||
}
|
||||
em.events <- eventJSON
|
||||
}
|
||||
}
|
||||
|
||||
// eventBus is an internal function that is used to distribute events to all subscribers
|
||||
func (em *manager) eventBus() {
|
||||
for {
|
||||
eventJSON := <-em.events
|
||||
|
||||
// In the case on an empty event. Tear down the Queue
|
||||
if len(eventJSON) == 0 {
|
||||
log.Errorf("Received zero length event")
|
||||
break
|
||||
}
|
||||
|
||||
var event Event
|
||||
err := json.Unmarshal(eventJSON, &event)
|
||||
|
||||
if err != nil {
|
||||
log.Errorf("Error on Deep Copy: %v %v", eventJSON, err)
|
||||
}
|
||||
|
||||
// maps aren't thread safe
|
||||
em.mapMutex.Lock()
|
||||
subscribers := em.subscribers[event.EventType]
|
||||
em.mapMutex.Unlock()
|
||||
|
||||
// Send the event to any subscribers to that event type
|
||||
for _, subscriber := range subscribers {
|
||||
// Deep Copy for Each Subscriber
|
||||
var eventCopy Event
|
||||
err = json.Unmarshal(eventJSON, &eventCopy)
|
||||
if err != nil {
|
||||
log.Errorf("error unmarshalling event: %v ", err)
|
||||
}
|
||||
subscriber.Publish(eventCopy)
|
||||
}
|
||||
}
|
||||
|
||||
// We are about to exit the eventbus thread, fire off an event internally
|
||||
em.internal <- true
|
||||
}
|
||||
|
||||
// Shutdown triggers, and waits for, the internal eventBus goroutine to finish
|
||||
func (em *manager) Shutdown() {
|
||||
em.events <- []byte{}
|
||||
em.chanMutex.Lock()
|
||||
em.closed = true
|
||||
em.chanMutex.Unlock()
|
||||
// wait for eventBus to finish
|
||||
<-em.internal
|
||||
close(em.events)
|
||||
close(em.internal)
|
||||
}
|
|
@ -1,91 +0,0 @@
|
|||
package event
|
||||
|
||||
import (
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"testing"
|
||||
"time"
|
||||
)
|
||||
|
||||
// Most basic Manager Test, Initialize, Subscribe, Publish, Receive
|
||||
func TestEventManager(t *testing.T) {
|
||||
eventManager := NewEventManager()
|
||||
|
||||
// We need to make this buffer at least 1, otherwise we will log an error!
|
||||
simpleQueue := NewQueue()
|
||||
eventManager.Subscribe("TEST", simpleQueue)
|
||||
eventManager.Publish(Event{EventType: "TEST", Data: map[Field]string{"Value": "Hello World"}})
|
||||
|
||||
event := simpleQueue.Next()
|
||||
if event.EventType == "TEST" && event.Data["Value"] == "Hello World" {
|
||||
|
||||
} else {
|
||||
t.Errorf("Received Invalid Event")
|
||||
}
|
||||
|
||||
eventManager.Shutdown()
|
||||
}
|
||||
|
||||
func TestEventManagerMultiple(t *testing.T) {
|
||||
log.SetLevel(log.LevelDebug)
|
||||
eventManager := NewEventManager()
|
||||
|
||||
groupEventQueue := NewQueue()
|
||||
peerEventQueue := NewQueue()
|
||||
allEventQueue := NewQueue()
|
||||
|
||||
eventManager.Subscribe("PeerEvent", peerEventQueue)
|
||||
eventManager.Subscribe("GroupEvent", groupEventQueue)
|
||||
eventManager.Subscribe("PeerEvent", allEventQueue)
|
||||
eventManager.Subscribe("GroupEvent", allEventQueue)
|
||||
eventManager.Subscribe("ErrorEvent", allEventQueue)
|
||||
|
||||
eventManager.Publish(Event{EventType: "PeerEvent", Data: map[Field]string{"Value": "Hello World Peer"}})
|
||||
eventManager.Publish(Event{EventType: "GroupEvent", Data: map[Field]string{"Value": "Hello World Group"}})
|
||||
eventManager.Publish(Event{EventType: "PeerEvent", Data: map[Field]string{"Value": "Hello World Peer"}})
|
||||
eventManager.Publish(Event{EventType: "ErrorEvent", Data: map[Field]string{"Value": "Hello World Error"}})
|
||||
eventManager.Publish(Event{EventType: "NobodyIsSubscribedToThisEvent", Data: map[Field]string{"Value": "No one should see this!"}})
|
||||
|
||||
assertLength := func(len int, expected int, label string) {
|
||||
if len != expected {
|
||||
t.Errorf("Expected %s to be %v was %v", label, expected, len)
|
||||
}
|
||||
}
|
||||
|
||||
time.Sleep(time.Second)
|
||||
|
||||
assertLength(groupEventQueue.Len(), 1, "Group Event Queue Length")
|
||||
assertLength(peerEventQueue.Len(), 2, "Peer Event Queue Length")
|
||||
assertLength(allEventQueue.Len(), 4, "All Event Queue Length")
|
||||
|
||||
checkEvent := func(eventType Type, expected Type, label string) {
|
||||
if eventType != expected {
|
||||
t.Errorf("Expected %s to be %v was %v", label, expected, eventType)
|
||||
}
|
||||
}
|
||||
|
||||
event := groupEventQueue.Next()
|
||||
checkEvent(event.EventType, "GroupEvent", "First Group Event")
|
||||
|
||||
event = peerEventQueue.Next()
|
||||
checkEvent(event.EventType, "PeerEvent", "First Peer Event")
|
||||
event = peerEventQueue.Next()
|
||||
checkEvent(event.EventType, "PeerEvent", "Second Peer Event")
|
||||
|
||||
event = allEventQueue.Next()
|
||||
checkEvent(event.EventType, "PeerEvent", "ALL: First Peer Event")
|
||||
event = allEventQueue.Next()
|
||||
checkEvent(event.EventType, "GroupEvent", "ALL: First Group Event")
|
||||
event = allEventQueue.Next()
|
||||
checkEvent(event.EventType, "PeerEvent", "ALL: Second Peer Event")
|
||||
event = allEventQueue.Next()
|
||||
checkEvent(event.EventType, "ErrorEvent", "ALL: First Error Event")
|
||||
|
||||
eventManager.Shutdown()
|
||||
groupEventQueue.Shutdown()
|
||||
peerEventQueue.Shutdown()
|
||||
allEventQueue.Shutdown()
|
||||
|
||||
// Reading from a closed queue should result in an instant return and an empty event
|
||||
event = groupEventQueue.Next()
|
||||
checkEvent(event.EventType, "", "Test Next() on Empty Queue")
|
||||
}
|
|
@ -1,73 +0,0 @@
|
|||
// nolint:nilaway - the infiniteBuffer function causes issues with static analysis because it is very unidomatic.
|
||||
package event
|
||||
|
||||
/*
|
||||
This package is taken from https://github.com/eapache/channels
|
||||
as per their suggestion we are not importing the entire package and instead cherry picking and adapting what is needed
|
||||
|
||||
It is covered by the MIT License https://github.com/eapache/channels/blob/master/LICENSE
|
||||
*/
|
||||
|
||||
// infiniteChannel implements the Channel interface with an infinite buffer between the input and the output.
|
||||
type infiniteChannel struct {
|
||||
input, output chan Event
|
||||
length chan int
|
||||
buffer *infiniteQueue
|
||||
}
|
||||
|
||||
func newInfiniteChannel() *infiniteChannel {
|
||||
ch := &infiniteChannel{
|
||||
input: make(chan Event),
|
||||
output: make(chan Event),
|
||||
length: make(chan int),
|
||||
buffer: newInfiniteQueue(),
|
||||
}
|
||||
go ch.infiniteBuffer()
|
||||
return ch
|
||||
}
|
||||
func (ch *infiniteChannel) In() chan<- Event {
|
||||
return ch.input
|
||||
}
|
||||
|
||||
func (ch *infiniteChannel) Out() <-chan Event {
|
||||
return ch.output
|
||||
}
|
||||
|
||||
func (ch *infiniteChannel) Len() int {
|
||||
return <-ch.length
|
||||
}
|
||||
|
||||
func (ch *infiniteChannel) Close() {
|
||||
close(ch.input)
|
||||
}
|
||||
|
||||
func (ch *infiniteChannel) infiniteBuffer() {
|
||||
var input, output chan Event
|
||||
var next Event
|
||||
input = ch.input
|
||||
|
||||
for input != nil || output != nil {
|
||||
select {
|
||||
case elem, open := <-input:
|
||||
if open {
|
||||
ch.buffer.Add(elem)
|
||||
} else {
|
||||
input = nil
|
||||
}
|
||||
case output <- next:
|
||||
ch.buffer.Remove()
|
||||
case ch.length <- ch.buffer.Length():
|
||||
}
|
||||
|
||||
if ch.buffer.Length() > 0 {
|
||||
output = ch.output
|
||||
next = ch.buffer.Peek()
|
||||
} else {
|
||||
output = nil
|
||||
//next = nil
|
||||
}
|
||||
}
|
||||
|
||||
close(ch.output)
|
||||
close(ch.length)
|
||||
}
|
|
@ -1,108 +0,0 @@
|
|||
package event
|
||||
|
||||
/*
|
||||
This package is taken from https://github.com/eapache/channels
|
||||
as per their suggestion we are not importing the entire package and instead cherry picking and adapting what is needed
|
||||
|
||||
It is covered by the MIT License https://github.com/eapache/channels/blob/master/LICENSE
|
||||
*/
|
||||
/*
|
||||
Package queue provides a fast, ring-buffer queue based on the version suggested by Dariusz Górecki.
|
||||
Using this instead of other, simpler, queue implementations (slice+append or linked list) provides
|
||||
substantial memory and time benefits, and fewer GC pauses.
|
||||
The queue implemented here is as fast as it is for an additional reason: it is *not* thread-safe.
|
||||
*/
|
||||
|
||||
// minQueueLen is smallest capacity that queue may have.
|
||||
// Must be power of 2 for bitwise modulus: x % n == x & (n - 1).
|
||||
const minQueueLen = 16
|
||||
|
||||
// Queue represents a single instance of the queue data structure.
|
||||
type infiniteQueue struct {
|
||||
buf []Event
|
||||
head, tail, count int
|
||||
}
|
||||
|
||||
// New constructs and returns a new Queue.
|
||||
func newInfiniteQueue() *infiniteQueue {
|
||||
return &infiniteQueue{
|
||||
buf: make([]Event, minQueueLen),
|
||||
}
|
||||
}
|
||||
|
||||
// Length returns the number of elements currently stored in the queue.
|
||||
func (q *infiniteQueue) Length() int {
|
||||
return q.count
|
||||
}
|
||||
|
||||
// resizes the queue to fit exactly twice its current contents
|
||||
// this can result in shrinking if the queue is less than half-full
|
||||
func (q *infiniteQueue) resize() {
|
||||
newBuf := make([]Event, q.count<<1)
|
||||
|
||||
if q.tail > q.head {
|
||||
copy(newBuf, q.buf[q.head:q.tail])
|
||||
} else {
|
||||
n := copy(newBuf, q.buf[q.head:])
|
||||
copy(newBuf[n:], q.buf[:q.tail])
|
||||
}
|
||||
|
||||
q.head = 0
|
||||
q.tail = q.count
|
||||
q.buf = newBuf
|
||||
}
|
||||
|
||||
// Add puts an element on the end of the queue.
|
||||
func (q *infiniteQueue) Add(elem Event) {
|
||||
if q.count == len(q.buf) {
|
||||
q.resize()
|
||||
}
|
||||
|
||||
q.buf[q.tail] = elem
|
||||
// bitwise modulus
|
||||
q.tail = (q.tail + 1) & (len(q.buf) - 1)
|
||||
q.count++
|
||||
}
|
||||
|
||||
// Peek returns the element at the head of the queue. This call panics
|
||||
// if the queue is empty.
|
||||
func (q *infiniteQueue) Peek() Event {
|
||||
if q.count <= 0 {
|
||||
panic("queue: Peek() called on empty queue")
|
||||
}
|
||||
return q.buf[q.head]
|
||||
}
|
||||
|
||||
// Get returns the element at index i in the queue. If the index is
|
||||
// invalid, the call will panic. This method accepts both positive and
|
||||
// negative index values. Index 0 refers to the first element, and
|
||||
// index -1 refers to the last.
|
||||
func (q *infiniteQueue) Get(i int) Event {
|
||||
// If indexing backwards, convert to positive index.
|
||||
if i < 0 {
|
||||
i += q.count
|
||||
}
|
||||
if i < 0 || i >= q.count {
|
||||
panic("queue: Get() called with index out of range")
|
||||
}
|
||||
// bitwise modulus
|
||||
return q.buf[(q.head+i)&(len(q.buf)-1)]
|
||||
}
|
||||
|
||||
// Remove removes and returns the element from the front of the queue. If the
|
||||
// queue is empty, the call will panic.
|
||||
func (q *infiniteQueue) Remove() Event {
|
||||
if q.count <= 0 {
|
||||
panic("queue: Remove() called on empty queue")
|
||||
}
|
||||
ret := q.buf[q.head]
|
||||
//q.buf[q.head] = nil
|
||||
// bitwise modulus
|
||||
q.head = (q.head + 1) & (len(q.buf) - 1)
|
||||
q.count--
|
||||
// Resize down if buffer 1/4 full.
|
||||
if len(q.buf) > minQueueLen && (q.count<<2) == len(q.buf) {
|
||||
q.resize()
|
||||
}
|
||||
return ret
|
||||
}
|
|
@ -1,128 +0,0 @@
|
|||
package extensions
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/model/attr"
|
||||
"cwtch.im/cwtch/model/constants"
|
||||
"cwtch.im/cwtch/peer"
|
||||
"cwtch.im/cwtch/protocol/connections"
|
||||
"cwtch.im/cwtch/settings"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"strconv"
|
||||
)
|
||||
|
||||
// ProfileValueExtension implements custom Profile Names over Cwtch
|
||||
type ProfileValueExtension struct {
|
||||
}
|
||||
|
||||
func (pne ProfileValueExtension) NotifySettingsUpdate(_ settings.GlobalSettings) {
|
||||
}
|
||||
|
||||
func (pne ProfileValueExtension) EventsToRegister() []event.Type {
|
||||
return []event.Type{event.PeerStateChange, event.Heartbeat}
|
||||
}
|
||||
|
||||
func (pne ProfileValueExtension) ExperimentsToRegister() []string {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (pne ProfileValueExtension) requestProfileInfo(profile peer.CwtchPeer, ci *model.Conversation) {
|
||||
profile.SendScopedZonedGetValToContact(ci.ID, attr.PublicScope, attr.ProfileZone, constants.Name)
|
||||
profile.SendScopedZonedGetValToContact(ci.ID, attr.PublicScope, attr.ProfileZone, constants.ProfileStatus)
|
||||
profile.SendScopedZonedGetValToContact(ci.ID, attr.PublicScope, attr.ProfileZone, constants.ProfileAttribute1)
|
||||
profile.SendScopedZonedGetValToContact(ci.ID, attr.PublicScope, attr.ProfileZone, constants.ProfileAttribute2)
|
||||
profile.SendScopedZonedGetValToContact(ci.ID, attr.PublicScope, attr.ProfileZone, constants.ProfileAttribute3)
|
||||
}
|
||||
|
||||
func (pne ProfileValueExtension) OnEvent(ev event.Event, profile peer.CwtchPeer) {
|
||||
switch ev.EventType {
|
||||
case event.Heartbeat:
|
||||
// once every heartbeat, loop through conversations and, if they are online, request an update to any long info..
|
||||
conversations, err := profile.FetchConversations()
|
||||
if err == nil {
|
||||
for _, ci := range conversations {
|
||||
if profile.GetPeerState(ci.Handle) == connections.AUTHENTICATED {
|
||||
pne.requestProfileInfo(profile, ci)
|
||||
}
|
||||
}
|
||||
}
|
||||
case event.PeerStateChange:
|
||||
ci, err := profile.FetchConversationInfo(ev.Data["RemotePeer"])
|
||||
if err == nil {
|
||||
// if we have re-authenticated with thie peer then request their profile image...
|
||||
if connections.ConnectionStateToType()[ev.Data[event.ConnectionState]] == connections.AUTHENTICATED {
|
||||
// Request some profile information...
|
||||
pne.requestProfileInfo(profile, ci)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// OnContactReceiveValue for ProfileValueExtension handles saving specific Public Profile Values like Profile Name
|
||||
func (pne ProfileValueExtension) OnContactReceiveValue(profile peer.CwtchPeer, conversation model.Conversation, szp attr.ScopedZonedPath, value string, exists bool) {
|
||||
// Allow public profile parameters to be added as contact specific attributes...
|
||||
scope, zone, _ := szp.GetScopeZonePath()
|
||||
if exists && scope.IsPublic() && zone == attr.ProfileZone {
|
||||
|
||||
// Check the current value of the attribute
|
||||
currentValue, err := profile.GetConversationAttribute(conversation.ID, szp)
|
||||
if err == nil && currentValue == value {
|
||||
// Value exists and the value is the same, short-circuit
|
||||
return
|
||||
}
|
||||
|
||||
// Save the new Attribute
|
||||
err = profile.SetConversationAttribute(conversation.ID, szp, value)
|
||||
if err != nil {
|
||||
// Something else wen't wrong.. short-circuit
|
||||
log.Errorf("error setting conversation attribute %v", err)
|
||||
return
|
||||
}
|
||||
|
||||
// Finally publish an update for listeners to react to.
|
||||
scope, zone, zpath := szp.GetScopeZonePath()
|
||||
profile.PublishEvent(event.NewEvent(event.UpdatedConversationAttribute, map[event.Field]string{
|
||||
event.Scope: string(scope),
|
||||
event.Path: string(zone.ConstructZonedPath(zpath)),
|
||||
event.Data: value,
|
||||
event.RemotePeer: conversation.Handle,
|
||||
event.ConversationID: strconv.Itoa(conversation.ID),
|
||||
}))
|
||||
}
|
||||
}
|
||||
|
||||
// OnContactRequestValue for ProfileValueExtension handles returning Public Profile Values
|
||||
func (pne ProfileValueExtension) OnContactRequestValue(profile peer.CwtchPeer, conversation model.Conversation, eventID string, szp attr.ScopedZonedPath) {
|
||||
scope, zone, zpath := szp.GetScopeZonePath()
|
||||
log.Debugf("Looking up public | conversation scope/zone %v", szp.ToString())
|
||||
if scope.IsPublic() || scope.IsConversation() {
|
||||
val, exists := profile.GetScopedZonedAttribute(scope, zone, zpath)
|
||||
|
||||
// NOTE: Temporary Override because UI currently wipes names if it can't find them...
|
||||
if !exists && zone == attr.UnknownZone && zpath == constants.Name {
|
||||
val, exists = profile.GetScopedZonedAttribute(attr.PublicScope, attr.ProfileZone, constants.Name)
|
||||
}
|
||||
|
||||
// NOTE: Cwtch 1.15+ requires that profiles be able to restrict file downloading to specific contacts. As such we need an ACL check here
|
||||
// on the fileshareing zone.
|
||||
// TODO: Split this functionality into FilesharingFunctionality, and restrict this function to only considering Profile zoned attributes?
|
||||
if zone == attr.FilesharingZone {
|
||||
if !conversation.GetPeerAC().ShareFiles {
|
||||
return
|
||||
}
|
||||
}
|
||||
|
||||
// Construct a Response
|
||||
resp := event.NewEvent(event.SendRetValMessageToPeer, map[event.Field]string{event.ConversationID: strconv.Itoa(conversation.ID), event.RemotePeer: conversation.Handle, event.Exists: strconv.FormatBool(exists)})
|
||||
resp.EventID = eventID
|
||||
if exists {
|
||||
resp.Data[event.Data] = val
|
||||
} else {
|
||||
resp.Data[event.Data] = ""
|
||||
}
|
||||
|
||||
log.Debugf("Responding with SendRetValMessageToPeer exists:%v data: %v\n", exists, val)
|
||||
profile.PublishEvent(resp)
|
||||
}
|
||||
}
|
|
@ -1,66 +0,0 @@
|
|||
package extensions
|
||||
|
||||
import (
|
||||
"strconv"
|
||||
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/model/attr"
|
||||
"cwtch.im/cwtch/model/constants"
|
||||
"cwtch.im/cwtch/peer"
|
||||
"cwtch.im/cwtch/protocol/connections"
|
||||
"cwtch.im/cwtch/settings"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
)
|
||||
|
||||
// SendWhenOnlineExtension implements automatic sending
|
||||
// Some Considerations:
|
||||
// - There are race conditions inherant in this approach e.g. a peer could go offline just after recieving a message and never sending an ack
|
||||
// - In that case the next time we connect we will send a duplicate message.
|
||||
// - Currently we do not include metadata like sent time in raw peer protocols (however Overlay does now have support for that information)
|
||||
type SendWhenOnlineExtension struct {
|
||||
}
|
||||
|
||||
func (soe SendWhenOnlineExtension) NotifySettingsUpdate(_ settings.GlobalSettings) {
|
||||
}
|
||||
|
||||
func (soe SendWhenOnlineExtension) EventsToRegister() []event.Type {
|
||||
return []event.Type{event.PeerStateChange}
|
||||
}
|
||||
|
||||
func (soe SendWhenOnlineExtension) ExperimentsToRegister() []string {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (soe SendWhenOnlineExtension) OnEvent(ev event.Event, profile peer.CwtchPeer) {
|
||||
switch ev.EventType {
|
||||
case event.PeerStateChange:
|
||||
ci, err := profile.FetchConversationInfo(ev.Data["RemotePeer"])
|
||||
if err == nil {
|
||||
// if we have re-authenticated with thie peer then request their profile image...
|
||||
if connections.ConnectionStateToType()[ev.Data[event.ConnectionState]] == connections.AUTHENTICATED {
|
||||
// Check the last 100 messages, if any of them are pending, then send them now...
|
||||
messsages, _ := profile.GetMostRecentMessages(ci.ID, 0, 0, uint(100))
|
||||
for _, message := range messsages {
|
||||
if message.Attr[constants.AttrAck] == constants.False {
|
||||
body := message.Body
|
||||
ev := event.NewEvent(event.SendMessageToPeer, map[event.Field]string{event.ConversationID: strconv.Itoa(ci.ID), event.RemotePeer: ci.Handle, event.Data: body})
|
||||
ev.EventID = message.Signature // we need this ensure that we correctly ack this in the db when it comes back
|
||||
// TODO: The EventBus is becoming very noisy...we may want to consider a one-way shortcut to Engine i.e. profile.Engine.SendMessageToPeer
|
||||
log.Debugf("resending message that was sent when peer was offline")
|
||||
profile.PublishEvent(ev)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// OnContactReceiveValue is nop for SendWhenOnnlineExtension
|
||||
func (soe SendWhenOnlineExtension) OnContactReceiveValue(profile peer.CwtchPeer, conversation model.Conversation, szp attr.ScopedZonedPath, value string, exists bool) {
|
||||
}
|
||||
|
||||
// OnContactRequestValue is nop for SendWhenOnnlineExtension
|
||||
func (soe SendWhenOnlineExtension) OnContactRequestValue(profile peer.CwtchPeer, conversation model.Conversation, eventID string, szp attr.ScopedZonedPath) {
|
||||
|
||||
}
|
|
@ -1,591 +0,0 @@
|
|||
package filesharing
|
||||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/settings"
|
||||
"encoding/hex"
|
||||
"encoding/json"
|
||||
"errors"
|
||||
"fmt"
|
||||
"io"
|
||||
"math"
|
||||
"os"
|
||||
path "path/filepath"
|
||||
"regexp"
|
||||
"runtime"
|
||||
"strconv"
|
||||
"strings"
|
||||
"time"
|
||||
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/model/attr"
|
||||
"cwtch.im/cwtch/model/constants"
|
||||
"cwtch.im/cwtch/peer"
|
||||
"cwtch.im/cwtch/protocol/files"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
)
|
||||
|
||||
// Functionality groups some common UI triggered functions for contacts...
|
||||
type Functionality struct {
|
||||
}
|
||||
|
||||
func (f *Functionality) NotifySettingsUpdate(settings settings.GlobalSettings) {
|
||||
}
|
||||
|
||||
func (f *Functionality) EventsToRegister() []event.Type {
|
||||
return []event.Type{event.ProtocolEngineCreated, event.ManifestReceived, event.FileDownloaded}
|
||||
}
|
||||
|
||||
func (f *Functionality) ExperimentsToRegister() []string {
|
||||
return []string{constants.FileSharingExperiment}
|
||||
}
|
||||
|
||||
// OnEvent handles File Sharing Hooks like Manifest Received and FileDownloaded
|
||||
func (f *Functionality) OnEvent(ev event.Event, profile peer.CwtchPeer) {
|
||||
if profile.IsFeatureEnabled(constants.FileSharingExperiment) {
|
||||
switch ev.EventType {
|
||||
case event.ProtocolEngineCreated:
|
||||
f.ReShareFiles(profile)
|
||||
case event.ManifestReceived:
|
||||
log.Debugf("Manifest Received Event!: %v", ev)
|
||||
handle := ev.Data[event.Handle]
|
||||
fileKey := ev.Data[event.FileKey]
|
||||
serializedManifest := ev.Data[event.SerializedManifest]
|
||||
|
||||
manifestFilePath, exists := profile.GetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%v.manifest", fileKey))
|
||||
if exists {
|
||||
downloadFilePath, exists := profile.GetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%v.path", fileKey))
|
||||
if exists {
|
||||
log.Debugf("downloading manifest to %v, file to %v", manifestFilePath, downloadFilePath)
|
||||
var manifest files.Manifest
|
||||
err := json.Unmarshal([]byte(serializedManifest), &manifest)
|
||||
|
||||
if err == nil {
|
||||
// We only need to check the file size here, as manifest is sent to engine and the file created
|
||||
// will be bound to the size advertised in manifest.
|
||||
fileSizeLimitValue, fileSizeLimitExists := profile.GetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%v.limit", fileKey))
|
||||
if fileSizeLimitExists {
|
||||
fileSizeLimit, err := strconv.ParseUint(fileSizeLimitValue, 10, 64)
|
||||
if err == nil {
|
||||
if manifest.FileSizeInBytes >= fileSizeLimit {
|
||||
log.Debugf("could not download file, size %v greater than limit %v", manifest.FileSizeInBytes, fileSizeLimitValue)
|
||||
} else {
|
||||
manifest.Title = manifest.FileName
|
||||
manifest.FileName = downloadFilePath
|
||||
log.Debugf("saving manifest")
|
||||
err = manifest.Save(manifestFilePath)
|
||||
if err != nil {
|
||||
log.Errorf("could not save manifest: %v", err)
|
||||
} else {
|
||||
tempFile := ""
|
||||
if runtime.GOOS == "android" {
|
||||
tempFile = manifestFilePath[0 : len(manifestFilePath)-len(".manifest")]
|
||||
log.Debugf("derived android temp path: %v", tempFile)
|
||||
}
|
||||
profile.PublishEvent(event.NewEvent(event.ManifestSaved, map[event.Field]string{
|
||||
event.FileKey: fileKey,
|
||||
event.Handle: handle,
|
||||
event.SerializedManifest: string(manifest.Serialize()),
|
||||
event.TempFile: tempFile,
|
||||
event.NameSuggestion: manifest.Title,
|
||||
}))
|
||||
}
|
||||
}
|
||||
} else {
|
||||
log.Errorf("error saving manifest: file size limit is incorrect: %v", err)
|
||||
}
|
||||
} else {
|
||||
log.Errorf("error saving manifest: could not find file size limit info")
|
||||
}
|
||||
} else {
|
||||
log.Errorf("error saving manifest: %v", err)
|
||||
}
|
||||
} else {
|
||||
log.Errorf("found manifest path but not download path for %v", fileKey)
|
||||
}
|
||||
} else {
|
||||
log.Errorf("no download path found for manifest: %v", fileKey)
|
||||
}
|
||||
case event.FileDownloaded:
|
||||
fileKey := ev.Data[event.FileKey]
|
||||
profile.SetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%s.complete", fileKey), "true")
|
||||
}
|
||||
} else {
|
||||
log.Errorf("profile called filesharing experiment OnContactReceiveValue even though file sharing was not enabled. This is likely a programming error.")
|
||||
}
|
||||
}
|
||||
|
||||
func (f *Functionality) OnContactRequestValue(profile peer.CwtchPeer, conversation model.Conversation, eventID string, path attr.ScopedZonedPath) {
|
||||
// nop
|
||||
}
|
||||
|
||||
func (f *Functionality) OnContactReceiveValue(profile peer.CwtchPeer, conversation model.Conversation, path attr.ScopedZonedPath, value string, exists bool) {
|
||||
// Profile should not call us if FileSharing is disabled
|
||||
if profile.IsFeatureEnabled(constants.FileSharingExperiment) {
|
||||
scope, zone, zpath := path.GetScopeZonePath()
|
||||
log.Debugf("file sharing contact receive value")
|
||||
if exists && scope.IsConversation() && zone == attr.FilesharingZone && strings.HasSuffix(zpath, ".manifest.size") {
|
||||
fileKey := strings.Replace(zpath, ".manifest.size", "", 1)
|
||||
size, err := strconv.Atoi(value)
|
||||
// if size is valid and below the maximum size for a manifest
|
||||
// this is to prevent malicious sharers from using large amounts of memory when distributing
|
||||
// a manifest as we reconstruct this in-memory
|
||||
if err == nil && size < files.MaxManifestSize {
|
||||
profile.PublishEvent(event.NewEvent(event.ManifestSizeReceived, map[event.Field]string{event.FileKey: fileKey, event.ManifestSize: value, event.Handle: conversation.Handle}))
|
||||
} else {
|
||||
profile.PublishEvent(event.NewEvent(event.ManifestError, map[event.Field]string{event.FileKey: fileKey, event.Handle: conversation.Handle}))
|
||||
}
|
||||
}
|
||||
} else {
|
||||
log.Errorf("profile called filesharing experiment OnContactReceiveValue even though file sharing was not enabled. This is likely a programming error.")
|
||||
}
|
||||
}
|
||||
|
||||
// FunctionalityGate returns filesharing functionality - gates now happen on function calls.
|
||||
func FunctionalityGate() *Functionality {
|
||||
return new(Functionality)
|
||||
}
|
||||
|
||||
// PreviewFunctionalityGate returns filesharing if image previews are enabled
|
||||
func PreviewFunctionalityGate(experimentMap map[string]bool) (*Functionality, error) {
|
||||
if experimentMap[constants.FileSharingExperiment] && experimentMap[constants.ImagePreviewsExperiment] {
|
||||
return new(Functionality), nil
|
||||
}
|
||||
return nil, errors.New("image previews are not enabled")
|
||||
}
|
||||
|
||||
// OverlayMessage presents the canonical format of the File Sharing functionality Overlay Message
|
||||
// This is the format that the UI will parse to display the message
|
||||
type OverlayMessage struct {
|
||||
Name string `json:"f"`
|
||||
Hash string `json:"h"`
|
||||
Nonce string `json:"n"`
|
||||
Size uint64 `json:"s"`
|
||||
}
|
||||
|
||||
// FileKey is the unique reference to a file offer
|
||||
func (om *OverlayMessage) FileKey() string {
|
||||
return fmt.Sprintf("%s.%s", om.Hash, om.Nonce)
|
||||
}
|
||||
|
||||
// ShouldAutoDL checks file size and file name. *DOES NOT* check user settings or contact state
|
||||
func (om *OverlayMessage) ShouldAutoDL() bool {
|
||||
if om.Size > constants.ImagePreviewMaxSizeInBytes {
|
||||
return false
|
||||
}
|
||||
lname := strings.ToLower(om.Name)
|
||||
for _, s := range constants.AutoDLFileExts {
|
||||
if strings.HasSuffix(lname, s) {
|
||||
return true
|
||||
}
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
func (f *Functionality) VerifyOrResumeDownloadDefaultLimit(profile peer.CwtchPeer, conversation int, fileKey string) error {
|
||||
return f.VerifyOrResumeDownload(profile, conversation, fileKey, files.MaxManifestSize*files.DefaultChunkSize)
|
||||
}
|
||||
|
||||
func (f *Functionality) VerifyOrResumeDownload(profile peer.CwtchPeer, conversation int, fileKey string, size uint64) error {
|
||||
if manifestFilePath, exists := profile.GetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%s.manifest", fileKey)); exists {
|
||||
if downloadfilepath, exists := profile.GetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%s.path", fileKey)); exists {
|
||||
manifest, err := files.LoadManifest(manifestFilePath)
|
||||
if err == nil {
|
||||
// Assert the filename...this is technically not necessary, but is here for completeness
|
||||
manifest.FileName = downloadfilepath
|
||||
if manifest.VerifyFile() == nil {
|
||||
// Send a FileDownloaded Event. Usually when VerifyOrResumeDownload is triggered it's because some UI is awaiting the results of a
|
||||
// Download.
|
||||
profile.PublishEvent(event.NewEvent(event.FileDownloaded, map[event.Field]string{event.FileKey: fileKey, event.FilePath: downloadfilepath, event.TempFile: downloadfilepath}))
|
||||
// File is verified and there is nothing else to do...
|
||||
return nil
|
||||
} else {
|
||||
// Kick off another Download...
|
||||
return f.DownloadFile(profile, conversation, downloadfilepath, manifestFilePath, fileKey, size)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
return errors.New("file download metadata does not exist, or is corrupted")
|
||||
}
|
||||
|
||||
func (f *Functionality) CheckDownloadStatus(profile peer.CwtchPeer, fileKey string) error {
|
||||
path, _ := profile.GetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%s.path", fileKey))
|
||||
if value, exists := profile.GetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%s.complete", fileKey)); exists && value == event.True {
|
||||
profile.PublishEvent(event.NewEvent(event.FileDownloaded, map[event.Field]string{
|
||||
event.ProfileOnion: profile.GetOnion(),
|
||||
event.FileKey: fileKey,
|
||||
event.FilePath: path,
|
||||
event.TempFile: "",
|
||||
}))
|
||||
} else {
|
||||
log.Debugf("CheckDownloadStatus found .path but not .complete")
|
||||
profile.PublishEvent(event.NewEvent(event.FileDownloadProgressUpdate, map[event.Field]string{
|
||||
event.ProfileOnion: profile.GetOnion(),
|
||||
event.FileKey: fileKey,
|
||||
event.Progress: "-1",
|
||||
event.FileSizeInChunks: "-1",
|
||||
event.FilePath: path,
|
||||
}))
|
||||
}
|
||||
return nil // cannot fail
|
||||
}
|
||||
|
||||
func (f *Functionality) EnhancedShareFile(profile peer.CwtchPeer, conversationID int, sharefilepath string) string {
|
||||
fileKey, overlay, err := f.ShareFile(sharefilepath, profile)
|
||||
if err != nil {
|
||||
log.Errorf("error sharing file: %v", err)
|
||||
} else if conversationID == -1 {
|
||||
// FIXME: At some point we might want to allow arbitrary public files, but for now this API will assume
|
||||
// there is only one, and it is the custom profile image...
|
||||
profile.SetScopedZonedAttribute(attr.PublicScope, attr.ProfileZone, constants.CustomProfileImageKey, fileKey)
|
||||
} else {
|
||||
// Set a new attribute so we can associate this download with this conversation...
|
||||
profile.SetConversationAttribute(conversationID, attr.ConversationScope.ConstructScopedZonedPath(attr.FilesharingZone.ConstructZonedPath(fileKey)), "")
|
||||
id, err := profile.SendMessage(conversationID, overlay)
|
||||
if err == nil {
|
||||
return profile.EnhancedGetMessageById(conversationID, id)
|
||||
}
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
// DownloadFileDefaultLimit given a profile, a conversation handle and a file sharing key, start off a download process
|
||||
// to downloadFilePath with a default filesize limit
|
||||
func (f *Functionality) DownloadFileDefaultLimit(profile peer.CwtchPeer, conversationID int, downloadFilePath string, manifestFilePath string, key string) error {
|
||||
return f.DownloadFile(profile, conversationID, downloadFilePath, manifestFilePath, key, files.MaxManifestSize*files.DefaultChunkSize)
|
||||
}
|
||||
|
||||
// DownloadFile given a profile, a conversation handle and a file sharing key, start off a download process
|
||||
// to downloadFilePath
|
||||
func (f *Functionality) DownloadFile(profile peer.CwtchPeer, conversationID int, downloadFilePath string, manifestFilePath string, key string, limit uint64) error {
|
||||
|
||||
// assert that we are allowed to download the file
|
||||
if !profile.IsFeatureEnabled(constants.FileSharingExperiment) {
|
||||
return errors.New("filesharing functionality is not enabled")
|
||||
}
|
||||
|
||||
// Don't download files if the download or manifest path is not set
|
||||
if downloadFilePath == "" || manifestFilePath == "" {
|
||||
return errors.New("download path or manifest path is empty")
|
||||
}
|
||||
|
||||
// Don't download files if the download file directory does not exist
|
||||
// Unless we are on Android where the kernel wishes to keep us ignorant of the
|
||||
// actual path and/or existence of the file. We handle this case further down
|
||||
// the line when the manifest is received and protocol engine and the Android layer
|
||||
// negotiate a temporary local file -> final file copy. We don't want to worry
|
||||
// about that here...
|
||||
if runtime.GOOS != "android" {
|
||||
if _, err := os.Stat(path.Dir(downloadFilePath)); os.IsNotExist(err) {
|
||||
return errors.New("download directory does not exist")
|
||||
}
|
||||
|
||||
// Don't download files if the manifest file directory does not exist
|
||||
if _, err := os.Stat(path.Dir(manifestFilePath)); os.IsNotExist(err) {
|
||||
return errors.New("manifest directory does not exist")
|
||||
}
|
||||
}
|
||||
// Store local.filesharing.filekey.manifest as the location of the manifest
|
||||
profile.SetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%s.manifest", key), manifestFilePath)
|
||||
|
||||
// Store local.filesharing.filekey.path as the location of the download
|
||||
profile.SetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%s.path", key), downloadFilePath)
|
||||
|
||||
// Store local.filesharing.filekey.limit as the max file size of the download
|
||||
profile.SetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%s.limit", key), strconv.FormatUint(limit, 10))
|
||||
|
||||
// Get the value of conversation.filesharing.filekey.manifest.size from `handle`
|
||||
profile.SendScopedZonedGetValToContact(conversationID, attr.ConversationScope, attr.FilesharingZone, fmt.Sprintf("%s.manifest.size", key))
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// startFileShare is a private method used to finalize a file share and publish it to the protocol engine for processing.
|
||||
// if force is set to true, this function will ignore timestamp checks...
|
||||
func (f *Functionality) startFileShare(profile peer.CwtchPeer, filekey string, manifest string, force bool) error {
|
||||
tsStr, exists := profile.GetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%s.ts", filekey))
|
||||
if exists && !force {
|
||||
ts, err := strconv.ParseInt(tsStr, 10, 64)
|
||||
if err != nil || ts < time.Now().Unix()-2592000 {
|
||||
log.Errorf("ignoring request to download a file offered more than 30 days ago")
|
||||
return err
|
||||
}
|
||||
}
|
||||
|
||||
// set the filekey status to active
|
||||
profile.SetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%s.active", filekey), constants.True)
|
||||
// reset the timestamp...
|
||||
profile.SetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%s.ts", filekey), strconv.FormatInt(time.Now().Unix(), 10))
|
||||
// share the manifest
|
||||
profile.PublishEvent(event.NewEvent(event.ShareManifest, map[event.Field]string{event.FileKey: filekey, event.SerializedManifest: manifest}))
|
||||
return nil
|
||||
}
|
||||
|
||||
// RestartFileShare takes in an existing filekey and, assuming the manifest exists, restarts sharing of the manifest
|
||||
// by default this function always forces a file share, even if the file has timed out.
|
||||
func (f *Functionality) RestartFileShare(profile peer.CwtchPeer, filekey string) error {
|
||||
return f.restartFileShareAdvanced(profile, filekey, true)
|
||||
}
|
||||
|
||||
// RestartFileShareAdvanced takes in an existing filekey and, assuming the manifest exists, restarts sharing of the manifest in addition
|
||||
// to a set of parameters
|
||||
func (f *Functionality) restartFileShareAdvanced(profile peer.CwtchPeer, filekey string, force bool) error {
|
||||
|
||||
// assert that we are allowed to restart filesharing
|
||||
if !profile.IsFeatureEnabled(constants.FileSharingExperiment) {
|
||||
return errors.New("filesharing functionality is not enabled")
|
||||
}
|
||||
|
||||
// check that a manifest exists
|
||||
manifest, manifestExists := profile.GetScopedZonedAttribute(attr.ConversationScope, attr.FilesharingZone, fmt.Sprintf("%s.manifest", filekey))
|
||||
if manifestExists {
|
||||
// everything is in order, so reshare this file with the engine
|
||||
log.Debugf("restarting file share: %v", filekey)
|
||||
return f.startFileShare(profile, filekey, manifest, force)
|
||||
}
|
||||
return fmt.Errorf("manifest does not exist for filekey: %v", filekey)
|
||||
}
|
||||
|
||||
// ReShareFiles given a profile we iterate through all existing fileshares and re-share them
|
||||
// if the time limit has not expired
|
||||
func (f *Functionality) ReShareFiles(profile peer.CwtchPeer) error {
|
||||
|
||||
// assert that we are allowed to restart filesharing
|
||||
if !profile.IsFeatureEnabled(constants.FileSharingExperiment) {
|
||||
return errors.New("filesharing functionality is not enabled")
|
||||
}
|
||||
|
||||
keys, err := profile.GetScopedZonedAttributeKeys(attr.LocalScope, attr.FilesharingZone)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
for _, key := range keys {
|
||||
// only look at timestamp keys
|
||||
// this is an arbitrary choice
|
||||
|
||||
if strings.HasSuffix(key, ".ts") {
|
||||
_, zonedpath := attr.ParseScope(key)
|
||||
_, keypath := attr.ParseZone(zonedpath)
|
||||
keyparts := strings.Split(keypath, ".")
|
||||
|
||||
// assert that the key is well-formed
|
||||
if len(keyparts) == 3 && keyparts[2] == "ts" {
|
||||
// fetch the timestamp key
|
||||
filekey := strings.Join(keyparts[:2], ".")
|
||||
sharedFile, err := f.GetFileShareInfo(profile, filekey)
|
||||
|
||||
// If we haven't explicitly stopped sharing the file then attempt a reshare
|
||||
if err == nil && sharedFile.Active {
|
||||
// this reshare can fail because we don't force sharing of files older than 30 days...
|
||||
err := f.restartFileShareAdvanced(profile, filekey, false)
|
||||
if err != nil {
|
||||
log.Debugf("could not reshare file: %v", err)
|
||||
}
|
||||
} else {
|
||||
log.Debugf("could not get fileshare info %v", err)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// GetFileShareInfo returns information related to a known fileshare.
|
||||
// An error is returned if the data is incomplete
|
||||
func (f *Functionality) GetFileShareInfo(profile peer.CwtchPeer, filekey string) (*SharedFile, error) {
|
||||
timestampString, tsExists := profile.GetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%s.ts", filekey))
|
||||
pathString, pathExists := profile.GetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%s.path", filekey))
|
||||
activeString, activeExists := profile.GetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%s.active", filekey))
|
||||
if tsExists && pathExists && activeExists {
|
||||
timestamp, err := strconv.Atoi(timestampString)
|
||||
if err == nil {
|
||||
|
||||
dateShared := time.Unix(int64(timestamp), 0)
|
||||
expired := time.Since(dateShared) >= time.Hour*24*30
|
||||
|
||||
return &SharedFile{
|
||||
FileKey: filekey,
|
||||
Path: pathString,
|
||||
DateShared: dateShared,
|
||||
Active: !expired && activeString == constants.True,
|
||||
Expired: expired,
|
||||
}, nil
|
||||
}
|
||||
}
|
||||
return nil, fmt.Errorf("nonexistant or malformed fileshare %v", filekey)
|
||||
}
|
||||
|
||||
// ShareFile given a profile and a conversation handle, sets up a file sharing process to share the file
|
||||
// at filepath
|
||||
func (f *Functionality) ShareFile(filepath string, profile peer.CwtchPeer) (string, string, error) {
|
||||
|
||||
// assert that we are allowed to share files
|
||||
if !profile.IsFeatureEnabled(constants.FileSharingExperiment) {
|
||||
return "", "", errors.New("filesharing functionality is not enabled")
|
||||
}
|
||||
|
||||
manifest, err := files.CreateManifest(filepath)
|
||||
if err != nil {
|
||||
return "", "", err
|
||||
}
|
||||
|
||||
var nonce [24]byte
|
||||
if _, err := io.ReadFull(rand.Reader, nonce[:]); err != nil {
|
||||
log.Errorf("Cannot read from random: %v\n", err)
|
||||
return "", "", err
|
||||
}
|
||||
|
||||
message := OverlayMessage{
|
||||
Name: path.Base(manifest.FileName),
|
||||
Hash: hex.EncodeToString(manifest.RootHash),
|
||||
Nonce: hex.EncodeToString(nonce[:]),
|
||||
Size: manifest.FileSizeInBytes,
|
||||
}
|
||||
|
||||
data, _ := json.Marshal(message)
|
||||
|
||||
wrapper := model.MessageWrapper{
|
||||
Overlay: model.OverlayFileSharing,
|
||||
Data: string(data),
|
||||
}
|
||||
|
||||
wrapperJSON, _ := json.Marshal(wrapper)
|
||||
key := fmt.Sprintf("%x.%x", manifest.RootHash, nonce)
|
||||
serializedManifest, _ := json.Marshal(manifest)
|
||||
|
||||
// Store the size of the manifest (in chunks) as part of the public scope so contacts who we share the file with
|
||||
// can fetch the manifest as if it were a file.
|
||||
// manifest.FileName gets redacted in filesharing_subsystem (to remove the system-specific file hierarchy),
|
||||
// but we need to *store* the full path because the sender also uses it to locate the file
|
||||
lenDiff := len(filepath) - len(path.Base(filepath))
|
||||
|
||||
// the sender needs to know the location of the file so they can display it in a preview...
|
||||
// This eventually becomes a message attribute, but we don't have access to the message identifier until
|
||||
// the message gets sent.
|
||||
// In the worst case, this can be obtained using CheckDownloadStatus (though in practice this lookup will be
|
||||
// rare because the UI will almost always initiate the construction of a preview a file directly after sending it).
|
||||
profile.SetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%s.path", key), filepath)
|
||||
|
||||
// Store the timestamp, manifest and manifest size for later.
|
||||
profile.SetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%s.ts", key), strconv.FormatInt(time.Now().Unix(), 10))
|
||||
profile.SetScopedZonedAttribute(attr.ConversationScope, attr.FilesharingZone, fmt.Sprintf("%s.manifest", key), string(serializedManifest))
|
||||
profile.SetScopedZonedAttribute(attr.ConversationScope, attr.FilesharingZone, fmt.Sprintf("%s.manifest.size", key), strconv.Itoa(int(math.Ceil(float64(len(serializedManifest)-lenDiff)/float64(files.DefaultChunkSize)))))
|
||||
|
||||
err = f.startFileShare(profile, key, string(serializedManifest), false)
|
||||
|
||||
return key, string(wrapperJSON), err
|
||||
}
|
||||
|
||||
// SharedFile encapsulates information about a shared file
|
||||
// including the file key, file path, the original share date and the
|
||||
// current sharing status
|
||||
type SharedFile struct {
|
||||
|
||||
// The roothash.nonce identifier derived for this file share
|
||||
FileKey string
|
||||
|
||||
// Path is the OS specific location of the file
|
||||
Path string
|
||||
|
||||
// DateShared is the original datetime the file was shared
|
||||
DateShared time.Time
|
||||
|
||||
// Active is true if the file is currently being shared, false otherwise
|
||||
Active bool
|
||||
|
||||
// Expired is true if the file is not eligible to be shared (because e.g. it has been too long since the file was originally shared,
|
||||
// or the file no longer exists).
|
||||
Expired bool
|
||||
}
|
||||
|
||||
func (f *Functionality) EnhancedGetSharedFiles(profile peer.CwtchPeer, conversationID int) string {
|
||||
data, err := json.Marshal(f.GetSharedFiles(profile, conversationID))
|
||||
if err == nil {
|
||||
return string(data)
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
// GetSharedFiles returns all file shares associated with a given conversation
|
||||
func (f *Functionality) GetSharedFiles(profile peer.CwtchPeer, conversationID int) []SharedFile {
|
||||
var sharedFiles []SharedFile
|
||||
ci, err := profile.GetConversationInfo(conversationID)
|
||||
if err == nil {
|
||||
for k := range ci.Attributes {
|
||||
// when we share a file with a conversation we set a single attribute conversation.filesharing.<filekey>
|
||||
if strings.HasPrefix(k, "conversation.filesharing") {
|
||||
parts := strings.SplitN(k, ".", 3)
|
||||
if len(parts) == 3 {
|
||||
key := parts[2]
|
||||
sharedFile, err := f.GetFileShareInfo(profile, key)
|
||||
if err == nil {
|
||||
sharedFiles = append(sharedFiles, *sharedFile)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
return sharedFiles
|
||||
}
|
||||
|
||||
// GenerateDownloadPath creates a file path that doesn't currently exist on the filesystem
|
||||
func GenerateDownloadPath(basePath, fileName string, overwrite bool) (filePath, manifestPath string) {
|
||||
// avoid all kina funky shit
|
||||
re := regexp.MustCompile(`[^A-Za-z0-9._-]`)
|
||||
filePath = re.ReplaceAllString(filePath, "")
|
||||
// avoid hidden files on linux
|
||||
for strings.HasPrefix(filePath, ".") {
|
||||
filePath = strings.TrimPrefix(filePath, ".")
|
||||
}
|
||||
// avoid empties
|
||||
if strings.TrimSpace(filePath) == "" {
|
||||
filePath = "untitled"
|
||||
}
|
||||
// if you like it, put a / on it
|
||||
if !strings.HasSuffix(basePath, string(os.PathSeparator)) {
|
||||
basePath = fmt.Sprintf("%s%s", basePath, string(os.PathSeparator))
|
||||
}
|
||||
filePath = fmt.Sprintf("%s%s", basePath, fileName)
|
||||
manifestPath = fmt.Sprintf("%s.manifest", filePath)
|
||||
|
||||
// if file is named "file", iterate "file", "file (2)", "file (3)", ... until DNE
|
||||
// if file is named "file.ext", iterate "file.ext", "file (2).ext", "file (3).ext", ... until DNE
|
||||
parts := strings.Split(fileName, ".")
|
||||
fileNameBase := parts[0]
|
||||
fileNameExt := ""
|
||||
if len(parts) > 1 {
|
||||
fileNameBase = strings.Join(parts[0:len(parts)-1], ".")
|
||||
fileNameExt = fmt.Sprintf(".%s", parts[len(parts)-1])
|
||||
}
|
||||
|
||||
if !overwrite {
|
||||
for i := 2; ; i++ {
|
||||
if _, err := os.Open(filePath); os.IsNotExist(err) {
|
||||
if _, err := os.Open(manifestPath); os.IsNotExist(err) {
|
||||
return
|
||||
}
|
||||
}
|
||||
filePath = fmt.Sprintf("%s%s (%d)%s", basePath, fileNameBase, i, fileNameExt)
|
||||
manifestPath = fmt.Sprintf("%s.manifest", filePath)
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
// StopFileShare sends a message to the ProtocolEngine to cease sharing a particular file
|
||||
func (f *Functionality) StopFileShare(profile peer.CwtchPeer, fileKey string) error {
|
||||
// Note we do not do a permissions check here, as we are *always* permitted to stop sharing files.
|
||||
// set the filekey status to inactive
|
||||
profile.SetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%s.active", fileKey), constants.False)
|
||||
profile.PublishEvent(event.NewEvent(event.StopFileShare, map[event.Field]string{event.FileKey: fileKey}))
|
||||
return nil // cannot fail
|
||||
}
|
||||
|
||||
// StopAllFileShares sends a message to the ProtocolEngine to cease sharing all files
|
||||
func (f *Functionality) StopAllFileShares(profile peer.CwtchPeer) {
|
||||
// Note we do not do a permissions check here, as we are *always* permitted to stop sharing files.
|
||||
profile.PublishEvent(event.NewEvent(event.StopAllFileShares, map[event.Field]string{}))
|
||||
}
|
|
@ -1,181 +0,0 @@
|
|||
package filesharing
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/model/attr"
|
||||
"cwtch.im/cwtch/model/constants"
|
||||
"cwtch.im/cwtch/peer"
|
||||
"cwtch.im/cwtch/protocol/connections"
|
||||
"cwtch.im/cwtch/settings"
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"os"
|
||||
"strconv"
|
||||
"time"
|
||||
)
|
||||
|
||||
type ImagePreviewsFunctionality struct {
|
||||
downloadFolder string
|
||||
}
|
||||
|
||||
func (i *ImagePreviewsFunctionality) NotifySettingsUpdate(settings settings.GlobalSettings) {
|
||||
i.downloadFolder = settings.DownloadPath
|
||||
}
|
||||
|
||||
func (i *ImagePreviewsFunctionality) EventsToRegister() []event.Type {
|
||||
return []event.Type{event.ProtocolEngineCreated, event.NewMessageFromPeer, event.NewMessageFromGroup, event.PeerStateChange, event.Heartbeat}
|
||||
}
|
||||
|
||||
func (i *ImagePreviewsFunctionality) ExperimentsToRegister() []string {
|
||||
return []string{constants.FileSharingExperiment, constants.ImagePreviewsExperiment}
|
||||
}
|
||||
|
||||
func (i *ImagePreviewsFunctionality) OnEvent(ev event.Event, profile peer.CwtchPeer) {
|
||||
if profile.IsFeatureEnabled(constants.FileSharingExperiment) && profile.IsFeatureEnabled(constants.ImagePreviewsExperiment) {
|
||||
switch ev.EventType {
|
||||
case event.NewMessageFromPeer:
|
||||
ci, err := profile.FetchConversationInfo(ev.Data["RemotePeer"])
|
||||
if err == nil {
|
||||
if ci.GetPeerAC().RenderImages {
|
||||
i.handleImagePreviews(profile, &ev, ci.ID, ci.ID)
|
||||
}
|
||||
}
|
||||
case event.NewMessageFromGroup:
|
||||
ci, err := profile.FetchConversationInfo(ev.Data["RemotePeer"])
|
||||
if err == nil {
|
||||
if ci.GetPeerAC().RenderImages {
|
||||
i.handleImagePreviews(profile, &ev, ci.ID, ci.ID)
|
||||
}
|
||||
}
|
||||
case event.PeerStateChange:
|
||||
ci, err := profile.FetchConversationInfo(ev.Data["RemotePeer"])
|
||||
if err == nil {
|
||||
// if we have re-authenticated with this peer then request their profile image...
|
||||
if connections.ConnectionStateToType()[ev.Data[event.ConnectionState]] == connections.AUTHENTICATED {
|
||||
profile.SendScopedZonedGetValToContact(ci.ID, attr.PublicScope, attr.ProfileZone, constants.CustomProfileImageKey)
|
||||
}
|
||||
}
|
||||
case event.Heartbeat:
|
||||
conversations, err := profile.FetchConversations()
|
||||
if err == nil {
|
||||
for _, ci := range conversations {
|
||||
if profile.GetPeerState(ci.Handle) == connections.AUTHENTICATED {
|
||||
// if we have enabled file shares for this contact, then send them our profile image
|
||||
// NOTE: In the past, Cwtch treated "profile image" as a public file share. As such, anyone with the file key and who is able
|
||||
// to authenticate with the profile (i.e. non-blocked peers) can download the file (if the global profile images experiment is enabled)
|
||||
// To better allow for fine-grained permissions (and to support hybrid group permissions), we want to enable per-conversation file
|
||||
// sharing permissions. As such, profile images are now only shared with contacts with that permission enabled.
|
||||
// (i.e. all previous accepted contacts, new accepted contacts, and contacts who have this toggle set explictly)
|
||||
if ci.GetPeerAC().ShareFiles {
|
||||
profile.SendScopedZonedGetValToContact(ci.ID, attr.PublicScope, attr.ProfileZone, constants.CustomProfileImageKey)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
case event.ProtocolEngineCreated:
|
||||
// Now that the Peer Engine is Activated, Reshare Profile Images
|
||||
key, exists := profile.GetScopedZonedAttribute(attr.PublicScope, attr.ProfileZone, constants.CustomProfileImageKey)
|
||||
if exists {
|
||||
serializedManifest, _ := profile.GetScopedZonedAttribute(attr.ConversationScope, attr.FilesharingZone, fmt.Sprintf("%s.manifest", key))
|
||||
// reset the share timestamp, currently file shares are hardcoded to expire after 30 days...
|
||||
// we reset the profile image here so that it is always available.
|
||||
profile.SetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%s.ts", key), strconv.FormatInt(time.Now().Unix(), 10))
|
||||
log.Debugf("Custom Profile Image: %v %s", key, serializedManifest)
|
||||
f := Functionality{}
|
||||
f.RestartFileShare(profile, key)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (i *ImagePreviewsFunctionality) OnContactRequestValue(profile peer.CwtchPeer, conversation model.Conversation, eventID string, path attr.ScopedZonedPath) {
|
||||
}
|
||||
|
||||
func (i *ImagePreviewsFunctionality) OnContactReceiveValue(profile peer.CwtchPeer, conversation model.Conversation, path attr.ScopedZonedPath, value string, exists bool) {
|
||||
if profile.IsFeatureEnabled(constants.FileSharingExperiment) && profile.IsFeatureEnabled(constants.ImagePreviewsExperiment) {
|
||||
_, zone, path := path.GetScopeZonePath()
|
||||
if exists && zone == attr.ProfileZone && path == constants.CustomProfileImageKey {
|
||||
// We only download from accepted conversations
|
||||
if conversation.GetPeerAC().RenderImages {
|
||||
fileKey := value
|
||||
basepath := i.downloadFolder
|
||||
fsf := FunctionalityGate()
|
||||
// We always overwrite profile image files...
|
||||
fp, mp := GenerateDownloadPath(basepath, fileKey, true)
|
||||
|
||||
// If we have marked this file as complete...
|
||||
if value, exists := profile.GetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%s.complete", fileKey)); exists && value == event.True {
|
||||
if _, err := os.Stat(fp); err == nil {
|
||||
// file is marked as completed downloaded and exists...
|
||||
// Note: this will also resend the FileDownloaded event if successful...
|
||||
if fsf.VerifyOrResumeDownload(profile, conversation.ID, fileKey, constants.ImagePreviewMaxSizeInBytes) == nil {
|
||||
return
|
||||
}
|
||||
// Otherwise we fall through...
|
||||
}
|
||||
// Something went wrong...the file is marked as complete but either doesn't exist, or is corrupted such that we can't continue...
|
||||
// So mark complete as false...
|
||||
profile.SetScopedZonedAttribute(attr.LocalScope, attr.FilesharingZone, fmt.Sprintf("%s.complete", fileKey), event.False)
|
||||
}
|
||||
|
||||
// If we have reached this point then we need to download the file again...
|
||||
log.Debugf("Downloading Profile Image %v %v %v", fp, mp, fileKey)
|
||||
fsf.DownloadFile(profile, conversation.ID, fp, mp, fileKey, constants.ImagePreviewMaxSizeInBytes)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// handleImagePreviews checks settings and, if appropriate, auto-downloads any images
|
||||
func (i *ImagePreviewsFunctionality) handleImagePreviews(profile peer.CwtchPeer, ev *event.Event, conversationID, senderID int) {
|
||||
if profile.IsFeatureEnabled(constants.FileSharingExperiment) && profile.IsFeatureEnabled(constants.ImagePreviewsExperiment) {
|
||||
ci, err := profile.GetConversationInfo(senderID)
|
||||
if err != nil {
|
||||
log.Errorf("attempted to call handleImagePreviews with unknown conversation: %v", senderID)
|
||||
return
|
||||
}
|
||||
|
||||
if !ci.GetPeerAC().ShareFiles || !ci.GetPeerAC().RenderImages {
|
||||
log.Infof("refusing to autodownload files from sender: %v. conversation AC does not permit image rendering", senderID)
|
||||
return
|
||||
}
|
||||
|
||||
// Short-circuit failures
|
||||
// Don't auto-download images if the download path does not exist.
|
||||
if i.downloadFolder == "" {
|
||||
log.Errorf("download folder %v is not set", i.downloadFolder)
|
||||
return
|
||||
}
|
||||
|
||||
// Don't auto-download images if the download path does not exist.
|
||||
if _, err := os.Stat(i.downloadFolder); os.IsNotExist(err) {
|
||||
log.Errorf("download folder %v does not exist", i.downloadFolder)
|
||||
return
|
||||
}
|
||||
|
||||
// If file sharing is enabled then reshare all active files...
|
||||
fsf := FunctionalityGate()
|
||||
|
||||
// Now look at the image preview experiment
|
||||
var cm model.MessageWrapper
|
||||
err = json.Unmarshal([]byte(ev.Data[event.Data]), &cm)
|
||||
if err == nil && cm.Overlay == model.OverlayFileSharing {
|
||||
log.Debugf("Received File Sharing Message")
|
||||
var fm OverlayMessage
|
||||
err = json.Unmarshal([]byte(cm.Data), &fm)
|
||||
if err == nil {
|
||||
if fm.ShouldAutoDL() {
|
||||
basepath := i.downloadFolder
|
||||
fp, mp := GenerateDownloadPath(basepath, fm.Name, false)
|
||||
log.Debugf("autodownloading file! %v %v %v", basepath, fp, i.downloadFolder)
|
||||
ev.Data["Auto"] = constants.True
|
||||
mID, _ := strconv.Atoi(ev.Data["Index"])
|
||||
profile.UpdateMessageAttribute(conversationID, 0, mID, constants.AttrDownloaded, constants.True)
|
||||
fsf.DownloadFile(profile, senderID, fp, mp, fm.FileKey(), constants.ImagePreviewMaxSizeInBytes)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
|
@ -1,150 +0,0 @@
|
|||
package servers
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/model/attr"
|
||||
"cwtch.im/cwtch/model/constants"
|
||||
"cwtch.im/cwtch/peer"
|
||||
"cwtch.im/cwtch/protocol/connections"
|
||||
"cwtch.im/cwtch/settings"
|
||||
"encoding/json"
|
||||
"errors"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
)
|
||||
|
||||
const (
|
||||
// ServerList is a json encoded list of servers
|
||||
ServerList = event.Field("ServerList")
|
||||
)
|
||||
|
||||
const (
|
||||
// UpdateServerInfo is an event containing a ProfileOnion and a ServerList
|
||||
UpdateServerInfo = event.Type("UpdateServerInfo")
|
||||
)
|
||||
|
||||
// Functionality groups some common UI triggered functions for contacts...
|
||||
type Functionality struct {
|
||||
}
|
||||
|
||||
func (f *Functionality) NotifySettingsUpdate(settings settings.GlobalSettings) {
|
||||
|
||||
}
|
||||
|
||||
func (f *Functionality) EventsToRegister() []event.Type {
|
||||
return []event.Type{event.QueueJoinServer}
|
||||
}
|
||||
|
||||
func (f *Functionality) ExperimentsToRegister() []string {
|
||||
return []string{constants.GroupsExperiment}
|
||||
}
|
||||
|
||||
// OnEvent handles File Sharing Hooks like Manifest Received and FileDownloaded
|
||||
func (f *Functionality) OnEvent(ev event.Event, profile peer.CwtchPeer) {
|
||||
if profile.IsFeatureEnabled(constants.GroupsExperiment) {
|
||||
switch ev.EventType {
|
||||
// keep the UI in sync with the current backend server updates...
|
||||
// queue join server gets triggered on load and on new servers so it's a nice
|
||||
// low-noise event to hook into...
|
||||
case event.QueueJoinServer:
|
||||
f.PublishServerUpdate(profile)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (f *Functionality) OnContactRequestValue(profile peer.CwtchPeer, conversation model.Conversation, eventID string, path attr.ScopedZonedPath) {
|
||||
// nop
|
||||
}
|
||||
|
||||
func (f *Functionality) OnContactReceiveValue(profile peer.CwtchPeer, conversation model.Conversation, path attr.ScopedZonedPath, value string, exists bool) {
|
||||
// nopt
|
||||
}
|
||||
|
||||
// FunctionalityGate returns filesharing functionality - gates now happen on function calls.
|
||||
func FunctionalityGate() *Functionality {
|
||||
return new(Functionality)
|
||||
}
|
||||
|
||||
// ServerKey packages up key information...
|
||||
// TODO: Can this be merged with KeyBundle?
|
||||
type ServerKey struct {
|
||||
Type string `json:"type"`
|
||||
Key string `json:"key"`
|
||||
}
|
||||
|
||||
// SyncStatus packages up server sync information...
|
||||
type SyncStatus struct {
|
||||
StartTime string `json:"startTime"`
|
||||
LastMessageTime string `json:"lastMessageTime"`
|
||||
}
|
||||
|
||||
// Server encapsulates the information needed to represent a server...
|
||||
type Server struct {
|
||||
Onion string `json:"onion"`
|
||||
Identifier int `json:"identifier"`
|
||||
Status string `json:"status"`
|
||||
Description string `json:"description"`
|
||||
Keys []ServerKey `json:"keys"`
|
||||
SyncProgress SyncStatus `json:"syncProgress"`
|
||||
}
|
||||
|
||||
// PublishServerUpdate serializes the current list of group servers and publishes an event with this information
|
||||
func (f *Functionality) PublishServerUpdate(profile peer.CwtchPeer) error {
|
||||
serverListForOnion := f.GetServerInfoList(profile)
|
||||
serversListBytes, err := json.Marshal(serverListForOnion)
|
||||
profile.PublishEvent(event.NewEvent(UpdateServerInfo, map[event.Field]string{"ProfileOnion": profile.GetOnion(), ServerList: string(serversListBytes)}))
|
||||
return err
|
||||
}
|
||||
|
||||
// GetServerInfoList compiles all the information the UI might need regarding all servers..
|
||||
func (f *Functionality) GetServerInfoList(profile peer.CwtchPeer) []Server {
|
||||
var servers []Server
|
||||
for _, server := range profile.GetServers() {
|
||||
server, err := f.GetServerInfo(profile, server)
|
||||
if err != nil {
|
||||
log.Errorf("profile server list is corrupted: %v", err)
|
||||
continue
|
||||
}
|
||||
servers = append(servers, server)
|
||||
}
|
||||
return servers
|
||||
}
|
||||
|
||||
// DeleteServer purges a server and all related keys from a profile
|
||||
func (f *Functionality) DeleteServerInfo(profile peer.CwtchPeer, serverOnion string) error {
|
||||
// Servers are stores as special conversations
|
||||
ci, err := profile.FetchConversationInfo(serverOnion)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
// Purge keys...
|
||||
// NOTE: This will leave some groups in the state of being unable to connect to a particular
|
||||
// server.
|
||||
profile.DeleteConversation(ci.ID)
|
||||
f.PublishServerUpdate(profile)
|
||||
return nil
|
||||
}
|
||||
|
||||
// GetServerInfo compiles all the information the UI might need regarding a particular server including any verified
|
||||
// cryptographic keys
|
||||
func (f *Functionality) GetServerInfo(profile peer.CwtchPeer, serverOnion string) (Server, error) {
|
||||
serverInfo, err := profile.FetchConversationInfo(serverOnion)
|
||||
if err != nil {
|
||||
return Server{}, errors.New("server not found")
|
||||
}
|
||||
keyTypes := []model.KeyType{model.KeyTypeServerOnion, model.KeyTypeTokenOnion, model.KeyTypePrivacyPass}
|
||||
var serverKeys []ServerKey
|
||||
|
||||
for _, keyType := range keyTypes {
|
||||
if key, has := serverInfo.GetAttribute(attr.PublicScope, attr.ServerKeyZone, string(keyType)); has {
|
||||
serverKeys = append(serverKeys, ServerKey{Type: string(keyType), Key: key})
|
||||
}
|
||||
}
|
||||
|
||||
description, _ := serverInfo.GetAttribute(attr.LocalScope, attr.ServerZone, constants.Description)
|
||||
startTimeStr := serverInfo.Attributes[attr.LocalScope.ConstructScopedZonedPath(attr.LegacyGroupZone.ConstructZonedPath(constants.SyncPreLastMessageTime)).ToString()]
|
||||
recentTimeStr := serverInfo.Attributes[attr.LocalScope.ConstructScopedZonedPath(attr.LegacyGroupZone.ConstructZonedPath(constants.SyncMostRecentMessageTime)).ToString()]
|
||||
syncStatus := SyncStatus{startTimeStr, recentTimeStr}
|
||||
|
||||
return Server{Onion: serverOnion, Identifier: serverInfo.ID, Status: connections.ConnectionStateName[profile.GetPeerState(serverInfo.Handle)], Keys: serverKeys, Description: description, SyncProgress: syncStatus}, nil
|
||||
}
|
29
go.mod
29
go.mod
|
@ -1,29 +0,0 @@
|
|||
module cwtch.im/cwtch
|
||||
|
||||
go 1.20
|
||||
|
||||
require (
|
||||
git.openprivacy.ca/cwtch.im/tapir v0.6.0
|
||||
git.openprivacy.ca/openprivacy/connectivity v1.11.0
|
||||
git.openprivacy.ca/openprivacy/log v1.0.3
|
||||
github.com/gtank/ristretto255 v0.1.3-0.20210930101514-6bb39798585c
|
||||
github.com/mutecomm/go-sqlcipher/v4 v4.4.2
|
||||
github.com/onsi/ginkgo/v2 v2.1.4
|
||||
github.com/onsi/gomega v1.20.1
|
||||
golang.org/x/crypto v0.0.0-20220826181053-bd7e27e6170d
|
||||
)
|
||||
|
||||
require (
|
||||
filippo.io/edwards25519 v1.0.0 // indirect
|
||||
git.openprivacy.ca/openprivacy/bine v0.0.5 // indirect
|
||||
github.com/google/go-cmp v0.5.8 // indirect
|
||||
github.com/gtank/merlin v0.1.1 // indirect
|
||||
github.com/mimoo/StrobeGo v0.0.0-20220103164710-9a04d6ca976b // indirect
|
||||
github.com/stretchr/testify v1.7.0 // indirect
|
||||
go.etcd.io/bbolt v1.3.6 // indirect
|
||||
golang.org/x/net v0.0.0-20220826154423-83b083e8dc8b // indirect
|
||||
golang.org/x/sys v0.0.0-20220825204002-c680a09ffe64 // indirect
|
||||
golang.org/x/text v0.3.7 // indirect
|
||||
gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c // indirect
|
||||
gopkg.in/yaml.v3 v3.0.1 // indirect
|
||||
)
|
70
go.sum
70
go.sum
|
@ -1,70 +0,0 @@
|
|||
filippo.io/edwards25519 v1.0.0 h1:0wAIcmJUqRdI8IJ/3eGi5/HwXZWPujYXXlkrQogz0Ek=
|
||||
filippo.io/edwards25519 v1.0.0/go.mod h1:N1IkdkCkiLB6tki+MYJoSx2JTY9NUlxZE7eHn5EwJns=
|
||||
git.openprivacy.ca/cwtch.im/tapir v0.6.0 h1:TtnKjxitkIDMM7Qn0n/u+mOHRLJzuQUYjYRu5n0/QFY=
|
||||
git.openprivacy.ca/cwtch.im/tapir v0.6.0/go.mod h1:iQIq4y7N+DuP3CxyG66WNEC/d6vzh+wXvvOmelB+KoY=
|
||||
git.openprivacy.ca/openprivacy/bine v0.0.5 h1:DJs5gqw3SkvLSgRDvroqJxZ7F+YsbxbBRg5t0rU5gYE=
|
||||
git.openprivacy.ca/openprivacy/bine v0.0.5/go.mod h1:fwdeq6RO08WDkV0k7HfArsjRvurVULoUQmT//iaABZM=
|
||||
git.openprivacy.ca/openprivacy/connectivity v1.11.0 h1:roASjaFtQLu+HdH5fa2wx6F00NL3YsUTlmXBJh8aLZk=
|
||||
git.openprivacy.ca/openprivacy/connectivity v1.11.0/go.mod h1:OQO1+7OIz/jLxDrorEMzvZA6SEbpbDyLGpjoFqT3z1Y=
|
||||
git.openprivacy.ca/openprivacy/log v1.0.3 h1:E/PMm4LY+Q9s3aDpfySfEDq/vYQontlvNj/scrPaga0=
|
||||
git.openprivacy.ca/openprivacy/log v1.0.3/go.mod h1:gGYK8xHtndRLDymFtmjkG26GaMQNgyhioNS82m812Iw=
|
||||
github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
||||
github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/golang/protobuf v1.5.2 h1:ROPKBNFfQgOUMifHyP+KYbvpjbdoFNs+aK7DXlji0Tw=
|
||||
github.com/google/go-cmp v0.5.8 h1:e6P7q2lk1O+qJJb4BtCQXlK8vWEO8V1ZeuEdJNOqZyg=
|
||||
github.com/google/go-cmp v0.5.8/go.mod h1:17dUlkBOakJ0+DkrSSNjCkIjxS6bF9zb3elmeNGIjoY=
|
||||
github.com/gtank/merlin v0.1.1 h1:eQ90iG7K9pOhtereWsmyRJ6RAwcP4tHTDBHXNg+u5is=
|
||||
github.com/gtank/merlin v0.1.1/go.mod h1:T86dnYJhcGOh5BjZFCJWTDeTK7XW8uE+E21Cy/bIQ+s=
|
||||
github.com/gtank/ristretto255 v0.1.3-0.20210930101514-6bb39798585c h1:gkfmnY4Rlt3VINCo4uKdpvngiibQyoENVj5Q88sxXhE=
|
||||
github.com/gtank/ristretto255 v0.1.3-0.20210930101514-6bb39798585c/go.mod h1:tDPFhGdt3hJWqtKwx57i9baiB1Cj0yAg22VOPUqm5vY=
|
||||
github.com/kr/pretty v0.2.1 h1:Fmg33tUaq4/8ym9TJN1x7sLJnHVwhP33CNkpYV/7rwI=
|
||||
github.com/kr/pretty v0.2.1/go.mod h1:ipq/a2n7PKx3OHsz4KJII5eveXtPO4qwEXGdVfWzfnI=
|
||||
github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ=
|
||||
github.com/kr/text v0.1.0 h1:45sCR5RtlFHMR4UwH9sdQ5TC8v0qDQCHnXt+kaKSTVE=
|
||||
github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI=
|
||||
github.com/mimoo/StrobeGo v0.0.0-20181016162300-f8f6d4d2b643/go.mod h1:43+3pMjjKimDBf5Kr4ZFNGbLql1zKkbImw+fZbw3geM=
|
||||
github.com/mimoo/StrobeGo v0.0.0-20220103164710-9a04d6ca976b h1:QrHweqAtyJ9EwCaGHBu1fghwxIPiopAHV06JlXrMHjk=
|
||||
github.com/mimoo/StrobeGo v0.0.0-20220103164710-9a04d6ca976b/go.mod h1:xxLb2ip6sSUts3g1irPVHyk/DGslwQsNOo9I7smJfNU=
|
||||
github.com/mutecomm/go-sqlcipher/v4 v4.4.2 h1:eM10bFtI4UvibIsKr10/QT7Yfz+NADfjZYh0GKrXUNc=
|
||||
github.com/mutecomm/go-sqlcipher/v4 v4.4.2/go.mod h1:mF2UmIpBnzFeBdu/ypTDb/LdbS0nk0dfSN1WUsWTjMA=
|
||||
github.com/onsi/ginkgo/v2 v2.1.4 h1:GNapqRSid3zijZ9H77KrgVG4/8KqiyRsxcSxe+7ApXY=
|
||||
github.com/onsi/ginkgo/v2 v2.1.4/go.mod h1:um6tUpWM/cxCK3/FK8BXqEiUMUwRgSM4JXG47RKZmLU=
|
||||
github.com/onsi/gomega v1.20.1 h1:PA/3qinGoukvymdIDV8pii6tiZgC8kbmJO6Z5+b002Q=
|
||||
github.com/onsi/gomega v1.20.1/go.mod h1:DtrZpjmvpn2mPm4YWQa0/ALMDj9v4YxLgojwPeREyVo=
|
||||
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
||||
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
||||
github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
|
||||
github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI=
|
||||
github.com/stretchr/testify v1.6.1/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg=
|
||||
github.com/stretchr/testify v1.7.0 h1:nwc3DEeHmmLAfoZucVR881uASk0Mfjw8xYJ99tb5CcY=
|
||||
github.com/stretchr/testify v1.7.0/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg=
|
||||
go.etcd.io/bbolt v1.3.6 h1:/ecaJf0sk1l4l6V4awd65v2C3ILy7MSj+s/x1ADCIMU=
|
||||
go.etcd.io/bbolt v1.3.6/go.mod h1:qXsaaIqmgQH0T+OPdb99Bf+PKfBBQVAdyD6TY9G8XM4=
|
||||
golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w=
|
||||
golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
|
||||
golang.org/x/crypto v0.0.0-20201012173705-84dcc777aaee/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
|
||||
golang.org/x/crypto v0.0.0-20220826181053-bd7e27e6170d h1:3qF+Z8Hkrw9sOhrFHti9TlB1Hkac1x+DNRkv0XQiFjo=
|
||||
golang.org/x/crypto v0.0.0-20220826181053-bd7e27e6170d/go.mod h1:IxCIyHEi3zRg3s0A5j5BB6A9Jmi73HwBIUl50j+osU4=
|
||||
golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
|
||||
golang.org/x/net v0.0.0-20201010224723-4f7140c49acb/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU=
|
||||
golang.org/x/net v0.0.0-20220826154423-83b083e8dc8b h1:ZmngSVLe/wycRns9MKikG9OWIEjGcGAkacif7oYQaUY=
|
||||
golang.org/x/net v0.0.0-20220826154423-83b083e8dc8b/go.mod h1:YDH+HFinaLZZlnHAfSS6ZXJJ9M9t4Dl22yv3iI2vPwk=
|
||||
golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20200923182605-d9f96fdee20d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20200930185726-fdedc70b468f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20220825204002-c680a09ffe64 h1:UiNENfZ8gDvpiWw7IpOMQ27spWmThO1RwwdQVbJahJM=
|
||||
golang.org/x/sys v0.0.0-20220825204002-c680a09ffe64/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||
golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
|
||||
golang.org/x/text v0.3.3/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
|
||||
golang.org/x/text v0.3.7 h1:olpwvP2KacW1ZWvsR7uQhoyTYvKAupfQrRGBFM352Gk=
|
||||
golang.org/x/text v0.3.7/go.mod h1:u+2+/6zg+i71rQMx5EYifcz6MCKuco9NR6JIITiCfzQ=
|
||||
golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||
google.golang.org/protobuf v1.28.0 h1:w43yiav+6bVFTBQFZX0r7ipe9JQ1QsbMgHwbBziscLw=
|
||||
gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
||||
gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c h1:Hei/4ADfdWqJk1ZMxUNpqntNwaWcugrBjAiHlqqRiVk=
|
||||
gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c/go.mod h1:JHkPIbrfpd72SG/EVd6muEfDQjcINNoR0C8j2r3qZ4Q=
|
||||
gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
|
||||
gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
|
||||
gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
|
|
@ -1,104 +0,0 @@
|
|||
package attr
|
||||
|
||||
import (
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"strings"
|
||||
)
|
||||
|
||||
/*
|
||||
Scope model for peer attributes and requests
|
||||
|
||||
A local peer "Alice" has a PublicScope that is queryable by getVal requests.
|
||||
By default, for now, other scopes are private, of which we here define SettingsScope
|
||||
|
||||
Alice's peer structs of remote peers such as "Bob" keep the queried
|
||||
PublicScope values in the PeerScope, which can be overridden by the same named
|
||||
values stored in the LocalScope.
|
||||
|
||||
*/
|
||||
|
||||
// Scope strongly types Scope strings
|
||||
type Scope string
|
||||
|
||||
// ScopedZonedPath typed path with a scope and a zone
|
||||
type ScopedZonedPath string
|
||||
|
||||
func (szp ScopedZonedPath) GetScopeZonePath() (Scope, Zone, string) {
|
||||
scope, path := ParseScope(string(szp))
|
||||
zone, zpath := ParseZone(path)
|
||||
return scope, zone, zpath
|
||||
}
|
||||
|
||||
// scopes for attributes
|
||||
const (
|
||||
// on a peer, local and peer supplied data
|
||||
LocalScope = Scope("local")
|
||||
PeerScope = Scope("peer")
|
||||
ConversationScope = Scope("conversation")
|
||||
|
||||
// on a local profile, public data and private settings
|
||||
PublicScope = Scope("public")
|
||||
|
||||
UnknownScope = Scope("unknown")
|
||||
)
|
||||
|
||||
// Separator for scope and the rest of path
|
||||
const Separator = "."
|
||||
|
||||
// IntoScope converts a string to a Scope
|
||||
func IntoScope(scope string) Scope {
|
||||
switch scope {
|
||||
case "local":
|
||||
return LocalScope
|
||||
case "peer":
|
||||
return PeerScope
|
||||
case "conversation":
|
||||
return ConversationScope
|
||||
case "public":
|
||||
return PublicScope
|
||||
}
|
||||
return UnknownScope
|
||||
}
|
||||
|
||||
// ConstructScopedZonedPath enforces a scope over a zoned path
|
||||
func (scope Scope) ConstructScopedZonedPath(zonedPath ZonedPath) ScopedZonedPath {
|
||||
return ScopedZonedPath(string(scope) + Separator + string(zonedPath))
|
||||
}
|
||||
|
||||
// ToString converts a ScopedZonedPath to a string
|
||||
func (szp ScopedZonedPath) ToString() string {
|
||||
return string(szp)
|
||||
}
|
||||
|
||||
// IsLocal returns true if the scope is a local scope
|
||||
func (scope Scope) IsLocal() bool {
|
||||
return scope == LocalScope
|
||||
}
|
||||
|
||||
// IsPeer returns true if the scope is a peer scope
|
||||
func (scope Scope) IsPeer() bool {
|
||||
return scope == PeerScope
|
||||
}
|
||||
|
||||
// IsPublic returns true if the scope is a public scope
|
||||
func (scope Scope) IsPublic() bool {
|
||||
return scope == PublicScope
|
||||
}
|
||||
|
||||
// IsConversation returns true if the scope is a conversation scope
|
||||
func (scope Scope) IsConversation() bool {
|
||||
return scope == ConversationScope
|
||||
}
|
||||
|
||||
// ParseScope takes in an untyped string and returns an explicit Scope along with the rest of the untyped path
|
||||
func ParseScope(path string) (Scope, string) {
|
||||
parts := strings.SplitN(path, Separator, 3)
|
||||
|
||||
log.Debugf("parsed scope: %v %v", parts, path)
|
||||
|
||||
if len(parts) != 3 {
|
||||
return UnknownScope, ""
|
||||
}
|
||||
|
||||
return IntoScope(parts[0]), parts[1] + Separator + parts[2]
|
||||
}
|
|
@ -1,71 +0,0 @@
|
|||
package attr
|
||||
|
||||
import (
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"strings"
|
||||
)
|
||||
|
||||
// Zone forces attributes to belong to a given subsystem e.g profile or filesharing
|
||||
// Note: Zone is different from Scope which deals with public visibility of a given attribute
|
||||
type Zone string
|
||||
|
||||
// ZonedPath explicitly types paths that contain a zone for strongly typed APIs
|
||||
type ZonedPath string
|
||||
|
||||
const (
|
||||
|
||||
// ProfileZone for attributes related to profile details like name and profile image
|
||||
ProfileZone = Zone("profile")
|
||||
|
||||
// LegacyGroupZone for attributes related to legacy group experiment
|
||||
LegacyGroupZone = Zone("legacygroup")
|
||||
|
||||
// FilesharingZone for attributes related to file sharing
|
||||
FilesharingZone = Zone("filesharing")
|
||||
|
||||
// ServerKeyZone for attributes related to Server Keys
|
||||
ServerKeyZone = Zone("serverkey")
|
||||
|
||||
// ServerZone is for attributes related to the server
|
||||
ServerZone = Zone("server")
|
||||
|
||||
// UnknownZone is a catch all useful for error handling
|
||||
UnknownZone = Zone("unknown")
|
||||
)
|
||||
|
||||
// ConstructZonedPath takes a path and attaches a zone to it.
|
||||
// Note that this returns a ZonedPath which isn't directly usable, it must be given to ConstructScopedZonedPath
|
||||
// in order to be realized into an actual attribute path.
|
||||
func (zone Zone) ConstructZonedPath(path string) ZonedPath {
|
||||
return ZonedPath(string(zone) + Separator + path)
|
||||
}
|
||||
|
||||
func (zp ZonedPath) ToString() string {
|
||||
return string(zp)
|
||||
}
|
||||
|
||||
// ParseZone takes in an untyped string and returns an explicit Zone along with the rest of the untyped path
|
||||
func ParseZone(path string) (Zone, string) {
|
||||
parts := strings.SplitN(path, Separator, 2)
|
||||
|
||||
log.Debugf("parsed zone: %v %v", parts, path)
|
||||
|
||||
if len(parts) != 2 {
|
||||
return UnknownZone, ""
|
||||
}
|
||||
|
||||
switch Zone(parts[0]) {
|
||||
case ProfileZone:
|
||||
return ProfileZone, parts[1]
|
||||
case LegacyGroupZone:
|
||||
return LegacyGroupZone, parts[1]
|
||||
case FilesharingZone:
|
||||
return FilesharingZone, parts[1]
|
||||
case ServerKeyZone:
|
||||
return ServerKeyZone, parts[1]
|
||||
case ServerZone:
|
||||
return ServerZone, parts[1]
|
||||
default:
|
||||
return UnknownZone, parts[1]
|
||||
}
|
||||
}
|
|
@ -1,74 +0,0 @@
|
|||
package constants
|
||||
|
||||
// Name refers to a Profile Name
|
||||
const Name = "name"
|
||||
|
||||
// Onion refers the Onion address of the profile
|
||||
const Onion = "onion"
|
||||
|
||||
// Tag describes the type of a profile e.g. default password / encrypted etc.
|
||||
const Tag = "tag"
|
||||
|
||||
// ProfileTypeV1DefaultPassword is a tag describing a profile protected with the default password.
|
||||
const ProfileTypeV1DefaultPassword = "v1-defaultPassword"
|
||||
|
||||
// ProfileTypeV1Password is a tag describing a profile encrypted derived from a user-provided password.
|
||||
const ProfileTypeV1Password = "v1-userPassword"
|
||||
|
||||
// GroupID is the ID of a group
|
||||
const GroupID = "groupid"
|
||||
|
||||
// GroupServer identifies the Server the legacy group is hosted on
|
||||
const GroupServer = "groupserver"
|
||||
|
||||
// GroupKey is the name of the group key attribute...
|
||||
const GroupKey = "groupkey"
|
||||
|
||||
// True - true
|
||||
const True = "true"
|
||||
|
||||
// False - false
|
||||
const False = "false"
|
||||
|
||||
// AttrAuthor - conversation attribute for author of the message - referenced by pub key rather than conversation id because of groups.
|
||||
const AttrAuthor = "author"
|
||||
|
||||
// AttrAck - conversation attribute for acknowledgement status
|
||||
const AttrAck = "ack"
|
||||
|
||||
// AttrErr - conversation attribute for errored status
|
||||
const AttrErr = "error"
|
||||
|
||||
// AttrSentTimestamp - conversation attribute for the time the message was (nominally) sent
|
||||
const AttrSentTimestamp = "sent"
|
||||
|
||||
// Legacy MessageFlags
|
||||
|
||||
// AttrRejected - conversation attribute for storing rejected prompts (for invites)
|
||||
const AttrRejected = "rejected-invite"
|
||||
|
||||
// AttrDownloaded - conversation attribute for storing downloaded prompts (for file downloads)
|
||||
const AttrDownloaded = "file-downloaded"
|
||||
|
||||
const CustomProfileImageKey = "custom-profile-image"
|
||||
|
||||
const SyncPreLastMessageTime = "SyncPreLastMessageTime"
|
||||
const SyncMostRecentMessageTime = "SyncMostRecentMessageTime"
|
||||
|
||||
const AttrLastConnectionTime = "last-connection-time"
|
||||
const PeerAutostart = "autostart"
|
||||
const PeerAppearOffline = "appear-offline"
|
||||
const Archived = "archived"
|
||||
|
||||
const ProfileStatus = "profile-status"
|
||||
const ProfileAttribute1 = "profile-attribute-1"
|
||||
const ProfileAttribute2 = "profile-attribute-2"
|
||||
const ProfileAttribute3 = "profile-attribute-3"
|
||||
|
||||
// Description is used on server contacts,
|
||||
const Description = "description"
|
||||
|
||||
// Used to store the status of acl migrations
|
||||
const ACLVersion = "acl-version"
|
||||
const ACLVersionOne = "acl-v1"
|
||||
const ACLVersionTwo = "acl-v2"
|
|
@ -1,13 +0,0 @@
|
|||
package constants
|
||||
|
||||
// ServerPrefix precedes a server import statement
|
||||
const ServerPrefix = "server:"
|
||||
|
||||
// TofuBundlePrefix precedes a server and a group import statement
|
||||
const TofuBundlePrefix = "tofubundle:"
|
||||
|
||||
// GroupPrefix precedes a group import statement
|
||||
const GroupPrefix = "torv3"
|
||||
|
||||
// ImportBundlePrefix is an error api constant for import bundle error messages
|
||||
const ImportBundlePrefix = "importBundle"
|
|
@ -1,7 +0,0 @@
|
|||
package constants
|
||||
|
||||
// InvalidPasswordError is returned when an incorrect password is provided to a function that requires the current active password
|
||||
const InvalidPasswordError = "invalid_password_error"
|
||||
|
||||
// PasswordsDoNotMatchError is returned when two passwords do not match
|
||||
const PasswordsDoNotMatchError = "passwords_do_not_match"
|
|
@ -1,21 +0,0 @@
|
|||
package constants
|
||||
|
||||
const GroupsExperiment = "tapir-groups-experiment"
|
||||
|
||||
// FileSharingExperiment Allows file sharing
|
||||
const FileSharingExperiment = "filesharing"
|
||||
|
||||
// ImagePreviewsExperiment Causes images (up to ImagePreviewMaxSizeInBytes, from accepted contacts) to auto-dl and preview
|
||||
// requires FileSharingExperiment to be enabled
|
||||
const ImagePreviewsExperiment = "filesharing-images"
|
||||
|
||||
// ImagePreviewMaxSizeInBytes Files up to this size will be autodownloaded using ImagePreviewsExperiment
|
||||
const ImagePreviewMaxSizeInBytes = 20971520
|
||||
|
||||
const MessageFormattingExperiment = "message-formatting"
|
||||
|
||||
// AutoDLFileExts Files with these extensions will be autodownloaded using ImagePreviewsExperiment
|
||||
var AutoDLFileExts = [...]string{".jpg", ".jpeg", ".png", ".gif", ".webp", ".bmp"}
|
||||
|
||||
// BlodeuweddExperiment enables the Blodeuwedd Assistant
|
||||
const BlodeuweddExperiment = "blodeuwedd"
|
|
@ -1,156 +0,0 @@
|
|||
package model
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"time"
|
||||
|
||||
"cwtch.im/cwtch/model/attr"
|
||||
"cwtch.im/cwtch/model/constants"
|
||||
"git.openprivacy.ca/openprivacy/connectivity/tor"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
)
|
||||
|
||||
// AccessControl is a type determining client assigned authorization to a peer
|
||||
// for a given conversation
|
||||
type AccessControl struct {
|
||||
Blocked bool // Any attempts from this handle to connect are blocked overrides all other settings
|
||||
|
||||
// Basic Conversation Rights
|
||||
Read bool // Allows a handle to access the conversation
|
||||
Append bool // Allows a handle to append new messages to the conversation
|
||||
|
||||
AutoConnect bool // Profile should automatically try to connect with peer
|
||||
ExchangeAttributes bool // Profile should automatically exchange attributes like Name, Profile Image, etc.
|
||||
|
||||
// Extension Related Permissions
|
||||
ShareFiles bool // Allows a handle to share files to a conversation
|
||||
RenderImages bool // Indicates that certain filetypes should be autodownloaded and rendered when shared by this contact
|
||||
}
|
||||
|
||||
// DefaultP2PAccessControl defaults to a semi-trusted peer with no access to special extensions.
|
||||
func DefaultP2PAccessControl() AccessControl {
|
||||
return AccessControl{Read: true, Append: true, ExchangeAttributes: true, Blocked: false,
|
||||
AutoConnect: true, ShareFiles: false, RenderImages: false}
|
||||
}
|
||||
|
||||
// AccessControlList represents an access control list for a conversation. Mapping handles to conversation
|
||||
// functions
|
||||
type AccessControlList map[string]AccessControl
|
||||
|
||||
// Serialize transforms the ACL into json.
|
||||
func (acl *AccessControlList) Serialize() []byte {
|
||||
data, _ := json.Marshal(acl)
|
||||
return data
|
||||
}
|
||||
|
||||
// DeserializeAccessControlList takes in JSON and returns an AccessControlList
|
||||
func DeserializeAccessControlList(data []byte) (AccessControlList, error) {
|
||||
var acl AccessControlList
|
||||
err := json.Unmarshal(data, &acl)
|
||||
return acl, err
|
||||
}
|
||||
|
||||
// Attributes a type-driven encapsulation of an Attribute map.
|
||||
type Attributes map[string]string
|
||||
|
||||
// Serialize transforms an Attributes map into a JSON struct
|
||||
func (a *Attributes) Serialize() []byte {
|
||||
data, _ := json.Marshal(a)
|
||||
return data
|
||||
}
|
||||
|
||||
// DeserializeAttributes converts a JSON struct into an Attributes map
|
||||
func DeserializeAttributes(data []byte) Attributes {
|
||||
attributes := make(Attributes)
|
||||
err := json.Unmarshal(data, &attributes)
|
||||
if err != nil {
|
||||
log.Error("error deserializing attributes (this is likely a programming error): %v", err)
|
||||
return make(Attributes)
|
||||
}
|
||||
return attributes
|
||||
}
|
||||
|
||||
// Conversation encapsulates high-level information about a conversation, including the
|
||||
// handle, any set attributes, the access control list associated with the message tree and the
|
||||
// accepted status of the conversation (whether the user has consented into the conversation).
|
||||
type Conversation struct {
|
||||
ID int
|
||||
Handle string
|
||||
Attributes Attributes
|
||||
ACL AccessControlList
|
||||
|
||||
// Deprecated, please use ACL for permissions related functions
|
||||
Accepted bool
|
||||
}
|
||||
|
||||
// GetAttribute is a helper function that fetches a conversation attribute by scope, zone and key
|
||||
func (ci *Conversation) GetAttribute(scope attr.Scope, zone attr.Zone, key string) (string, bool) {
|
||||
if value, exists := ci.Attributes[scope.ConstructScopedZonedPath(zone.ConstructZonedPath(key)).ToString()]; exists {
|
||||
return value, true
|
||||
}
|
||||
return "", false
|
||||
}
|
||||
|
||||
// GetPeerAC returns a suitable Access Control object for a the given peer conversation
|
||||
// If this is called for a group conversation, this method will error and return a safe default AC.
|
||||
func (ci *Conversation) GetPeerAC() AccessControl {
|
||||
if acl, exists := ci.ACL[ci.Handle]; exists {
|
||||
return acl
|
||||
}
|
||||
log.Errorf("attempted to access a Peer Access Control object from %v but peer ACL is undefined. This is likely a programming error", ci.Handle)
|
||||
return DefaultP2PAccessControl()
|
||||
}
|
||||
|
||||
// IsCwtchPeer is a helper attribute that identifies whether a conversation is a cwtch peer
|
||||
func (ci *Conversation) IsCwtchPeer() bool {
|
||||
return tor.IsValidHostname(ci.Handle)
|
||||
}
|
||||
|
||||
// IsGroup is a helper attribute that identifies whether a conversation is a legacy group
|
||||
func (ci *Conversation) IsGroup() bool {
|
||||
if _, exists := ci.Attributes[attr.LocalScope.ConstructScopedZonedPath(attr.LegacyGroupZone.ConstructZonedPath(constants.GroupID)).ToString()]; exists {
|
||||
return true
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
// IsServer is a helper attribute that identifies whether a conversation is with a server
|
||||
func (ci *Conversation) IsServer() bool {
|
||||
if _, exists := ci.Attributes[attr.PublicScope.ConstructScopedZonedPath(attr.ServerKeyZone.ConstructZonedPath(string(BundleType))).ToString()]; exists {
|
||||
return true
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
// ServerSyncProgress is only valid during a server being in the AUTHENTICATED state and therefor in the syncing process
|
||||
// it returns a double (0-1) representing the estimated progress of the syncing
|
||||
func (ci *Conversation) ServerSyncProgress() float64 {
|
||||
startTimeStr, startExists := ci.Attributes[attr.LocalScope.ConstructScopedZonedPath(attr.LegacyGroupZone.ConstructZonedPath(constants.SyncPreLastMessageTime)).ToString()]
|
||||
recentTimeStr, recentExists := ci.Attributes[attr.LocalScope.ConstructScopedZonedPath(attr.LegacyGroupZone.ConstructZonedPath(constants.SyncMostRecentMessageTime)).ToString()]
|
||||
|
||||
if !startExists || !recentExists {
|
||||
return 0.0
|
||||
}
|
||||
|
||||
startTime, err := time.Parse(startTimeStr, time.RFC3339Nano)
|
||||
if err != nil {
|
||||
return 0.0
|
||||
}
|
||||
recentTime, err := time.Parse(recentTimeStr, time.RFC3339Nano)
|
||||
if err != nil {
|
||||
return 0.0
|
||||
}
|
||||
|
||||
syncRange := time.Since(startTime)
|
||||
pointFromStart := startTime.Sub(recentTime)
|
||||
return pointFromStart.Seconds() / syncRange.Seconds()
|
||||
}
|
||||
|
||||
// ConversationMessage bundles an instance of a conversation message row
|
||||
type ConversationMessage struct {
|
||||
ID int
|
||||
Body string
|
||||
Attr Attributes
|
||||
Signature string
|
||||
ContentHash string
|
||||
}
|
|
@ -1,15 +0,0 @@
|
|||
package model
|
||||
|
||||
// Error models some common errors that need to be handled by applications that use Cwtch
|
||||
type Error string
|
||||
|
||||
// Error is the error interface
|
||||
func (e Error) Error() string {
|
||||
return string(e)
|
||||
}
|
||||
|
||||
// Error definitions
|
||||
const (
|
||||
InvalidEd25519PublicKey = Error("InvalidEd25519PublicKey")
|
||||
InconsistentKeyBundleError = Error("InconsistentKeyBundleError")
|
||||
)
|
|
@ -1,41 +0,0 @@
|
|||
package model
|
||||
|
||||
import "sync"
|
||||
|
||||
// Experiments are optional functionality that can be enabled/disabled by an application either completely or individually.
|
||||
// examples of experiments include File Sharing, Profile Images and Groups.
|
||||
type Experiments struct {
|
||||
enabled bool
|
||||
experiments sync.Map
|
||||
}
|
||||
|
||||
// InitExperiments encapsulates a set of experiments separate from their storage in GlobalSettings.
|
||||
func InitExperiments(enabled bool, experiments map[string]bool) Experiments {
|
||||
|
||||
var syncExperiments sync.Map
|
||||
for experiment, set := range experiments {
|
||||
syncExperiments.Store(experiment, set)
|
||||
}
|
||||
|
||||
return Experiments{
|
||||
enabled: enabled,
|
||||
experiments: syncExperiments,
|
||||
}
|
||||
}
|
||||
|
||||
// IsEnabled is a convenience function that takes in an experiment and returns true if it is enabled. Experiments
|
||||
// are only enabled if both global experiments are turned on and if the specific experiment is also turned on.
|
||||
// The one exception to this is experiments that have been promoted to default functionality which may be turned on
|
||||
// even if experiments turned off globally. These experiments are defined by DefaultEnabledFunctionality.
|
||||
func (e *Experiments) IsEnabled(experiment string) bool {
|
||||
if !e.enabled {
|
||||
// todo handle default-enabled functionality
|
||||
return false
|
||||
}
|
||||
|
||||
enabled, exists := e.experiments.Load(experiment)
|
||||
if !exists {
|
||||
return false
|
||||
}
|
||||
return enabled.(bool)
|
||||
}
|
340
model/group.go
340
model/group.go
|
@ -1,280 +1,176 @@
|
|||
package model
|
||||
|
||||
import (
|
||||
"crypto/ed25519"
|
||||
"crypto/rand"
|
||||
"crypto/sha512"
|
||||
"cwtch.im/cwtch/protocol/groups"
|
||||
"encoding/base32"
|
||||
"encoding/base64"
|
||||
"encoding/hex"
|
||||
"encoding/json"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"errors"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives"
|
||||
"git.openprivacy.ca/openprivacy/connectivity/tor"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"golang.org/x/crypto/nacl/secretbox"
|
||||
"golang.org/x/crypto/pbkdf2"
|
||||
"io"
|
||||
"strings"
|
||||
"log"
|
||||
"sync"
|
||||
"time"
|
||||
)
|
||||
|
||||
// CurrentGroupVersion is used to set the version of newly created groups and make sure group structs stored are correct and up to date
|
||||
const CurrentGroupVersion = 4
|
||||
|
||||
// GroupInvitePrefix identifies a particular string as being a serialized group invite.
|
||||
const GroupInvitePrefix = "torv3"
|
||||
|
||||
// Group defines and encapsulates Cwtch's conception of group chat. Which are sessions
|
||||
// tied to a server under a given group key. Each group has a set of Messages.
|
||||
// tied to a server under a given group key. Each group has a set of messages.
|
||||
type Group struct {
|
||||
// GroupID is now derived from the GroupKey and the GroupServer
|
||||
GroupID string
|
||||
GroupName string
|
||||
GroupKey [32]byte
|
||||
GroupServer string
|
||||
Attributes map[string]string //legacy to not use
|
||||
Version int
|
||||
Timeline Timeline `json:"-"`
|
||||
LocalID string
|
||||
GroupID string
|
||||
SignedGroupID []byte
|
||||
GroupKey [32]byte
|
||||
GroupServer string
|
||||
Timeline Timeline
|
||||
Accepted bool
|
||||
Owner string
|
||||
IsCompromised bool
|
||||
InitialMessage []byte
|
||||
Attributes map[string]string
|
||||
lock sync.Mutex
|
||||
NewMessage chan Message `json:"-"`
|
||||
}
|
||||
|
||||
// NewGroup initializes a new group associated with a given CwtchServer
|
||||
func NewGroup(server string) (*Group, error) {
|
||||
group := new(Group)
|
||||
if !tor.IsValidHostname(server) {
|
||||
return nil, errors.New("server is not a valid v3 onion")
|
||||
|
||||
if utils.IsValidHostname(server) == false {
|
||||
return nil, errors.New("Server is not a valid v3 onion")
|
||||
}
|
||||
|
||||
group.GroupServer = server
|
||||
|
||||
var groupID [16]byte
|
||||
if _, err := io.ReadFull(rand.Reader, groupID[:]); err != nil {
|
||||
log.Printf("Error: Cannot read from random: %v\n", err)
|
||||
return nil, err
|
||||
}
|
||||
group.GroupID = fmt.Sprintf("%x", groupID)
|
||||
|
||||
var groupKey [32]byte
|
||||
if _, err := io.ReadFull(rand.Reader, groupKey[:]); err != nil {
|
||||
log.Errorf("Error: Cannot read from random: %v\n", err)
|
||||
log.Printf("Error: Cannot read from random: %v\n", err)
|
||||
return nil, err
|
||||
}
|
||||
copy(group.GroupKey[:], groupKey[:])
|
||||
|
||||
// Derive Group ID from the group key and the server public key. This binds the group to a particular server
|
||||
// and key.
|
||||
var err error
|
||||
group.GroupID, err = deriveGroupID(groupKey[:], server)
|
||||
return group, err
|
||||
group.Owner = "self"
|
||||
group.Attributes = make(map[string]string)
|
||||
return group, nil
|
||||
}
|
||||
|
||||
// CheckGroup returns true only if the ID of the group is cryptographically valid.
|
||||
func (g *Group) CheckGroup() bool {
|
||||
id, _ := deriveGroupID(g.GroupKey[:], g.GroupServer)
|
||||
return g.GroupID == id
|
||||
// SignGroup adds a signature to the group.
|
||||
func (g *Group) SignGroup(signature []byte) {
|
||||
g.SignedGroupID = signature
|
||||
copy(g.Timeline.SignedGroupID[:], g.SignedGroupID)
|
||||
}
|
||||
|
||||
// deriveGroupID hashes together the key and the hostname to create a bound identifier that can later
|
||||
// be referenced and checked by profiles when they receive invites and messages.
|
||||
func deriveGroupID(groupKey []byte, serverHostname string) (string, error) {
|
||||
data, err := base32.StdEncoding.DecodeString(strings.ToUpper(serverHostname))
|
||||
if err != nil {
|
||||
return "", err
|
||||
}
|
||||
pubkey := data[0:ed25519.PublicKeySize]
|
||||
return hex.EncodeToString(pbkdf2.Key(groupKey, pubkey, 4096, 16, sha512.New)), nil
|
||||
// Compromised should be called if we detect a a groupkey leak.
|
||||
func (g *Group) Compromised() {
|
||||
g.IsCompromised = true
|
||||
}
|
||||
|
||||
// GetInitialMessage returns the first message of the group, if one was sent with the invite.
|
||||
func (g *Group) GetInitialMessage() []byte {
|
||||
g.lock.Lock()
|
||||
defer g.lock.Unlock()
|
||||
return g.InitialMessage
|
||||
}
|
||||
|
||||
// Invite generates a invitation that can be sent to a cwtch peer
|
||||
func (g *Group) Invite() (string, error) {
|
||||
func (g *Group) Invite(initialMessage []byte) ([]byte, error) {
|
||||
|
||||
gci := &groups.GroupInvite{
|
||||
GroupID: g.GroupID,
|
||||
GroupName: g.GroupName,
|
||||
SharedKey: g.GroupKey[:],
|
||||
ServerHost: g.GroupServer,
|
||||
if g.SignedGroupID == nil {
|
||||
return nil, errors.New("group isn't signed")
|
||||
}
|
||||
|
||||
invite, err := json.Marshal(gci)
|
||||
serializedInvite := fmt.Sprintf("%v%v", GroupInvitePrefix, base64.StdEncoding.EncodeToString(invite))
|
||||
return serializedInvite, err
|
||||
g.InitialMessage = initialMessage[:]
|
||||
|
||||
gci := &protocol.GroupChatInvite{
|
||||
GroupName: g.GroupID,
|
||||
GroupSharedKey: g.GroupKey[:],
|
||||
ServerHost: g.GroupServer,
|
||||
SignedGroupId: g.SignedGroupID[:],
|
||||
InitialMessage: initialMessage[:],
|
||||
}
|
||||
|
||||
cp := &protocol.CwtchPeerPacket{
|
||||
GroupChatInvite: gci,
|
||||
}
|
||||
invite, err := proto.Marshal(cp)
|
||||
return invite, err
|
||||
}
|
||||
|
||||
// EncryptMessage takes a message and encrypts the message under the group key.
|
||||
func (g *Group) EncryptMessage(message *groups.DecryptedGroupMessage) ([]byte, error) {
|
||||
// AddMessage takes a DecryptedGroupMessage and adds it to the Groups Timeline
|
||||
func (g *Group) AddMessage(message *protocol.DecryptedGroupMessage, sig []byte) *Message {
|
||||
g.lock.Lock()
|
||||
timelineMessage := &Message{
|
||||
Message: message.GetText(),
|
||||
Timestamp: time.Unix(int64(message.GetTimestamp()), 0),
|
||||
Received: time.Now(),
|
||||
Signature: sig,
|
||||
PeerID: message.GetOnion(),
|
||||
PreviousMessageSig: message.GetPreviousMessageSig(),
|
||||
}
|
||||
seen := g.Timeline.Insert(timelineMessage)
|
||||
g.lock.Unlock()
|
||||
|
||||
// Send a new Message notification if we have an app that is listening.
|
||||
if g.NewMessage != nil && !seen {
|
||||
g.NewMessage <- *timelineMessage
|
||||
}
|
||||
return timelineMessage
|
||||
}
|
||||
|
||||
// GetTimeline provides a safe copy of the timeline-=
|
||||
func (g *Group) GetTimeline() (t []Message) {
|
||||
g.lock.Lock()
|
||||
t = g.Timeline.GetMessages()
|
||||
g.lock.Unlock()
|
||||
return
|
||||
|
||||
}
|
||||
|
||||
//EncryptMessage takes a message and encrypts the message under the group key.
|
||||
func (g *Group) EncryptMessage(message *protocol.DecryptedGroupMessage) ([]byte, error) {
|
||||
var nonce [24]byte
|
||||
if _, err := io.ReadFull(rand.Reader, nonce[:]); err != nil {
|
||||
log.Errorf("Cannot read from random: %v\n", err)
|
||||
return nil, err
|
||||
}
|
||||
wire, err := json.Marshal(message)
|
||||
if err != nil {
|
||||
log.Printf("Error: Cannot read from random: %v\n", err)
|
||||
return nil, err
|
||||
}
|
||||
wire, err := proto.Marshal(message)
|
||||
utils.CheckError(err)
|
||||
encrypted := secretbox.Seal(nonce[:], []byte(wire), &nonce, &g.GroupKey)
|
||||
return encrypted, nil
|
||||
}
|
||||
|
||||
// DecryptMessage takes a ciphertext and returns true and the decrypted message if the
|
||||
// cipher text can be successfully decrypted,else false.
|
||||
func (g *Group) DecryptMessage(ciphertext []byte) (bool, *groups.DecryptedGroupMessage) {
|
||||
if len(ciphertext) > 24 {
|
||||
var decryptNonce [24]byte
|
||||
copy(decryptNonce[:], ciphertext[:24])
|
||||
decrypted, ok := secretbox.Open(nil, ciphertext[24:], &decryptNonce, &g.GroupKey)
|
||||
if ok {
|
||||
dm := &groups.DecryptedGroupMessage{}
|
||||
err := json.Unmarshal(decrypted, dm)
|
||||
if err == nil {
|
||||
return true, dm
|
||||
}
|
||||
}
|
||||
}
|
||||
return false, nil
|
||||
}
|
||||
|
||||
// ValidateInvite takes in a serialized invite and returns the invite structure if it is cryptographically valid
|
||||
// and an error if it is not
|
||||
func ValidateInvite(invite string) (*groups.GroupInvite, error) {
|
||||
// We prefix invites for groups with torv3
|
||||
if strings.HasPrefix(invite, GroupInvitePrefix) {
|
||||
data, err := base64.StdEncoding.DecodeString(invite[len(GroupInvitePrefix):])
|
||||
func (g *Group) DecryptMessage(ciphertext []byte) (bool, *protocol.DecryptedGroupMessage) {
|
||||
var decryptNonce [24]byte
|
||||
copy(decryptNonce[:], ciphertext[:24])
|
||||
decrypted, ok := secretbox.Open(nil, ciphertext[24:], &decryptNonce, &g.GroupKey)
|
||||
if ok {
|
||||
dm := &protocol.DecryptedGroupMessage{}
|
||||
err := proto.Unmarshal(decrypted, dm)
|
||||
if err == nil {
|
||||
// First attempt to unmarshal the json...
|
||||
var gci groups.GroupInvite
|
||||
err := json.Unmarshal(data, &gci)
|
||||
if err == nil {
|
||||
|
||||
// Validate the Invite by first checking that the server is a valid v3 onion
|
||||
if !tor.IsValidHostname(gci.ServerHost) {
|
||||
return nil, errors.New("server is not a valid v3 onion")
|
||||
}
|
||||
|
||||
// Validate the length of the shared key...
|
||||
if len(gci.SharedKey) != 32 {
|
||||
return nil, errors.New("key length is not 32 bytes")
|
||||
}
|
||||
|
||||
// Derive the servers public key (we can ignore the error checking here because it's already been
|
||||
// done by IsValidHostname, and check that we derive the same groupID...
|
||||
derivedGroupID, _ := deriveGroupID(gci.SharedKey, gci.ServerHost)
|
||||
if derivedGroupID != gci.GroupID {
|
||||
return nil, errors.New("group id is invalid")
|
||||
}
|
||||
|
||||
// Replace the original with the derived, this should be a no-op at this point but defense in depth...
|
||||
gci.GroupID = derivedGroupID
|
||||
return &gci, nil
|
||||
}
|
||||
return true, dm
|
||||
}
|
||||
}
|
||||
return nil, errors.New("invite has invalid structure")
|
||||
}
|
||||
|
||||
// AttemptDecryption takes a ciphertext and signature and attempts to decrypt it under known groups.
|
||||
// If successful, adds the message to the group's timeline
|
||||
func (g *Group) AttemptDecryption(ciphertext []byte, signature []byte) (bool, *groups.DecryptedGroupMessage) {
|
||||
success, dgm := g.DecryptMessage(ciphertext)
|
||||
// the second check here is not needed, but DecryptMessage violates the usual
|
||||
// go calling convention and we want static analysis tools to pick it up
|
||||
if success && dgm != nil {
|
||||
|
||||
// Attempt to serialize this message
|
||||
serialized, err := json.Marshal(dgm)
|
||||
|
||||
// Someone send a message that isn't a valid Decrypted Group Message. Since we require this struct in orer
|
||||
// to verify the message, we simply ignore it.
|
||||
if err != nil {
|
||||
return false, nil
|
||||
}
|
||||
|
||||
// This now requires knowledge of the Sender, the Onion and the Specific Decrypted Group Message (which should only
|
||||
// be derivable from the cryptographic key) which contains many unique elements such as the time and random padding
|
||||
verified := g.VerifyGroupMessage(dgm.Onion, g.GroupID, base64.StdEncoding.EncodeToString(serialized), signature)
|
||||
|
||||
if !verified {
|
||||
// An earlier version of this protocol mistakenly signed the ciphertext of the message
|
||||
// instead of the serialized decrypted group message.
|
||||
// This has 2 issues:
|
||||
// 1. A server with knowledge of group members public keys AND the Group ID would be able to detect valid messages
|
||||
// 2. It made the metadata-security of a group dependent on keeping the cryptographically derived Group ID secret.
|
||||
// While not awful, it also isn't good. For Version 3 groups only we permit Cwtch to check this older signature
|
||||
// structure in a backwards compatible way for the duration of the Groups Experiment.
|
||||
// TODO: Delete this check when Groups are no long Experimental
|
||||
if g.Version == 3 {
|
||||
verified = g.VerifyGroupMessage(dgm.Onion, g.GroupID, string(ciphertext), signature)
|
||||
}
|
||||
}
|
||||
|
||||
// So we have a message that has a valid group key, but the signature can't be verified.
|
||||
// The most obvious explanation for this is that the group key has been compromised (or we are in an open group and the server is being malicious)
|
||||
// Either way, someone who has the private key is being detectably bad so we are just going to throw this message away and mark the group as Compromised.
|
||||
if !verified {
|
||||
return false, nil
|
||||
}
|
||||
return true, dgm
|
||||
}
|
||||
|
||||
// If we couldn't find a group to decrypt the message with we just return false. This is an expected case
|
||||
return false, nil
|
||||
}
|
||||
|
||||
// VerifyGroupMessage confirms the authenticity of a message given an sender onion, message and signature.
|
||||
// The goal of this function is 2-fold:
|
||||
// 1. We confirm that the sender referenced in the group text is the actual sender of the message (or at least
|
||||
// knows the senders private key)
|
||||
// 2. Secondly, we confirm that the sender sent the message to a particular group id on a specific server (it doesn't
|
||||
// matter if we actually received this message from the server or from a hybrid protocol, all that matters is
|
||||
// that the sender and receivers agree that this message was intended for the group
|
||||
//
|
||||
// The 2nd point is important as it prevents an attack documented in the original Cwtch paper (and later at
|
||||
// https://docs.openprivacy.ca/cwtch-security-handbook/groups.html) in which a malicious profile sets up 2 groups
|
||||
// on two different servers with the same key and then forwards messages between them to convince the parties in
|
||||
// each group that they are actually in one big group (with the intent to later censor and/or selectively send messages
|
||||
// to each group).
|
||||
func (g *Group) VerifyGroupMessage(onion string, groupID string, message string, signature []byte) bool {
|
||||
// We use our group id, a known reference server and the ciphertext of the message.
|
||||
m := groupID + g.GroupServer + message
|
||||
|
||||
// Otherwise we derive the public key from the sender and check it against that.
|
||||
decodedPub, err := base32.StdEncoding.DecodeString(strings.ToUpper(onion))
|
||||
if err == nil && len(decodedPub) >= 32 {
|
||||
return ed25519.Verify(decodedPub[:32], []byte(m), signature)
|
||||
}
|
||||
return false
|
||||
// SetAttribute allows applications to store arbitrary configuration info at the group level.
|
||||
func (g *Group) SetAttribute(name string, value string) {
|
||||
g.lock.Lock()
|
||||
defer g.lock.Unlock()
|
||||
g.Attributes[name] = value
|
||||
}
|
||||
|
||||
// EncryptMessageToGroup when given a message and a group, encrypts and signs the message under the group and
|
||||
// profile
|
||||
func EncryptMessageToGroup(message string, author primitives.Identity, group *Group, prevSig string) ([]byte, []byte, *groups.DecryptedGroupMessage, error) {
|
||||
if len(message) > MaxGroupMessageLength {
|
||||
return nil, nil, nil, errors.New("group message is too long")
|
||||
}
|
||||
timestamp := time.Now().Unix()
|
||||
|
||||
lenPadding := MaxGroupMessageLength - len(message)
|
||||
padding := make([]byte, lenPadding)
|
||||
getRandomness(&padding)
|
||||
hexGroupID, err := hex.DecodeString(group.GroupID)
|
||||
if err != nil {
|
||||
return nil, nil, nil, err
|
||||
}
|
||||
|
||||
prevSigBytes, err := base64.StdEncoding.DecodeString(prevSig)
|
||||
if err != nil {
|
||||
return nil, nil, nil, err
|
||||
}
|
||||
|
||||
dm := &groups.DecryptedGroupMessage{
|
||||
Onion: author.Hostname(),
|
||||
Text: message,
|
||||
SignedGroupID: hexGroupID,
|
||||
Timestamp: uint64(timestamp),
|
||||
PreviousMessageSig: prevSigBytes,
|
||||
Padding: padding[:],
|
||||
}
|
||||
|
||||
ciphertext, err := group.EncryptMessage(dm)
|
||||
if err != nil {
|
||||
return nil, nil, nil, err
|
||||
}
|
||||
serialized, _ := json.Marshal(dm)
|
||||
signature := author.Sign([]byte(group.GroupID + group.GroupServer + base64.StdEncoding.EncodeToString(serialized)))
|
||||
return ciphertext, signature, dm, nil
|
||||
// GetAttribute returns the value of a value set with SetAttribute. If no such value has been set exists is set to false.
|
||||
func (g *Group) GetAttribute(name string) (value string, exists bool) {
|
||||
g.lock.Lock()
|
||||
defer g.lock.Unlock()
|
||||
value, exists = g.Attributes[name]
|
||||
return
|
||||
}
|
||||
|
|
|
@ -1,50 +1,33 @@
|
|||
package model
|
||||
|
||||
import (
|
||||
"crypto/sha256"
|
||||
"cwtch.im/cwtch/protocol/groups"
|
||||
"strings"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"testing"
|
||||
"time"
|
||||
)
|
||||
|
||||
func TestGroup(t *testing.T) {
|
||||
g, err := NewGroup("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd")
|
||||
if err != nil {
|
||||
t.Fatalf("Group with real group server should not fail")
|
||||
}
|
||||
dgm := &groups.DecryptedGroupMessage{
|
||||
Onion: "onion",
|
||||
Text: "Hello World!",
|
||||
Timestamp: uint64(time.Now().Unix()),
|
||||
SignedGroupID: []byte{},
|
||||
g, _ := NewGroup("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd")
|
||||
dgm := &protocol.DecryptedGroupMessage{
|
||||
Onion: proto.String("onion"),
|
||||
Text: proto.String("Hello World!"),
|
||||
Timestamp: proto.Int32(int32(time.Now().Unix())),
|
||||
SignedGroupId: []byte{},
|
||||
PreviousMessageSig: []byte{},
|
||||
Padding: []byte{},
|
||||
}
|
||||
|
||||
invite, err := g.Invite()
|
||||
|
||||
if err != nil {
|
||||
t.Fatalf("error creating group invite: %v", err)
|
||||
}
|
||||
|
||||
validatedInvite, err := ValidateInvite(invite)
|
||||
|
||||
if err != nil {
|
||||
t.Fatalf("error validating group invite: %v", err)
|
||||
}
|
||||
|
||||
if validatedInvite.GroupID != g.GroupID {
|
||||
t.Fatalf("after validate group invite id should be identical to original: %v", err)
|
||||
}
|
||||
|
||||
encMessage, _ := g.EncryptMessage(dgm)
|
||||
ok, message := g.DecryptMessage(encMessage)
|
||||
if (!ok || message == nil) || message.Text != "Hello World!" {
|
||||
if !ok || message.GetText() != "Hello World!" {
|
||||
t.Errorf("group encryption was invalid, or returned wrong message decrypted:%v message:%v", ok, message)
|
||||
return
|
||||
}
|
||||
|
||||
g.SetAttribute("test", "test_value")
|
||||
value, exists := g.GetAttribute("test")
|
||||
if !exists || value != "test_value" {
|
||||
t.Errorf("Custom Attribute Should have been set, instead %v %v", exists, value)
|
||||
}
|
||||
t.Logf("Got message %v", message)
|
||||
}
|
||||
|
||||
|
@ -54,60 +37,3 @@ func TestGroupErr(t *testing.T) {
|
|||
t.Errorf("Group Setup Should Have Failed")
|
||||
}
|
||||
}
|
||||
|
||||
// Test various group invite validation failures...
|
||||
func TestGroupValidation(t *testing.T) {
|
||||
|
||||
group := &Group{
|
||||
GroupID: "",
|
||||
GroupKey: [32]byte{},
|
||||
GroupServer: "",
|
||||
Timeline: Timeline{},
|
||||
LocalID: "",
|
||||
Version: 0,
|
||||
}
|
||||
|
||||
invite, _ := group.Invite()
|
||||
_, err := ValidateInvite(invite)
|
||||
|
||||
if err == nil {
|
||||
t.Fatalf("Group with empty group id should have been an error")
|
||||
}
|
||||
t.Logf("Error: %v", err)
|
||||
|
||||
// Generate a valid group but replace the group server...
|
||||
group, err = NewGroup("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd")
|
||||
if err != nil {
|
||||
t.Fatalf("Group with real group server should not fail")
|
||||
}
|
||||
group.GroupServer = "tcnkoch4nyr3cldkemejtkpqok342rbql6iclnjjs3ndgnjgufzyxvqd"
|
||||
invite, _ = group.Invite()
|
||||
_, err = ValidateInvite(invite)
|
||||
|
||||
if err == nil {
|
||||
t.Fatalf("Group with empty group id should have been an error")
|
||||
}
|
||||
t.Logf("Error: %v", err)
|
||||
|
||||
// Generate a valid group but replace the group key...
|
||||
group, err = NewGroup("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd")
|
||||
if err != nil {
|
||||
t.Fatalf("Group with real group server should not fail")
|
||||
}
|
||||
group.GroupKey = sha256.Sum256([]byte{})
|
||||
invite, _ = group.Invite()
|
||||
_, err = ValidateInvite(invite)
|
||||
|
||||
if err == nil {
|
||||
t.Fatalf("Group with different group key should have errored")
|
||||
}
|
||||
t.Logf("Error: %v", err)
|
||||
|
||||
// mangle the invite
|
||||
_, err = ValidateInvite(strings.ReplaceAll(invite, GroupInvitePrefix, ""))
|
||||
if err == nil {
|
||||
t.Fatalf("Group with different group key should have errored")
|
||||
}
|
||||
t.Logf("Error: %v", err)
|
||||
|
||||
}
|
||||
|
|
|
@ -1,110 +0,0 @@
|
|||
package model_test
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/protocol/groups"
|
||||
"encoding/base64"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives"
|
||||
. "github.com/onsi/ginkgo/v2"
|
||||
. "github.com/onsi/gomega"
|
||||
)
|
||||
|
||||
var _ = Describe("group models", func() {
|
||||
var (
|
||||
newgroup *model.Group
|
||||
anothergroup *model.Group
|
||||
dgm groups.DecryptedGroupMessage
|
||||
alice primitives.Identity
|
||||
)
|
||||
|
||||
BeforeEach(func() {
|
||||
newgroup, _ = model.NewGroup("iikv7tizbyxc42rsagnjxss65h3nfiwrkkoiikh7ui27r5xkav7gzuid")
|
||||
anothergroup, _ = model.NewGroup("iikv7tizbyxc42rsagnjxss65h3nfiwrkkoiikh7ui27r5xkav7gzuid")
|
||||
|
||||
alice, _ = primitives.InitializeEphemeralIdentity()
|
||||
|
||||
dgm = groups.DecryptedGroupMessage{
|
||||
Text: "hello world",
|
||||
Onion: "some random onion",
|
||||
Timestamp: 0,
|
||||
SignedGroupID: nil,
|
||||
PreviousMessageSig: nil,
|
||||
Padding: nil,
|
||||
}
|
||||
})
|
||||
|
||||
Context("on creation of a group", func() {
|
||||
It("should pass the cryptographic check", func() {
|
||||
Expect(newgroup.CheckGroup()).To(Equal(true))
|
||||
})
|
||||
})
|
||||
|
||||
Context("after generating an invite", func() {
|
||||
It("should validate", func() {
|
||||
invite, err := newgroup.Invite()
|
||||
Expect(err).NotTo(HaveOccurred())
|
||||
anotherGroup, err := model.ValidateInvite(invite)
|
||||
Expect(err).NotTo(HaveOccurred())
|
||||
|
||||
Expect(anotherGroup.GroupID).To(Equal(newgroup.GroupID))
|
||||
Expect(anotherGroup.GroupName).To(Equal(newgroup.GroupName))
|
||||
Expect(anotherGroup.SharedKey).To(Equal(newgroup.GroupKey[:]))
|
||||
})
|
||||
})
|
||||
|
||||
Context("when encrypting a message", func() {
|
||||
Context("decrypting with the same group", func() {
|
||||
It("should succeed", func() {
|
||||
ciphertext, err := newgroup.EncryptMessage(&dgm)
|
||||
Expect(err).NotTo(HaveOccurred())
|
||||
success, decryptedMessage := newgroup.DecryptMessage(ciphertext)
|
||||
Expect(success).To(Equal(true))
|
||||
Expect(decryptedMessage.Text).To(Equal(dgm.Text))
|
||||
Expect(decryptedMessage.Onion).To(Equal(dgm.Onion))
|
||||
})
|
||||
})
|
||||
|
||||
Context("decrypting with a different group", func() {
|
||||
It("should fail", func() {
|
||||
ciphertext, err := newgroup.EncryptMessage(&dgm)
|
||||
Expect(err).NotTo(HaveOccurred())
|
||||
success, decryptedMessage := anothergroup.DecryptMessage(ciphertext)
|
||||
Expect(success).To(Equal(false))
|
||||
Expect(decryptedMessage).To(BeNil())
|
||||
})
|
||||
})
|
||||
})
|
||||
|
||||
Context("when alice encrypts a message to new group", func() {
|
||||
It("should succeed and bob should succeed in decrypting it", func() {
|
||||
ciphertext, sign, _, err := model.EncryptMessageToGroup("hello world", alice, newgroup, base64.StdEncoding.EncodeToString([]byte("hello world")))
|
||||
Expect(err).NotTo(HaveOccurred())
|
||||
success, dgm := newgroup.AttemptDecryption(ciphertext, sign)
|
||||
Expect(success).To(BeTrue())
|
||||
Expect(dgm.Text).To(Equal("hello world"))
|
||||
})
|
||||
})
|
||||
|
||||
Context("when alice encrypts a message to new group", func() {
|
||||
It("should succeed and eve should fail in decrypting it", func() {
|
||||
ciphertext, sign, _, err := model.EncryptMessageToGroup("hello world", alice, newgroup, base64.StdEncoding.EncodeToString([]byte("hello world")))
|
||||
Expect(err).NotTo(HaveOccurred())
|
||||
success, dgm := anothergroup.AttemptDecryption(ciphertext, sign)
|
||||
Expect(success).To(BeFalse())
|
||||
Expect(dgm).To(BeNil())
|
||||
})
|
||||
})
|
||||
|
||||
Context("when alice encrypts a message to new group", func() {
|
||||
Context("and the server messes with the signature", func() {
|
||||
It("bob should be unable to verify the message with the wrong signature", func() {
|
||||
ciphertext, _, _, err := model.EncryptMessageToGroup("hello world", alice, newgroup, base64.StdEncoding.EncodeToString([]byte("hello world")))
|
||||
Expect(err).NotTo(HaveOccurred())
|
||||
success, dgm := newgroup.AttemptDecryption(ciphertext, []byte("bad signature"))
|
||||
Expect(success).To(BeFalse())
|
||||
Expect(dgm).To(BeNil())
|
||||
})
|
||||
})
|
||||
})
|
||||
|
||||
})
|
|
@ -1,103 +0,0 @@
|
|||
package model
|
||||
|
||||
import (
|
||||
"crypto/ed25519"
|
||||
"encoding/base32"
|
||||
"encoding/json"
|
||||
"errors"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives"
|
||||
"strings"
|
||||
)
|
||||
|
||||
// KeyType provides a wrapper for a generic public key type identifier (could be an onion address, a zcash address etc.)
|
||||
type KeyType string
|
||||
|
||||
const (
|
||||
|
||||
// BundleType - the attribute under which the signed server bundle is stored...
|
||||
BundleType = KeyType("server_key_bundle")
|
||||
|
||||
// KeyTypeServerOnion - a cwtch address
|
||||
KeyTypeServerOnion = KeyType("bulletin_board_onion") // bulletin board
|
||||
|
||||
// KeyTypeTokenOnion - a cwtch peer with a PoW based token protocol
|
||||
KeyTypeTokenOnion = KeyType("token_service_onion")
|
||||
|
||||
//KeyTypePrivacyPass - a privacy pass based token server
|
||||
KeyTypePrivacyPass = KeyType("privacy_pass_public_key")
|
||||
)
|
||||
|
||||
// Key provides a wrapper for a generic public key identifier (could be an onion address, a zcash address etc.)
|
||||
type Key string
|
||||
|
||||
// KeyBundle manages a collection of related keys for various different services.
|
||||
type KeyBundle struct {
|
||||
Keys map[KeyType]Key
|
||||
Signature []byte
|
||||
}
|
||||
|
||||
// NewKeyBundle creates a new KeyBundle initialized with no keys.
|
||||
func NewKeyBundle() *KeyBundle {
|
||||
keyBundle := new(KeyBundle)
|
||||
keyBundle.Keys = make(map[KeyType]Key)
|
||||
return keyBundle
|
||||
}
|
||||
|
||||
// HasKeyType returns true if the bundle has a public key of a given type.
|
||||
func (kb *KeyBundle) HasKeyType(keytype KeyType) bool {
|
||||
_, exists := kb.Keys[keytype]
|
||||
return exists
|
||||
}
|
||||
|
||||
// GetKey retrieves a key with a given type from the bundle
|
||||
func (kb *KeyBundle) GetKey(keytype KeyType) (Key, error) {
|
||||
key, exists := kb.Keys[keytype]
|
||||
if exists {
|
||||
return key, nil
|
||||
}
|
||||
return "", errors.New("no such key")
|
||||
}
|
||||
|
||||
// Serialize produces a json encoded byte array.
|
||||
func (kb KeyBundle) Serialize() []byte {
|
||||
// json.Marshal sorts map keys
|
||||
bundle, _ := json.Marshal(kb)
|
||||
return bundle
|
||||
}
|
||||
|
||||
// Sign allows a server to authenticate a key bundle by signing it (this uses the tapir identity interface)
|
||||
func (kb *KeyBundle) Sign(identity primitives.Identity) {
|
||||
kb.Signature = identity.Sign(kb.Serialize())
|
||||
}
|
||||
|
||||
// DeserializeAndVerify takes in a json formatted bundle and only returns a valid key bundle
|
||||
// if it has been signed by the server.
|
||||
func DeserializeAndVerify(bundle []byte) (*KeyBundle, error) {
|
||||
keyBundle := new(KeyBundle)
|
||||
err := json.Unmarshal(bundle, &keyBundle)
|
||||
if err == nil {
|
||||
signature := keyBundle.Signature
|
||||
keyBundle.Signature = nil
|
||||
serverKey, _ := keyBundle.GetKey(KeyTypeServerOnion)
|
||||
|
||||
// We have to do convert the encoded key to a format that can be used to verify the signature
|
||||
var decodedPub []byte
|
||||
decodedPub, err = base32.StdEncoding.DecodeString(strings.ToUpper(string(serverKey)))
|
||||
if err == nil && len(decodedPub) == 35 {
|
||||
if ed25519.Verify(decodedPub[:32], keyBundle.Serialize(), signature) { // == true
|
||||
return keyBundle, nil
|
||||
}
|
||||
}
|
||||
err = InvalidEd25519PublicKey
|
||||
}
|
||||
return nil, err
|
||||
}
|
||||
|
||||
// AttributeBundle returns a map that can be used as part of a peer attribute bundle
|
||||
func (kb *KeyBundle) AttributeBundle() map[string]string {
|
||||
ab := make(map[string]string)
|
||||
for k, v := range kb.Keys {
|
||||
ab[string(k)] = string(v)
|
||||
}
|
||||
return ab
|
||||
}
|
|
@ -1,64 +0,0 @@
|
|||
package model
|
||||
|
||||
import (
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives"
|
||||
"testing"
|
||||
)
|
||||
|
||||
func TestDeserializeAndVerify(t *testing.T) {
|
||||
server, _ := primitives.InitializeEphemeralIdentity()
|
||||
|
||||
serverKeyBundle := NewKeyBundle()
|
||||
|
||||
serverKeyBundle.Keys[KeyTypeServerOnion] = Key(server.Hostname())
|
||||
serverKeyBundle.Keys[KeyTypePrivacyPass] = Key("random 1")
|
||||
serverKeyBundle.Keys[KeyTypeTokenOnion] = Key("random 2")
|
||||
serverKeyBundle.Sign(server)
|
||||
|
||||
//eyeball keys are sorted
|
||||
t.Logf("%s", serverKeyBundle.Serialize())
|
||||
serialize := serverKeyBundle.Serialize()
|
||||
|
||||
newKeyBundle, err := DeserializeAndVerify(serialize)
|
||||
if err != nil {
|
||||
t.Fatalf("Key Bundle did not Deserialize %v", err)
|
||||
}
|
||||
|
||||
if newKeyBundle.Keys[KeyTypeServerOnion] != Key(server.Hostname()) {
|
||||
t.Fatalf("Key Bundle did not Serialize Correctly Actual: %v Expected: %v", newKeyBundle, serverKeyBundle)
|
||||
}
|
||||
}
|
||||
|
||||
func TestDeserializeAndVerifyMaliciousSignShouldFail(t *testing.T) {
|
||||
server, _ := primitives.InitializeEphemeralIdentity()
|
||||
maliciousServer, _ := primitives.InitializeEphemeralIdentity()
|
||||
serverKeyBundle := NewKeyBundle()
|
||||
|
||||
serverKeyBundle.Keys[KeyTypeServerOnion] = Key(server.Hostname())
|
||||
|
||||
// This time we sign with a malicious server
|
||||
serverKeyBundle.Sign(maliciousServer)
|
||||
serialize := serverKeyBundle.Serialize()
|
||||
|
||||
newKeyBundle, err := DeserializeAndVerify(serialize)
|
||||
if err == nil {
|
||||
t.Fatalf("Key Bundle did Deserialize (it should have failed): %v", newKeyBundle)
|
||||
}
|
||||
}
|
||||
|
||||
func TestDeserializeAndVerifyUnsignedShouldFail(t *testing.T) {
|
||||
server, _ := primitives.InitializeEphemeralIdentity()
|
||||
|
||||
serverKeyBundle := NewKeyBundle()
|
||||
|
||||
serverKeyBundle.Keys[KeyTypeServerOnion] = Key(server.Hostname())
|
||||
|
||||
// This time we don't sign
|
||||
// serverKeyBundle.Sign(server)
|
||||
serialize := serverKeyBundle.Serialize()
|
||||
|
||||
newKeyBundle, err := DeserializeAndVerify(serialize)
|
||||
if err == nil {
|
||||
t.Fatalf("Key Bundle did Deserialize (it should have failed): %v", newKeyBundle)
|
||||
}
|
||||
}
|
168
model/message.go
168
model/message.go
|
@ -1,38 +1,17 @@
|
|||
package model
|
||||
|
||||
import (
|
||||
"crypto/sha256"
|
||||
"encoding/base64"
|
||||
"errors"
|
||||
"sort"
|
||||
"sync"
|
||||
"time"
|
||||
)
|
||||
|
||||
// Timeline encapsulates a collection of ordered Messages, and a mechanism to access them
|
||||
// Timeline encapsulates a collection of ordered messages, and a mechanism to access them
|
||||
// in a threadsafe manner.
|
||||
type Timeline struct {
|
||||
Messages []Message
|
||||
SignedGroupID []byte
|
||||
lock sync.Mutex
|
||||
|
||||
// a cache to allow quick checks for existing messages...
|
||||
signatureCache map[string]int
|
||||
|
||||
// a cache to allowing looking up messages by content hash
|
||||
// we need this for features like reply-to message, and other self
|
||||
// referential applications.
|
||||
// note: that the index stored here is not global as different peers may have difference views of the timeline
|
||||
// depending on if they save history, and when the last time they purged their timeline was, as such we can't
|
||||
// simply send the index of the message.
|
||||
hashCache map[string][]int
|
||||
}
|
||||
|
||||
// LocallyIndexedMessage is a type wrapper around a Message and a TimeLine Index that is local to this
|
||||
// instance of the timeline.
|
||||
type LocallyIndexedMessage struct {
|
||||
Message
|
||||
LocalIndex int
|
||||
}
|
||||
|
||||
// Message is a local representation of a given message sent over a group chat channel.
|
||||
|
@ -43,19 +22,8 @@ type Message struct {
|
|||
Message string
|
||||
Signature []byte
|
||||
PreviousMessageSig []byte
|
||||
ReceivedByServer bool // messages sent to a server
|
||||
Acknowledged bool // peer to peer
|
||||
Error string `json:",omitempty"`
|
||||
// Application specific flags, useful for storing small amounts of metadata
|
||||
Flags uint64
|
||||
}
|
||||
|
||||
// MessageBaseSize 2021.06 byte size of an *empty* message json serialized
|
||||
const MessageBaseSize float64 = 463
|
||||
|
||||
// compareSignatures checks if a and b are equal. Note: this function does
|
||||
// not need to be constant time - in fact it is better that it is not as it's only main use
|
||||
// is in sorting timeline state consistently.
|
||||
func compareSignatures(a []byte, b []byte) bool {
|
||||
if len(a) != len(b) {
|
||||
return false
|
||||
|
@ -77,82 +45,19 @@ func (t *Timeline) GetMessages() []Message {
|
|||
return messages
|
||||
}
|
||||
|
||||
// GetCopy returns a duplicate of the Timeline
|
||||
func (t *Timeline) GetCopy() *Timeline {
|
||||
t.lock.Lock()
|
||||
defer t.lock.Unlock()
|
||||
newt := &Timeline{}
|
||||
// initialize the timeline and copy the message over...
|
||||
newt.SetMessages(t.Messages)
|
||||
return newt
|
||||
}
|
||||
|
||||
// SetMessages sets the Messages of this timeline. Only to be used in loading/initialization
|
||||
func (t *Timeline) SetMessages(messages []Message) {
|
||||
t.lock.Lock()
|
||||
t.init()
|
||||
t.lock.Unlock()
|
||||
for _, m := range messages {
|
||||
t.Insert(&m)
|
||||
}
|
||||
}
|
||||
|
||||
// GetMessagesByHash attempts to find messages that match the given
|
||||
// content hash in the timeline. If successful it returns a list of messages as well as their local index
|
||||
// , on failure it returns an error.
|
||||
// We return a list of messages because content hashes are not guaranteed to be unique from a given Peer. This allows
|
||||
// us to do things like: ensure that reply-to and quotes reference the last seen message from the message they are quoted
|
||||
// in or detect duplicate messages from a peer.
|
||||
func (t *Timeline) GetMessagesByHash(contentHash string) ([]LocallyIndexedMessage, error) {
|
||||
t.lock.Lock()
|
||||
defer t.lock.Unlock()
|
||||
t.init()
|
||||
if idxs, exists := t.hashCache[contentHash]; exists {
|
||||
var messages []LocallyIndexedMessage
|
||||
for _, idx := range idxs {
|
||||
messages = append(messages, LocallyIndexedMessage{LocalIndex: idx, Message: t.Messages[idx]})
|
||||
}
|
||||
return messages, nil
|
||||
}
|
||||
return nil, errors.New("cannot find message by hash")
|
||||
}
|
||||
|
||||
// calculateHash calculates the content hash of a given message
|
||||
// the content used is the sender of the message, the body of the message
|
||||
//
|
||||
// content hashes must be calculable across timeline views so that different participants can
|
||||
// calculate the same hash for the same message - as such we cannot use timestamps from peers or groups
|
||||
// as they are mostly fuzzy.
|
||||
//
|
||||
// As a reminder: for p2p messages PeerID is authenticated by the initial 3DH handshake, for groups
|
||||
// each message is signed by the sender, and this signature is checked prior to inclusion in the timeline.
|
||||
//
|
||||
// Multiple messages from the same peer can result in the same hash (where the same user sends the same message more
|
||||
// than once) - in this case we will only store the idx of the most recent message - and use that for reference lookups.
|
||||
func (t *Timeline) calculateHash(message Message) string {
|
||||
content := []byte(message.PeerID + message.Message)
|
||||
contentBasedHash := sha256.Sum256(content)
|
||||
return base64.StdEncoding.EncodeToString(contentBasedHash[:])
|
||||
}
|
||||
|
||||
// Len gets the length of the timeline
|
||||
func (t *Timeline) Len() int {
|
||||
return len(t.Messages)
|
||||
}
|
||||
|
||||
// Swap swaps 2 Messages on the timeline.
|
||||
// Swap swaps 2 messages on the timeline.
|
||||
func (t *Timeline) Swap(i, j int) {
|
||||
t.Messages[i], t.Messages[j] = t.Messages[j], t.Messages[i]
|
||||
}
|
||||
|
||||
// Less checks 2 Messages (i and j) in the timeline and returns true if i occurred before j, else false
|
||||
// Less checks 2 messages (i and j) in the timeline and returns true if i occurred before j, else false
|
||||
func (t *Timeline) Less(i, j int) bool {
|
||||
|
||||
if t.Messages[i].Timestamp.Before(t.Messages[j].Timestamp) {
|
||||
return true
|
||||
}
|
||||
|
||||
// Short circuit false if j is before i, signature checks will give a wrong order in this case.
|
||||
if t.Messages[j].Timestamp.Before(t.Messages[i].Timestamp) {
|
||||
return false
|
||||
}
|
||||
|
@ -168,70 +73,19 @@ func (t *Timeline) Less(i, j int) bool {
|
|||
return false
|
||||
}
|
||||
|
||||
// Sort sorts the timeline in a canonical order.
|
||||
func (t *Timeline) Sort() {
|
||||
// Insert inserts a message into the timeline in a thread safe way.
|
||||
func (t *Timeline) Insert(mi *Message) bool {
|
||||
t.lock.Lock()
|
||||
defer t.lock.Unlock()
|
||||
|
||||
sort.Sort(t)
|
||||
}
|
||||
|
||||
// Insert a message into the timeline in a thread safe way.
|
||||
func (t *Timeline) Insert(mi *Message) int {
|
||||
t.lock.Lock()
|
||||
defer t.lock.Unlock()
|
||||
|
||||
// assert timeline is initialized
|
||||
t.init()
|
||||
|
||||
// check that we haven't seen this message before (this has no impact on p2p messages, but is essential for
|
||||
// group messages)
|
||||
// FIXME: The below code now checks if the message has a signature. If it doesn't then skip duplication check.
|
||||
// We do this because p2p messages right now do not have a signature, and so many p2p messages are not stored
|
||||
// with a signature. In the future in hybrid groups this check will go away as all timelines will use the same
|
||||
// underlying protocol.
|
||||
// This is currently safe to do because p2p does not rely on signatures and groups will verify the signature of
|
||||
// messages prior to generating an event to include them in the timeline.
|
||||
if len(mi.Signature) != 0 {
|
||||
idx, exists := t.signatureCache[base64.StdEncoding.EncodeToString(mi.Signature)]
|
||||
if exists {
|
||||
t.Messages[idx].Acknowledged = true
|
||||
return idx
|
||||
for _, m := range t.Messages {
|
||||
// If the message already exists, then we don't add it
|
||||
if compareSignatures(m.Signature, mi.Signature) {
|
||||
return true
|
||||
}
|
||||
}
|
||||
|
||||
// update the message store
|
||||
t.Messages = append(t.Messages, *mi)
|
||||
// add to signature cache for fast checking of group messages...
|
||||
t.signatureCache[base64.StdEncoding.EncodeToString(mi.Signature)] = len(t.Messages) - 1
|
||||
// content based addressing index
|
||||
contentHash := t.calculateHash(*mi)
|
||||
t.hashCache[contentHash] = append(t.hashCache[contentHash], len(t.Messages)-1)
|
||||
return len(t.Messages) - 1
|
||||
}
|
||||
|
||||
func (t *Timeline) init() {
|
||||
// only allow this setting once...
|
||||
if t.signatureCache == nil {
|
||||
t.signatureCache = make(map[string]int)
|
||||
}
|
||||
|
||||
if t.hashCache == nil {
|
||||
t.hashCache = make(map[string][]int)
|
||||
}
|
||||
}
|
||||
|
||||
// SetSendError marks a message has having some kind of application specific error.
|
||||
// Note: The message here is indexed by signature.
|
||||
func (t *Timeline) SetSendError(sig []byte, e string) bool {
|
||||
t.lock.Lock()
|
||||
defer t.lock.Unlock()
|
||||
|
||||
idx, exists := t.signatureCache[base64.StdEncoding.EncodeToString(sig)]
|
||||
if !exists {
|
||||
return false
|
||||
}
|
||||
|
||||
t.Messages[idx].Error = e
|
||||
return true
|
||||
sort.Sort(t)
|
||||
return false
|
||||
}
|
||||
|
|
|
@ -0,0 +1,104 @@
|
|||
package model
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"strconv"
|
||||
"testing"
|
||||
"time"
|
||||
)
|
||||
|
||||
func TestMessagePadding(t *testing.T) {
|
||||
|
||||
// Setup the Group
|
||||
sarah := GenerateNewProfile("Sarah")
|
||||
alice := GenerateNewProfile("Alice")
|
||||
sarah.AddContact(alice.Onion, &alice.PublicProfile)
|
||||
alice.AddContact(sarah.Onion, &sarah.PublicProfile)
|
||||
|
||||
gid, invite, _ := alice.StartGroup("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd")
|
||||
gci := &protocol.CwtchPeerPacket{}
|
||||
proto.Unmarshal(invite, gci)
|
||||
sarah.ProcessInvite(gci.GetGroupChatInvite(), alice.Onion)
|
||||
|
||||
group := alice.GetGroupByGroupID(gid)
|
||||
|
||||
c1, s1, err := sarah.EncryptMessageToGroup("Hello World 1", group.GroupID)
|
||||
t.Logf("Length of Encrypted Message: %v %v", len(c1), err)
|
||||
alice.AttemptDecryption(c1, s1)
|
||||
|
||||
c2, s2, _ := alice.EncryptMessageToGroup("Hello World 2", group.GroupID)
|
||||
t.Logf("Length of Encrypted Message: %v", len(c2))
|
||||
alice.AttemptDecryption(c2, s2)
|
||||
|
||||
c3, s3, _ := alice.EncryptMessageToGroup("Hello World 3", group.GroupID)
|
||||
t.Logf("Length of Encrypted Message: %v", len(c3))
|
||||
alice.AttemptDecryption(c3, s3)
|
||||
|
||||
c4, s4, _ := alice.EncryptMessageToGroup("Hello World this is a much longer message 3", group.GroupID)
|
||||
t.Logf("Length of Encrypted Message: %v", len(c4))
|
||||
alice.AttemptDecryption(c4, s4)
|
||||
|
||||
}
|
||||
|
||||
func TestTranscriptConsistency(t *testing.T) {
|
||||
timeline := new(Timeline)
|
||||
|
||||
// Setup the Group
|
||||
sarah := GenerateNewProfile("Sarah")
|
||||
alice := GenerateNewProfile("Alice")
|
||||
sarah.AddContact(alice.Onion, &alice.PublicProfile)
|
||||
alice.AddContact(sarah.Onion, &sarah.PublicProfile)
|
||||
|
||||
gid, invite, _ := alice.StartGroup("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd")
|
||||
gci := &protocol.CwtchPeerPacket{}
|
||||
proto.Unmarshal(invite, gci)
|
||||
sarah.ProcessInvite(gci.GetGroupChatInvite(), alice.Onion)
|
||||
|
||||
group := alice.GetGroupByGroupID(gid)
|
||||
|
||||
t.Logf("group: %v, sarah %v", group, sarah)
|
||||
|
||||
c1, s1, _ := alice.EncryptMessageToGroup("Hello World 1", group.GroupID)
|
||||
t.Logf("Length of Encrypted Message: %v", len(c1))
|
||||
alice.AttemptDecryption(c1, s1)
|
||||
|
||||
c2, s2, _ := alice.EncryptMessageToGroup("Hello World 2", group.GroupID)
|
||||
t.Logf("Length of Encrypted Message: %v", len(c2))
|
||||
alice.AttemptDecryption(c2, s2)
|
||||
|
||||
c3, s3, _ := alice.EncryptMessageToGroup("Hello World 3", group.GroupID)
|
||||
t.Logf("Length of Encrypted Message: %v", len(c3))
|
||||
alice.AttemptDecryption(c3, s3)
|
||||
|
||||
time.Sleep(time.Second * 1)
|
||||
|
||||
c4, s4, _ := alice.EncryptMessageToGroup("Hello World 4", group.GroupID)
|
||||
t.Logf("Length of Encrypted Message: %v", len(c4))
|
||||
alice.AttemptDecryption(c4, s4)
|
||||
|
||||
c5, s5, _ := alice.EncryptMessageToGroup("Hello World 5", group.GroupID)
|
||||
t.Logf("Length of Encrypted Message: %v", len(c5))
|
||||
|
||||
_, m1 := sarah.AttemptDecryption(c1, s1)
|
||||
sarah.AttemptDecryption(c1, s1) // Try a duplicate
|
||||
_, m2 := sarah.AttemptDecryption(c2, s2)
|
||||
_, m3 := sarah.AttemptDecryption(c3, s3)
|
||||
_, m4 := sarah.AttemptDecryption(c4, s4)
|
||||
_, m5 := sarah.AttemptDecryption(c5, s5)
|
||||
|
||||
// Now we simulate a client receiving these messages completely out of order
|
||||
timeline.Insert(m1)
|
||||
timeline.Insert(m5)
|
||||
timeline.Insert(m4)
|
||||
timeline.Insert(m3)
|
||||
timeline.Insert(m2)
|
||||
|
||||
for i, m := range group.GetTimeline() {
|
||||
if m.Message != "Hello World "+strconv.Itoa(i+1) {
|
||||
t.Fatalf("Timeline Out of Order!: %v %v", i, m)
|
||||
}
|
||||
|
||||
t.Logf("Messages %v: %v %x %x", i, m.Message, m.Signature, m.PreviousMessageSig)
|
||||
}
|
||||
}
|
|
@ -1,25 +0,0 @@
|
|||
package model
|
||||
|
||||
import (
|
||||
"crypto/sha256"
|
||||
"encoding/base64"
|
||||
"encoding/json"
|
||||
)
|
||||
|
||||
// CalculateContentHash derives a hash using the author and the message body. It is intended to be
|
||||
// globally referencable in the context of a single conversation
|
||||
func CalculateContentHash(author string, messageBody string) string {
|
||||
content := []byte(author + messageBody)
|
||||
contentBasedHash := sha256.Sum256(content)
|
||||
return base64.StdEncoding.EncodeToString(contentBasedHash[:])
|
||||
}
|
||||
|
||||
func DeserializeMessage(message string) (*MessageWrapper, error) {
|
||||
var cm MessageWrapper
|
||||
err := json.Unmarshal([]byte(message), &cm)
|
||||
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &cm, err
|
||||
}
|
|
@ -1,13 +0,0 @@
|
|||
package model_test
|
||||
|
||||
import (
|
||||
"testing"
|
||||
|
||||
. "github.com/onsi/ginkgo/v2"
|
||||
. "github.com/onsi/gomega"
|
||||
)
|
||||
|
||||
func TestModel(t *testing.T) {
|
||||
RegisterFailHandler(Fail)
|
||||
RunSpecs(t, "Model Suite")
|
||||
}
|
|
@ -1,50 +0,0 @@
|
|||
package model
|
||||
|
||||
import (
|
||||
"time"
|
||||
)
|
||||
|
||||
// MessageWrapper is the canonical Cwtch overlay wrapper
|
||||
type MessageWrapper struct {
|
||||
Overlay int `json:"o"`
|
||||
Data string `json:"d"`
|
||||
|
||||
// when the data was assembled
|
||||
SendTime *time.Time `json:"s,omitempty"`
|
||||
|
||||
// when the data was transmitted (by protocol engine e.g. over Tor)
|
||||
TransitTime *time.Time `json:"t,omitempty"`
|
||||
|
||||
// when the data was received
|
||||
RecvTime *time.Time `json:"r,omitempty"`
|
||||
}
|
||||
|
||||
// Channel is defined as being the last 3 bits of the overlay id
|
||||
// Channel 0 is reserved for the main conversation
|
||||
// Channel 2 is reserved for conversation admin (managed groups)
|
||||
// Channel 7 is reserved for streams (no ack, no store)
|
||||
func (mw MessageWrapper) Channel() int {
|
||||
if mw.Overlay > 1024 {
|
||||
return mw.Overlay & 0x07
|
||||
}
|
||||
// for backward compatibilty all overlays less than 0x400 i.e. 1024 are
|
||||
// mapped to channel 0 regardless of their channel status.
|
||||
return 0
|
||||
}
|
||||
|
||||
// If Overlay is a Stream Message it should not be ackd, or stored.
|
||||
func (mw MessageWrapper) IsStream() bool {
|
||||
return mw.Channel() == 0x07
|
||||
}
|
||||
|
||||
// OverlayChat is the canonical identifier for chat overlays
|
||||
const OverlayChat = 1
|
||||
|
||||
// OverlayInviteContact is the canonical identifier for the contact invite overlay
|
||||
const OverlayInviteContact = 100
|
||||
|
||||
// OverlayInviteGroup is the canonical identifier for the group invite overlay
|
||||
const OverlayInviteGroup = 101
|
||||
|
||||
// OverlayFileSharing is the canonical identifier for the file sharing overlay
|
||||
const OverlayFileSharing = 200
|
432
model/profile.go
432
model/profile.go
|
@ -2,99 +2,387 @@ package model
|
|||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"encoding/hex"
|
||||
"encoding/json"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"encoding/base32"
|
||||
"errors"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"golang.org/x/crypto/ed25519"
|
||||
"io"
|
||||
"strings"
|
||||
"sync"
|
||||
)
|
||||
|
||||
// Authorization is a type determining client assigned authorization to a peer
|
||||
// Deprecated - Only used for Importing legacy profile formats
|
||||
// Still used in some APIs in UI but will be replaced prior to full deprecation
|
||||
type Authorization string
|
||||
|
||||
const (
|
||||
// AuthUnknown is an initial state for a new unseen peer
|
||||
AuthUnknown Authorization = "unknown"
|
||||
// AuthApproved means the client has approved the peer, it can send messages to us, perform GetVals, etc
|
||||
AuthApproved Authorization = "approved"
|
||||
// AuthBlocked means the client has blocked the peer, it's messages and connections should be rejected
|
||||
AuthBlocked Authorization = "blocked"
|
||||
"time"
|
||||
)
|
||||
|
||||
// PublicProfile is a local copy of a CwtchIdentity
|
||||
// Deprecated - Only used for Importing legacy profile formats
|
||||
type PublicProfile struct {
|
||||
Name string
|
||||
Ed25519PublicKey ed25519.PublicKey
|
||||
Authorization Authorization
|
||||
DeprecatedBlocked bool `json:"Blocked"`
|
||||
Onion string
|
||||
Attributes map[string]string
|
||||
Timeline Timeline `json:"-"`
|
||||
LocalID string // used by storage engine
|
||||
State string `json:"-"`
|
||||
lock sync.Mutex
|
||||
UnacknowledgedMessages map[string]int
|
||||
Name string
|
||||
Ed25519PublicKey ed25519.PublicKey
|
||||
Trusted bool
|
||||
Blocked bool
|
||||
Onion string
|
||||
Attributes map[string]string
|
||||
Timeline Timeline
|
||||
lock sync.Mutex
|
||||
}
|
||||
|
||||
// Profile encapsulates all the attributes necessary to be a Cwtch Peer.
|
||||
// Deprecated - Only used for Importing legacy profile formats
|
||||
type Profile struct {
|
||||
PublicProfile
|
||||
Contacts map[string]*PublicProfile
|
||||
Ed25519PrivateKey ed25519.PrivateKey
|
||||
Groups map[string]*Group
|
||||
Custom map[string]string
|
||||
lock sync.Mutex
|
||||
}
|
||||
|
||||
// MaxGroupMessageLength is the maximum length of a message posted to a server group.
|
||||
// TODO: Should this be per server?
|
||||
const MaxGroupMessageLength = 1800
|
||||
func (p *PublicProfile) init() {
|
||||
p.Attributes = make(map[string]string)
|
||||
}
|
||||
|
||||
// SetAttribute allows applications to store arbitrary configuration info at the profile level.
|
||||
func (p *PublicProfile) SetAttribute(name string, value string) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
p.Attributes[name] = value
|
||||
}
|
||||
|
||||
// GetAttribute returns the value of a value set with SetCustomAttribute. If no such value has been set exists is set to false.
|
||||
func (p *PublicProfile) GetAttribute(name string) (value string, exists bool) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
value, exists = p.Attributes[name]
|
||||
return
|
||||
}
|
||||
|
||||
// GenerateNewProfile creates a new profile, with new encryption and signing keys, and a profile name.
|
||||
func GenerateNewProfile(name string) *Profile {
|
||||
p := new(Profile)
|
||||
p.Name = name
|
||||
pub, priv, _ := ed25519.GenerateKey(rand.Reader)
|
||||
p.Ed25519PublicKey = pub
|
||||
p.Ed25519PrivateKey = priv
|
||||
p.Onion = utils.GetTorV3Hostname(pub)
|
||||
|
||||
p.Contacts = make(map[string]*PublicProfile)
|
||||
p.Contacts[p.Onion] = &p.PublicProfile
|
||||
p.Groups = make(map[string]*Group)
|
||||
p.Custom = make(map[string]string)
|
||||
return p
|
||||
}
|
||||
|
||||
// GetCwtchIdentityPacket returns the wire message for conveying this profiles identity.
|
||||
func (p *Profile) GetCwtchIdentityPacket() (message []byte) {
|
||||
ci := &protocol.CwtchIdentity{
|
||||
Name: p.Name,
|
||||
Ed25519PublicKey: p.Ed25519PublicKey,
|
||||
}
|
||||
cpp := &protocol.CwtchPeerPacket{
|
||||
CwtchIdentify: ci,
|
||||
}
|
||||
message, err := proto.Marshal(cpp)
|
||||
utils.CheckError(err)
|
||||
return
|
||||
}
|
||||
|
||||
// AddContact allows direct manipulation of cwtch contacts
|
||||
func (p *Profile) AddContact(onion string, profile *PublicProfile) {
|
||||
p.lock.Lock()
|
||||
profile.init()
|
||||
// TODO: More Robust V3 Onion Handling
|
||||
decodedPub, _ := base32.StdEncoding.DecodeString(strings.ToUpper(onion[:56]))
|
||||
profile.Ed25519PublicKey = ed25519.PublicKey(decodedPub[:32])
|
||||
p.Contacts[onion] = profile
|
||||
p.lock.Unlock()
|
||||
}
|
||||
|
||||
// RejectInvite rejects and removes a group invite
|
||||
func (p *Profile) RejectInvite(groupID string) {
|
||||
p.lock.Lock()
|
||||
delete(p.Groups, groupID)
|
||||
p.lock.Unlock()
|
||||
}
|
||||
|
||||
// AddMessageToContactTimeline allows the saving of a message sent via a direct connection chat to the profile.
|
||||
func (p *Profile) AddMessageToContactTimeline(onion string, fromMe bool, message string, sent time.Time) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
contact, ok := p.Contacts[onion]
|
||||
|
||||
// We don't really need a Signature here, but we use it to maintain order
|
||||
now := time.Now()
|
||||
sig := p.SignMessage(onion + message + sent.String() + now.String())
|
||||
if ok {
|
||||
if fromMe {
|
||||
contact.Timeline.Insert(&Message{PeerID: p.Onion, Message: message, Timestamp: sent, Received: now, Signature: sig})
|
||||
} else {
|
||||
contact.Timeline.Insert(&Message{PeerID: onion, Message: message, Timestamp: sent, Received: now, Signature: sig})
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// AcceptInvite accepts a group invite
|
||||
func (p *Profile) AcceptInvite(groupID string) (err error) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
group, ok := p.Groups[groupID]
|
||||
if ok {
|
||||
group.Accepted = true
|
||||
} else {
|
||||
err = errors.New("group does not exist")
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
// GetGroups returns an unordered list of group IDs associated with this profile.
|
||||
func (p *Profile) GetGroups() []string {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
var keys []string
|
||||
for onion := range p.Groups {
|
||||
keys = append(keys, onion)
|
||||
}
|
||||
return keys
|
||||
}
|
||||
|
||||
// SetCustomAttribute allows applications to store arbitrary configuration info at the profile level.
|
||||
func (p *Profile) SetCustomAttribute(name string, value string) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
p.Custom[name] = value
|
||||
}
|
||||
|
||||
// GetCustomAttribute returns the value of a value set with SetCustomAttribute. If no such value has been set exists is set to false.
|
||||
func (p *Profile) GetCustomAttribute(name string) (value string, exists bool) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
value, exists = p.Custom[name]
|
||||
return
|
||||
}
|
||||
|
||||
// GetContacts returns an unordered list of contact onions associated with this profile.
|
||||
func (p *Profile) GetContacts() []string {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
var keys []string
|
||||
for onion := range p.Contacts {
|
||||
if onion != p.Onion {
|
||||
keys = append(keys, onion)
|
||||
}
|
||||
}
|
||||
return keys
|
||||
}
|
||||
|
||||
// BlockPeer blocks a contact
|
||||
func (p *Profile) BlockPeer(onion string) (err error) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
contact, ok := p.Contacts[onion]
|
||||
if ok {
|
||||
contact.Blocked = true
|
||||
} else {
|
||||
err = errors.New("peer does not exist")
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
// TrustPeer sets a contact to trusted
|
||||
func (p *Profile) TrustPeer(onion string) (err error) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
contact, ok := p.Contacts[onion]
|
||||
if ok {
|
||||
contact.Trusted = true
|
||||
} else {
|
||||
err = errors.New("peer does not exist")
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
// IsBlocked returns true if the contact has been blocked, false otherwise
|
||||
func (p *Profile) IsBlocked(onion string) bool {
|
||||
contact, ok := p.GetContact(onion)
|
||||
if ok {
|
||||
return contact.Blocked
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
// GetContact returns a contact if the profile has it
|
||||
func (p *Profile) GetContact(onion string) (*PublicProfile, bool) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
contact, ok := p.Contacts[onion]
|
||||
return contact, ok
|
||||
}
|
||||
|
||||
// VerifyGroupMessage confirms the authenticity of a message given an onion, message and signature.
|
||||
func (p *Profile) VerifyGroupMessage(onion string, groupID string, message string, timestamp int32, ciphertext []byte, signature []byte) bool {
|
||||
|
||||
group := p.GetGroupByGroupID(groupID)
|
||||
if group == nil {
|
||||
return false
|
||||
}
|
||||
|
||||
if onion == p.Onion {
|
||||
m := groupID + group.GroupServer + string(ciphertext)
|
||||
return ed25519.Verify(p.Ed25519PublicKey, []byte(m), signature)
|
||||
}
|
||||
|
||||
m := groupID + group.GroupServer + string(ciphertext)
|
||||
decodedPub, err := base32.StdEncoding.DecodeString(strings.ToUpper(onion))
|
||||
if err == nil {
|
||||
return ed25519.Verify(decodedPub[:32], []byte(m), signature)
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
// SignMessage takes a given message and returns an Ed21159 signature
|
||||
func (p *Profile) SignMessage(message string) []byte {
|
||||
sig := ed25519.Sign(p.Ed25519PrivateKey, []byte(message))
|
||||
return sig
|
||||
}
|
||||
|
||||
// StartGroup when given a server, creates a new Group under this profile and returns the group id an a precomputed
|
||||
// invite which can be sent on the wire.
|
||||
func (p *Profile) StartGroup(server string) (groupID string, invite []byte, err error) {
|
||||
return p.StartGroupWithMessage(server, []byte{})
|
||||
}
|
||||
|
||||
// StartGroupWithMessage when given a server, and an initial message creates a new Group under this profile and returns the group id an a precomputed
|
||||
// invite which can be sent on the wire.
|
||||
func (p *Profile) StartGroupWithMessage(server string, initialMessage []byte) (groupID string, invite []byte, err error) {
|
||||
group, err := NewGroup(server)
|
||||
if err != nil {
|
||||
return "", nil, err
|
||||
}
|
||||
groupID = group.GroupID
|
||||
signedGroupID := p.SignMessage(groupID + server)
|
||||
group.SignGroup(signedGroupID)
|
||||
invite, err = group.Invite(initialMessage)
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
p.Groups[group.GroupID] = group
|
||||
return
|
||||
}
|
||||
|
||||
// GetGroupByGroupID a pointer to a Group by the group Id, returns nil if no group found.
|
||||
func (p *Profile) GetGroupByGroupID(groupID string) (g *Group) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
g = p.Groups[groupID]
|
||||
return
|
||||
}
|
||||
|
||||
// ProcessInvite adds a new group invite to the profile.
|
||||
func (p *Profile) ProcessInvite(gci *protocol.GroupChatInvite, peerHostname string) {
|
||||
group := new(Group)
|
||||
group.GroupID = gci.GetGroupName()
|
||||
group.SignedGroupID = gci.GetSignedGroupId()
|
||||
copy(group.GroupKey[:], gci.GetGroupSharedKey()[:])
|
||||
group.GroupServer = gci.GetServerHost()
|
||||
group.InitialMessage = gci.GetInitialMessage()[:]
|
||||
group.Accepted = false
|
||||
group.Owner = peerHostname
|
||||
p.AddGroup(group)
|
||||
}
|
||||
|
||||
// AddGroup is a convenience method for adding a group to a profile.
|
||||
func (p *Profile) AddGroup(group *Group) {
|
||||
existingGroup, exists := p.Groups[group.GroupID]
|
||||
if !exists {
|
||||
// TODO More robust error handling (confirm this onion checksum is correct)
|
||||
decodedPub, _ := base32.StdEncoding.DecodeString(strings.ToUpper(group.Owner[:56]))
|
||||
valid := ed25519.Verify(ed25519.PublicKey(decodedPub[:32]), []byte(group.GroupID+group.GroupServer), group.SignedGroupID)
|
||||
if valid {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
p.Groups[group.GroupID] = group
|
||||
}
|
||||
} else if exists && existingGroup.Owner == group.Owner {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
p.Groups[group.GroupID] = group
|
||||
}
|
||||
|
||||
// If we are sent an invite or group update by someone who is not an owner
|
||||
// then we reject the group.
|
||||
}
|
||||
|
||||
// AttemptDecryption takes a ciphertext and signature and attempts to decrypt it under known groups.
|
||||
func (p *Profile) AttemptDecryption(ciphertext []byte, signature []byte) (bool, *Message) {
|
||||
for _, group := range p.Groups {
|
||||
success, dgm := group.DecryptMessage(ciphertext)
|
||||
if success {
|
||||
|
||||
// Assert that we know the owner of the group
|
||||
owner, ok := p.Contacts[group.Owner]
|
||||
if ok {
|
||||
valid := ed25519.Verify(owner.Ed25519PublicKey, []byte(group.GroupID+group.GroupServer), dgm.SignedGroupId)
|
||||
// If we can decrypt the message, but the group id is wrong that means that
|
||||
// this message is from someone who was not invited to the group.
|
||||
// As such this group has been compromised, probably by one of the other members.
|
||||
// We set the flag to be handled by the UX and reject the message.
|
||||
if !valid {
|
||||
group.Compromised()
|
||||
return false, nil
|
||||
}
|
||||
}
|
||||
|
||||
verified := p.VerifyGroupMessage(dgm.GetOnion(), group.GroupID, dgm.GetText(), dgm.GetTimestamp(), ciphertext, signature)
|
||||
|
||||
// So we have a message that has a valid group key, but the signature can't be verified.
|
||||
// The most obvious explanation for this is that the group key has been compromised (or we are in an open group and the server is being malicious)
|
||||
// Either way, someone who has the private key is being detectably bad so we are just going to throw this message away and mark the group as Compromised.
|
||||
if !verified {
|
||||
group.Compromised()
|
||||
return false, nil
|
||||
}
|
||||
|
||||
return true, group.AddMessage(dgm, signature)
|
||||
}
|
||||
}
|
||||
return false, nil
|
||||
}
|
||||
|
||||
func getRandomness(arr *[]byte) {
|
||||
if _, err := io.ReadFull(rand.Reader, (*arr)[:]); err != nil {
|
||||
utils.CheckError(err)
|
||||
}
|
||||
}
|
||||
|
||||
// EncryptMessageToGroup when given a message and a group, encrypts and signs the message under the group and
|
||||
// profile
|
||||
func (p *Profile) EncryptMessageToGroup(message string, groupID string) ([]byte, []byte, error) {
|
||||
group := p.GetGroupByGroupID(groupID)
|
||||
if group != nil {
|
||||
timestamp := time.Now().Unix()
|
||||
|
||||
var prevSig []byte
|
||||
if len(group.Timeline.Messages) > 0 {
|
||||
prevSig = group.Timeline.Messages[len(group.Timeline.Messages)-1].Signature
|
||||
} else {
|
||||
prevSig = group.SignedGroupID
|
||||
}
|
||||
|
||||
lenPadding := 1024 - len(message)
|
||||
padding := make([]byte, lenPadding)
|
||||
getRandomness(&padding)
|
||||
|
||||
dm := &protocol.DecryptedGroupMessage{
|
||||
Onion: proto.String(p.Onion),
|
||||
Text: proto.String(message),
|
||||
SignedGroupId: group.SignedGroupID[:],
|
||||
Timestamp: proto.Int32(int32(timestamp)),
|
||||
PreviousMessageSig: prevSig,
|
||||
Padding: padding[:],
|
||||
}
|
||||
ciphertext, err := group.EncryptMessage(dm)
|
||||
if err != nil {
|
||||
// If we can't do randomness, just crash something is very very wrong and we are not going
|
||||
// to resolve it here....
|
||||
panic(err.Error())
|
||||
return nil, nil, err
|
||||
}
|
||||
signature := p.SignMessage(groupID + group.GroupServer + string(ciphertext))
|
||||
return ciphertext, signature, nil
|
||||
}
|
||||
}
|
||||
|
||||
// GenerateRandomID generates a random 16 byte hex id code
|
||||
func GenerateRandomID() string {
|
||||
randBytes := make([]byte, 16)
|
||||
rand.Read(randBytes)
|
||||
return hex.EncodeToString(randBytes)
|
||||
}
|
||||
|
||||
// GetCopy returns a full deep copy of the Profile struct and its members (timeline inclusion control by arg)
|
||||
func (p *Profile) GetCopy(timeline bool) *Profile {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
|
||||
newp := new(Profile)
|
||||
bytes, _ := json.Marshal(p)
|
||||
json.Unmarshal(bytes, &newp)
|
||||
|
||||
if timeline {
|
||||
for groupID := range newp.Groups {
|
||||
if group, exists := newp.Groups[groupID]; exists {
|
||||
if pGroup, exists := p.Groups[groupID]; exists {
|
||||
group.Timeline = *(pGroup).Timeline.GetCopy()
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
for peerID := range newp.Contacts {
|
||||
if peer, exists := newp.Contacts[peerID]; exists {
|
||||
if pPeer, exists := p.Contacts[peerID]; exists {
|
||||
peer.Timeline = *(pPeer).Timeline.GetCopy()
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
return newp
|
||||
return nil, nil, errors.New("group does not exist")
|
||||
}
|
||||
|
|
|
@ -0,0 +1,172 @@
|
|||
package model
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"testing"
|
||||
"time"
|
||||
)
|
||||
|
||||
func TestP2P(t *testing.T) {
|
||||
sarah := GenerateNewProfile("Sarah")
|
||||
alice := GenerateNewProfile("Alice")
|
||||
|
||||
sarah.AddContact(alice.Onion, &alice.PublicProfile)
|
||||
|
||||
sarah.AddMessageToContactTimeline(alice.Onion, false, "hello", time.Now())
|
||||
sarah.AddMessageToContactTimeline(alice.Onion, true, "world", time.Now())
|
||||
|
||||
contact, _ := sarah.GetContact(alice.Onion)
|
||||
for i, m := range contact.Timeline.GetMessages() {
|
||||
if i == 0 && (m.Message != "hello" || m.PeerID != alice.Onion) {
|
||||
t.Fatalf("Timeline is invalid: %v", m)
|
||||
}
|
||||
|
||||
if i == 1 && (m.Message != "world" || m.PeerID != sarah.Onion) {
|
||||
t.Fatalf("Timeline is invalid: %v", m)
|
||||
}
|
||||
t.Logf("Message: %v", m)
|
||||
}
|
||||
}
|
||||
|
||||
func TestProfileIdentity(t *testing.T) {
|
||||
sarah := GenerateNewProfile("Sarah")
|
||||
alice := GenerateNewProfile("Alice")
|
||||
|
||||
message := sarah.GetCwtchIdentityPacket()
|
||||
|
||||
ci := &protocol.CwtchPeerPacket{}
|
||||
err := proto.Unmarshal(message, ci)
|
||||
if err != nil {
|
||||
t.Errorf("alice should have added sarah as a contact %v", err)
|
||||
}
|
||||
|
||||
alice.AddContact(sarah.Onion, &sarah.PublicProfile)
|
||||
if alice.Contacts[sarah.Onion].Name != "Sarah" {
|
||||
t.Errorf("alice should have added sarah as a contact %v", alice.Contacts)
|
||||
}
|
||||
|
||||
if len(alice.GetContacts()) != 1 {
|
||||
t.Errorf("alice should be only contact: %v", alice.GetContacts())
|
||||
}
|
||||
|
||||
alice.SetCustomAttribute("test", "hello world")
|
||||
value, _ := alice.GetCustomAttribute("test")
|
||||
if value != "hello world" {
|
||||
t.Errorf("value from custom attribute should have been 'hello world', instead was: %v", value)
|
||||
}
|
||||
|
||||
t.Logf("%v", alice)
|
||||
}
|
||||
|
||||
func TestTrustPeer(t *testing.T) {
|
||||
sarah := GenerateNewProfile("Sarah")
|
||||
alice := GenerateNewProfile("Alice")
|
||||
sarah.AddContact(alice.Onion, &alice.PublicProfile)
|
||||
alice.AddContact(sarah.Onion, &sarah.PublicProfile)
|
||||
alice.TrustPeer(sarah.Onion)
|
||||
if alice.IsBlocked(sarah.Onion) {
|
||||
t.Errorf("peer should not be blocked")
|
||||
}
|
||||
|
||||
if alice.TrustPeer("") == nil {
|
||||
t.Errorf("trusting a non existent peer should error")
|
||||
}
|
||||
}
|
||||
|
||||
func TestBlockPeer(t *testing.T) {
|
||||
sarah := GenerateNewProfile("Sarah")
|
||||
alice := GenerateNewProfile("Alice")
|
||||
sarah.AddContact(alice.Onion, &alice.PublicProfile)
|
||||
alice.AddContact(sarah.Onion, &sarah.PublicProfile)
|
||||
alice.BlockPeer(sarah.Onion)
|
||||
if !alice.IsBlocked(sarah.Onion) {
|
||||
t.Errorf("peer should not be blocked")
|
||||
}
|
||||
|
||||
if alice.BlockPeer("") == nil {
|
||||
t.Errorf("blocking a non existent peer should error")
|
||||
}
|
||||
}
|
||||
|
||||
func TestAcceptNonExistentGroup(t *testing.T) {
|
||||
sarah := GenerateNewProfile("Sarah")
|
||||
sarah.AcceptInvite("doesnotexist")
|
||||
}
|
||||
|
||||
func TestRejectGroupInvite(t *testing.T) {
|
||||
sarah := GenerateNewProfile("Sarah")
|
||||
alice := GenerateNewProfile("Alice")
|
||||
sarah.AddContact(alice.Onion, &alice.PublicProfile)
|
||||
alice.AddContact(sarah.Onion, &sarah.PublicProfile)
|
||||
|
||||
gid, invite, _ := alice.StartGroup("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd")
|
||||
gci := &protocol.CwtchPeerPacket{}
|
||||
proto.Unmarshal(invite, gci)
|
||||
sarah.ProcessInvite(gci.GetGroupChatInvite(), alice.Onion)
|
||||
group := alice.GetGroupByGroupID(gid)
|
||||
if len(sarah.Groups) == 1 {
|
||||
if sarah.GetGroupByGroupID(group.GroupID).Accepted {
|
||||
t.Errorf("Group should not be accepted")
|
||||
}
|
||||
sarah.RejectInvite(group.GroupID)
|
||||
if len(sarah.Groups) != 0 {
|
||||
t.Errorf("Group %v should have been deleted", group.GroupID)
|
||||
}
|
||||
return
|
||||
}
|
||||
t.Errorf("Group should exist in map")
|
||||
}
|
||||
|
||||
func TestProfileGroup(t *testing.T) {
|
||||
sarah := GenerateNewProfile("Sarah")
|
||||
alice := GenerateNewProfile("Alice")
|
||||
sarah.AddContact(alice.Onion, &alice.PublicProfile)
|
||||
alice.AddContact(sarah.Onion, &sarah.PublicProfile)
|
||||
|
||||
gid, invite, _ := alice.StartGroupWithMessage("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd", []byte("Hello World"))
|
||||
gci := &protocol.CwtchPeerPacket{}
|
||||
proto.Unmarshal(invite, gci)
|
||||
sarah.ProcessInvite(gci.GetGroupChatInvite(), alice.Onion)
|
||||
if len(sarah.GetGroups()) != 1 {
|
||||
t.Errorf("sarah should only be in 1 group instead: %v", sarah.GetGroups())
|
||||
}
|
||||
|
||||
group := alice.GetGroupByGroupID(gid)
|
||||
sarah.AcceptInvite(group.GroupID)
|
||||
c, s1, _ := sarah.EncryptMessageToGroup("Hello World", group.GroupID)
|
||||
alice.AttemptDecryption(c, s1)
|
||||
|
||||
gid2, invite2, _ := alice.StartGroup("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd")
|
||||
gci2 := &protocol.CwtchPeerPacket{}
|
||||
proto.Unmarshal(invite2, gci2)
|
||||
sarah.ProcessInvite(gci2.GetGroupChatInvite(), alice.Onion)
|
||||
group2 := alice.GetGroupByGroupID(gid2)
|
||||
c2, s2, _ := sarah.EncryptMessageToGroup("Hello World", group2.GroupID)
|
||||
alice.AttemptDecryption(c2, s2)
|
||||
|
||||
sarahGroup := sarah.GetGroupByGroupID(group.GroupID)
|
||||
im := sarahGroup.GetInitialMessage()
|
||||
if string(im) != "Hello World" {
|
||||
t.Errorf("Initial Message was not stored properly: %v", im)
|
||||
}
|
||||
|
||||
bob := GenerateNewProfile("bob")
|
||||
bob.AddContact(alice.Onion, &alice.PublicProfile)
|
||||
bob.ProcessInvite(gci2.GetGroupChatInvite(), alice.Onion)
|
||||
c3, s3, err := bob.EncryptMessageToGroup("Bobs Message", group2.GroupID)
|
||||
if err == nil {
|
||||
ok, message := alice.AttemptDecryption(c3, s3)
|
||||
if !ok {
|
||||
t.Errorf("Bobs message to the group should be decrypted %v %v", message, ok)
|
||||
}
|
||||
|
||||
eve := GenerateNewProfile("eve")
|
||||
ok, _ = eve.AttemptDecryption(c3, s3)
|
||||
if ok {
|
||||
t.Errorf("Eves hould not be able to decrypt messages!")
|
||||
}
|
||||
} else {
|
||||
t.Errorf("Bob failed to encrypt a message to the group")
|
||||
}
|
||||
}
|
|
@ -0,0 +1,153 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/application"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||
"sync"
|
||||
"time"
|
||||
)
|
||||
|
||||
// Manager encapsulates all the logic necessary to manage outgoing peer and server connections.
|
||||
type Manager struct {
|
||||
peerConnections map[string]*PeerPeerConnection
|
||||
serverConnections map[string]*PeerServerConnection
|
||||
lock sync.Mutex
|
||||
breakChannel chan bool
|
||||
acn connectivity.ACN
|
||||
}
|
||||
|
||||
// NewConnectionsManager creates a new instance of Manager.
|
||||
func NewConnectionsManager(acn connectivity.ACN) *Manager {
|
||||
m := new(Manager)
|
||||
m.acn = acn
|
||||
m.peerConnections = make(map[string]*PeerPeerConnection)
|
||||
m.serverConnections = make(map[string]*PeerServerConnection)
|
||||
m.breakChannel = make(chan bool)
|
||||
return m
|
||||
}
|
||||
|
||||
// ManagePeerConnection creates a new PeerConnection for the given Host and Profile.
|
||||
func (m *Manager) ManagePeerConnection(host string, profile *model.Profile, dataHandler func(string, []byte) []byte, aif application.ApplicationInstanceFactory) *PeerPeerConnection {
|
||||
m.lock.Lock()
|
||||
defer m.lock.Unlock()
|
||||
|
||||
_, exists := m.peerConnections[host]
|
||||
if !exists {
|
||||
ppc := NewPeerPeerConnection(m.acn, host, profile, dataHandler, aif)
|
||||
go ppc.Run()
|
||||
m.peerConnections[host] = ppc
|
||||
return ppc
|
||||
}
|
||||
return m.peerConnections[host]
|
||||
}
|
||||
|
||||
// ManageServerConnection creates a new ServerConnection for Host with the given callback handler.
|
||||
func (m *Manager) ManageServerConnection(host string, handler func(string, *protocol.GroupMessage)) {
|
||||
m.lock.Lock()
|
||||
|
||||
_, exists := m.serverConnections[host]
|
||||
if !exists {
|
||||
psc := NewPeerServerConnection(m.acn, host)
|
||||
go psc.Run()
|
||||
psc.GroupMessageHandler = handler
|
||||
m.serverConnections[host] = psc
|
||||
}
|
||||
m.lock.Unlock()
|
||||
}
|
||||
|
||||
// GetPeers returns a map of all peer connections with their state
|
||||
func (m *Manager) GetPeers() map[string]ConnectionState {
|
||||
rm := make(map[string]ConnectionState)
|
||||
m.lock.Lock()
|
||||
for onion, ppc := range m.peerConnections {
|
||||
rm[onion] = ppc.GetState()
|
||||
}
|
||||
m.lock.Unlock()
|
||||
return rm
|
||||
}
|
||||
|
||||
// GetServers returns a map of all server connections with their state.
|
||||
func (m *Manager) GetServers() map[string]ConnectionState {
|
||||
rm := make(map[string]ConnectionState)
|
||||
m.lock.Lock()
|
||||
for onion, psc := range m.serverConnections {
|
||||
rm[onion] = psc.GetState()
|
||||
}
|
||||
m.lock.Unlock()
|
||||
return rm
|
||||
}
|
||||
|
||||
// GetPeerPeerConnectionForOnion safely returns a given peer connection
|
||||
func (m *Manager) GetPeerPeerConnectionForOnion(host string) (ppc *PeerPeerConnection) {
|
||||
m.lock.Lock()
|
||||
ppc = m.peerConnections[host]
|
||||
m.lock.Unlock()
|
||||
return
|
||||
}
|
||||
|
||||
// GetPeerServerConnectionForOnion safely returns a given host connection
|
||||
func (m *Manager) GetPeerServerConnectionForOnion(host string) (psc *PeerServerConnection) {
|
||||
m.lock.Lock()
|
||||
psc = m.serverConnections[host]
|
||||
m.lock.Unlock()
|
||||
return
|
||||
}
|
||||
|
||||
// AttemptReconnections repeatedly attempts to reconnect with failed peers and servers.
|
||||
func (m *Manager) AttemptReconnections() {
|
||||
timeout := time.Duration(0) // first pass right away
|
||||
|
||||
for {
|
||||
select {
|
||||
case <-time.After(timeout):
|
||||
m.lock.Lock()
|
||||
for _, ppc := range m.peerConnections {
|
||||
if ppc.GetState() == FAILED {
|
||||
go ppc.Run()
|
||||
}
|
||||
}
|
||||
m.lock.Unlock()
|
||||
|
||||
m.lock.Lock()
|
||||
for _, psc := range m.serverConnections {
|
||||
if psc.GetState() == FAILED {
|
||||
go psc.Run()
|
||||
}
|
||||
}
|
||||
m.lock.Unlock()
|
||||
|
||||
// Launch Another Run In 30 Seconds
|
||||
timeout = time.Duration(30 * time.Second)
|
||||
case <-m.breakChannel:
|
||||
return
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// ClosePeerConnection closes an existing peer connection
|
||||
func (m *Manager) ClosePeerConnection(onion string) {
|
||||
m.lock.Lock()
|
||||
pc, ok := m.peerConnections[onion]
|
||||
if ok {
|
||||
pc.Close()
|
||||
delete(m.peerConnections, onion)
|
||||
}
|
||||
m.lock.Unlock()
|
||||
}
|
||||
|
||||
// Shutdown closes all connections under managment (freeing their goroutines)
|
||||
func (m *Manager) Shutdown() {
|
||||
m.breakChannel <- true
|
||||
m.lock.Lock()
|
||||
for onion, ppc := range m.peerConnections {
|
||||
ppc.Close()
|
||||
delete(m.peerConnections, onion)
|
||||
}
|
||||
for onion, psc := range m.serverConnections {
|
||||
psc.Close()
|
||||
delete(m.serverConnections, onion)
|
||||
}
|
||||
m.lock.Unlock()
|
||||
}
|
|
@ -0,0 +1,11 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||
"testing"
|
||||
)
|
||||
|
||||
func TestConnectionsManager(t *testing.T) {
|
||||
// TODO We need to encapsulate connections behind a well defined interface for tesintg
|
||||
NewConnectionsManager(connectivity.LocalProvider())
|
||||
}
|
|
@ -0,0 +1,156 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/peer/peer"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/application"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connection"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/identity"
|
||||
"log"
|
||||
"time"
|
||||
)
|
||||
|
||||
// PeerPeerConnection encapsulates a single outgoing cwtchPeer->cwtchPeer connection
|
||||
type PeerPeerConnection struct {
|
||||
connection.AutoConnectionHandler
|
||||
PeerHostname string
|
||||
state ConnectionState
|
||||
connection *connection.Connection
|
||||
profile *model.Profile
|
||||
dataHandler func(string, []byte) []byte
|
||||
aif application.ApplicationInstanceFactory
|
||||
acn connectivity.ACN
|
||||
}
|
||||
|
||||
// NewPeerPeerConnection creates a new peer connection for the given hostname and profile.
|
||||
func NewPeerPeerConnection(acn connectivity.ACN, peerhostname string, profile *model.Profile, dataHandler func(string, []byte) []byte, aif application.ApplicationInstanceFactory) *PeerPeerConnection {
|
||||
ppc := new(PeerPeerConnection)
|
||||
ppc.acn = acn
|
||||
ppc.PeerHostname = peerhostname
|
||||
ppc.profile = profile
|
||||
ppc.dataHandler = dataHandler
|
||||
ppc.aif = aif
|
||||
ppc.Init()
|
||||
return ppc
|
||||
}
|
||||
|
||||
// GetState returns the current connection state
|
||||
func (ppc *PeerPeerConnection) GetState() ConnectionState {
|
||||
return ppc.state
|
||||
}
|
||||
|
||||
// HandleGroupInvite passes the given group invite tothe profile
|
||||
func (ppc *PeerPeerConnection) HandleGroupInvite(gci *protocol.GroupChatInvite) {
|
||||
ppc.profile.ProcessInvite(gci, ppc.PeerHostname)
|
||||
}
|
||||
|
||||
// HandlePacket handles data packets on the optional data channel
|
||||
func (ppc *PeerPeerConnection) HandlePacket(data []byte) []byte {
|
||||
return ppc.dataHandler(ppc.PeerHostname, data)
|
||||
}
|
||||
|
||||
// SendPacket sends data packets on the optional data channel
|
||||
func (ppc *PeerPeerConnection) SendPacket(data []byte) {
|
||||
ppc.WaitTilAuthenticated()
|
||||
ppc.connection.Do(func() error {
|
||||
channel := ppc.connection.Channel("im.cwtch.peer.data", channels.Outbound)
|
||||
if channel != nil {
|
||||
peerchannel, ok := channel.Handler.(*peer.CwtchPeerDataChannel)
|
||||
if ok {
|
||||
log.Printf("Sending packet\n")
|
||||
peerchannel.SendMessage(data)
|
||||
}
|
||||
}
|
||||
return nil
|
||||
})
|
||||
}
|
||||
|
||||
// DoOnChannel performs an operation on the requested channel
|
||||
func (ppc *PeerPeerConnection) DoOnChannel(ctype string, direction channels.Direction, doSomethingWith func(channel *channels.Channel)) {
|
||||
ppc.WaitTilAuthenticated()
|
||||
ppc.connection.Do(func() error {
|
||||
channel := ppc.connection.Channel(ctype, direction)
|
||||
if channel != nil {
|
||||
doSomethingWith(channel)
|
||||
}
|
||||
return nil
|
||||
})
|
||||
}
|
||||
|
||||
// SendGroupInvite sends the given serialized invite packet to the Peer
|
||||
func (ppc *PeerPeerConnection) SendGroupInvite(invite []byte) {
|
||||
ppc.WaitTilAuthenticated()
|
||||
ppc.connection.Do(func() error {
|
||||
channel := ppc.connection.Channel("im.cwtch.peer", channels.Outbound)
|
||||
if channel != nil {
|
||||
peerchannel, ok := channel.Handler.(*peer.CwtchPeerChannel)
|
||||
if ok {
|
||||
log.Printf("Sending group invite packet\n")
|
||||
peerchannel.SendMessage(invite)
|
||||
}
|
||||
}
|
||||
return nil
|
||||
})
|
||||
}
|
||||
|
||||
// WaitTilAuthenticated waits until the underlying connection is authenticated
|
||||
func (ppc *PeerPeerConnection) WaitTilAuthenticated() {
|
||||
for {
|
||||
if ppc.GetState() == AUTHENTICATED {
|
||||
break
|
||||
}
|
||||
time.Sleep(time.Second * 1)
|
||||
}
|
||||
}
|
||||
|
||||
// Run manages the setup and teardown of a peer->peer connection
|
||||
func (ppc *PeerPeerConnection) Run() error {
|
||||
ppc.state = CONNECTING
|
||||
rc, err := goricochet.Open(ppc.acn, ppc.PeerHostname)
|
||||
if err == nil {
|
||||
rc.TraceLog(false)
|
||||
ppc.connection = rc
|
||||
ppc.state = CONNECTED
|
||||
_, err := connection.HandleOutboundConnection(ppc.connection).ProcessAuthAsV3Client(identity.InitializeV3(ppc.profile.Name, &ppc.profile.Ed25519PrivateKey, &ppc.profile.Ed25519PublicKey))
|
||||
if err == nil {
|
||||
ppc.state = AUTHENTICATED
|
||||
go func() {
|
||||
ppc.connection.Do(func() error {
|
||||
ppc.connection.RequestOpenChannel("im.cwtch.peer", &peer.CwtchPeerChannel{Handler: ppc})
|
||||
return nil
|
||||
})
|
||||
|
||||
if ppc.dataHandler != nil {
|
||||
ppc.connection.Do(func() error {
|
||||
ppc.connection.RequestOpenChannel("im.cwtch.peer.data", &peer.CwtchPeerDataChannel{Handler: ppc})
|
||||
return nil
|
||||
})
|
||||
}
|
||||
|
||||
handlers := ppc.aif.GetHandlers()
|
||||
for i := range handlers {
|
||||
ppc.connection.Do(func() error {
|
||||
ppc.connection.RequestOpenChannel(handlers[i], ppc.aif.GetHandler(handlers[i])(ppc.aif.GetApplicationInstance(ppc.connection))())
|
||||
return nil
|
||||
})
|
||||
}
|
||||
}()
|
||||
|
||||
ppc.connection.Process(ppc)
|
||||
}
|
||||
}
|
||||
ppc.state = FAILED
|
||||
return err
|
||||
}
|
||||
|
||||
// Close closes the connection
|
||||
func (ppc *PeerPeerConnection) Close() {
|
||||
ppc.state = KILLED
|
||||
if ppc.connection != nil {
|
||||
ppc.connection.Conn.Close()
|
||||
}
|
||||
}
|
|
@ -0,0 +1,89 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/peer/peer"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/application"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connection"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/identity"
|
||||
"golang.org/x/crypto/ed25519"
|
||||
"net"
|
||||
"testing"
|
||||
"time"
|
||||
)
|
||||
|
||||
func PeerAuthValid(hostname string, key ed25519.PublicKey) (allowed, known bool) {
|
||||
return true, true
|
||||
}
|
||||
|
||||
func runtestpeer(t *testing.T, tp *TestPeer, identity identity.Identity, listenChan chan bool) {
|
||||
ln, _ := net.Listen("tcp", "127.0.0.1:5452")
|
||||
listenChan <- true
|
||||
conn, _ := ln.Accept()
|
||||
defer conn.Close()
|
||||
|
||||
rc, err := goricochet.NegotiateVersionInbound(conn)
|
||||
if err != nil {
|
||||
t.Errorf("Negotiate Version Error: %v", err)
|
||||
}
|
||||
rc.TraceLog(true)
|
||||
err = connection.HandleInboundConnection(rc).ProcessAuthAsV3Server(identity, PeerAuthValid)
|
||||
if err != nil {
|
||||
t.Errorf("ServerAuth Error: %v", err)
|
||||
}
|
||||
tp.RegisterChannelHandler("im.cwtch.peer", func() channels.Handler {
|
||||
cpc := new(peer.CwtchPeerChannel)
|
||||
cpc.Handler = tp
|
||||
return cpc
|
||||
})
|
||||
|
||||
rc.Process(tp)
|
||||
}
|
||||
|
||||
type TestPeer struct {
|
||||
connection.AutoConnectionHandler
|
||||
ReceivedIdentityPacket bool
|
||||
ReceivedGroupInvite bool
|
||||
}
|
||||
|
||||
func (tp *TestPeer) HandleGroupInvite(gci *protocol.GroupChatInvite) {
|
||||
tp.ReceivedGroupInvite = true
|
||||
}
|
||||
|
||||
func TestPeerPeerConnection(t *testing.T) {
|
||||
pub, priv, _ := ed25519.GenerateKey(rand.Reader)
|
||||
identity := identity.InitializeV3("", &priv, &pub)
|
||||
|
||||
profile := model.GenerateNewProfile("alice")
|
||||
hostname := identity.Hostname()
|
||||
ppc := NewPeerPeerConnection(connectivity.LocalProvider(), "127.0.0.1:5452|"+hostname, profile, nil, application.ApplicationInstanceFactory{})
|
||||
|
||||
tp := new(TestPeer)
|
||||
tp.Init()
|
||||
listenChan := make(chan bool)
|
||||
go runtestpeer(t, tp, identity, listenChan)
|
||||
<-listenChan
|
||||
state := ppc.GetState()
|
||||
if state != DISCONNECTED {
|
||||
fmt.Println("ERROR state should be disconnected")
|
||||
t.Errorf("new connections should start in disconnected state")
|
||||
}
|
||||
go ppc.Run()
|
||||
time.Sleep(time.Second * 5)
|
||||
state = ppc.GetState()
|
||||
if state != AUTHENTICATED {
|
||||
t.Errorf("connection state should be authenticated(3), was instead %v", state)
|
||||
}
|
||||
_, invite, _ := profile.StartGroup("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd")
|
||||
ppc.SendGroupInvite(invite)
|
||||
time.Sleep(time.Second * 3)
|
||||
if tp.ReceivedGroupInvite == false {
|
||||
t.Errorf("should have received an group invite packet")
|
||||
}
|
||||
}
|
|
@ -0,0 +1,141 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"cwtch.im/cwtch/peer/fetch"
|
||||
"cwtch.im/cwtch/peer/listen"
|
||||
"cwtch.im/cwtch/peer/send"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"errors"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connection"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/identity"
|
||||
"golang.org/x/crypto/ed25519"
|
||||
"log"
|
||||
"time"
|
||||
)
|
||||
|
||||
// PeerServerConnection encapsulates a single Peer->Server connection
|
||||
type PeerServerConnection struct {
|
||||
connection.AutoConnectionHandler
|
||||
Server string
|
||||
state ConnectionState
|
||||
connection *connection.Connection
|
||||
acn connectivity.ACN
|
||||
|
||||
GroupMessageHandler func(string, *protocol.GroupMessage)
|
||||
}
|
||||
|
||||
// NewPeerServerConnection creates a new Peer->Server outbound connection
|
||||
func NewPeerServerConnection(acn connectivity.ACN, serverhostname string) *PeerServerConnection {
|
||||
psc := new(PeerServerConnection)
|
||||
psc.acn = acn
|
||||
psc.Server = serverhostname
|
||||
psc.Init()
|
||||
return psc
|
||||
}
|
||||
|
||||
// GetState returns the current connection state
|
||||
func (psc *PeerServerConnection) GetState() ConnectionState {
|
||||
return psc.state
|
||||
}
|
||||
|
||||
// WaitTilAuthenticated waits until the underlying connection is authenticated
|
||||
func (psc *PeerServerConnection) WaitTilAuthenticated() {
|
||||
for {
|
||||
if psc.GetState() == AUTHENTICATED {
|
||||
break
|
||||
}
|
||||
time.Sleep(time.Second * 1)
|
||||
}
|
||||
}
|
||||
|
||||
// Run manages the setup and teardown of a peer server connection
|
||||
func (psc *PeerServerConnection) Run() error {
|
||||
log.Printf("Connecting to %v", psc.Server)
|
||||
rc, err := goricochet.Open(psc.acn, psc.Server)
|
||||
if err == nil {
|
||||
rc.TraceLog(true)
|
||||
psc.connection = rc
|
||||
psc.state = CONNECTED
|
||||
pub, priv, _ := ed25519.GenerateKey(rand.Reader)
|
||||
if err == nil {
|
||||
_, err := connection.HandleOutboundConnection(psc.connection).ProcessAuthAsV3Client(identity.InitializeV3("cwtchpeer", &priv, &pub))
|
||||
if err == nil {
|
||||
psc.state = AUTHENTICATED
|
||||
|
||||
go func() {
|
||||
psc.connection.Do(func() error {
|
||||
psc.connection.RequestOpenChannel("im.cwtch.server.fetch", &fetch.CwtchPeerFetchChannel{Handler: psc})
|
||||
return nil
|
||||
})
|
||||
|
||||
psc.connection.Do(func() error {
|
||||
psc.connection.RequestOpenChannel("im.cwtch.server.listen", &listen.CwtchPeerListenChannel{Handler: psc})
|
||||
return nil
|
||||
})
|
||||
}()
|
||||
psc.connection.Process(psc)
|
||||
}
|
||||
}
|
||||
}
|
||||
psc.state = FAILED
|
||||
return err
|
||||
}
|
||||
|
||||
// Break makes Run() return and prevents processing, but doesn't close the connection.
|
||||
func (psc *PeerServerConnection) Break() error {
|
||||
return psc.connection.Break()
|
||||
}
|
||||
|
||||
// SendGroupMessage sends the given protocol message to the Server.
|
||||
func (psc *PeerServerConnection) SendGroupMessage(gm *protocol.GroupMessage) error {
|
||||
if psc.state != AUTHENTICATED {
|
||||
return errors.New("peer is not yet connected & authenticated to server cannot send message")
|
||||
}
|
||||
|
||||
err := psc.connection.Do(func() error {
|
||||
psc.connection.RequestOpenChannel("im.cwtch.server.send", &send.CwtchPeerSendChannel{})
|
||||
return nil
|
||||
})
|
||||
|
||||
errCount := 0
|
||||
for errCount < 5 {
|
||||
time.Sleep(time.Second * 1)
|
||||
err = psc.connection.Do(func() error {
|
||||
channel := psc.connection.Channel("im.cwtch.server.send", channels.Outbound)
|
||||
if channel == nil {
|
||||
return errors.New("no channel found")
|
||||
}
|
||||
sendchannel, ok := channel.Handler.(*send.CwtchPeerSendChannel)
|
||||
if ok {
|
||||
return sendchannel.SendGroupMessage(gm)
|
||||
}
|
||||
return errors.New("channel is not a peer send channel (this should definitely not happen)")
|
||||
})
|
||||
|
||||
if err != nil {
|
||||
errCount++
|
||||
} else {
|
||||
return nil
|
||||
}
|
||||
}
|
||||
|
||||
return err
|
||||
}
|
||||
|
||||
// Close shuts down the connection (freeing the handler goroutines)
|
||||
func (psc *PeerServerConnection) Close() {
|
||||
psc.state = KILLED
|
||||
if psc.connection != nil {
|
||||
psc.connection.Conn.Close()
|
||||
}
|
||||
}
|
||||
|
||||
// HandleGroupMessage passes the given group message back to the profile.
|
||||
func (psc *PeerServerConnection) HandleGroupMessage(gm *protocol.GroupMessage) {
|
||||
log.Printf("Received Group Message")
|
||||
psc.GroupMessageHandler(psc.Server, gm)
|
||||
}
|
|
@ -0,0 +1,107 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"cwtch.im/cwtch/server/fetch"
|
||||
"cwtch.im/cwtch/server/send"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connection"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/identity"
|
||||
"golang.org/x/crypto/ed25519"
|
||||
"net"
|
||||
"testing"
|
||||
"time"
|
||||
)
|
||||
|
||||
func ServerAuthValid(hostname string, key ed25519.PublicKey) (allowed, known bool) {
|
||||
return true, true
|
||||
}
|
||||
|
||||
type TestServer struct {
|
||||
connection.AutoConnectionHandler
|
||||
Received bool
|
||||
}
|
||||
|
||||
func (ts *TestServer) HandleGroupMessage(gm *protocol.GroupMessage) {
|
||||
ts.Received = true
|
||||
}
|
||||
|
||||
func (ts *TestServer) HandleFetchRequest() []*protocol.GroupMessage {
|
||||
return []*protocol.GroupMessage{{Ciphertext: []byte("hello"), Signature: []byte{}, Spamguard: []byte{}}, {Ciphertext: []byte("hello"), Signature: []byte{}, Spamguard: []byte{}}}
|
||||
}
|
||||
|
||||
func runtestserver(t *testing.T, ts *TestServer, identity identity.Identity, listenChan chan bool) {
|
||||
ln, _ := net.Listen("tcp", "127.0.0.1:5451")
|
||||
listenChan <- true
|
||||
conn, _ := ln.Accept()
|
||||
defer conn.Close()
|
||||
|
||||
rc, err := goricochet.NegotiateVersionInbound(conn)
|
||||
if err != nil {
|
||||
t.Errorf("Negotiate Version Error: %v", err)
|
||||
}
|
||||
rc.TraceLog(true)
|
||||
err = connection.HandleInboundConnection(rc).ProcessAuthAsV3Server(identity, ServerAuthValid)
|
||||
if err != nil {
|
||||
t.Errorf("ServerAuth Error: %v", err)
|
||||
}
|
||||
|
||||
ts.RegisterChannelHandler("im.cwtch.server.send", func() channels.Handler {
|
||||
server := new(send.CwtchServerSendChannel)
|
||||
server.Handler = ts
|
||||
return server
|
||||
})
|
||||
|
||||
ts.RegisterChannelHandler("im.cwtch.server.fetch", func() channels.Handler {
|
||||
server := new(fetch.CwtchServerFetchChannel)
|
||||
server.Handler = ts
|
||||
return server
|
||||
})
|
||||
|
||||
rc.Process(ts)
|
||||
}
|
||||
|
||||
func TestPeerServerConnection(t *testing.T) {
|
||||
pub, priv, _ := ed25519.GenerateKey(rand.Reader)
|
||||
|
||||
identity := identity.InitializeV3("", &priv, &pub)
|
||||
|
||||
ts := new(TestServer)
|
||||
ts.Init()
|
||||
listenChan := make(chan bool)
|
||||
go runtestserver(t, ts, identity, listenChan)
|
||||
<-listenChan
|
||||
onionAddr := identity.Hostname()
|
||||
|
||||
psc := NewPeerServerConnection(connectivity.LocalProvider(), "127.0.0.1:5451|"+onionAddr)
|
||||
numcalls := 0
|
||||
psc.GroupMessageHandler = func(s string, gm *protocol.GroupMessage) {
|
||||
numcalls++
|
||||
}
|
||||
state := psc.GetState()
|
||||
if state != DISCONNECTED {
|
||||
t.Errorf("new connections should start in disconnected state")
|
||||
}
|
||||
time.Sleep(time.Second * 1)
|
||||
go psc.Run()
|
||||
time.Sleep(time.Second * 2)
|
||||
state = psc.GetState()
|
||||
if state != AUTHENTICATED {
|
||||
t.Errorf("connection should now be authed(%v), instead was %v", AUTHENTICATED, state)
|
||||
}
|
||||
|
||||
gm := &protocol.GroupMessage{Ciphertext: []byte("hello"), Signature: []byte{}}
|
||||
psc.SendGroupMessage(gm)
|
||||
time.Sleep(time.Second * 2)
|
||||
if ts.Received == false {
|
||||
t.Errorf("Should have received a group message in test server")
|
||||
}
|
||||
|
||||
if numcalls != 2 {
|
||||
t.Errorf("Should have received 2 calls from fetch request, instead received %v", numcalls)
|
||||
}
|
||||
|
||||
}
|
|
@ -7,25 +7,17 @@ type ConnectionState int
|
|||
// DISCONNECTED - No existing connection has been made, or all attempts have failed
|
||||
// CONNECTING - We are in the process of attempting to connect to a given endpoint
|
||||
// CONNECTED - We have connected but not yet authenticated
|
||||
// AUTHENTICATED - im.ricochet.auth-hidden-server has succeeded on the connection.
|
||||
// SYNCED - we have pulled all the messages for groups from the server and are ready to send
|
||||
// AUTHENTICATED - im.ricochet.auth-hidden-server has succeeded on thec onnection.
|
||||
const (
|
||||
DISCONNECTED ConnectionState = iota
|
||||
CONNECTING
|
||||
CONNECTED
|
||||
AUTHENTICATED
|
||||
SYNCED
|
||||
FAILED
|
||||
KILLED
|
||||
)
|
||||
|
||||
var (
|
||||
// ConnectionStateName allows conversion of states to their string representations
|
||||
ConnectionStateName = []string{"Disconnected", "Connecting", "Connected", "Authenticated", "Synced", "Failed", "Killed"}
|
||||
// ConnectionStateName allows conversaion of states to their string representations
|
||||
ConnectionStateName = []string{"Disconnected", "Connecting", "Connected", "Authenticated", "Failed", "Killed"}
|
||||
)
|
||||
|
||||
// ConnectionStateToType allows conversion of strings to their state type
|
||||
func ConnectionStateToType() map[string]ConnectionState {
|
||||
return map[string]ConnectionState{"Disconnected": DISCONNECTED, "Connecting": CONNECTING,
|
||||
"Connected": CONNECTED, "Authenticated": AUTHENTICATED, "Synced": SYNCED, "Failed": FAILED, "Killed": KILLED}
|
||||
}
|
2156
peer/cwtch_peer.go
2156
peer/cwtch_peer.go
File diff suppressed because it is too large
Load Diff
|
@ -0,0 +1,73 @@
|
|||
package peer
|
||||
|
||||
import (
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||
"testing"
|
||||
)
|
||||
|
||||
func TestCwtchPeerGenerate(t *testing.T) {
|
||||
|
||||
alice := NewCwtchPeer("alice")
|
||||
|
||||
groupID, _, _ := alice.StartGroup("test.server")
|
||||
exportedGroup, _ := alice.ExportGroup(groupID)
|
||||
t.Logf("Exported Group: %v from %v", exportedGroup, alice.GetProfile().Onion)
|
||||
|
||||
importedGroupID, err := alice.ImportGroup(exportedGroup)
|
||||
group := alice.GetGroup(importedGroupID)
|
||||
t.Logf("Imported Group: %v, err := %v %v", group, err, importedGroupID)
|
||||
|
||||
}
|
||||
|
||||
func TestTrustPeer(t *testing.T) {
|
||||
groupName := "2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd"
|
||||
alice := NewCwtchPeer("alice")
|
||||
alice.Init(connectivity.LocalProvider())
|
||||
defer alice.Shutdown()
|
||||
bob := NewCwtchPeer("bob")
|
||||
bob.Init(connectivity.LocalProvider())
|
||||
defer bob.Shutdown()
|
||||
|
||||
bobOnion := bob.GetProfile().Onion
|
||||
aliceOnion := alice.GetProfile().Onion
|
||||
|
||||
groupID, _, err := alice.StartGroup(groupName)
|
||||
if err != nil {
|
||||
t.Error(err)
|
||||
}
|
||||
|
||||
groupAlice := alice.GetGroup(groupID)
|
||||
if groupAlice.GroupID != groupID {
|
||||
t.Errorf("Alice should be part of group %v, got %v instead", groupID, groupAlice)
|
||||
}
|
||||
|
||||
exportedGroup, err := alice.ExportGroup(groupID)
|
||||
if err != nil {
|
||||
t.Error(err)
|
||||
}
|
||||
|
||||
err = alice.InviteOnionToGroup(bobOnion, groupID)
|
||||
if err == nil {
|
||||
t.Errorf("onion invitation should fail since alice does no trust bob")
|
||||
}
|
||||
|
||||
err = alice.TrustPeer(bobOnion)
|
||||
if err == nil {
|
||||
t.Errorf("trust peer should fail since alice does not know about bob")
|
||||
}
|
||||
|
||||
// bob adds alice contact by importing serialized group created by alice
|
||||
_, err = bob.ImportGroup(exportedGroup)
|
||||
if err != nil {
|
||||
t.Error(err)
|
||||
}
|
||||
err = bob.TrustPeer(aliceOnion)
|
||||
if err != nil {
|
||||
t.Errorf("bob must be able to trust alice, got %v", err)
|
||||
}
|
||||
|
||||
err = bob.InviteOnionToGroup(aliceOnion, groupID)
|
||||
if err == nil {
|
||||
t.Errorf("bob trusts alice but peer connection is not ready yet. should not be able to invite her to group, instead got: %v", err)
|
||||
}
|
||||
}
|
File diff suppressed because it is too large
Load Diff
|
@ -0,0 +1,103 @@
|
|||
package fetch
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"errors"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
)
|
||||
|
||||
// CwtchPeerFetchChannel is the peer implementation of the im.cwtch.server.fetch
|
||||
// channel.
|
||||
type CwtchPeerFetchChannel struct {
|
||||
channel *channels.Channel
|
||||
Handler CwtchPeerFetchChannelHandler
|
||||
}
|
||||
|
||||
// CwtchPeerFetchChannelHandler should be implemented by peers to receive new messages.
|
||||
type CwtchPeerFetchChannelHandler interface {
|
||||
HandleGroupMessage(*protocol.GroupMessage)
|
||||
}
|
||||
|
||||
// Type returns the type string for this channel, e.g. "im.ricochet.server.fetch)
|
||||
func (cpfc *CwtchPeerFetchChannel) Type() string {
|
||||
return "im.cwtch.server.fetch"
|
||||
}
|
||||
|
||||
// Closed is called when the channel is closed for any reason.
|
||||
func (cpfc *CwtchPeerFetchChannel) Closed(err error) {
|
||||
|
||||
}
|
||||
|
||||
// OnlyClientCanOpen - for Cwtch server channels only client can open
|
||||
func (cpfc *CwtchPeerFetchChannel) OnlyClientCanOpen() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// Singleton - for Cwtch channels there can only be one instance per direction
|
||||
func (cpfc *CwtchPeerFetchChannel) Singleton() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// Bidirectional - for Cwtch channels are not bidrectional
|
||||
func (cpfc *CwtchPeerFetchChannel) Bidirectional() bool {
|
||||
return false
|
||||
}
|
||||
|
||||
// RequiresAuthentication - Cwtch server channels require no auth.
|
||||
func (cpfc *CwtchPeerFetchChannel) RequiresAuthentication() string {
|
||||
return "none"
|
||||
}
|
||||
|
||||
// OpenInbound - cwtch server peer implementations shouldnever respond to inbound requests
|
||||
func (cpfc *CwtchPeerFetchChannel) OpenInbound(channel *channels.Channel, raw *Protocol_Data_Control.OpenChannel) ([]byte, error) {
|
||||
return nil, errors.New("client does not receive inbound listen channels")
|
||||
}
|
||||
|
||||
// OpenOutbound sets up a new cwtch fetch channel
|
||||
func (cpfc *CwtchPeerFetchChannel) OpenOutbound(channel *channels.Channel) ([]byte, error) {
|
||||
cpfc.channel = channel
|
||||
messageBuilder := new(utils.MessageBuilder)
|
||||
return messageBuilder.OpenChannel(channel.ID, cpfc.Type()), nil
|
||||
}
|
||||
|
||||
// OpenOutboundResult confirms a previous open channel request
|
||||
func (cpfc *CwtchPeerFetchChannel) OpenOutboundResult(err error, crm *Protocol_Data_Control.ChannelResult) {
|
||||
if err == nil {
|
||||
if crm.GetOpened() {
|
||||
cpfc.channel.Pending = false
|
||||
cpfc.FetchRequest()
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// FetchRequest sends a FetchMessage to the Server.
|
||||
func (cpfc *CwtchPeerFetchChannel) FetchRequest() error {
|
||||
if cpfc.channel.Pending == false {
|
||||
fm := &protocol.FetchMessage{}
|
||||
csp := &protocol.CwtchServerPacket{
|
||||
FetchMessage: fm,
|
||||
}
|
||||
packet, _ := proto.Marshal(csp)
|
||||
cpfc.channel.SendMessage(packet)
|
||||
} else {
|
||||
return errors.New("channel isn't set up yet")
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// Packet is called for each raw packet received on this channel.
|
||||
func (cpfc *CwtchPeerFetchChannel) Packet(data []byte) {
|
||||
csp := &protocol.CwtchServerPacket{}
|
||||
err := proto.Unmarshal(data, csp)
|
||||
if err == nil {
|
||||
if csp.GetGroupMessage() != nil {
|
||||
gm := csp.GetGroupMessage()
|
||||
// We create a new go routine here to avoid leaking any information about processing time
|
||||
// TODO Server can probably try to use this to DoS a peer
|
||||
go cpfc.Handler.HandleGroupMessage(gm)
|
||||
}
|
||||
}
|
||||
}
|
|
@ -0,0 +1,92 @@
|
|||
package fetch
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"testing"
|
||||
"time"
|
||||
)
|
||||
|
||||
type TestHandler struct {
|
||||
Received bool
|
||||
}
|
||||
|
||||
func (th *TestHandler) HandleGroupMessage(m *protocol.GroupMessage) {
|
||||
th.Received = true
|
||||
}
|
||||
|
||||
func TestPeerFetchChannelAttributes(t *testing.T) {
|
||||
cssc := new(CwtchPeerFetchChannel)
|
||||
if cssc.Type() != "im.cwtch.server.fetch" {
|
||||
t.Errorf("cwtch channel type is incorrect %v", cssc.Type())
|
||||
}
|
||||
|
||||
if !cssc.OnlyClientCanOpen() {
|
||||
t.Errorf("only clients should be able to open im.cwtch.server.Fetch channel")
|
||||
}
|
||||
|
||||
if cssc.Bidirectional() {
|
||||
t.Errorf("im.cwtch.server.fetch should not be bidirectional")
|
||||
}
|
||||
|
||||
if !cssc.Singleton() {
|
||||
t.Errorf("im.cwtch.server.fetch should be a Singleton")
|
||||
}
|
||||
|
||||
if cssc.RequiresAuthentication() != "none" {
|
||||
t.Errorf("cwtch channel required auth is incorrect %v", cssc.RequiresAuthentication())
|
||||
}
|
||||
|
||||
}
|
||||
func TestPeerFetchChannelOpenInbound(t *testing.T) {
|
||||
cssc := new(CwtchPeerFetchChannel)
|
||||
channel := new(channels.Channel)
|
||||
_, err := cssc.OpenInbound(channel, nil)
|
||||
if err == nil {
|
||||
t.Errorf("client implementation of im.cwtch.server.Fetch should never open an inbound channel")
|
||||
}
|
||||
}
|
||||
|
||||
func TestPeerFetchChannel(t *testing.T) {
|
||||
pfc := new(CwtchPeerFetchChannel)
|
||||
th := new(TestHandler)
|
||||
pfc.Handler = th
|
||||
channel := new(channels.Channel)
|
||||
channel.ID = 3
|
||||
channel.SendMessage = func([]byte) {}
|
||||
channel.CloseChannel = func() {}
|
||||
result, err := pfc.OpenOutbound(channel)
|
||||
if err != nil {
|
||||
t.Errorf("expected result but also got non-nil error: result:%v, err: %v", result, err)
|
||||
}
|
||||
|
||||
cr := &Protocol_Data_Control.ChannelResult{
|
||||
ChannelIdentifier: proto.Int32(3),
|
||||
Opened: proto.Bool(true),
|
||||
}
|
||||
|
||||
pfc.OpenOutboundResult(nil, cr)
|
||||
if channel.Pending {
|
||||
t.Errorf("once opened channel should no longer be pending")
|
||||
}
|
||||
|
||||
csp := &protocol.CwtchServerPacket{
|
||||
GroupMessage: &protocol.GroupMessage{
|
||||
Ciphertext: []byte("hello"), Signature: []byte{}, Spamguard: []byte{},
|
||||
},
|
||||
}
|
||||
packet, _ := proto.Marshal(csp)
|
||||
|
||||
pfc.Packet(packet)
|
||||
|
||||
time.Sleep(time.Second * 2)
|
||||
|
||||
if th.Received != true {
|
||||
t.Errorf("group message should not have been received")
|
||||
}
|
||||
|
||||
pfc.Closed(nil)
|
||||
|
||||
}
|
|
@ -1,52 +0,0 @@
|
|||
package peer
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/model/attr"
|
||||
"cwtch.im/cwtch/settings"
|
||||
)
|
||||
|
||||
type ProfileHooks interface {
|
||||
// EventsToRegister returns a set of events that the extension is interested hooking
|
||||
EventsToRegister() []event.Type
|
||||
|
||||
// ExperimentsToRegister returns a set of experiments that the extension is interested in being notified about
|
||||
ExperimentsToRegister() []string
|
||||
|
||||
// OnEvent is called whenever an event Registered with RegisterEvents is called
|
||||
OnEvent(event event.Event, profile CwtchPeer)
|
||||
|
||||
// OnContactRequestValue is Hooked when a contact sends a request for the given path
|
||||
OnContactRequestValue(profile CwtchPeer, conversation model.Conversation, eventID string, path attr.ScopedZonedPath)
|
||||
|
||||
// OnContactReceiveValue is Hooked after a profile receives a response to a Get/Val Request
|
||||
OnContactReceiveValue(profile CwtchPeer, conversation model.Conversation, path attr.ScopedZonedPath, value string, exists bool)
|
||||
|
||||
// NotifySettingsUpdate allow profile hooks to access configs e.g. download folder
|
||||
NotifySettingsUpdate(settings settings.GlobalSettings)
|
||||
}
|
||||
|
||||
type ProfileHook struct {
|
||||
extension ProfileHooks
|
||||
events map[event.Type]bool
|
||||
experiments map[string]bool
|
||||
}
|
||||
|
||||
func ConstructHook(extension ProfileHooks) ProfileHook {
|
||||
events := make(map[event.Type]bool)
|
||||
for _, e := range extension.EventsToRegister() {
|
||||
events[e] = true
|
||||
}
|
||||
|
||||
experiments := make(map[string]bool)
|
||||
for _, experiment := range extension.ExperimentsToRegister() {
|
||||
experiments[experiment] = true
|
||||
}
|
||||
|
||||
return ProfileHook{
|
||||
extension,
|
||||
events,
|
||||
experiments,
|
||||
}
|
||||
}
|
|
@ -0,0 +1,86 @@
|
|||
package listen
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"errors"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
)
|
||||
|
||||
// CwtchPeerListenChannel is the peer implementation of im.cwtch.server.listen
|
||||
type CwtchPeerListenChannel struct {
|
||||
channel *channels.Channel
|
||||
Handler CwtchPeerSendChannelHandler
|
||||
}
|
||||
|
||||
// CwtchPeerSendChannelHandler is implemented by peers who want to listen to new messages
|
||||
type CwtchPeerSendChannelHandler interface {
|
||||
HandleGroupMessage(*protocol.GroupMessage)
|
||||
}
|
||||
|
||||
// Type returns the type string for this channel, e.g. "im.ricochet.server.listen".
|
||||
func (cplc *CwtchPeerListenChannel) Type() string {
|
||||
return "im.cwtch.server.listen"
|
||||
}
|
||||
|
||||
// Closed is called when the channel is closed for any reason.
|
||||
func (cplc *CwtchPeerListenChannel) Closed(err error) {
|
||||
|
||||
}
|
||||
|
||||
// OnlyClientCanOpen - for Cwtch server channels can only be opened by peers
|
||||
func (cplc *CwtchPeerListenChannel) OnlyClientCanOpen() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// Singleton - for Cwtch channels there can only be one instance per direction
|
||||
func (cplc *CwtchPeerListenChannel) Singleton() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// Bidirectional - for Cwtch channels are not bidrectional
|
||||
func (cplc *CwtchPeerListenChannel) Bidirectional() bool {
|
||||
return false
|
||||
}
|
||||
|
||||
// RequiresAuthentication - Cwtch channels require no auth channels
|
||||
func (cplc *CwtchPeerListenChannel) RequiresAuthentication() string {
|
||||
return "none"
|
||||
}
|
||||
|
||||
// OpenInbound - peers should never respond to open inbound requests from servers
|
||||
func (cplc *CwtchPeerListenChannel) OpenInbound(channel *channels.Channel, raw *Protocol_Data_Control.OpenChannel) ([]byte, error) {
|
||||
return nil, errors.New("client does not receive inbound listen channels")
|
||||
}
|
||||
|
||||
// OpenOutbound sets up a new server listen channel
|
||||
func (cplc *CwtchPeerListenChannel) OpenOutbound(channel *channels.Channel) ([]byte, error) {
|
||||
cplc.channel = channel
|
||||
messageBuilder := new(utils.MessageBuilder)
|
||||
return messageBuilder.OpenChannel(channel.ID, cplc.Type()), nil
|
||||
}
|
||||
|
||||
// OpenOutboundResult confirms a previous open channel request
|
||||
func (cplc *CwtchPeerListenChannel) OpenOutboundResult(err error, crm *Protocol_Data_Control.ChannelResult) {
|
||||
if err == nil {
|
||||
if crm.GetOpened() {
|
||||
cplc.channel.Pending = false
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Packet is called for each server packet received on this channel.
|
||||
func (cplc *CwtchPeerListenChannel) Packet(data []byte) {
|
||||
csp := &protocol.CwtchServerPacket{}
|
||||
err := proto.Unmarshal(data, csp)
|
||||
if err == nil {
|
||||
if csp.GetGroupMessage() != nil {
|
||||
gm := csp.GetGroupMessage()
|
||||
// We create a new go routine here to avoid leaking any information about processing time
|
||||
// TODO Server can probably try to use this to DoS a peer
|
||||
go cplc.Handler.HandleGroupMessage(gm)
|
||||
}
|
||||
}
|
||||
}
|
|
@ -0,0 +1,89 @@
|
|||
package listen
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"testing"
|
||||
"time"
|
||||
)
|
||||
|
||||
type TestHandler struct {
|
||||
Received bool
|
||||
}
|
||||
|
||||
func (th *TestHandler) HandleGroupMessage(m *protocol.GroupMessage) {
|
||||
th.Received = true
|
||||
}
|
||||
|
||||
func TestPeerListenChannelAttributes(t *testing.T) {
|
||||
cssc := new(CwtchPeerListenChannel)
|
||||
if cssc.Type() != "im.cwtch.server.listen" {
|
||||
t.Errorf("cwtch channel type is incorrect %v", cssc.Type())
|
||||
}
|
||||
|
||||
if !cssc.OnlyClientCanOpen() {
|
||||
t.Errorf("only clients should be able to open im.cwtch.server.listen channel")
|
||||
}
|
||||
|
||||
if cssc.Bidirectional() {
|
||||
t.Errorf("im.cwtch.server.listen should not be bidirectional")
|
||||
}
|
||||
|
||||
if !cssc.Singleton() {
|
||||
t.Errorf("im.cwtch.server.listen should be a Singleton")
|
||||
}
|
||||
|
||||
if cssc.RequiresAuthentication() != "none" {
|
||||
t.Errorf("cwtch channel required auth is incorrect %v", cssc.RequiresAuthentication())
|
||||
}
|
||||
|
||||
}
|
||||
func TestPeerListenChannelOpenInbound(t *testing.T) {
|
||||
cssc := new(CwtchPeerListenChannel)
|
||||
channel := new(channels.Channel)
|
||||
_, err := cssc.OpenInbound(channel, nil)
|
||||
if err == nil {
|
||||
t.Errorf("client implementation of im.cwtch.server.Listen should never open an inbound channel")
|
||||
}
|
||||
}
|
||||
|
||||
func TestPeerListenChannel(t *testing.T) {
|
||||
pfc := new(CwtchPeerListenChannel)
|
||||
th := new(TestHandler)
|
||||
pfc.Handler = th
|
||||
channel := new(channels.Channel)
|
||||
channel.ID = 3
|
||||
result, err := pfc.OpenOutbound(channel)
|
||||
if err != nil {
|
||||
t.Errorf("expected result but also got non-nil error: result:%v, err: %v", result, err)
|
||||
}
|
||||
|
||||
cr := &Protocol_Data_Control.ChannelResult{
|
||||
ChannelIdentifier: proto.Int32(3),
|
||||
Opened: proto.Bool(true),
|
||||
}
|
||||
|
||||
pfc.OpenOutboundResult(nil, cr)
|
||||
if channel.Pending {
|
||||
t.Errorf("once opened channel should no longer be pending")
|
||||
}
|
||||
|
||||
csp := &protocol.CwtchServerPacket{
|
||||
GroupMessage: &protocol.GroupMessage{Ciphertext: []byte("hello"), Signature: []byte{}, Spamguard: []byte{}},
|
||||
}
|
||||
packet, _ := proto.Marshal(csp)
|
||||
|
||||
pfc.Packet(packet)
|
||||
|
||||
// Wait for goroutine to run
|
||||
time.Sleep(time.Second * 1)
|
||||
|
||||
if !th.Received {
|
||||
t.Errorf("group message should have been received")
|
||||
}
|
||||
|
||||
pfc.Closed(nil)
|
||||
|
||||
}
|
|
@ -0,0 +1,106 @@
|
|||
package peer
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"log"
|
||||
)
|
||||
|
||||
// CwtchPeerChannel implements the ChannelHandler interface for a channel of
|
||||
// type "im.ricochet.Cwtch". The channel may be inbound or outbound.
|
||||
//
|
||||
// CwtchPeerChannel implements protocol-level sanity and state validation, but
|
||||
// does not handle or acknowledge Cwtch messages. The application must provide
|
||||
// a CwtchPeerChannelHandler implementation to handle Cwtch events.
|
||||
type CwtchPeerChannel struct {
|
||||
// Methods of Handler are called for Cwtch events on this channel
|
||||
Handler CwtchPeerChannelHandler
|
||||
channel *channels.Channel
|
||||
}
|
||||
|
||||
// CwtchPeerChannelHandler is implemented by an application type to receive
|
||||
// events from a CwtchPeerChannel.
|
||||
type CwtchPeerChannelHandler interface {
|
||||
HandleGroupInvite(*protocol.GroupChatInvite)
|
||||
}
|
||||
|
||||
// SendMessage sends a raw message on this channel
|
||||
func (cpc *CwtchPeerChannel) SendMessage(data []byte) {
|
||||
cpc.channel.SendMessage(data)
|
||||
}
|
||||
|
||||
// Type returns the type string for this channel, e.g. "im.ricochet.Cwtch".
|
||||
func (cpc *CwtchPeerChannel) Type() string {
|
||||
return "im.cwtch.peer"
|
||||
}
|
||||
|
||||
// Closed is called when the channel is closed for any reason.
|
||||
func (cpc *CwtchPeerChannel) Closed(err error) {
|
||||
|
||||
}
|
||||
|
||||
// OnlyClientCanOpen - for Cwtch channels any side can open
|
||||
func (cpc *CwtchPeerChannel) OnlyClientCanOpen() bool {
|
||||
return false
|
||||
}
|
||||
|
||||
// Singleton - for Cwtch channels there can only be one instance per direction
|
||||
func (cpc *CwtchPeerChannel) Singleton() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// Bidirectional - for Cwtch channels are not bidrectional
|
||||
func (cpc *CwtchPeerChannel) Bidirectional() bool {
|
||||
return false
|
||||
}
|
||||
|
||||
// RequiresAuthentication - Cwtch channels require hidden service auth
|
||||
func (cpc *CwtchPeerChannel) RequiresAuthentication() string {
|
||||
return "im.ricochet.auth.3dh"
|
||||
}
|
||||
|
||||
// OpenInbound is the first method called for an inbound channel request.
|
||||
// If an error is returned, the channel is rejected. If a RawMessage is
|
||||
// returned, it will be sent as the ChannelResult message.
|
||||
func (cpc *CwtchPeerChannel) OpenInbound(channel *channels.Channel, raw *Protocol_Data_Control.OpenChannel) ([]byte, error) {
|
||||
cpc.channel = channel
|
||||
messageBuilder := new(utils.MessageBuilder)
|
||||
return messageBuilder.AckOpenChannel(channel.ID), nil
|
||||
}
|
||||
|
||||
// OpenOutbound is the first method called for an outbound channel request.
|
||||
// If an error is returned, the channel is not opened. If a RawMessage is
|
||||
// returned, it will be sent as the OpenChannel message.
|
||||
func (cpc *CwtchPeerChannel) OpenOutbound(channel *channels.Channel) ([]byte, error) {
|
||||
cpc.channel = channel
|
||||
messageBuilder := new(utils.MessageBuilder)
|
||||
return messageBuilder.OpenChannel(channel.ID, cpc.Type()), nil
|
||||
}
|
||||
|
||||
// OpenOutboundResult is called when a response is received for an
|
||||
// outbound OpenChannel request. If `err` is non-nil, the channel was
|
||||
// rejected and Closed will be called immediately afterwards. `raw`
|
||||
// contains the raw protocol message including any extension data.
|
||||
func (cpc *CwtchPeerChannel) OpenOutboundResult(err error, crm *Protocol_Data_Control.ChannelResult) {
|
||||
if err == nil {
|
||||
if crm.GetOpened() {
|
||||
cpc.channel.Pending = false
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Packet is called for each raw packet received on this channel.
|
||||
func (cpc *CwtchPeerChannel) Packet(data []byte) {
|
||||
cpp := &protocol.CwtchPeerPacket{}
|
||||
err := proto.Unmarshal(data, cpp)
|
||||
if err == nil {
|
||||
if cpp.GetGroupChatInvite() != nil {
|
||||
cpc.Handler.HandleGroupInvite(cpp.GetGroupChatInvite())
|
||||
}
|
||||
} else {
|
||||
log.Printf("Error Receivng Packet %v\n", err)
|
||||
}
|
||||
}
|
|
@ -0,0 +1,102 @@
|
|||
package peer
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"testing"
|
||||
)
|
||||
|
||||
func TestPeerChannelAttributes(t *testing.T) {
|
||||
cssc := new(CwtchPeerChannel)
|
||||
if cssc.Type() != "im.cwtch.peer" {
|
||||
t.Errorf("cwtch channel type is incorrect %v", cssc.Type())
|
||||
}
|
||||
|
||||
if cssc.OnlyClientCanOpen() {
|
||||
t.Errorf("either side should be able to open im.cwtch.peer channel")
|
||||
}
|
||||
|
||||
if cssc.Bidirectional() {
|
||||
t.Errorf("im.cwtch.peer should not be bidirectional")
|
||||
}
|
||||
|
||||
if !cssc.Singleton() {
|
||||
t.Errorf("im.cwtch.server.listen should be a Singleton")
|
||||
}
|
||||
|
||||
if cssc.RequiresAuthentication() != "im.ricochet.auth.3dh" {
|
||||
t.Errorf("cwtch channel required auth is incorrect %v", cssc.RequiresAuthentication())
|
||||
}
|
||||
}
|
||||
|
||||
type TestHandler struct {
|
||||
Received bool
|
||||
ReceviedGroupInvite bool
|
||||
}
|
||||
|
||||
func (th *TestHandler) ClientIdentity(ci *protocol.CwtchIdentity) {
|
||||
if ci.GetName() == "hello" {
|
||||
th.Received = true
|
||||
}
|
||||
}
|
||||
|
||||
func (th *TestHandler) HandleGroupInvite(ci *protocol.GroupChatInvite) {
|
||||
///if ci.GetName() == "hello" {
|
||||
th.ReceviedGroupInvite = true
|
||||
//}
|
||||
}
|
||||
|
||||
func (th *TestHandler) GetClientIdentityPacket() []byte {
|
||||
return nil
|
||||
}
|
||||
|
||||
func TestPeerChannel(t *testing.T) {
|
||||
th := new(TestHandler)
|
||||
cpc := new(CwtchPeerChannel)
|
||||
cpc.Handler = th
|
||||
channel := new(channels.Channel)
|
||||
channel.ID = 3
|
||||
result, err := cpc.OpenOutbound(channel)
|
||||
if err != nil {
|
||||
t.Errorf("should have send open channel request instead %v, %v", result, err)
|
||||
}
|
||||
|
||||
cpc2 := new(CwtchPeerChannel)
|
||||
channel2 := new(channels.Channel)
|
||||
channel2.ID = 3
|
||||
sent := false
|
||||
channel2.SendMessage = func(message []byte) {
|
||||
sent = true
|
||||
}
|
||||
|
||||
control := new(Protocol_Data_Control.Packet)
|
||||
proto.Unmarshal(result[:], control)
|
||||
ack, err := cpc2.OpenInbound(channel2, control.GetOpenChannel())
|
||||
if err != nil {
|
||||
t.Errorf("should have ack open channel request instead %v, %v", ack, err)
|
||||
}
|
||||
|
||||
ackpacket := new(Protocol_Data_Control.Packet)
|
||||
proto.Unmarshal(ack[:], ackpacket)
|
||||
cpc.OpenOutboundResult(nil, ackpacket.GetChannelResult())
|
||||
if channel.Pending != false {
|
||||
t.Errorf("Channel should no longer be pending")
|
||||
}
|
||||
|
||||
gci := &protocol.GroupChatInvite{
|
||||
GroupName: "hello",
|
||||
GroupSharedKey: []byte{},
|
||||
ServerHost: "abc.onion",
|
||||
}
|
||||
|
||||
cpp := &protocol.CwtchPeerPacket{
|
||||
GroupChatInvite: gci,
|
||||
}
|
||||
packet, _ := proto.Marshal(cpp)
|
||||
cpc.Packet(packet)
|
||||
if sent && th.ReceviedGroupInvite == false {
|
||||
t.Errorf("Should have sent invite packet to handler")
|
||||
}
|
||||
}
|
|
@ -0,0 +1,98 @@
|
|||
package peer
|
||||
|
||||
import (
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
)
|
||||
|
||||
// CwtchPeerDataChannel implements the ChannelHandler interface for a channel of
|
||||
// type "im.cwtch.peer.data The channel may be inbound or outbound.
|
||||
//
|
||||
// CwtchPeerChannel implements protocol-level sanity and state validation, but
|
||||
// does not handle or acknowledge Cwtch messages. The application must provide
|
||||
// a CwtchPeerChannelHandler implementation to handle Cwtch events.
|
||||
type CwtchPeerDataChannel struct {
|
||||
// Methods of Handler are called for Cwtch events on this channel
|
||||
Handler CwtchPeerDataHandler
|
||||
channel *channels.Channel
|
||||
}
|
||||
|
||||
// CwtchPeerDataHandler is implemented by an application type to receive
|
||||
// events from a CwtchPeerChannel.
|
||||
type CwtchPeerDataHandler interface {
|
||||
HandlePacket([]byte) []byte
|
||||
}
|
||||
|
||||
// SendMessage sends a raw message on this channel
|
||||
func (cpc *CwtchPeerDataChannel) SendMessage(data []byte) {
|
||||
cpc.channel.SendMessage(data)
|
||||
}
|
||||
|
||||
// Type returns the type string for this channel, e.g. "im.ricochet.Cwtch".
|
||||
func (cpc *CwtchPeerDataChannel) Type() string {
|
||||
return "im.cwtch.peer.data"
|
||||
}
|
||||
|
||||
// Closed is called when the channel is closed for any reason.
|
||||
func (cpc *CwtchPeerDataChannel) Closed(err error) {
|
||||
|
||||
}
|
||||
|
||||
// OnlyClientCanOpen - for Cwtch channels any side can open
|
||||
func (cpc *CwtchPeerDataChannel) OnlyClientCanOpen() bool {
|
||||
return false
|
||||
}
|
||||
|
||||
// Singleton - for Cwtch channels there can only be one instance per direction
|
||||
func (cpc *CwtchPeerDataChannel) Singleton() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// Bidirectional - for Cwtch channels are bidirectional
|
||||
func (cpc *CwtchPeerDataChannel) Bidirectional() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// RequiresAuthentication - Cwtch channels require hidden service auth
|
||||
func (cpc *CwtchPeerDataChannel) RequiresAuthentication() string {
|
||||
return "im.ricochet.auth.3dh"
|
||||
}
|
||||
|
||||
// OpenInbound is the first method called for an inbound channel request.
|
||||
// If an error is returned, the channel is rejected. If a RawMessage is
|
||||
// returned, it will be sent as the ChannelResult message.
|
||||
func (cpc *CwtchPeerDataChannel) OpenInbound(channel *channels.Channel, raw *Protocol_Data_Control.OpenChannel) ([]byte, error) {
|
||||
cpc.channel = channel
|
||||
messageBuilder := new(utils.MessageBuilder)
|
||||
return messageBuilder.AckOpenChannel(channel.ID), nil
|
||||
}
|
||||
|
||||
// OpenOutbound is the first method called for an outbound channel request.
|
||||
// If an error is returned, the channel is not opened. If a RawMessage is
|
||||
// returned, it will be sent as the OpenChannel message.
|
||||
func (cpc *CwtchPeerDataChannel) OpenOutbound(channel *channels.Channel) ([]byte, error) {
|
||||
cpc.channel = channel
|
||||
messageBuilder := new(utils.MessageBuilder)
|
||||
return messageBuilder.OpenChannel(channel.ID, cpc.Type()), nil
|
||||
}
|
||||
|
||||
// OpenOutboundResult is called when a response is received for an
|
||||
// outbound OpenChannel request. If `err` is non-nil, the channel was
|
||||
// rejected and Closed will be called immediately afterwards. `raw`
|
||||
// contains the raw protocol message including any extension data.
|
||||
func (cpc *CwtchPeerDataChannel) OpenOutboundResult(err error, crm *Protocol_Data_Control.ChannelResult) {
|
||||
if err == nil {
|
||||
if crm.GetOpened() {
|
||||
cpc.channel.Pending = false
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Packet is called for each raw packet received on this channel.
|
||||
func (cpc *CwtchPeerDataChannel) Packet(data []byte) {
|
||||
ret := cpc.Handler.HandlePacket(data)
|
||||
if len(ret) > 0 {
|
||||
cpc.channel.SendMessage(ret)
|
||||
}
|
||||
}
|
|
@ -1,181 +0,0 @@
|
|||
package peer
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/model/attr"
|
||||
"cwtch.im/cwtch/protocol/connections"
|
||||
"cwtch.im/cwtch/settings"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives/privacypass"
|
||||
"git.openprivacy.ca/openprivacy/connectivity"
|
||||
)
|
||||
|
||||
// AccessPeeringState provides access to functions relating to the underlying connections of a peer.
|
||||
type AccessPeeringState interface {
|
||||
GetPeerState(string) connections.ConnectionState
|
||||
}
|
||||
|
||||
// ModifyPeeringState is a meta-interface intended to restrict callers to modify-only access to connection peers
|
||||
type ModifyPeeringState interface {
|
||||
BlockUnknownConnections()
|
||||
AllowUnknownConnections()
|
||||
PeerWithOnion(string)
|
||||
QueueJoinServer(string)
|
||||
DisconnectFromPeer(string)
|
||||
DisconnectFromServer(string)
|
||||
}
|
||||
|
||||
// ModifyContactsAndPeers is a meta-interface intended to restrict a call to reading and modifying contacts
|
||||
// and peers.
|
||||
type ModifyContactsAndPeers interface {
|
||||
ModifyPeeringState
|
||||
}
|
||||
|
||||
// ReadServers provides access to the servers
|
||||
type ReadServers interface {
|
||||
GetServers() []string
|
||||
}
|
||||
|
||||
// ModifyGroups provides write-only access add/edit/remove new groups
|
||||
type ModifyGroups interface {
|
||||
ImportGroup(string) (int, error)
|
||||
StartGroup(string, string) (int, error)
|
||||
}
|
||||
|
||||
// ModifyServers provides write-only access to servers
|
||||
type ModifyServers interface {
|
||||
AddServer(string) (string, error)
|
||||
ResyncServer(onion string) error
|
||||
}
|
||||
|
||||
// SendMessages enables a caller to sender messages to a contact
|
||||
type SendMessages interface {
|
||||
SendMessage(conversation int, message string) (int, error)
|
||||
|
||||
// EnhancedSendMessage Attempts to Send a Message and Immediately Attempts to Lookup the Message in the Database
|
||||
EnhancedSendMessage(conversation int, message string) string
|
||||
|
||||
SendInviteToConversation(conversationID int, inviteConversationID int) (int, error)
|
||||
|
||||
// EnhancedSendInviteMessage Attempts to Send an Invite and Immediately Attempts to Lookup the Message in the Database
|
||||
EnhancedSendInviteMessage(conversation int, inviteConversationID int) string
|
||||
|
||||
SendScopedZonedGetValToContact(conversationID int, scope attr.Scope, zone attr.Zone, key string)
|
||||
}
|
||||
|
||||
// CwtchPeer provides us with a way of testing systems built on top of cwtch without having to
|
||||
// directly implement a cwtchPeer.
|
||||
type CwtchPeer interface {
|
||||
|
||||
// Core Cwtch Peer Functions that should not be exposed to
|
||||
// most functions
|
||||
Init(event.Manager)
|
||||
|
||||
GenerateProtocolEngine(acn connectivity.ACN, bus event.Manager, engineHooks connections.EngineHooks) (connections.Engine, error)
|
||||
|
||||
AutoHandleEvents(events []event.Type)
|
||||
Listen()
|
||||
StartConnections(doPeers, doServers bool)
|
||||
// Deprecated in 1.10
|
||||
StartPeersConnections()
|
||||
// Deprecated in 1.10
|
||||
StartServerConnections()
|
||||
|
||||
Shutdown()
|
||||
|
||||
// GetOnion is deprecated. If you find yourself needing to rely on this method it is time
|
||||
// to consider replacing this with a GetAddress(es) function that can fully expand cwtch beyond the boundaries
|
||||
// of tor v3 onion services.
|
||||
// Deprecated
|
||||
GetOnion() string
|
||||
|
||||
// SetScopedZonedAttribute allows the setting of an attribute by scope and zone
|
||||
// scope.zone.key = value
|
||||
SetScopedZonedAttribute(scope attr.Scope, zone attr.Zone, key string, value string)
|
||||
|
||||
// GetScopedZonedAttribute allows the retrieval of an attribute by scope and zone
|
||||
// scope.zone.key = value
|
||||
GetScopedZonedAttribute(scope attr.Scope, zone attr.Zone, key string) (string, bool)
|
||||
|
||||
// GetScopedZonedAttributeKeys returns all keys associated with a given scope and zone
|
||||
GetScopedZonedAttributeKeys(scope attr.Scope, zone attr.Zone) ([]string, error)
|
||||
|
||||
AccessPeeringState
|
||||
ModifyPeeringState
|
||||
|
||||
ModifyGroups
|
||||
|
||||
ReadServers
|
||||
ModifyServers
|
||||
|
||||
SendMessages
|
||||
|
||||
// Import Bundle
|
||||
ImportBundle(string) error
|
||||
EnhancedImportBundle(string) string
|
||||
|
||||
// New Unified Conversation Interfaces
|
||||
NewContactConversation(handle string, acl model.AccessControl, accepted bool) (int, error)
|
||||
FetchConversations() ([]*model.Conversation, error)
|
||||
ArchiveConversation(conversation int)
|
||||
GetConversationInfo(conversation int) (*model.Conversation, error)
|
||||
FetchConversationInfo(handle string) (*model.Conversation, error)
|
||||
|
||||
// API-level management of conversation access control
|
||||
UpdateConversationAccessControlList(id int, acl model.AccessControlList) error
|
||||
EnhancedUpdateConversationAccessControlList(conversation int, acjson string) error
|
||||
|
||||
GetConversationAccessControlList(conversation int) (model.AccessControlList, error)
|
||||
EnhancedGetConversationAccessControlList(conversation int) (string, error)
|
||||
|
||||
// Convieniance Functions for ACL Management
|
||||
AcceptConversation(conversation int) error
|
||||
BlockConversation(conversation int) error
|
||||
UnblockConversation(conversation int) error
|
||||
|
||||
SetConversationAttribute(conversation int, path attr.ScopedZonedPath, value string) error
|
||||
GetConversationAttribute(conversation int, path attr.ScopedZonedPath) (string, error)
|
||||
DeleteConversation(conversation int) error
|
||||
|
||||
// New Unified Conversation Channel Interfaces
|
||||
GetChannelMessage(conversation int, channel int, id int) (string, model.Attributes, error)
|
||||
GetChannelMessageCount(conversation int, channel int) (int, error)
|
||||
GetChannelMessageByContentHash(conversation int, channel int, contenthash string) (int, error)
|
||||
GetMostRecentMessages(conversation int, channel int, offset int, limit uint) ([]model.ConversationMessage, error)
|
||||
UpdateMessageAttribute(conversation int, channel int, id int, key string, value string) error
|
||||
SearchConversations(pattern string) string
|
||||
|
||||
// EnhancedGetMessageById returns a json-encoded enhanced message, suitable for rendering in a UI
|
||||
EnhancedGetMessageById(conversation int, mid int) string
|
||||
|
||||
// EnhancedGetMessageByContentHash returns a json-encoded enhanced message, suitable for rendering in a UI
|
||||
EnhancedGetMessageByContentHash(conversation int, hash string) string
|
||||
|
||||
// EnhancedGetMessages returns a set of json-encoded enhanced messages, suitable for rendering in a UI
|
||||
EnhancedGetMessages(conversation int, index int, count uint) string
|
||||
|
||||
// Server Token APIS
|
||||
// TODO move these to feature protected interfaces
|
||||
StoreCachedTokens(tokenServer string, tokens []*privacypass.Token)
|
||||
|
||||
// Profile Management
|
||||
CheckPassword(password string) bool
|
||||
ChangePassword(oldpassword string, newpassword string, newpasswordAgain string) error
|
||||
ExportProfile(file string) error
|
||||
Delete()
|
||||
PublishEvent(resp event.Event)
|
||||
RegisterHook(hook ProfileHooks)
|
||||
UpdateExperiments(enabled bool, experiments map[string]bool)
|
||||
NotifySettingsUpdate(settings settings.GlobalSettings)
|
||||
IsFeatureEnabled(featureName string) bool
|
||||
}
|
||||
|
||||
// EnhancedMessage wraps a Cwtch model.Message with some additional data to reduce calls from the UI.
|
||||
type EnhancedMessage struct {
|
||||
model.Message
|
||||
ID int // the actual ID of the message in the database (not the row number)
|
||||
LocalIndex int // local index in the DB (row #). Can be empty (most calls supply it) but lookup by hash will fill it
|
||||
ContentHash string
|
||||
ContactImage string
|
||||
Attributes map[string]string
|
||||
}
|
|
@ -1,13 +0,0 @@
|
|||
package peer
|
||||
|
||||
import "errors"
|
||||
|
||||
// Response is a wrapper to better semantically convey the response type...
|
||||
type Response error
|
||||
|
||||
const errorSeparator = "."
|
||||
|
||||
// ConstructResponse is a helper function for creating Response structures.
|
||||
func ConstructResponse(prefix string, error string) Response {
|
||||
return errors.New(prefix + errorSeparator + error)
|
||||
}
|
|
@ -0,0 +1,95 @@
|
|||
package send
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"cwtch.im/cwtch/protocol/spam"
|
||||
"errors"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
)
|
||||
|
||||
// CwtchPeerSendChannel is the peer implementation of im.cwtch.server.send
|
||||
type CwtchPeerSendChannel struct {
|
||||
channel *channels.Channel
|
||||
spamGuard spam.Guard
|
||||
challenge []byte
|
||||
}
|
||||
|
||||
// Type returns the type string for this channel, e.g. "im.ricochet.server.send".
|
||||
func (cpsc *CwtchPeerSendChannel) Type() string {
|
||||
return "im.cwtch.server.send"
|
||||
}
|
||||
|
||||
// Closed is called when the channel is closed for any reason.
|
||||
func (cpsc *CwtchPeerSendChannel) Closed(err error) {
|
||||
|
||||
}
|
||||
|
||||
// OnlyClientCanOpen - for Cwtch server channels only peers may open.
|
||||
func (cpsc *CwtchPeerSendChannel) OnlyClientCanOpen() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// Singleton - for Cwtch channels there can only be one instance per direction
|
||||
func (cpsc *CwtchPeerSendChannel) Singleton() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// Bidirectional - for Cwtch channels are not bidrectional
|
||||
func (cpsc *CwtchPeerSendChannel) Bidirectional() bool {
|
||||
return false
|
||||
}
|
||||
|
||||
// RequiresAuthentication - Cwtch channels require no auth
|
||||
func (cpsc *CwtchPeerSendChannel) RequiresAuthentication() string {
|
||||
return "none"
|
||||
}
|
||||
|
||||
// OpenInbound should never be called on peers.
|
||||
func (cpsc *CwtchPeerSendChannel) OpenInbound(channel *channels.Channel, raw *Protocol_Data_Control.OpenChannel) ([]byte, error) {
|
||||
return nil, errors.New("client does not receive inbound listen channels")
|
||||
}
|
||||
|
||||
// OpenOutbound is used to set up a new send channel and initialize spamguard
|
||||
func (cpsc *CwtchPeerSendChannel) OpenOutbound(channel *channels.Channel) ([]byte, error) {
|
||||
cpsc.spamGuard.Difficulty = 2
|
||||
cpsc.channel = channel
|
||||
messageBuilder := new(utils.MessageBuilder)
|
||||
return messageBuilder.OpenChannel(channel.ID, cpsc.Type()), nil
|
||||
}
|
||||
|
||||
// OpenOutboundResult confirms the open channel request and sets the spamguard challenge
|
||||
func (cpsc *CwtchPeerSendChannel) OpenOutboundResult(err error, crm *Protocol_Data_Control.ChannelResult) {
|
||||
if err == nil {
|
||||
if crm.GetOpened() {
|
||||
ce, _ := proto.GetExtension(crm, protocol.E_ServerNonce)
|
||||
cpsc.challenge = ce.([]byte)[:]
|
||||
cpsc.channel.Pending = false
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// SendGroupMessage performs the spamguard proof of work and sends a message.
|
||||
func (cpsc *CwtchPeerSendChannel) SendGroupMessage(gm *protocol.GroupMessage) error {
|
||||
if cpsc.channel.Pending == false {
|
||||
sgsolve := cpsc.spamGuard.SolveChallenge(cpsc.challenge, gm.GetCiphertext())
|
||||
gm.Spamguard = sgsolve[:]
|
||||
csp := &protocol.CwtchServerPacket{
|
||||
GroupMessage: gm,
|
||||
}
|
||||
packet, _ := proto.Marshal(csp)
|
||||
cpsc.channel.SendMessage(packet)
|
||||
cpsc.channel.CloseChannel()
|
||||
} else {
|
||||
return errors.New("channel isn't set up yet")
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// Packet should never be
|
||||
func (cpsc *CwtchPeerSendChannel) Packet(data []byte) {
|
||||
// If we receive a packet on this channel, close the connection
|
||||
cpsc.channel.CloseChannel()
|
||||
}
|
|
@ -0,0 +1,108 @@
|
|||
package send
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"cwtch.im/cwtch/protocol/spam"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"testing"
|
||||
)
|
||||
|
||||
func TestPeerSendChannelAttributes(t *testing.T) {
|
||||
cssc := new(CwtchPeerSendChannel)
|
||||
if cssc.Type() != "im.cwtch.server.send" {
|
||||
t.Errorf("cwtch channel type is incorrect %v", cssc.Type())
|
||||
}
|
||||
|
||||
if !cssc.OnlyClientCanOpen() {
|
||||
t.Errorf("only clients should be able to open im.cwtch.server.send channel")
|
||||
}
|
||||
|
||||
if cssc.Bidirectional() {
|
||||
t.Errorf("im.cwtch.server.listen should not be bidirectional")
|
||||
}
|
||||
|
||||
if !cssc.Singleton() {
|
||||
t.Errorf("im.cwtch.server.listen should be a Singleton")
|
||||
}
|
||||
|
||||
if cssc.RequiresAuthentication() != "none" {
|
||||
t.Errorf("cwtch channel required auth is incorrect %v", cssc.RequiresAuthentication())
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
func TestPeerSendChannelOpenInbound(t *testing.T) {
|
||||
cssc := new(CwtchPeerSendChannel)
|
||||
channel := new(channels.Channel)
|
||||
_, err := cssc.OpenInbound(channel, nil)
|
||||
if err == nil {
|
||||
t.Errorf("client implementation of im.cwtch.server.Listen should never open an inbound channel")
|
||||
}
|
||||
}
|
||||
|
||||
func TestPeerSendChannelClosesOnPacket(t *testing.T) {
|
||||
pfc := new(CwtchPeerSendChannel)
|
||||
channel := new(channels.Channel)
|
||||
closed := false
|
||||
channel.CloseChannel = func() {
|
||||
closed = true
|
||||
}
|
||||
|
||||
pfc.OpenOutbound(channel)
|
||||
pfc.Packet([]byte{})
|
||||
if !closed {
|
||||
t.Errorf("send channel should close if server attempts to send packets")
|
||||
}
|
||||
}
|
||||
|
||||
func TestPeerSendChannel(t *testing.T) {
|
||||
pfc := new(CwtchPeerSendChannel)
|
||||
|
||||
channel := new(channels.Channel)
|
||||
channel.ID = 3
|
||||
success := false
|
||||
|
||||
var sg spam.Guard
|
||||
sg.Difficulty = 2
|
||||
|
||||
closed := false
|
||||
channel.CloseChannel = func() {
|
||||
closed = true
|
||||
}
|
||||
|
||||
channel.SendMessage = func(message []byte) {
|
||||
packet := new(protocol.CwtchServerPacket)
|
||||
proto.Unmarshal(message[:], packet)
|
||||
if packet.GetGroupMessage() != nil {
|
||||
success = sg.ValidateChallenge(packet.GetGroupMessage().GetCiphertext(), packet.GetGroupMessage().GetSpamguard())
|
||||
}
|
||||
}
|
||||
result, err := pfc.OpenOutbound(channel)
|
||||
if err != nil {
|
||||
t.Errorf("expected result but also got non-nil error: result:%v, err: %v", result, err)
|
||||
}
|
||||
|
||||
challenge := sg.GenerateChallenge(3)
|
||||
control := new(Protocol_Data_Control.Packet)
|
||||
proto.Unmarshal(challenge[:], control)
|
||||
|
||||
pfc.OpenOutboundResult(nil, control.GetChannelResult())
|
||||
if channel.Pending {
|
||||
t.Errorf("once opened channel should no longer be pending")
|
||||
}
|
||||
|
||||
gm := &protocol.GroupMessage{Ciphertext: []byte("hello")}
|
||||
pfc.SendGroupMessage(gm)
|
||||
if !success {
|
||||
t.Errorf("send channel should have successfully sent a valid group message")
|
||||
}
|
||||
|
||||
if !closed {
|
||||
t.Errorf("send channel should have successfully closed after a valid group message")
|
||||
}
|
||||
|
||||
pfc.Closed(nil)
|
||||
|
||||
}
|
|
@ -1,29 +0,0 @@
|
|||
package peer
|
||||
|
||||
import (
|
||||
"database/sql"
|
||||
"fmt"
|
||||
)
|
||||
|
||||
// SQLCreateTableProfileKeyValue creates the Profile Key Value Table
|
||||
const SQLCreateTableProfileKeyValue = `create table if not exists profile_kv (KeyType text, KeyName text, KeyValue blob, UNIQUE (KeyType,KeyName));`
|
||||
|
||||
// SQLCreateTableConversations creates the Profile Key Value Table
|
||||
const SQLCreateTableConversations = `create table if not exists conversations (ID integer unique primary key autoincrement, Handle text, Attributes blob, ACL blob, Accepted bool);`
|
||||
|
||||
// initializeDatabase executes all the sql statements necessary to construct the base of the database.
|
||||
// db must be open
|
||||
func initializeDatabase(db *sql.DB) error {
|
||||
|
||||
_, err := db.Exec(SQLCreateTableProfileKeyValue)
|
||||
if err != nil {
|
||||
return fmt.Errorf("error On Executing Query: %v %v", SQLCreateTableProfileKeyValue, err)
|
||||
}
|
||||
|
||||
_, err = db.Exec(SQLCreateTableConversations)
|
||||
if err != nil {
|
||||
return fmt.Errorf("error On Executing Query: %v %v", SQLCreateTableConversations, err)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
329
peer/storage.go
329
peer/storage.go
|
@ -1,329 +0,0 @@
|
|||
package peer
|
||||
|
||||
import (
|
||||
"archive/tar"
|
||||
"compress/gzip"
|
||||
"crypto/rand"
|
||||
"database/sql"
|
||||
"encoding/hex"
|
||||
"errors"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"golang.org/x/crypto/pbkdf2"
|
||||
"golang.org/x/crypto/sha3"
|
||||
"io"
|
||||
"os"
|
||||
"path"
|
||||
"path/filepath"
|
||||
"strings"
|
||||
)
|
||||
|
||||
const versionFile = "VERSION"
|
||||
const version = "2"
|
||||
const saltFile = "SALT"
|
||||
const dbFile = "db"
|
||||
|
||||
// CreateKeySalt derives a key and salt from a password: returns key, salt, err
|
||||
func CreateKeySalt(password string) ([32]byte, [128]byte, error) {
|
||||
var salt [128]byte
|
||||
if _, err := io.ReadFull(rand.Reader, salt[:]); err != nil {
|
||||
log.Errorf("Cannot read from random: %v\n", err)
|
||||
return [32]byte{}, salt, err
|
||||
}
|
||||
dk := pbkdf2.Key([]byte(password), salt[:], 4096, 32, sha3.New512)
|
||||
|
||||
var dkr [32]byte
|
||||
copy(dkr[:], dk)
|
||||
return dkr, salt, nil
|
||||
}
|
||||
|
||||
// createKey derives a key from a password and salt
|
||||
func createKey(password string, salt []byte) [32]byte {
|
||||
dk := pbkdf2.Key([]byte(password), salt, 4096, 32, sha3.New512)
|
||||
|
||||
var dkr [32]byte
|
||||
copy(dkr[:], dk)
|
||||
return dkr
|
||||
}
|
||||
|
||||
func initV2Directory(directory, password string) ([32]byte, [128]byte, error) {
|
||||
os.MkdirAll(directory, 0700)
|
||||
|
||||
key, salt, err := CreateKeySalt(password)
|
||||
if err != nil {
|
||||
log.Errorf("Could not create key for profile store from password: %v\n", err)
|
||||
return [32]byte{}, [128]byte{}, err
|
||||
}
|
||||
|
||||
if err = os.WriteFile(path.Join(directory, versionFile), []byte(version), 0600); err != nil {
|
||||
log.Errorf("Could not write version file: %v", err)
|
||||
return [32]byte{}, [128]byte{}, err
|
||||
}
|
||||
|
||||
if err = os.WriteFile(path.Join(directory, saltFile), salt[:], 0600); err != nil {
|
||||
log.Errorf("Could not write salt file: %v", err)
|
||||
return [32]byte{}, [128]byte{}, err
|
||||
}
|
||||
|
||||
return key, salt, nil
|
||||
}
|
||||
|
||||
func openEncryptedDatabase(profileDirectory string, password string, createIfNotExists bool) (*sql.DB, error) {
|
||||
salt, err := os.ReadFile(path.Join(profileDirectory, saltFile))
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
key := createKey(password, salt)
|
||||
dbPath := filepath.Join(profileDirectory, "db")
|
||||
|
||||
if !createIfNotExists {
|
||||
if _, err := os.Stat(dbPath); errors.Is(err, os.ErrNotExist) {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
|
||||
dbname := fmt.Sprintf("%v?_pragma_key=x'%x'&_pragma_cipher_page_size=8192", dbPath, key)
|
||||
db, err := sql.Open("sqlite3", dbname)
|
||||
if err != nil {
|
||||
log.Errorf("could not open encrypted database", err)
|
||||
return nil, err
|
||||
}
|
||||
return db, nil
|
||||
}
|
||||
|
||||
// CreateEncryptedStorePeer creates a *new* Cwtch Profile backed by an encrypted datastore
|
||||
func CreateEncryptedStorePeer(profileDirectory string, name string, password string) (CwtchPeer, error) {
|
||||
log.Debugf("Initializing Encrypted Storage Directory")
|
||||
_, _, err := initV2Directory(profileDirectory, password)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
log.Debugf("Opening Encrypted Database")
|
||||
db, err := openEncryptedDatabase(profileDirectory, password, true)
|
||||
if db == nil || err != nil {
|
||||
return nil, fmt.Errorf("unable to open encrypted database: error: %v", err)
|
||||
}
|
||||
|
||||
log.Debugf("Initializing Database")
|
||||
err = initializeDatabase(db)
|
||||
|
||||
if err != nil {
|
||||
db.Close()
|
||||
return nil, err
|
||||
}
|
||||
|
||||
log.Debugf("Creating Cwtch Profile Backed By Encrypted Database")
|
||||
|
||||
cps, err := NewCwtchProfileStorage(db, profileDirectory)
|
||||
if err != nil {
|
||||
db.Close()
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return NewProfileWithEncryptedStorage(name, cps), nil
|
||||
}
|
||||
|
||||
// CreateEncryptedStore creates a encrypted datastore
|
||||
func CreateEncryptedStore(profileDirectory string, password string) (*CwtchProfileStorage, error) {
|
||||
|
||||
log.Debugf("Creating Encrypted Database")
|
||||
db, err := openEncryptedDatabase(profileDirectory, password, true)
|
||||
if db == nil || err != nil {
|
||||
return nil, fmt.Errorf("unable to open encrypted database: error: %v", err)
|
||||
}
|
||||
|
||||
log.Debugf("Initializing Database")
|
||||
err = initializeDatabase(db)
|
||||
|
||||
if err != nil {
|
||||
db.Close()
|
||||
return nil, err
|
||||
}
|
||||
|
||||
log.Debugf("Creating Cwtch Profile Backed By Encrypted Database")
|
||||
|
||||
cps, err := NewCwtchProfileStorage(db, profileDirectory)
|
||||
if err != nil {
|
||||
db.Close()
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return cps, nil
|
||||
}
|
||||
|
||||
// FromEncryptedDatabase constructs a Cwtch Profile from an existing Encrypted Database
|
||||
func FromEncryptedDatabase(profileDirectory string, password string) (CwtchPeer, error) {
|
||||
log.Debugf("Loading Encrypted Profile: %v", profileDirectory)
|
||||
db, err := openEncryptedDatabase(profileDirectory, password, false)
|
||||
if db == nil || err != nil {
|
||||
return nil, fmt.Errorf("unable to open encrypted database: error: %v", err)
|
||||
}
|
||||
|
||||
log.Debugf("Initializing Profile from Encrypted Storage")
|
||||
cps, err := NewCwtchProfileStorage(db, profileDirectory)
|
||||
if err != nil {
|
||||
db.Close()
|
||||
return nil, err
|
||||
}
|
||||
return FromEncryptedStorage(cps), nil
|
||||
}
|
||||
|
||||
func ImportProfile(exportedCwtchFile string, profilesDir string, password string) (CwtchPeer, error) {
|
||||
profileID, err := checkCwtchProfileBackupFile(exportedCwtchFile)
|
||||
if profileID == "" || err != nil {
|
||||
log.Errorf("%s is an invalid cwtch backup file: %s", profileID, err)
|
||||
return nil, err
|
||||
}
|
||||
log.Debugf("%s is a valid cwtch backup file", profileID)
|
||||
|
||||
profileDBFile := filepath.Join(profilesDir, profileID, dbFile)
|
||||
log.Debugf("checking %v", profileDBFile)
|
||||
if _, err := os.Stat(profileDBFile); errors.Is(err, os.ErrNotExist) {
|
||||
// backup is valid and the profile hasn't been imported yet, time to extract and check the password
|
||||
profileDir := filepath.Join(profilesDir, profileID)
|
||||
os.MkdirAll(profileDir, 0700)
|
||||
err := importCwtchProfileBackupFile(exportedCwtchFile, profilesDir)
|
||||
if err == nil {
|
||||
profile, err := FromEncryptedDatabase(profileDir, password)
|
||||
if err == nil {
|
||||
return profile, err
|
||||
}
|
||||
// Otherwise purge
|
||||
log.Errorf("error importing profile: %v. removing %s", err, profileDir)
|
||||
os.RemoveAll(profileDir)
|
||||
return nil, err
|
||||
}
|
||||
return nil, err
|
||||
}
|
||||
return nil, fmt.Errorf("%s is already a profile for this app", profileID)
|
||||
}
|
||||
|
||||
func checkCwtchProfileBackupFile(srcFile string) (string, error) {
|
||||
f, err := os.Open(srcFile)
|
||||
if err != nil {
|
||||
return "", err
|
||||
}
|
||||
defer f.Close()
|
||||
|
||||
gzf, err := gzip.NewReader(f)
|
||||
if err != nil {
|
||||
return "", err
|
||||
}
|
||||
|
||||
tarReader := tar.NewReader(gzf)
|
||||
|
||||
profileName := ""
|
||||
|
||||
for {
|
||||
header, err := tarReader.Next()
|
||||
|
||||
if err == io.EOF {
|
||||
break
|
||||
}
|
||||
|
||||
if err != nil {
|
||||
return "", err
|
||||
}
|
||||
|
||||
switch header.Typeflag {
|
||||
case tar.TypeDir:
|
||||
return "", errors.New("invalid cwtch backup file")
|
||||
case tar.TypeReg:
|
||||
parts := strings.Split(header.Name, "/")
|
||||
if len(parts) != 2 {
|
||||
return "", errors.New("invalid header name")
|
||||
}
|
||||
dir := parts[0]
|
||||
profileFileType := parts[1]
|
||||
|
||||
_, hexErr := hex.DecodeString(dir)
|
||||
if dir == "." || dir == ".." || len(dir) != 32 || hexErr != nil {
|
||||
return "", errors.New("invalid profile name")
|
||||
}
|
||||
|
||||
if profileName == "" {
|
||||
profileName = dir
|
||||
}
|
||||
if dir != profileName {
|
||||
return "", errors.New("invalid cwtch backup file")
|
||||
}
|
||||
|
||||
if profileFileType != dbFile && profileFileType != saltFile && profileFileType != versionFile {
|
||||
return "", errors.New("invalid cwtch backup file")
|
||||
}
|
||||
default:
|
||||
return "", errors.New("invalid cwtch backup file")
|
||||
}
|
||||
}
|
||||
return profileName, nil
|
||||
}
|
||||
|
||||
func importCwtchProfileBackupFile(srcFile string, profilesDir string) error {
|
||||
f, err := os.Open(srcFile)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
defer f.Close()
|
||||
|
||||
gzf, err := gzip.NewReader(f)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
tarReader := tar.NewReader(gzf)
|
||||
|
||||
profileName := ""
|
||||
|
||||
for {
|
||||
header, err := tarReader.Next()
|
||||
|
||||
if err == io.EOF {
|
||||
break
|
||||
}
|
||||
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
switch header.Typeflag {
|
||||
case tar.TypeDir:
|
||||
return errors.New("invalid cwtch backup file")
|
||||
case tar.TypeReg:
|
||||
// using split here because we deliberately construct these paths in a cross-platform consistent way
|
||||
parts := strings.Split(header.Name, "/")
|
||||
if len(parts) != 2 {
|
||||
return errors.New("invalid header name")
|
||||
}
|
||||
dir := parts[0]
|
||||
base := parts[1]
|
||||
|
||||
_, hexErr := hex.DecodeString(dir)
|
||||
if dir == "." || dir == ".." || len(dir) != 32 || hexErr != nil {
|
||||
return errors.New("invalid profile name")
|
||||
}
|
||||
|
||||
if profileName == "" {
|
||||
profileName = dir
|
||||
}
|
||||
|
||||
if dir != profileName {
|
||||
return errors.New("invalid cwtch backup file")
|
||||
}
|
||||
|
||||
// here we use filepath.Join to construct a valid directory path
|
||||
outFile, err := os.Create(filepath.Join(profilesDir, dir, base))
|
||||
if err != nil {
|
||||
return fmt.Errorf("error importing cwtch profile file: %s", err)
|
||||
}
|
||||
defer outFile.Close()
|
||||
if _, err := io.Copy(outFile, tarReader); err != nil {
|
||||
return fmt.Errorf("error importing cwtch profile file: %s", err)
|
||||
}
|
||||
default:
|
||||
return errors.New("invalid cwtch backup file")
|
||||
}
|
||||
}
|
||||
return nil
|
||||
}
|
|
@ -0,0 +1,325 @@
|
|||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// source: ControlChannel.proto
|
||||
|
||||
/*
|
||||
Package protocol is a generated protocol buffer package.
|
||||
|
||||
It is generated from these files:
|
||||
ControlChannel.proto
|
||||
cwtch-profile.proto
|
||||
group_message.proto
|
||||
|
||||
It has these top-level messages:
|
||||
Packet
|
||||
OpenChannel
|
||||
ChannelResult
|
||||
KeepAlive
|
||||
EnableFeatures
|
||||
FeaturesEnabled
|
||||
CwtchPeerPacket
|
||||
CwtchIdentity
|
||||
GroupChatInvite
|
||||
CwtchServerPacket
|
||||
FetchMessage
|
||||
GroupMessage
|
||||
DecryptedGroupMessage
|
||||
*/
|
||||
package protocol
|
||||
|
||||
import proto "github.com/golang/protobuf/proto"
|
||||
import fmt "fmt"
|
||||
import math "math"
|
||||
|
||||
// Reference imports to suppress errors if they are not otherwise used.
|
||||
var _ = proto.Marshal
|
||||
var _ = fmt.Errorf
|
||||
var _ = math.Inf
|
||||
|
||||
// This is a compile-time assertion to ensure that this generated file
|
||||
// is compatible with the proto package it is being compiled against.
|
||||
// A compilation error at this line likely means your copy of the
|
||||
// proto package needs to be updated.
|
||||
const _ = proto.ProtoPackageIsVersion2 // please upgrade the proto package
|
||||
|
||||
type ChannelResult_CommonError int32
|
||||
|
||||
const (
|
||||
ChannelResult_GenericError ChannelResult_CommonError = 0
|
||||
ChannelResult_UnknownTypeError ChannelResult_CommonError = 1
|
||||
ChannelResult_UnauthorizedError ChannelResult_CommonError = 2
|
||||
ChannelResult_BadUsageError ChannelResult_CommonError = 3
|
||||
ChannelResult_FailedError ChannelResult_CommonError = 4
|
||||
)
|
||||
|
||||
var ChannelResult_CommonError_name = map[int32]string{
|
||||
0: "GenericError",
|
||||
1: "UnknownTypeError",
|
||||
2: "UnauthorizedError",
|
||||
3: "BadUsageError",
|
||||
4: "FailedError",
|
||||
}
|
||||
var ChannelResult_CommonError_value = map[string]int32{
|
||||
"GenericError": 0,
|
||||
"UnknownTypeError": 1,
|
||||
"UnauthorizedError": 2,
|
||||
"BadUsageError": 3,
|
||||
"FailedError": 4,
|
||||
}
|
||||
|
||||
func (x ChannelResult_CommonError) Enum() *ChannelResult_CommonError {
|
||||
p := new(ChannelResult_CommonError)
|
||||
*p = x
|
||||
return p
|
||||
}
|
||||
func (x ChannelResult_CommonError) String() string {
|
||||
return proto.EnumName(ChannelResult_CommonError_name, int32(x))
|
||||
}
|
||||
func (x *ChannelResult_CommonError) UnmarshalJSON(data []byte) error {
|
||||
value, err := proto.UnmarshalJSONEnum(ChannelResult_CommonError_value, data, "ChannelResult_CommonError")
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
*x = ChannelResult_CommonError(value)
|
||||
return nil
|
||||
}
|
||||
func (ChannelResult_CommonError) EnumDescriptor() ([]byte, []int) { return fileDescriptor0, []int{2, 0} }
|
||||
|
||||
type Packet struct {
|
||||
// Must contain exactly one field
|
||||
OpenChannel *OpenChannel `protobuf:"bytes,1,opt,name=open_channel,json=openChannel" json:"open_channel,omitempty"`
|
||||
ChannelResult *ChannelResult `protobuf:"bytes,2,opt,name=channel_result,json=channelResult" json:"channel_result,omitempty"`
|
||||
KeepAlive *KeepAlive `protobuf:"bytes,3,opt,name=keep_alive,json=keepAlive" json:"keep_alive,omitempty"`
|
||||
EnableFeatures *EnableFeatures `protobuf:"bytes,4,opt,name=enable_features,json=enableFeatures" json:"enable_features,omitempty"`
|
||||
FeaturesEnabled *FeaturesEnabled `protobuf:"bytes,5,opt,name=features_enabled,json=featuresEnabled" json:"features_enabled,omitempty"`
|
||||
XXX_unrecognized []byte `json:"-"`
|
||||
}
|
||||
|
||||
func (m *Packet) Reset() { *m = Packet{} }
|
||||
func (m *Packet) String() string { return proto.CompactTextString(m) }
|
||||
func (*Packet) ProtoMessage() {}
|
||||
func (*Packet) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{0} }
|
||||
|
||||
func (m *Packet) GetOpenChannel() *OpenChannel {
|
||||
if m != nil {
|
||||
return m.OpenChannel
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *Packet) GetChannelResult() *ChannelResult {
|
||||
if m != nil {
|
||||
return m.ChannelResult
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *Packet) GetKeepAlive() *KeepAlive {
|
||||
if m != nil {
|
||||
return m.KeepAlive
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *Packet) GetEnableFeatures() *EnableFeatures {
|
||||
if m != nil {
|
||||
return m.EnableFeatures
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *Packet) GetFeaturesEnabled() *FeaturesEnabled {
|
||||
if m != nil {
|
||||
return m.FeaturesEnabled
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
type OpenChannel struct {
|
||||
ChannelIdentifier *int32 `protobuf:"varint,1,req,name=channel_identifier,json=channelIdentifier" json:"channel_identifier,omitempty"`
|
||||
ChannelType *string `protobuf:"bytes,2,req,name=channel_type,json=channelType" json:"channel_type,omitempty"`
|
||||
proto.XXX_InternalExtensions `json:"-"`
|
||||
XXX_unrecognized []byte `json:"-"`
|
||||
}
|
||||
|
||||
func (m *OpenChannel) Reset() { *m = OpenChannel{} }
|
||||
func (m *OpenChannel) String() string { return proto.CompactTextString(m) }
|
||||
func (*OpenChannel) ProtoMessage() {}
|
||||
func (*OpenChannel) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{1} }
|
||||
|
||||
var extRange_OpenChannel = []proto.ExtensionRange{
|
||||
{Start: 100, End: 536870911},
|
||||
}
|
||||
|
||||
func (*OpenChannel) ExtensionRangeArray() []proto.ExtensionRange {
|
||||
return extRange_OpenChannel
|
||||
}
|
||||
|
||||
func (m *OpenChannel) GetChannelIdentifier() int32 {
|
||||
if m != nil && m.ChannelIdentifier != nil {
|
||||
return *m.ChannelIdentifier
|
||||
}
|
||||
return 0
|
||||
}
|
||||
|
||||
func (m *OpenChannel) GetChannelType() string {
|
||||
if m != nil && m.ChannelType != nil {
|
||||
return *m.ChannelType
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
type ChannelResult struct {
|
||||
ChannelIdentifier *int32 `protobuf:"varint,1,req,name=channel_identifier,json=channelIdentifier" json:"channel_identifier,omitempty"`
|
||||
Opened *bool `protobuf:"varint,2,req,name=opened" json:"opened,omitempty"`
|
||||
CommonError *ChannelResult_CommonError `protobuf:"varint,3,opt,name=common_error,json=commonError,enum=protocol.ChannelResult_CommonError" json:"common_error,omitempty"`
|
||||
proto.XXX_InternalExtensions `json:"-"`
|
||||
XXX_unrecognized []byte `json:"-"`
|
||||
}
|
||||
|
||||
func (m *ChannelResult) Reset() { *m = ChannelResult{} }
|
||||
func (m *ChannelResult) String() string { return proto.CompactTextString(m) }
|
||||
func (*ChannelResult) ProtoMessage() {}
|
||||
func (*ChannelResult) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{2} }
|
||||
|
||||
var extRange_ChannelResult = []proto.ExtensionRange{
|
||||
{Start: 100, End: 536870911},
|
||||
}
|
||||
|
||||
func (*ChannelResult) ExtensionRangeArray() []proto.ExtensionRange {
|
||||
return extRange_ChannelResult
|
||||
}
|
||||
|
||||
func (m *ChannelResult) GetChannelIdentifier() int32 {
|
||||
if m != nil && m.ChannelIdentifier != nil {
|
||||
return *m.ChannelIdentifier
|
||||
}
|
||||
return 0
|
||||
}
|
||||
|
||||
func (m *ChannelResult) GetOpened() bool {
|
||||
if m != nil && m.Opened != nil {
|
||||
return *m.Opened
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
func (m *ChannelResult) GetCommonError() ChannelResult_CommonError {
|
||||
if m != nil && m.CommonError != nil {
|
||||
return *m.CommonError
|
||||
}
|
||||
return ChannelResult_GenericError
|
||||
}
|
||||
|
||||
type KeepAlive struct {
|
||||
ResponseRequested *bool `protobuf:"varint,1,req,name=response_requested,json=responseRequested" json:"response_requested,omitempty"`
|
||||
XXX_unrecognized []byte `json:"-"`
|
||||
}
|
||||
|
||||
func (m *KeepAlive) Reset() { *m = KeepAlive{} }
|
||||
func (m *KeepAlive) String() string { return proto.CompactTextString(m) }
|
||||
func (*KeepAlive) ProtoMessage() {}
|
||||
func (*KeepAlive) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{3} }
|
||||
|
||||
func (m *KeepAlive) GetResponseRequested() bool {
|
||||
if m != nil && m.ResponseRequested != nil {
|
||||
return *m.ResponseRequested
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
type EnableFeatures struct {
|
||||
Feature []string `protobuf:"bytes,1,rep,name=feature" json:"feature,omitempty"`
|
||||
proto.XXX_InternalExtensions `json:"-"`
|
||||
XXX_unrecognized []byte `json:"-"`
|
||||
}
|
||||
|
||||
func (m *EnableFeatures) Reset() { *m = EnableFeatures{} }
|
||||
func (m *EnableFeatures) String() string { return proto.CompactTextString(m) }
|
||||
func (*EnableFeatures) ProtoMessage() {}
|
||||
func (*EnableFeatures) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{4} }
|
||||
|
||||
var extRange_EnableFeatures = []proto.ExtensionRange{
|
||||
{Start: 100, End: 536870911},
|
||||
}
|
||||
|
||||
func (*EnableFeatures) ExtensionRangeArray() []proto.ExtensionRange {
|
||||
return extRange_EnableFeatures
|
||||
}
|
||||
|
||||
func (m *EnableFeatures) GetFeature() []string {
|
||||
if m != nil {
|
||||
return m.Feature
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
type FeaturesEnabled struct {
|
||||
Feature []string `protobuf:"bytes,1,rep,name=feature" json:"feature,omitempty"`
|
||||
proto.XXX_InternalExtensions `json:"-"`
|
||||
XXX_unrecognized []byte `json:"-"`
|
||||
}
|
||||
|
||||
func (m *FeaturesEnabled) Reset() { *m = FeaturesEnabled{} }
|
||||
func (m *FeaturesEnabled) String() string { return proto.CompactTextString(m) }
|
||||
func (*FeaturesEnabled) ProtoMessage() {}
|
||||
func (*FeaturesEnabled) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{5} }
|
||||
|
||||
var extRange_FeaturesEnabled = []proto.ExtensionRange{
|
||||
{Start: 100, End: 536870911},
|
||||
}
|
||||
|
||||
func (*FeaturesEnabled) ExtensionRangeArray() []proto.ExtensionRange {
|
||||
return extRange_FeaturesEnabled
|
||||
}
|
||||
|
||||
func (m *FeaturesEnabled) GetFeature() []string {
|
||||
if m != nil {
|
||||
return m.Feature
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func init() {
|
||||
proto.RegisterType((*Packet)(nil), "protocol.Packet")
|
||||
proto.RegisterType((*OpenChannel)(nil), "protocol.OpenChannel")
|
||||
proto.RegisterType((*ChannelResult)(nil), "protocol.ChannelResult")
|
||||
proto.RegisterType((*KeepAlive)(nil), "protocol.KeepAlive")
|
||||
proto.RegisterType((*EnableFeatures)(nil), "protocol.EnableFeatures")
|
||||
proto.RegisterType((*FeaturesEnabled)(nil), "protocol.FeaturesEnabled")
|
||||
proto.RegisterEnum("protocol.ChannelResult_CommonError", ChannelResult_CommonError_name, ChannelResult_CommonError_value)
|
||||
}
|
||||
|
||||
func init() { proto.RegisterFile("ControlChannel.proto", fileDescriptor0) }
|
||||
|
||||
var fileDescriptor0 = []byte{
|
||||
// 461 bytes of a gzipped FileDescriptorProto
|
||||
0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x94, 0x52, 0x4d, 0x8f, 0xd3, 0x30,
|
||||
0x10, 0x25, 0xe9, 0xee, 0x92, 0x4e, 0xfa, 0x91, 0x9a, 0x5d, 0x30, 0xb7, 0x12, 0x2e, 0x15, 0x12,
|
||||
0x3d, 0x54, 0x20, 0x21, 0x0e, 0x48, 0x4b, 0xd9, 0x22, 0xc4, 0x01, 0x64, 0xd1, 0x73, 0x64, 0x92,
|
||||
0x29, 0x1b, 0x35, 0x6b, 0x1b, 0xc7, 0x05, 0x2d, 0xa7, 0xfe, 0x0e, 0xfe, 0x0c, 0x7f, 0x0d, 0xc5,
|
||||
0x89, 0x9b, 0x14, 0x09, 0x09, 0x4e, 0xc9, 0x9b, 0xf7, 0xde, 0x8c, 0xfc, 0x66, 0xe0, 0x7c, 0x29,
|
||||
0x85, 0xd1, 0xb2, 0x58, 0x5e, 0x73, 0x21, 0xb0, 0x98, 0x2b, 0x2d, 0x8d, 0x24, 0x81, 0xfd, 0xa4,
|
||||
0xb2, 0x88, 0x7f, 0xf9, 0x70, 0xf6, 0x91, 0xa7, 0x5b, 0x34, 0xe4, 0x05, 0x0c, 0xa4, 0x42, 0x91,
|
||||
0xa4, 0xb5, 0x94, 0x7a, 0x53, 0x6f, 0x16, 0x2e, 0x2e, 0xe6, 0x4e, 0x3b, 0xff, 0xa0, 0x50, 0x34,
|
||||
0x7d, 0x58, 0x28, 0x5b, 0x40, 0x5e, 0xc1, 0xa8, 0x31, 0x25, 0x1a, 0xcb, 0x5d, 0x61, 0xa8, 0x6f,
|
||||
0xbd, 0x0f, 0x5a, 0xaf, 0xf3, 0x59, 0x9a, 0x0d, 0xd3, 0x2e, 0x24, 0x0b, 0x80, 0x2d, 0xa2, 0x4a,
|
||||
0x78, 0x91, 0x7f, 0x43, 0xda, 0xb3, 0xde, 0x7b, 0xad, 0xf7, 0x3d, 0xa2, 0xba, 0xac, 0x28, 0xd6,
|
||||
0xdf, 0xba, 0x5f, 0x72, 0x09, 0x63, 0x14, 0xfc, 0x73, 0x81, 0xc9, 0x06, 0xb9, 0xd9, 0x69, 0x2c,
|
||||
0xe9, 0x89, 0x35, 0xd2, 0xd6, 0x78, 0x65, 0x05, 0xab, 0x86, 0x67, 0x23, 0x3c, 0xc2, 0xe4, 0x0d,
|
||||
0x44, 0xce, 0x9b, 0xd4, 0x54, 0x46, 0x4f, 0x6d, 0x8f, 0x87, 0x6d, 0x0f, 0xa7, 0xae, 0x7b, 0x65,
|
||||
0x6c, 0xbc, 0x39, 0x2e, 0xc4, 0x39, 0x84, 0x9d, 0x60, 0xc8, 0x53, 0x20, 0x2e, 0x8b, 0x3c, 0x43,
|
||||
0x61, 0xf2, 0x4d, 0x8e, 0x9a, 0x7a, 0x53, 0x7f, 0x76, 0xca, 0x26, 0x0d, 0xf3, 0xee, 0x40, 0x90,
|
||||
0x47, 0x30, 0x70, 0x72, 0x73, 0xab, 0x90, 0xfa, 0x53, 0x7f, 0xd6, 0x67, 0x61, 0x53, 0xfb, 0x74,
|
||||
0xab, 0xf0, 0x49, 0x10, 0x64, 0xd1, 0x7e, 0xbf, 0xdf, 0xfb, 0xf1, 0x4f, 0x1f, 0x86, 0x47, 0x41,
|
||||
0xfe, 0xef, 0xb4, 0xfb, 0x70, 0x56, 0xed, 0x0d, 0x33, 0x3b, 0x27, 0x60, 0x0d, 0x22, 0x2b, 0x18,
|
||||
0xa4, 0xf2, 0xe6, 0x46, 0x8a, 0x04, 0xb5, 0x96, 0xda, 0xae, 0x60, 0xb4, 0x78, 0xfc, 0x97, 0xf5,
|
||||
0xcd, 0x97, 0x56, 0x7b, 0x55, 0x49, 0x59, 0x98, 0xb6, 0x20, 0x56, 0x10, 0x76, 0x38, 0x12, 0xc1,
|
||||
0xe0, 0x2d, 0x0a, 0xd4, 0x79, 0x6a, 0x71, 0x74, 0x87, 0x9c, 0x43, 0xb4, 0x16, 0x5b, 0x21, 0xbf,
|
||||
0x8b, 0xea, 0x69, 0x75, 0xd5, 0x23, 0x17, 0x30, 0x59, 0x0b, 0xbe, 0x33, 0xd7, 0x52, 0xe7, 0x3f,
|
||||
0x30, 0xab, 0xcb, 0x3e, 0x99, 0xc0, 0xf0, 0x35, 0xcf, 0xd6, 0x25, 0xff, 0xd2, 0x28, 0x7b, 0x64,
|
||||
0x0c, 0xe1, 0x8a, 0xe7, 0x85, 0xd3, 0x9c, 0x74, 0xc2, 0x79, 0x09, 0xfd, 0xc3, 0xa1, 0x54, 0xb9,
|
||||
0x68, 0x2c, 0x95, 0x14, 0x25, 0x26, 0x1a, 0xbf, 0xee, 0xb0, 0x34, 0x98, 0xd9, 0x5c, 0x02, 0x36,
|
||||
0x71, 0x0c, 0x73, 0x44, 0xfc, 0x0c, 0x46, 0xc7, 0xb7, 0x42, 0x28, 0xdc, 0x6d, 0x16, 0x4d, 0xbd,
|
||||
0x69, 0x6f, 0xd6, 0x67, 0x0e, 0x76, 0x26, 0x3e, 0x87, 0xf1, 0x1f, 0xd7, 0xf1, 0x2f, 0xb6, 0xdf,
|
||||
0x01, 0x00, 0x00, 0xff, 0xff, 0x9d, 0x32, 0x16, 0x1e, 0x93, 0x03, 0x00, 0x00,
|
||||
}
|
|
@ -0,0 +1,53 @@
|
|||
syntax = "proto2";
|
||||
package protocol;
|
||||
|
||||
message Packet {
|
||||
// Must contain exactly one field
|
||||
optional OpenChannel open_channel = 1;
|
||||
optional ChannelResult channel_result = 2;
|
||||
optional KeepAlive keep_alive = 3;
|
||||
optional EnableFeatures enable_features = 4;
|
||||
optional FeaturesEnabled features_enabled = 5;
|
||||
}
|
||||
|
||||
message OpenChannel {
|
||||
required int32 channel_identifier = 1; // Arbitrary unique identifier for this channel instance
|
||||
required string channel_type = 2; // String identifying channel type; e.g. im.ricochet.chat
|
||||
|
||||
// It is valid to extend the OpenChannel message to add fields specific
|
||||
// to the requested channel_type.
|
||||
extensions 100 to max;
|
||||
}
|
||||
|
||||
message ChannelResult {
|
||||
required int32 channel_identifier = 1; // Matching the value from OpenChannel
|
||||
required bool opened = 2; // If the channel is now open
|
||||
|
||||
enum CommonError {
|
||||
GenericError = 0;
|
||||
UnknownTypeError = 1;
|
||||
UnauthorizedError = 2;
|
||||
BadUsageError = 3;
|
||||
FailedError = 4;
|
||||
}
|
||||
|
||||
optional CommonError common_error = 3;
|
||||
|
||||
// As with OpenChannel, it is valid to extend this message with fields specific
|
||||
// to the channel type.
|
||||
extensions 100 to max;
|
||||
}
|
||||
|
||||
message KeepAlive {
|
||||
required bool response_requested = 1;
|
||||
}
|
||||
|
||||
message EnableFeatures {
|
||||
repeated string feature = 1;
|
||||
extensions 100 to max;
|
||||
}
|
||||
|
||||
message FeaturesEnabled {
|
||||
repeated string feature = 1;
|
||||
extensions 100 to max;
|
||||
}
|
|
@ -1,811 +0,0 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"encoding/base64"
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives/privacypass"
|
||||
"strconv"
|
||||
"strings"
|
||||
"sync"
|
||||
"sync/atomic"
|
||||
"time"
|
||||
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/protocol/files"
|
||||
"cwtch.im/cwtch/protocol/groups"
|
||||
pmodel "cwtch.im/cwtch/protocol/model"
|
||||
"git.openprivacy.ca/cwtch.im/tapir"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/applications"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/networks/tor"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives"
|
||||
"git.openprivacy.ca/openprivacy/connectivity"
|
||||
torProvider "git.openprivacy.ca/openprivacy/connectivity/tor"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"github.com/gtank/ristretto255"
|
||||
"golang.org/x/crypto/ed25519"
|
||||
)
|
||||
|
||||
// 32 from tor/src/app/config/config.c MaxClientCircuitsPending
|
||||
// we lower a bit because there's a lot of spillage
|
||||
// - just cus we get a SOCKS timeout doesn't mean tor has stopped trying as a huge sorce
|
||||
// - potential multiple profiles as a huge source
|
||||
// - second order connections like token service's second servers aren't tracked in our system adding a few extra periodically
|
||||
const TorMaxPendingConns = 28
|
||||
|
||||
type connectionLockedService struct {
|
||||
service tapir.Service
|
||||
connectingLock sync.Mutex
|
||||
}
|
||||
|
||||
type engine struct {
|
||||
queue event.Queue
|
||||
|
||||
// Engine Attributes
|
||||
identity primitives.Identity
|
||||
acn connectivity.ACN
|
||||
|
||||
// Authorization list of contacts to authorization status
|
||||
authorizations sync.Map // string(onion) => model.Authorization
|
||||
|
||||
// Block Unknown Contacts
|
||||
blockUnknownContacts atomic.Bool
|
||||
|
||||
// Pointer to the Global Event Manager
|
||||
eventManager event.Manager
|
||||
|
||||
// Nextgen Tapir Service
|
||||
service tapir.Service
|
||||
|
||||
getValRequests sync.Map // [string]string eventID:Data
|
||||
|
||||
// Nextgen Tapir Service
|
||||
ephemeralServices map[string]*connectionLockedService //sync.Map // string(onion) => tapir.Service
|
||||
ephemeralServicesLock sync.Mutex
|
||||
|
||||
// Required for listen(), inaccessible from identity
|
||||
privateKey ed25519.PrivateKey
|
||||
|
||||
// file sharing subsystem is responsible for maintaining active shares and downloads
|
||||
filesharingSubSystem files.FileSharingSubSystem
|
||||
|
||||
tokenManagers sync.Map // [tokenService][]TokenManager
|
||||
|
||||
shuttingDown atomic.Bool
|
||||
onSendMessage func(connection tapir.Connection, message []byte) error
|
||||
}
|
||||
|
||||
// Engine (ProtocolEngine) encapsulates the logic necessary to make and receive Cwtch connections.
|
||||
// Note: ProtocolEngine doesn't have access to any information necessary to encrypt or decrypt GroupMessages
|
||||
// Protocol Engine *can* associate Group Identifiers with Group Servers, although we don't currently make use of this fact
|
||||
// other than to route errors back to the UI.
|
||||
type Engine interface {
|
||||
ACN() connectivity.ACN
|
||||
EventManager() event.Manager
|
||||
Shutdown()
|
||||
}
|
||||
|
||||
// NewProtocolEngine initializes a new engine that runs Cwtch using the given parameters
|
||||
func NewProtocolEngine(identity primitives.Identity, privateKey ed25519.PrivateKey, acn connectivity.ACN, eventManager event.Manager, peerAuthorizations map[string]model.Authorization, engineHooks EngineHooks) Engine {
|
||||
engine := new(engine)
|
||||
engine.identity = identity
|
||||
engine.privateKey = privateKey
|
||||
engine.ephemeralServices = make(map[string]*connectionLockedService)
|
||||
engine.queue = event.NewQueue()
|
||||
|
||||
// the standard send message function
|
||||
engine.onSendMessage = engineHooks.SendPeerMessage
|
||||
|
||||
go engine.eventHandler()
|
||||
|
||||
engine.acn = acn
|
||||
|
||||
// Init the Server running the Simple App.
|
||||
engine.service = new(tor.BaseOnionService)
|
||||
engine.service.Init(acn, privateKey, &identity)
|
||||
|
||||
engine.eventManager = eventManager
|
||||
|
||||
engine.eventManager.Subscribe(event.ProtocolEngineStartListen, engine.queue)
|
||||
engine.eventManager.Subscribe(event.ProtocolEngineShutdown, engine.queue)
|
||||
engine.eventManager.Subscribe(event.PeerRequest, engine.queue)
|
||||
engine.eventManager.Subscribe(event.InvitePeerToGroup, engine.queue)
|
||||
engine.eventManager.Subscribe(event.JoinServer, engine.queue)
|
||||
engine.eventManager.Subscribe(event.LeaveServer, engine.queue)
|
||||
engine.eventManager.Subscribe(event.SendMessageToGroup, engine.queue)
|
||||
engine.eventManager.Subscribe(event.SendMessageToPeer, engine.queue)
|
||||
engine.eventManager.Subscribe(event.SendGetValMessageToPeer, engine.queue)
|
||||
engine.eventManager.Subscribe(event.SendRetValMessageToPeer, engine.queue)
|
||||
engine.eventManager.Subscribe(event.DeleteContact, engine.queue)
|
||||
|
||||
engine.eventManager.Subscribe(event.UpdateConversationAuthorization, engine.queue)
|
||||
engine.eventManager.Subscribe(event.BlockUnknownPeers, engine.queue)
|
||||
engine.eventManager.Subscribe(event.AllowUnknownPeers, engine.queue)
|
||||
engine.eventManager.Subscribe(event.DisconnectPeerRequest, engine.queue)
|
||||
engine.eventManager.Subscribe(event.DisconnectServerRequest, engine.queue)
|
||||
|
||||
// File Handling
|
||||
engine.eventManager.Subscribe(event.ShareManifest, engine.queue)
|
||||
engine.eventManager.Subscribe(event.StopFileShare, engine.queue)
|
||||
engine.eventManager.Subscribe(event.StopAllFileShares, engine.queue)
|
||||
engine.eventManager.Subscribe(event.ManifestSizeReceived, engine.queue)
|
||||
engine.eventManager.Subscribe(event.ManifestSaved, engine.queue)
|
||||
|
||||
// Token Server
|
||||
engine.eventManager.Subscribe(event.MakeAntispamPayment, engine.queue)
|
||||
|
||||
for peer, authorization := range peerAuthorizations {
|
||||
engine.authorizations.Store(peer, authorization)
|
||||
}
|
||||
return engine
|
||||
}
|
||||
|
||||
func (e *engine) ACN() connectivity.ACN {
|
||||
return e.acn
|
||||
}
|
||||
|
||||
func (e *engine) EventManager() event.Manager {
|
||||
return e.eventManager
|
||||
}
|
||||
|
||||
// eventHandler process events from other subsystems
|
||||
func (e *engine) eventHandler() {
|
||||
log.Debugf("restartFlow Launching ProtocolEngine listener")
|
||||
for {
|
||||
ev := e.queue.Next()
|
||||
// optimistic shutdown...
|
||||
if e.shuttingDown.Load() {
|
||||
return
|
||||
}
|
||||
switch ev.EventType {
|
||||
case event.StatusRequest:
|
||||
e.eventManager.Publish(event.Event{EventType: event.ProtocolEngineStatus, EventID: ev.EventID})
|
||||
case event.PeerRequest:
|
||||
log.Debugf("restartFlow Handling Peer Request")
|
||||
if torProvider.IsValidHostname(ev.Data[event.RemotePeer]) {
|
||||
go e.peerWithOnion(ev.Data[event.RemotePeer])
|
||||
}
|
||||
case event.InvitePeerToGroup:
|
||||
err := e.sendPeerMessage(ev.Data[event.RemotePeer], pmodel.PeerMessage{ID: ev.EventID, Context: event.ContextInvite, Data: []byte(ev.Data[event.GroupInvite])})
|
||||
if err != nil {
|
||||
e.eventManager.Publish(event.NewEvent(event.SendMessageToPeerError, map[event.Field]string{event.EventContext: string(event.InvitePeerToGroup), event.RemotePeer: ev.Data[event.RemotePeer], event.EventID: ev.EventID, event.Error: "peer is offline or the connection has yet to finalize"}))
|
||||
}
|
||||
case event.JoinServer:
|
||||
signature, err := base64.StdEncoding.DecodeString(ev.Data[event.Signature])
|
||||
if err != nil {
|
||||
// will result in a full sync
|
||||
signature = []byte{}
|
||||
}
|
||||
// if we have been sent cached tokens, also deserialize them
|
||||
cachedTokensJson := ev.Data[event.CachedTokens]
|
||||
var cachedTokens []*privacypass.Token
|
||||
if len(cachedTokensJson) != 0 {
|
||||
json.Unmarshal([]byte(cachedTokensJson), &cachedTokens)
|
||||
}
|
||||
|
||||
// create a new token handler...
|
||||
e.NewTokenHandler(ev.Data[event.ServerTokenOnion], cachedTokens)
|
||||
go e.peerWithTokenServer(ev.Data[event.GroupServer], ev.Data[event.ServerTokenOnion], ev.Data[event.ServerTokenY], signature, cachedTokens)
|
||||
case event.MakeAntispamPayment:
|
||||
go e.makeAntispamPayment(ev.Data[event.GroupServer])
|
||||
case event.LeaveServer:
|
||||
e.leaveServer(ev.Data[event.GroupServer])
|
||||
case event.DeleteContact:
|
||||
onion := ev.Data[event.RemotePeer]
|
||||
// We remove this peer from out blocklist which will prevent them from contacting us if we have "block unknown peers" turned on.
|
||||
e.authorizations.Delete(ev.Data[event.RemotePeer])
|
||||
e.deleteConnection(onion)
|
||||
case event.DisconnectPeerRequest:
|
||||
e.deleteConnection(ev.Data[event.RemotePeer])
|
||||
case event.DisconnectServerRequest:
|
||||
e.leaveServer(ev.Data[event.GroupServer])
|
||||
case event.SendMessageToGroup:
|
||||
ciphertext, _ := base64.StdEncoding.DecodeString(ev.Data[event.Ciphertext])
|
||||
signature, _ := base64.StdEncoding.DecodeString(ev.Data[event.Signature])
|
||||
|
||||
// launch a goroutine to post to the server
|
||||
go e.sendMessageToGroup(ev.Data[event.GroupID], ev.Data[event.GroupServer], ciphertext, signature, 0)
|
||||
case event.SendMessageToPeer:
|
||||
// TODO: remove this passthrough once the UI is integrated.
|
||||
context, ok := ev.Data[event.EventContext]
|
||||
if !ok {
|
||||
context = event.ContextRaw
|
||||
}
|
||||
if err := e.sendPeerMessage(ev.Data[event.RemotePeer], pmodel.PeerMessage{ID: ev.EventID, Context: context, Data: []byte(ev.Data[event.Data])}); err != nil {
|
||||
e.eventManager.Publish(event.NewEvent(event.SendMessageToPeerError, map[event.Field]string{event.EventContext: string(event.SendMessageToPeer), event.RemotePeer: ev.Data[event.RemotePeer], event.EventID: ev.EventID, event.Error: "peer is offline or the connection has yet to finalize"}))
|
||||
}
|
||||
case event.SendGetValMessageToPeer:
|
||||
if err := e.sendGetValToPeer(ev.EventID, ev.Data[event.RemotePeer], ev.Data[event.Scope], ev.Data[event.Path]); err != nil {
|
||||
e.eventManager.Publish(event.NewEvent(event.SendMessageToPeerError, map[event.Field]string{event.EventContext: string(event.SendGetValMessageToPeer), event.RemotePeer: ev.Data[event.RemotePeer], event.EventID: ev.EventID, event.Error: err.Error()}))
|
||||
}
|
||||
case event.SendRetValMessageToPeer:
|
||||
if err := e.sendRetValToPeer(ev.EventID, ev.Data[event.RemotePeer], ev.Data[event.Data], ev.Data[event.Exists]); err != nil {
|
||||
e.eventManager.Publish(event.NewEvent(event.SendMessageToPeerError, map[event.Field]string{event.EventContext: string(event.SendRetValMessageToPeer), event.RemotePeer: ev.Data[event.RemotePeer], event.EventID: ev.EventID, event.Error: err.Error()}))
|
||||
}
|
||||
case event.UpdateConversationAuthorization:
|
||||
accepted, _ := strconv.ParseBool(ev.Data[event.Accepted])
|
||||
blocked, _ := strconv.ParseBool(ev.Data[event.Blocked])
|
||||
auth := model.AuthUnknown
|
||||
if blocked {
|
||||
auth = model.AuthBlocked
|
||||
} else if accepted {
|
||||
auth = model.AuthApproved
|
||||
}
|
||||
e.authorizations.Store(ev.Data[event.RemotePeer], auth)
|
||||
if auth == model.AuthBlocked {
|
||||
connection, err := e.service.GetConnection(ev.Data[event.RemotePeer])
|
||||
if connection != nil && err == nil {
|
||||
connection.Close()
|
||||
}
|
||||
// Explicitly send a disconnected event (if we don't do this here then the UI can wait for a while before
|
||||
// an ongoing Open() connection fails and so the user will see a blocked peer as still connecting (because
|
||||
// there isn't an active connection and we are stuck waiting for tor to time out)
|
||||
e.peerDisconnected(ev.Data[event.RemotePeer])
|
||||
}
|
||||
case event.AllowUnknownPeers:
|
||||
log.Debugf("%v now allows unknown connections", e.identity.Hostname())
|
||||
e.blockUnknownContacts.Store(false)
|
||||
case event.BlockUnknownPeers:
|
||||
log.Debugf("%v now forbids unknown connections", e.identity.Hostname())
|
||||
e.blockUnknownContacts.Store(true)
|
||||
case event.ProtocolEngineStartListen:
|
||||
go e.listenFn()
|
||||
case event.ShareManifest:
|
||||
e.filesharingSubSystem.ShareFile(ev.Data[event.FileKey], ev.Data[event.SerializedManifest])
|
||||
case event.StopFileShare:
|
||||
e.filesharingSubSystem.StopFileShare(ev.Data[event.FileKey])
|
||||
case event.StopAllFileShares:
|
||||
e.filesharingSubSystem.StopAllFileShares()
|
||||
case event.ManifestSizeReceived:
|
||||
handle := ev.Data[event.Handle]
|
||||
key := ev.Data[event.FileKey]
|
||||
size, _ := strconv.Atoi(ev.Data[event.ManifestSize])
|
||||
if err := e.sendPeerMessage(handle, e.filesharingSubSystem.FetchManifest(key, uint64(size))); err != nil {
|
||||
e.eventManager.Publish(event.NewEvent(event.SendMessageToPeerError, map[event.Field]string{event.RemotePeer: ev.Data[event.RemotePeer], event.EventID: ev.EventID, event.Error: err.Error()}))
|
||||
}
|
||||
case event.ManifestSaved:
|
||||
handle := ev.Data[event.Handle]
|
||||
key := ev.Data[event.FileKey]
|
||||
serializedManifest := ev.Data[event.SerializedManifest]
|
||||
tempFile := ev.Data[event.TempFile]
|
||||
title := ev.Data[event.NameSuggestion]
|
||||
|
||||
// Another optimistic check here. Technically Cwtch profile should not request manifest on a download files
|
||||
// but if they do then we should check if it exists up front. If it does then announce that the download
|
||||
// is complete.
|
||||
if _, filePath, success := e.filesharingSubSystem.VerifyFile(key); success {
|
||||
log.Debugf("file verified and downloaded!")
|
||||
e.eventManager.Publish(event.NewEvent(event.FileDownloaded, map[event.Field]string{event.FileKey: key, event.FilePath: filePath, event.TempFile: tempFile}))
|
||||
} else {
|
||||
// NOTE: for now there will probably only ever be a single chunk request. When we enable group
|
||||
// sharing and rehosting then this loop will serve as a a way of splitting the request among multiple
|
||||
// contacts
|
||||
for _, message := range e.filesharingSubSystem.CompileChunkRequests(key, serializedManifest, tempFile, title) {
|
||||
if err := e.sendPeerMessage(handle, message); err != nil {
|
||||
e.eventManager.Publish(event.NewEvent(event.SendMessageToPeerError, map[event.Field]string{event.RemotePeer: ev.Data[event.RemotePeer], event.EventID: ev.EventID, event.Error: err.Error()}))
|
||||
}
|
||||
}
|
||||
}
|
||||
case event.ProtocolEngineShutdown:
|
||||
return
|
||||
default:
|
||||
return
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (e *engine) isBlocked(onion string) bool {
|
||||
authorization, known := e.authorizations.Load(onion)
|
||||
if !known {
|
||||
// if we block unknown peers we will block this contact
|
||||
return e.blockUnknownContacts.Load()
|
||||
}
|
||||
return authorization.(model.Authorization) == model.AuthBlocked
|
||||
}
|
||||
|
||||
func (e *engine) isAllowed(onion string) bool {
|
||||
authorization, known := e.authorizations.Load(onion)
|
||||
if !known {
|
||||
log.Errorf("attempted to lookup authorization of onion not in map...that should never happen")
|
||||
return false
|
||||
}
|
||||
if e.blockUnknownContacts.Load() {
|
||||
return authorization.(model.Authorization) == model.AuthApproved
|
||||
}
|
||||
return authorization.(model.Authorization) != model.AuthBlocked
|
||||
}
|
||||
|
||||
func (e *engine) createPeerTemplate() *PeerApp {
|
||||
peerAppTemplate := new(PeerApp)
|
||||
peerAppTemplate.IsBlocked = e.isBlocked
|
||||
peerAppTemplate.IsAllowed = e.isAllowed
|
||||
peerAppTemplate.MessageHandler = e.handlePeerMessage
|
||||
peerAppTemplate.OnAcknowledgement = e.ignoreOnShutdown2(e.peerAck)
|
||||
peerAppTemplate.OnAuth = e.ignoreOnShutdown(e.peerAuthed)
|
||||
peerAppTemplate.OnConnecting = e.ignoreOnShutdown(e.peerConnecting)
|
||||
peerAppTemplate.OnClose = e.ignoreOnShutdown(e.peerDisconnected)
|
||||
peerAppTemplate.OnSendMessage = e.onSendMessage
|
||||
return peerAppTemplate
|
||||
}
|
||||
|
||||
// Listen sets up an onion listener to process incoming cwtch messages
|
||||
func (e *engine) listenFn() {
|
||||
err := e.service.Listen(e.createPeerTemplate())
|
||||
if !e.shuttingDown.Load() {
|
||||
e.eventManager.Publish(event.NewEvent(event.ProtocolEngineStopped, map[event.Field]string{event.Identity: e.identity.Hostname(), event.Error: err.Error()}))
|
||||
}
|
||||
}
|
||||
|
||||
// Shutdown tears down the eventHandler goroutine
|
||||
func (e *engine) Shutdown() {
|
||||
// don't accept any more events...
|
||||
e.queue.Publish(event.NewEvent(event.ProtocolEngineShutdown, map[event.Field]string{}))
|
||||
e.eventManager.Publish(event.NewEvent(event.ProtocolEngineShutdown, map[event.Field]string{}))
|
||||
e.service.Shutdown()
|
||||
e.shuttingDown.Store(true)
|
||||
e.ephemeralServicesLock.Lock()
|
||||
defer e.ephemeralServicesLock.Unlock()
|
||||
for _, connection := range e.ephemeralServices {
|
||||
log.Infof("shutting down ephemeral service")
|
||||
// work around: service.shutdown() can block for a long time if it is Open()ing a new connection, putting it in a
|
||||
// goroutine means we can perform this operation and let the per service shutdown in their own time or until the app exits
|
||||
conn := connection // don't capture loop variable
|
||||
go func() {
|
||||
conn.connectingLock.Lock()
|
||||
conn.service.Shutdown()
|
||||
conn.connectingLock.Unlock()
|
||||
|
||||
}()
|
||||
}
|
||||
e.queue.Shutdown()
|
||||
}
|
||||
|
||||
// peerWithOnion is the entry point for cwtchPeer relationships
|
||||
// needs to be run in a goroutine as will block on Open.
|
||||
func (e *engine) peerWithOnion(onion string) {
|
||||
log.Debugf("Called PeerWithOnion for %v", onion)
|
||||
if !e.isBlocked(onion) {
|
||||
e.ignoreOnShutdown(e.peerConnecting)(onion)
|
||||
connected, err := e.service.Connect(onion, e.createPeerTemplate())
|
||||
if connected && err == nil {
|
||||
// on success CwtchPeer will handle Auth and other status updates
|
||||
// early exit from this function...
|
||||
return
|
||||
}
|
||||
// If we are already connected...check if we are authed and issue an auth event
|
||||
// (This allows the ui to be stateless)
|
||||
if connected && err != nil {
|
||||
conn, err := e.service.WaitForCapabilityOrClose(onion, cwtchCapability)
|
||||
if err == nil {
|
||||
if conn.HasCapability(cwtchCapability) {
|
||||
e.ignoreOnShutdown(e.peerAuthed)(onion)
|
||||
return
|
||||
}
|
||||
log.Errorf("PeerWithOnion something went very wrong...%v %v", onion, err)
|
||||
if conn != nil {
|
||||
conn.Close()
|
||||
}
|
||||
e.ignoreOnShutdown(e.peerDisconnected)(onion)
|
||||
} else {
|
||||
e.ignoreOnShutdown(e.peerDisconnected)(onion)
|
||||
}
|
||||
}
|
||||
}
|
||||
e.ignoreOnShutdown(e.peerDisconnected)(onion)
|
||||
}
|
||||
|
||||
func (e *engine) makeAntispamPayment(onion string) {
|
||||
log.Debugf("making antispam payment")
|
||||
e.ephemeralServicesLock.Lock()
|
||||
ephemeralService, ok := e.ephemeralServices[onion]
|
||||
e.ephemeralServicesLock.Unlock()
|
||||
|
||||
if ephemeralService == nil || !ok {
|
||||
log.Debugf("could not find associated group for antispam payment")
|
||||
return
|
||||
}
|
||||
|
||||
// Before doing anything, send and event with the current number of token
|
||||
// This may unblock downstream processes who don't have an accurate token count
|
||||
e.PokeTokenCount(onion)
|
||||
|
||||
conn, err := ephemeralService.service.GetConnection(onion)
|
||||
if err == nil {
|
||||
tokenApp, ok := (conn.App()).(*TokenBoardClient)
|
||||
if ok {
|
||||
tokenManagerPointer, _ := e.tokenManagers.LoadOrStore(tokenApp.tokenServiceOnion, NewTokenManager())
|
||||
tokenManager := tokenManagerPointer.(*TokenManager)
|
||||
log.Debugf("checking antispam tokens %v", tokenManager.NumTokens())
|
||||
if tokenManager.NumTokens() < 5 {
|
||||
go tokenApp.PurchaseTokens()
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// peerWithTokenServer is the entry point for cwtchPeer - server relationships
|
||||
// needs to be run in a goroutine as will block on Open.
|
||||
func (e *engine) peerWithTokenServer(onion string, tokenServerOnion string, tokenServerY string, lastKnownSignature []byte, cachedTokens []*privacypass.Token) {
|
||||
e.ephemeralServicesLock.Lock()
|
||||
_, exists := e.ephemeralServices[onion]
|
||||
|
||||
if exists {
|
||||
e.ephemeralServicesLock.Unlock()
|
||||
log.Debugf("attempted to join a server with an active connection")
|
||||
return
|
||||
}
|
||||
|
||||
connectionService := &connectionLockedService{service: new(tor.BaseOnionService)}
|
||||
e.ephemeralServices[onion] = connectionService
|
||||
|
||||
connectionService.connectingLock.Lock()
|
||||
defer connectionService.connectingLock.Unlock()
|
||||
e.ephemeralServicesLock.Unlock()
|
||||
|
||||
log.Debugf("Peering with Token Server %v %v", onion, tokenServerOnion)
|
||||
e.ignoreOnShutdown(e.serverConnecting)(onion)
|
||||
// Create a new ephemeral service for this connection
|
||||
eid, epk := primitives.InitializeEphemeralIdentity()
|
||||
connectionService.service.Init(e.acn, epk, &eid)
|
||||
|
||||
Y := new(ristretto255.Element)
|
||||
Y.UnmarshalText([]byte(tokenServerY))
|
||||
connected, err := connectionService.service.Connect(onion, NewTokenBoardClient(e.acn, Y, tokenServerOnion, lastKnownSignature, e))
|
||||
// If we are already connected...check if we are authed and issue an auth event
|
||||
// (This allows the ui to be stateless)
|
||||
if connected && err != nil {
|
||||
conn, err := connectionService.service.GetConnection(onion)
|
||||
if err == nil {
|
||||
|
||||
// If the server is synced, resend the synced status update
|
||||
if conn.HasCapability(groups.CwtchServerSyncedCapability) {
|
||||
e.ignoreOnShutdown(e.serverSynced)(onion)
|
||||
return
|
||||
}
|
||||
|
||||
// If the server is authed, resend the auth status update
|
||||
if conn.HasCapability(applications.AuthCapability) {
|
||||
// Resend the authed event...
|
||||
e.ignoreOnShutdown(e.serverAuthed)(onion)
|
||||
return
|
||||
}
|
||||
|
||||
// if we are not authed or synced then we are stuck...
|
||||
e.ignoreOnShutdown(e.serverConnecting)(onion)
|
||||
log.Errorf("server connection attempt issued to active connection")
|
||||
}
|
||||
}
|
||||
|
||||
// Only issue a disconnected error if we are disconnected (Connect will fail if a connection already exists)
|
||||
if !connected && err != nil {
|
||||
e.ignoreOnShutdown(e.serverDisconnected)(onion)
|
||||
}
|
||||
}
|
||||
|
||||
func (e *engine) ignoreOnShutdown(f func(string)) func(string) {
|
||||
return func(x string) {
|
||||
if !e.shuttingDown.Load() {
|
||||
f(x)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (e *engine) ignoreOnShutdown2(f func(string, string)) func(string, string) {
|
||||
return func(x, y string) {
|
||||
if !e.shuttingDown.Load() {
|
||||
f(x, y)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (e *engine) peerAuthed(onion string) {
|
||||
_, known := e.authorizations.Load(onion)
|
||||
if !known {
|
||||
e.authorizations.Store(onion, model.AuthUnknown)
|
||||
}
|
||||
|
||||
// FIXME: This call uses WAY too much memory, and was responsible for the vast majority
|
||||
// of allocations in the UI
|
||||
// This is because Bine ends up reading the entire response into memory and then passes that back
|
||||
// into Connectivity which eventually extracts just what it needs.
|
||||
// Ideally we would just read from the control stream directly into reusable buffers.
|
||||
|
||||
//details, err := e.acn.GetInfo(onion)
|
||||
//if err == nil {
|
||||
// if hops, exists := details["circuit"]; exists {
|
||||
// e.eventManager.Publish(event.NewEvent(event.ACNInfo, map[event.Field]string{
|
||||
// event.Handle: onion,
|
||||
// event.Key: "circuit",
|
||||
// event.Data: hops,
|
||||
// }))
|
||||
// }
|
||||
//} else {
|
||||
// log.Errorf("error getting info for onion %v", err)
|
||||
//}
|
||||
|
||||
e.eventManager.Publish(event.NewEvent(event.PeerStateChange, map[event.Field]string{
|
||||
event.RemotePeer: string(onion),
|
||||
event.ConnectionState: ConnectionStateName[AUTHENTICATED],
|
||||
}))
|
||||
}
|
||||
|
||||
func (e *engine) peerConnecting(onion string) {
|
||||
e.eventManager.Publish(event.NewEvent(event.PeerStateChange, map[event.Field]string{
|
||||
event.RemotePeer: onion,
|
||||
event.ConnectionState: ConnectionStateName[CONNECTING],
|
||||
}))
|
||||
}
|
||||
|
||||
func (e *engine) serverConnecting(onion string) {
|
||||
e.eventManager.Publish(event.NewEvent(event.ServerStateChange, map[event.Field]string{
|
||||
event.GroupServer: onion,
|
||||
event.ConnectionState: ConnectionStateName[CONNECTING],
|
||||
}))
|
||||
}
|
||||
|
||||
func (e *engine) serverAuthed(onion string) {
|
||||
e.eventManager.Publish(event.NewEvent(event.ServerStateChange, map[event.Field]string{
|
||||
event.GroupServer: onion,
|
||||
event.ConnectionState: ConnectionStateName[AUTHENTICATED],
|
||||
}))
|
||||
}
|
||||
|
||||
func (e *engine) serverSynced(onion string) {
|
||||
e.eventManager.Publish(event.NewEvent(event.ServerStateChange, map[event.Field]string{
|
||||
event.GroupServer: onion,
|
||||
event.ConnectionState: ConnectionStateName[SYNCED],
|
||||
}))
|
||||
}
|
||||
|
||||
func (e *engine) serverDisconnected(onion string) {
|
||||
e.leaveServer(onion)
|
||||
|
||||
e.eventManager.Publish(event.NewEvent(event.ServerStateChange, map[event.Field]string{
|
||||
event.GroupServer: onion,
|
||||
event.ConnectionState: ConnectionStateName[DISCONNECTED],
|
||||
}))
|
||||
}
|
||||
|
||||
func (e *engine) peerAck(onion string, eventID string) {
|
||||
e.eventManager.Publish(event.NewEvent(event.PeerAcknowledgement, map[event.Field]string{
|
||||
event.EventID: eventID,
|
||||
event.RemotePeer: onion,
|
||||
}))
|
||||
}
|
||||
|
||||
func (e *engine) peerDisconnected(onion string) {
|
||||
|
||||
// Clean up any existing get value requests...
|
||||
e.getValRequests.Range(func(key, value interface{}) bool {
|
||||
keyString := key.(string)
|
||||
if strings.HasPrefix(keyString, onion) {
|
||||
e.getValRequests.Delete(keyString)
|
||||
}
|
||||
return true
|
||||
})
|
||||
|
||||
// Purge circuit information...
|
||||
e.eventManager.Publish(event.NewEvent(event.ACNInfo, map[event.Field]string{
|
||||
event.Handle: onion,
|
||||
event.Key: "circuit",
|
||||
event.Data: "",
|
||||
}))
|
||||
|
||||
e.eventManager.Publish(event.NewEvent(event.PeerStateChange, map[event.Field]string{
|
||||
event.RemotePeer: string(onion),
|
||||
event.ConnectionState: ConnectionStateName[DISCONNECTED],
|
||||
}))
|
||||
}
|
||||
|
||||
func (e *engine) sendGetValToPeer(eventID, onion, scope, path string) error {
|
||||
log.Debugf("sendGetValMessage to peer %v %v.%v\n", onion, scope, path)
|
||||
getVal := peerGetVal{Scope: scope, Path: path}
|
||||
message, err := json.Marshal(getVal)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
key := onion + eventID
|
||||
e.getValRequests.Store(key, message)
|
||||
err = e.sendPeerMessage(onion, pmodel.PeerMessage{ID: eventID, Context: event.ContextGetVal, Data: message})
|
||||
if err != nil {
|
||||
e.getValRequests.Delete(key)
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
func (e *engine) sendRetValToPeer(eventID, onion, val, existsStr string) error {
|
||||
log.Debugf("sendRetValMessage to peer %v (%v) %v %v\n", onion, eventID, val, existsStr)
|
||||
exists, _ := strconv.ParseBool(existsStr)
|
||||
retVal := peerRetVal{Val: val, Exists: exists}
|
||||
message, err := json.Marshal(retVal)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return e.sendPeerMessage(onion, pmodel.PeerMessage{ID: eventID, Context: event.ContextRetVal, Data: message})
|
||||
}
|
||||
|
||||
func (e *engine) deleteConnection(id string) {
|
||||
conn, err := e.service.GetConnection(id)
|
||||
if err == nil {
|
||||
conn.Close()
|
||||
}
|
||||
}
|
||||
|
||||
// receiveGroupMessage is a callback function that processes GroupMessages from a given server
|
||||
func (e *engine) receiveGroupMessage(server string, gm *groups.EncryptedGroupMessage) {
|
||||
// Publish Event so that a Profile Engine can deal with it.
|
||||
// Note: This technically means that *multiple* Profile Engines could listen to the same ProtocolEngine!
|
||||
e.eventManager.Publish(event.NewEvent(event.EncryptedGroupMessage, map[event.Field]string{event.GroupServer: server, event.Ciphertext: base64.StdEncoding.EncodeToString(gm.Ciphertext), event.Signature: base64.StdEncoding.EncodeToString(gm.Signature)}))
|
||||
}
|
||||
|
||||
// sendMessageToGroup attempts to sent the given message to the given group id.
|
||||
func (e *engine) sendMessageToGroup(groupID string, server string, ct []byte, sig []byte, attempts int) {
|
||||
// sending to groups can fail for a few reasons (slow server, not enough tokens, etc.)
|
||||
// rather than trying to keep all that logic in method we simply back-off and try again
|
||||
// but if we fail more than 5 times then we report back to the client so they can investigate other options.
|
||||
// Note: This flow only applies to online-and-connected servers (this method will return faster if the server is not
|
||||
// online)
|
||||
if attempts >= 5 {
|
||||
log.Errorf("failed to post a message to a group after %v attempts", attempts)
|
||||
e.eventManager.Publish(event.NewEvent(event.SendMessageToGroupError, map[event.Field]string{event.GroupID: groupID, event.GroupServer: server, event.Error: "could not make payment to server", event.Signature: base64.StdEncoding.EncodeToString(sig)}))
|
||||
return
|
||||
}
|
||||
|
||||
e.ephemeralServicesLock.Lock()
|
||||
ephemeralService, ok := e.ephemeralServices[server]
|
||||
e.ephemeralServicesLock.Unlock()
|
||||
|
||||
if ephemeralService == nil || !ok {
|
||||
log.Debugf("could not send message to group: serve not found")
|
||||
e.eventManager.Publish(event.NewEvent(event.SendMessageToGroupError, map[event.Field]string{event.GroupID: groupID, event.GroupServer: server, event.Error: "server-not-found", event.Signature: base64.StdEncoding.EncodeToString(sig)}))
|
||||
return
|
||||
}
|
||||
|
||||
conn, err := ephemeralService.service.WaitForCapabilityOrClose(server, groups.CwtchServerSyncedCapability)
|
||||
if err == nil {
|
||||
tokenApp, ok := (conn.App()).(*TokenBoardClient)
|
||||
if ok {
|
||||
if spent, numtokens := tokenApp.Post(groupID, ct, sig); !spent {
|
||||
// we failed to post, probably because we ran out of tokens... so make a payment
|
||||
go tokenApp.PurchaseTokens()
|
||||
// backoff
|
||||
time.Sleep(time.Second * 5)
|
||||
// try again
|
||||
log.Debugf("sending message to group error attempt: %v", attempts)
|
||||
e.sendMessageToGroup(groupID, server, ct, sig, attempts+1)
|
||||
} else {
|
||||
if numtokens < 5 {
|
||||
go tokenApp.PurchaseTokens()
|
||||
}
|
||||
}
|
||||
// regardless we return....
|
||||
return
|
||||
}
|
||||
}
|
||||
log.Debugf("could not send message to group")
|
||||
e.eventManager.Publish(event.NewEvent(event.SendMessageToGroupError, map[event.Field]string{event.GroupID: groupID, event.GroupServer: server, event.Error: "server-connection-not-valid", event.Signature: base64.StdEncoding.EncodeToString(sig)}))
|
||||
}
|
||||
|
||||
// TODO this is becoming cluttered
|
||||
func (e *engine) handlePeerMessage(hostname string, eventID string, context string, message []byte) {
|
||||
log.Debugf("New message from peer: %v %v", hostname, context)
|
||||
|
||||
if context == event.ContextAck {
|
||||
e.peerAck(hostname, eventID)
|
||||
} else if context == event.ContextRetVal {
|
||||
req, ok := e.getValRequests.Load(hostname + eventID)
|
||||
if ok {
|
||||
reqStr := req.([]byte)
|
||||
e.handlePeerRetVal(hostname, reqStr, message)
|
||||
e.getValRequests.Delete(hostname + eventID)
|
||||
} else {
|
||||
log.Errorf("could not find val request for %v %s", hostname, eventID)
|
||||
}
|
||||
} else if context == event.ContextGetVal {
|
||||
var getVal peerGetVal
|
||||
err := json.Unmarshal(message, &getVal)
|
||||
if err == nil {
|
||||
ev := event.NewEventList(event.NewGetValMessageFromPeer, event.RemotePeer, hostname, event.Scope, getVal.Scope, event.Path, getVal.Path)
|
||||
ev.EventID = eventID
|
||||
e.eventManager.Publish(ev)
|
||||
}
|
||||
} else if context == event.ContextRequestManifest {
|
||||
for _, message := range e.filesharingSubSystem.RequestManifestParts(eventID) {
|
||||
if err := e.sendPeerMessage(hostname, message); err != nil {
|
||||
e.eventManager.Publish(event.NewEvent(event.SendMessageToPeerError, map[event.Field]string{event.RemotePeer: hostname, event.EventID: eventID, event.Error: err.Error()}))
|
||||
}
|
||||
}
|
||||
} else if context == event.ContextSendManifest {
|
||||
if fileKey, manifest := e.filesharingSubSystem.ReceiveManifestPart(eventID, message); len(manifest) != 0 {
|
||||
// We have a valid manifest
|
||||
e.eventManager.Publish(event.NewEvent(event.ManifestReceived, map[event.Field]string{event.Handle: hostname, event.FileKey: fileKey, event.SerializedManifest: manifest}))
|
||||
}
|
||||
} else if context == event.ContextRequestFile {
|
||||
chunks := e.filesharingSubSystem.ProcessChunkRequest(eventID, message)
|
||||
go func() {
|
||||
for _, message := range chunks {
|
||||
if err := e.sendPeerMessage(hostname, message); err != nil {
|
||||
e.eventManager.Publish(event.NewEvent(event.SendMessageToPeerError, map[event.Field]string{event.RemotePeer: hostname, event.EventID: eventID, event.Error: err.Error()}))
|
||||
}
|
||||
}
|
||||
}()
|
||||
} else if context == event.ContextSendFile {
|
||||
fileKey, progress, totalChunks, _, title := e.filesharingSubSystem.ProcessChunk(eventID, message)
|
||||
if len(fileKey) != 0 {
|
||||
e.eventManager.Publish(event.NewEvent(event.FileDownloadProgressUpdate, map[event.Field]string{event.FileKey: fileKey, event.Progress: strconv.Itoa(int(progress)), event.FileSizeInChunks: strconv.Itoa(int(totalChunks)), event.NameSuggestion: title}))
|
||||
if progress == totalChunks {
|
||||
if tempFile, filePath, success := e.filesharingSubSystem.VerifyFile(fileKey); success {
|
||||
log.Debugf("file verified and downloaded!")
|
||||
e.eventManager.Publish(event.NewEvent(event.FileDownloaded, map[event.Field]string{event.FileKey: fileKey, event.FilePath: filePath, event.TempFile: tempFile}))
|
||||
} else {
|
||||
log.Debugf("file failed to verify!")
|
||||
e.eventManager.Publish(event.NewEvent(event.FileVerificationFailed, map[event.Field]string{event.FileKey: fileKey}))
|
||||
}
|
||||
}
|
||||
}
|
||||
} else {
|
||||
// Fall through handler for the default text conversation.
|
||||
e.eventManager.Publish(event.NewEvent(event.NewMessageFromPeerEngine, map[event.Field]string{event.TimestampReceived: time.Now().Format(time.RFC3339Nano), event.RemotePeer: hostname, event.Data: string(message)}))
|
||||
|
||||
// Don't ack messages in channel 7
|
||||
// Note: this code explictly doesn't care about malformed messages, we deal with them
|
||||
// later on...we still want to ack the original send...(as some "malformed" messages
|
||||
// may be future-ok)
|
||||
if cm, err := model.DeserializeMessage(string(message)); err == nil {
|
||||
if cm.IsStream() {
|
||||
return
|
||||
}
|
||||
}
|
||||
|
||||
// Send an explicit acknowledgement
|
||||
// Every other protocol should have an explicit acknowledgement message e.g. value lookups have responses, and file handling has an explicit flow
|
||||
if err := e.sendPeerMessage(hostname, pmodel.PeerMessage{ID: eventID, Context: event.ContextAck, Data: []byte{}}); err != nil {
|
||||
e.eventManager.Publish(event.NewEvent(event.SendMessageToPeerError, map[event.Field]string{event.RemotePeer: hostname, event.EventID: eventID, event.Error: err.Error()}))
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (e *engine) handlePeerRetVal(hostname string, getValData, retValData []byte) {
|
||||
var getVal peerGetVal
|
||||
var retVal peerRetVal
|
||||
|
||||
err := json.Unmarshal(getValData, &getVal)
|
||||
if err != nil {
|
||||
log.Errorf("Unmarshalling our own getVal request: %v\n", err)
|
||||
return
|
||||
}
|
||||
err = json.Unmarshal(retValData, &retVal)
|
||||
if err != nil {
|
||||
log.Errorf("Unmarshalling peer response to getVal request")
|
||||
return
|
||||
}
|
||||
|
||||
e.eventManager.Publish(event.NewEventList(event.NewRetValMessageFromPeer, event.RemotePeer, hostname, event.Scope, getVal.Scope, event.Path, getVal.Path, event.Exists, strconv.FormatBool(retVal.Exists), event.Data, retVal.Val))
|
||||
}
|
||||
|
||||
// leaveServer disconnects from a server and deletes the ephemeral service
|
||||
func (e *engine) leaveServer(server string) {
|
||||
e.ephemeralServicesLock.Lock()
|
||||
defer e.ephemeralServicesLock.Unlock()
|
||||
ephemeralService, ok := e.ephemeralServices[server]
|
||||
if ok {
|
||||
ephemeralService.service.Shutdown()
|
||||
delete(e.ephemeralServices, server)
|
||||
}
|
||||
}
|
||||
|
||||
func (e *engine) sendPeerMessage(handle string, message pmodel.PeerMessage) error {
|
||||
conn, err := e.service.WaitForCapabilityOrClose(handle, cwtchCapability)
|
||||
if err == nil {
|
||||
peerApp, ok := (conn.App()).(*PeerApp)
|
||||
if ok {
|
||||
return peerApp.SendMessage(message)
|
||||
}
|
||||
log.Debugf("could not derive peer app: %v", err)
|
||||
return fmt.Errorf("could not find peer app to send message to: %v", handle)
|
||||
}
|
||||
log.Debugf("could not send peer message: %v", err)
|
||||
return err
|
||||
}
|
|
@ -1,59 +0,0 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/protocol/groups"
|
||||
"encoding/base64"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives/privacypass"
|
||||
"strconv"
|
||||
)
|
||||
|
||||
// Implement Token Service Handler for Engine
|
||||
|
||||
// GroupMessageHandler receives a server and an encrypted group message
|
||||
func (e *engine) GroupMessageHandler(server string, gm *groups.EncryptedGroupMessage) {
|
||||
e.receiveGroupMessage(server, gm)
|
||||
}
|
||||
|
||||
// PostingFailed notifies a peer that a message failed to post
|
||||
func (e *engine) PostingFailed(group string, sig []byte) {
|
||||
e.eventManager.Publish(event.NewEvent(event.SendMessageToGroupError, map[event.Field]string{event.GroupID: group, event.Error: "failed to post message", event.Signature: base64.StdEncoding.EncodeToString(sig)}))
|
||||
}
|
||||
|
||||
// ServerAuthedHandler is notified when a server has successfully authed
|
||||
func (e *engine) ServerAuthedHandler(server string) {
|
||||
e.serverAuthed(server)
|
||||
}
|
||||
|
||||
// ServerSyncedHandler is notified when a server has successfully synced
|
||||
func (e *engine) ServerSyncedHandler(server string) {
|
||||
e.serverSynced(server)
|
||||
}
|
||||
|
||||
// ServerClosedHandler is notified when a server connection has closed, the result is ignored during shutdown...
|
||||
func (e *engine) ServerClosedHandler(server string) {
|
||||
e.ignoreOnShutdown(e.serverDisconnected)(server)
|
||||
}
|
||||
|
||||
// NewTokenHandler is notified after a successful token acquisition
|
||||
func (e *engine) NewTokenHandler(tokenService string, tokens []*privacypass.Token) {
|
||||
tokenManagerPointer, _ := e.tokenManagers.LoadOrStore(tokenService, NewTokenManager())
|
||||
tokenManager := tokenManagerPointer.(*TokenManager)
|
||||
tokenManager.StoreNewTokens(tokens)
|
||||
e.eventManager.Publish(event.NewEvent(event.TokenManagerInfo, map[event.Field]string{event.ServerTokenOnion: tokenService, event.ServerTokenCount: strconv.Itoa(tokenManager.NumTokens())}))
|
||||
}
|
||||
|
||||
// FetchToken is notified when a server requires a new token from the client
|
||||
func (e *engine) FetchToken(tokenService string) (*privacypass.Token, int, error) {
|
||||
tokenManagerPointer, _ := e.tokenManagers.LoadOrStore(tokenService, NewTokenManager())
|
||||
tokenManager := tokenManagerPointer.(*TokenManager)
|
||||
token, numTokens, err := tokenManager.FetchToken()
|
||||
e.eventManager.Publish(event.NewEvent(event.TokenManagerInfo, map[event.Field]string{event.ServerTokenOnion: tokenService, event.ServerTokenCount: strconv.Itoa(numTokens)}))
|
||||
return token, numTokens, err
|
||||
}
|
||||
|
||||
func (e *engine) PokeTokenCount(tokenService string) {
|
||||
tokenManagerPointer, _ := e.tokenManagers.LoadOrStore(tokenService, NewTokenManager())
|
||||
tokenManager := tokenManagerPointer.(*TokenManager)
|
||||
e.eventManager.Publish(event.NewEvent(event.TokenManagerInfo, map[event.Field]string{event.ServerTokenOnion: tokenService, event.ServerTokenCount: strconv.Itoa(tokenManager.NumTokens())}))
|
||||
}
|
|
@ -1,14 +0,0 @@
|
|||
package connections
|
||||
|
||||
import "git.openprivacy.ca/cwtch.im/tapir"
|
||||
|
||||
type EngineHooks interface {
|
||||
SendPeerMessage(connection tapir.Connection, message []byte) error
|
||||
}
|
||||
|
||||
type DefaultEngineHooks struct {
|
||||
}
|
||||
|
||||
func (deh DefaultEngineHooks) SendPeerMessage(connection tapir.Connection, message []byte) error {
|
||||
return connection.Send(message)
|
||||
}
|
|
@ -1,59 +0,0 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/utils"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/applications"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/networks/tor"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives/privacypass"
|
||||
"git.openprivacy.ca/openprivacy/connectivity"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"reflect"
|
||||
"time"
|
||||
)
|
||||
|
||||
// MakePayment uses the PoW based token protocol to obtain more tokens
|
||||
func MakePayment(tokenServiceOnion string, tokenService *privacypass.TokenServer, acn connectivity.ACN, handler TokenBoardHandler) error {
|
||||
log.Debugf("making a payment")
|
||||
id, sk := primitives.InitializeEphemeralIdentity()
|
||||
client := new(tor.BaseOnionService)
|
||||
client.Init(acn, sk, &id)
|
||||
defer client.Shutdown()
|
||||
|
||||
tokenApplication := new(applications.TokenApplication)
|
||||
tokenApplication.TokenService = tokenService
|
||||
powTokenApp := new(applications.ApplicationChain).
|
||||
ChainApplication(new(applications.ProofOfWorkApplication), applications.SuccessfulProofOfWorkCapability).
|
||||
ChainApplication(tokenApplication, applications.HasTokensCapability)
|
||||
|
||||
log.Debugf("waiting for successful PoW auth...")
|
||||
tp := utils.TimeoutPolicy(time.Second * 30)
|
||||
err := tp.ExecuteAction(func() error {
|
||||
connected, err := client.Connect(tokenServiceOnion, powTokenApp)
|
||||
if connected && err == nil {
|
||||
log.Debugf("waiting for successful token acquisition...")
|
||||
conn, err := client.WaitForCapabilityOrClose(tokenServiceOnion, applications.HasTokensCapability)
|
||||
if err == nil {
|
||||
powtapp, ok := conn.App().(*applications.TokenApplication)
|
||||
if ok {
|
||||
log.Debugf("updating tokens")
|
||||
handler.NewTokenHandler(tokenServiceOnion, powtapp.Tokens)
|
||||
log.Debugf("transcript: %v", powtapp.Transcript().OutputTranscriptToAudit())
|
||||
conn.Close()
|
||||
return nil
|
||||
}
|
||||
log.Errorf("invalid cast of powapp. this should never happen %v %v", powtapp, reflect.TypeOf(conn.App()))
|
||||
return nil
|
||||
}
|
||||
return nil
|
||||
}
|
||||
return err
|
||||
})
|
||||
|
||||
// we timed out
|
||||
if err != nil {
|
||||
log.Debugf("make payment timeout...")
|
||||
return err
|
||||
}
|
||||
return err
|
||||
}
|
|
@ -1,195 +0,0 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/model"
|
||||
model2 "cwtch.im/cwtch/protocol/model"
|
||||
"encoding/json"
|
||||
"git.openprivacy.ca/cwtch.im/tapir"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/applications"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"sync/atomic"
|
||||
"time"
|
||||
)
|
||||
|
||||
const cwtchCapability = tapir.Capability("cwtchCapability")
|
||||
|
||||
// PeerApp encapsulates the behaviour of a Cwtch Peer
|
||||
type PeerApp struct {
|
||||
applications.AuthApp
|
||||
connection tapir.Connection
|
||||
MessageHandler func(string, string, string, []byte)
|
||||
IsBlocked func(string) bool
|
||||
IsAllowed func(string) bool
|
||||
OnAcknowledgement func(string, string)
|
||||
OnAuth func(string)
|
||||
OnClose func(string)
|
||||
OnConnecting func(string)
|
||||
OnSendMessage func(connection tapir.Connection, message []byte) error
|
||||
version atomic.Value
|
||||
}
|
||||
|
||||
type peerGetVal struct {
|
||||
Scope, Path string
|
||||
}
|
||||
|
||||
type peerRetVal struct {
|
||||
Val string
|
||||
Exists bool
|
||||
}
|
||||
|
||||
const Version1 = 0x01
|
||||
const Version2 = 0x02
|
||||
|
||||
// NewInstance should always return a new instantiation of the application.
|
||||
func (pa *PeerApp) NewInstance() tapir.Application {
|
||||
newApp := new(PeerApp)
|
||||
newApp.MessageHandler = pa.MessageHandler
|
||||
newApp.IsBlocked = pa.IsBlocked
|
||||
newApp.IsAllowed = pa.IsAllowed
|
||||
newApp.OnAcknowledgement = pa.OnAcknowledgement
|
||||
newApp.OnAuth = pa.OnAuth
|
||||
newApp.OnClose = pa.OnClose
|
||||
newApp.OnConnecting = pa.OnConnecting
|
||||
newApp.OnSendMessage = pa.OnSendMessage
|
||||
newApp.version.Store(Version1)
|
||||
return newApp
|
||||
}
|
||||
|
||||
// Init is run when the connection is first started.
|
||||
func (pa *PeerApp) Init(connection tapir.Connection) {
|
||||
// First run the Authentication App
|
||||
pa.AuthApp.Init(connection)
|
||||
|
||||
if connection.HasCapability(applications.AuthCapability) {
|
||||
|
||||
pa.connection = connection
|
||||
connection.SetCapability(cwtchCapability)
|
||||
|
||||
if pa.IsBlocked(connection.Hostname()) {
|
||||
pa.connection.Close()
|
||||
pa.OnClose(connection.Hostname())
|
||||
} else {
|
||||
|
||||
// we are authenticated
|
||||
// attempt to negotiate a more efficient packet format...
|
||||
// we are abusing the context here slightly by sending a "malformed" GetVal request.
|
||||
// as a rule cwtch ignores getval requests that it cannot deserialize so older clients will ignore this
|
||||
// message.
|
||||
// version *must* be the first message sent to prevent race conditions for other events fired after-auth
|
||||
// (e.g. getVal requests)
|
||||
// as such, we send this message before we update the rest of the system
|
||||
_ = pa.SendMessage(model2.PeerMessage{
|
||||
ID: event.ContextVersion,
|
||||
Context: event.ContextGetVal,
|
||||
Data: []byte{Version2},
|
||||
})
|
||||
|
||||
pa.OnAuth(connection.Hostname())
|
||||
go pa.listen()
|
||||
}
|
||||
} else {
|
||||
// The auth protocol wasn't completed, we can safely shutdown the connection
|
||||
// send an onclose here because we *may* have triggered this and we want to retry later...
|
||||
pa.OnClose(connection.Hostname())
|
||||
connection.Close()
|
||||
}
|
||||
}
|
||||
|
||||
func (pa *PeerApp) listen() {
|
||||
for {
|
||||
message := pa.connection.Expect()
|
||||
if len(message) == 0 {
|
||||
log.Debugf("0 byte read, socket has likely failed. Closing the listen goroutine")
|
||||
pa.OnClose(pa.connection.Hostname())
|
||||
return
|
||||
}
|
||||
|
||||
var packet model2.PeerMessage
|
||||
var err error
|
||||
|
||||
if pa.version.Load() == Version1 {
|
||||
err = json.Unmarshal(message, &packet)
|
||||
} else if pa.version.Load() == Version2 {
|
||||
parsePacket, parseErr := model2.ParsePeerMessage(message)
|
||||
// if all else fails...attempt to process this message as a version 1 message
|
||||
if parseErr != nil {
|
||||
err = json.Unmarshal(message, &packet)
|
||||
} else {
|
||||
packet = *parsePacket
|
||||
}
|
||||
|
||||
} else {
|
||||
log.Errorf("invalid version")
|
||||
pa.OnClose(pa.connection.Hostname())
|
||||
return
|
||||
}
|
||||
|
||||
if err == nil {
|
||||
if pa.IsAllowed(pa.connection.Hostname()) {
|
||||
// we don't expose im.cwtch.version messages outside of PeerApp (ideally at some point in the future we
|
||||
// can remove this check all together)
|
||||
if packet.ID == event.ContextVersion {
|
||||
if pa.version.Load() == Version1 && len(packet.Data) == 1 && packet.Data[0] == Version2 {
|
||||
log.Debugf("switching to protocol version 2")
|
||||
pa.version.Store(Version2)
|
||||
}
|
||||
} else {
|
||||
if cm, err := model.DeserializeMessage(string(packet.Data)); err == nil {
|
||||
if cm.TransitTime != nil {
|
||||
rt := time.Now().UTC()
|
||||
cm.RecvTime = &rt
|
||||
data, _ := json.Marshal(cm)
|
||||
packet.Data = data
|
||||
}
|
||||
}
|
||||
pa.MessageHandler(pa.connection.Hostname(), packet.ID, packet.Context, packet.Data)
|
||||
}
|
||||
}
|
||||
} else {
|
||||
log.Errorf("Error unmarshalling PeerMessage package: %x %v", message, err)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// SendMessage sends the peer a preformatted message
|
||||
// NOTE: This is a stub, we will likely want to extend this to better reflect the desired protocol
|
||||
func (pa *PeerApp) SendMessage(message model2.PeerMessage) error {
|
||||
var serialized []byte
|
||||
var err error
|
||||
|
||||
if cm, err := model.DeserializeMessage(string(message.Data)); err == nil {
|
||||
if cm.SendTime != nil {
|
||||
tt := time.Now().UTC()
|
||||
cm.TransitTime = &tt
|
||||
data, _ := json.Marshal(cm)
|
||||
message.Data = data
|
||||
}
|
||||
}
|
||||
|
||||
if pa.version.Load() == Version2 {
|
||||
// treat data as a pre-serialized string, not as a byte array (which will be base64 encoded and bloat the packet size)
|
||||
serialized = message.Serialize()
|
||||
} else {
|
||||
serialized, err = json.Marshal(message)
|
||||
}
|
||||
|
||||
if err == nil {
|
||||
err = pa.OnSendMessage(pa.connection, serialized)
|
||||
|
||||
// at this point we have tried to send a message to a peer only to find that something went wrong.
|
||||
// we don't know *what* went wrong - the most likely explanation is the peer went offline in the time between
|
||||
// sending the message and it arriving in the engine to be sent. Other explanations include problems with Tor,
|
||||
// a dropped wifi connection.
|
||||
// Regardless, we error out this message and close this peer app assuming it cannot be used again.
|
||||
// We expect that cwtch will eventually recreate this connection and the app.
|
||||
if err != nil {
|
||||
// close any associated sockets
|
||||
pa.connection.Close()
|
||||
// tell cwtch this connection is no longer valid
|
||||
pa.OnClose(err.Error())
|
||||
}
|
||||
return err
|
||||
}
|
||||
return err
|
||||
}
|
|
@ -1,54 +0,0 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"errors"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives/privacypass"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"sync"
|
||||
)
|
||||
|
||||
// TokenManager maintains a list of tokens associated with a single TokenServer
|
||||
type TokenManager struct {
|
||||
lock sync.Mutex
|
||||
tokens map[string]*privacypass.Token
|
||||
}
|
||||
|
||||
func NewTokenManager() *TokenManager {
|
||||
tm := new(TokenManager)
|
||||
tm.tokens = make(map[string]*privacypass.Token)
|
||||
return tm
|
||||
}
|
||||
|
||||
// StoreNewTokens adds tokens to the internal list managed by this TokenManager
|
||||
func (tm *TokenManager) StoreNewTokens(tokens []*privacypass.Token) {
|
||||
tm.lock.Lock()
|
||||
defer tm.lock.Unlock()
|
||||
log.Debugf("acquired %v new tokens", tokens)
|
||||
for _, token := range tokens {
|
||||
serialized, _ := json.Marshal(token)
|
||||
tm.tokens[string(serialized)] = token
|
||||
}
|
||||
}
|
||||
|
||||
// NumTokens returns the current number of tokens
|
||||
func (tm *TokenManager) NumTokens() int {
|
||||
tm.lock.Lock()
|
||||
defer tm.lock.Unlock()
|
||||
return len(tm.tokens)
|
||||
}
|
||||
|
||||
// FetchToken removes a token from the internal list and returns it, along with a count of the remaining tokens.
|
||||
// Errors if no tokens available.
|
||||
func (tm *TokenManager) FetchToken() (*privacypass.Token, int, error) {
|
||||
tm.lock.Lock()
|
||||
defer tm.lock.Unlock()
|
||||
if len(tm.tokens) == 0 {
|
||||
return nil, 0, errors.New("no more tokens")
|
||||
}
|
||||
for serializedToken, token := range tm.tokens {
|
||||
delete(tm.tokens, serializedToken)
|
||||
return token, len(tm.tokens), nil
|
||||
}
|
||||
return nil, 0, errors.New("no more tokens")
|
||||
}
|
|
@ -1,204 +0,0 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol/groups"
|
||||
"encoding/json"
|
||||
"git.openprivacy.ca/cwtch.im/tapir"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/applications"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives/privacypass"
|
||||
"git.openprivacy.ca/openprivacy/connectivity"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"github.com/gtank/ristretto255"
|
||||
"sync"
|
||||
)
|
||||
|
||||
// TokenBoardHandler encapsulates all the various handlers a client needs to interact with a token board
|
||||
// this includes handlers to receive new messages, as well as handlers to manage tokens.
|
||||
type TokenBoardHandler interface {
|
||||
GroupMessageHandler(server string, gm *groups.EncryptedGroupMessage)
|
||||
ServerAuthedHandler(server string)
|
||||
ServerSyncedHandler(server string)
|
||||
ServerClosedHandler(server string)
|
||||
NewTokenHandler(tokenService string, tokens []*privacypass.Token)
|
||||
PostingFailed(server string, sig []byte)
|
||||
FetchToken(tokenService string) (*privacypass.Token, int, error)
|
||||
}
|
||||
|
||||
// NewTokenBoardClient generates a new Client for Token Board
|
||||
func NewTokenBoardClient(acn connectivity.ACN, Y *ristretto255.Element, tokenServiceOnion string, lastKnownSignature []byte, tokenBoardHandler TokenBoardHandler) tapir.Application {
|
||||
tba := new(TokenBoardClient)
|
||||
tba.acn = acn
|
||||
tba.tokenService = privacypass.NewTokenServer()
|
||||
tba.tokenService.Y = Y
|
||||
tba.tokenServiceOnion = tokenServiceOnion
|
||||
tba.tokenBoardHandler = tokenBoardHandler
|
||||
tba.lastKnownSignature = lastKnownSignature
|
||||
return tba
|
||||
}
|
||||
|
||||
// TokenBoardClient defines a client for the TokenBoard server
|
||||
type TokenBoardClient struct {
|
||||
applications.AuthApp
|
||||
connection tapir.Connection
|
||||
tokenBoardHandler TokenBoardHandler
|
||||
|
||||
// Token service handling
|
||||
acn connectivity.ACN
|
||||
|
||||
tokenService *privacypass.TokenServer
|
||||
tokenServiceOnion string
|
||||
lastKnownSignature []byte
|
||||
|
||||
postLock sync.Mutex
|
||||
postQueue []groups.CachedEncryptedGroupMessage
|
||||
}
|
||||
|
||||
// NewInstance Client a new TokenBoardApp
|
||||
func (ta *TokenBoardClient) NewInstance() tapir.Application {
|
||||
tba := new(TokenBoardClient)
|
||||
tba.tokenBoardHandler = ta.tokenBoardHandler
|
||||
tba.acn = ta.acn
|
||||
tba.tokenService = ta.tokenService
|
||||
tba.tokenServiceOnion = ta.tokenServiceOnion
|
||||
tba.lastKnownSignature = ta.lastKnownSignature
|
||||
return tba
|
||||
}
|
||||
|
||||
// Init initializes the cryptographic TokenBoardApp
|
||||
func (ta *TokenBoardClient) Init(connection tapir.Connection) {
|
||||
// connection.Hostname is always valid because we are ALWAYS the initiating party
|
||||
log.Debugf("connecting to server: %v", connection.Hostname())
|
||||
ta.AuthApp.Init(connection)
|
||||
log.Debugf("server protocol complete: %v", connection.Hostname())
|
||||
if connection.HasCapability(applications.AuthCapability) {
|
||||
log.Debugf("Successfully Initialized Connection to %v", connection.Hostname())
|
||||
ta.connection = connection
|
||||
ta.tokenBoardHandler.ServerAuthedHandler(connection.Hostname())
|
||||
go ta.Listen()
|
||||
// Optimistically acquire many tokens for this server...
|
||||
go ta.PurchaseTokens()
|
||||
go ta.PurchaseTokens()
|
||||
ta.Replay()
|
||||
} else {
|
||||
log.Debugf("Error Connecting to %v", connection.Hostname())
|
||||
ta.tokenBoardHandler.ServerClosedHandler(connection.Hostname())
|
||||
connection.Close()
|
||||
}
|
||||
}
|
||||
|
||||
// Listen processes the messages for this application
|
||||
func (ta *TokenBoardClient) Listen() {
|
||||
for {
|
||||
log.Debugf("Client waiting...")
|
||||
data := ta.connection.Expect()
|
||||
if len(data) == 0 {
|
||||
log.Debugf("Server closed the connection...")
|
||||
ta.tokenBoardHandler.ServerClosedHandler(ta.connection.Hostname())
|
||||
return // connection is closed
|
||||
}
|
||||
|
||||
// We always expect the server to follow protocol, and the second it doesn't we close the connection
|
||||
var message groups.Message
|
||||
if err := json.Unmarshal(data, &message); err != nil {
|
||||
log.Debugf("Server sent an unexpected message, closing the connection: %v", err)
|
||||
ta.tokenBoardHandler.ServerClosedHandler(ta.connection.Hostname())
|
||||
ta.connection.Close()
|
||||
return
|
||||
}
|
||||
|
||||
switch message.MessageType {
|
||||
case groups.NewMessageMessage:
|
||||
if message.NewMessage != nil {
|
||||
ta.tokenBoardHandler.GroupMessageHandler(ta.connection.Hostname(), &message.NewMessage.EGM)
|
||||
} else {
|
||||
log.Debugf("Server sent an unexpected NewMessage, closing the connection: %s", data)
|
||||
ta.tokenBoardHandler.ServerClosedHandler(ta.connection.Hostname())
|
||||
ta.connection.Close()
|
||||
return
|
||||
}
|
||||
case groups.PostResultMessage:
|
||||
ta.postLock.Lock()
|
||||
egm := ta.postQueue[0]
|
||||
ta.postQueue = ta.postQueue[1:]
|
||||
ta.postLock.Unlock()
|
||||
if !message.PostResult.Success {
|
||||
log.Debugf("post result message: %v", message.PostResult)
|
||||
// Retry using another token
|
||||
posted, _ := ta.Post(egm.Group, egm.Ciphertext, egm.Signature)
|
||||
// if posting failed...
|
||||
if !posted {
|
||||
log.Errorf("error posting message")
|
||||
ta.tokenBoardHandler.PostingFailed(egm.Group, egm.Signature)
|
||||
}
|
||||
}
|
||||
case groups.ReplayResultMessage:
|
||||
if message.ReplayResult != nil {
|
||||
log.Debugf("Replaying %v Messages...", message.ReplayResult.NumMessages)
|
||||
for i := 0; i < message.ReplayResult.NumMessages; i++ {
|
||||
data := ta.connection.Expect()
|
||||
|
||||
if len(data) == 0 {
|
||||
log.Debugf("Server sent an unexpected EncryptedGroupMessage, closing the connection")
|
||||
ta.tokenBoardHandler.ServerClosedHandler(ta.connection.Hostname())
|
||||
ta.connection.Close()
|
||||
return
|
||||
}
|
||||
|
||||
egm := &groups.EncryptedGroupMessage{}
|
||||
if err := json.Unmarshal(data, egm); err == nil {
|
||||
ta.tokenBoardHandler.GroupMessageHandler(ta.connection.Hostname(), egm)
|
||||
ta.lastKnownSignature = egm.Signature
|
||||
} else {
|
||||
log.Debugf("Server sent an unexpected EncryptedGroupMessage, closing the connection: %v", err)
|
||||
ta.tokenBoardHandler.ServerClosedHandler(ta.connection.Hostname())
|
||||
ta.connection.Close()
|
||||
return
|
||||
}
|
||||
}
|
||||
ta.tokenBoardHandler.ServerSyncedHandler(ta.connection.Hostname())
|
||||
ta.connection.SetCapability(groups.CwtchServerSyncedCapability)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Replay posts a Replay Message to the server.
|
||||
func (ta *TokenBoardClient) Replay() {
|
||||
data, _ := json.Marshal(groups.Message{MessageType: groups.ReplayRequestMessage, ReplayRequest: &groups.ReplayRequest{LastCommit: ta.lastKnownSignature}})
|
||||
ta.connection.Send(data)
|
||||
}
|
||||
|
||||
// PurchaseTokens purchases the given number of tokens from the server (using the provided payment handler)
|
||||
func (ta *TokenBoardClient) PurchaseTokens() {
|
||||
MakePayment(ta.tokenServiceOnion, ta.tokenService, ta.acn, ta.tokenBoardHandler)
|
||||
}
|
||||
|
||||
// Post sends a Post Request to the server
|
||||
func (ta *TokenBoardClient) Post(group string, ct []byte, sig []byte) (bool, int) {
|
||||
egm := groups.EncryptedGroupMessage{Ciphertext: ct, Signature: sig}
|
||||
token, numTokens, err := ta.NextToken(egm.ToBytes(), ta.connection.Hostname())
|
||||
if err == nil {
|
||||
data, _ := json.Marshal(groups.Message{MessageType: groups.PostRequestMessage, PostRequest: &groups.PostRequest{EGM: egm, Token: token}})
|
||||
ta.postLock.Lock()
|
||||
// ONLY put group in the EGM as a cache / for error reporting...
|
||||
ta.postQueue = append(ta.postQueue, groups.CachedEncryptedGroupMessage{Group: group, EncryptedGroupMessage: egm})
|
||||
log.Debugf("Message Length: %s %v", data, len(data))
|
||||
err := ta.connection.Send(data)
|
||||
ta.postLock.Unlock()
|
||||
if err != nil {
|
||||
return false, numTokens
|
||||
}
|
||||
return true, numTokens
|
||||
}
|
||||
log.Debugf("No Valid Tokens: %v", err)
|
||||
return false, numTokens
|
||||
}
|
||||
|
||||
// NextToken retrieves the next token
|
||||
func (ta *TokenBoardClient) NextToken(data []byte, hostname string) (privacypass.SpentToken, int, error) {
|
||||
token, numtokens, err := ta.tokenBoardHandler.FetchToken(ta.tokenServiceOnion)
|
||||
if err != nil {
|
||||
return privacypass.SpentToken{}, numtokens, err
|
||||
}
|
||||
return token.SpendToken(append(data, hostname...)), numtokens, nil
|
||||
}
|
|
@ -0,0 +1,135 @@
|
|||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// source: cwtch-profile.proto
|
||||
|
||||
/*
|
||||
Package protocol is a generated protocol buffer package.
|
||||
|
||||
It is generated from these files:
|
||||
cwtch-profile.proto
|
||||
|
||||
It has these top-level messages:
|
||||
CwtchPeerPacket
|
||||
CwtchIdentity
|
||||
GroupChatInvite
|
||||
*/
|
||||
package protocol
|
||||
|
||||
import proto "github.com/golang/protobuf/proto"
|
||||
import fmt "fmt"
|
||||
import math "math"
|
||||
|
||||
// Reference imports to suppress errors if they are not otherwise used.
|
||||
var _ = proto.Marshal
|
||||
var _ = fmt.Errorf
|
||||
var _ = math.Inf
|
||||
|
||||
// This is a compile-time assertion to ensure that this generated file
|
||||
// is compatible with the proto package it is being compiled against.
|
||||
// A compilation error at this line likely means your copy of the
|
||||
// proto package needs to be updated.
|
||||
const _ = proto.ProtoPackageIsVersion2 // please upgrade the proto package
|
||||
|
||||
type CwtchPeerPacket struct {
|
||||
CwtchIdentify *CwtchIdentity `protobuf:"bytes,1,opt,name=cwtch_identify,json=cwtchIdentify" json:"cwtch_identify,omitempty"`
|
||||
GroupChatInvite *GroupChatInvite `protobuf:"bytes,2,opt,name=group_chat_invite,json=groupChatInvite" json:"group_chat_invite,omitempty"`
|
||||
}
|
||||
|
||||
func (m *CwtchPeerPacket) Reset() { *m = CwtchPeerPacket{} }
|
||||
func (m *CwtchPeerPacket) String() string { return proto.CompactTextString(m) }
|
||||
func (*CwtchPeerPacket) ProtoMessage() {}
|
||||
func (*CwtchPeerPacket) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{0} }
|
||||
|
||||
func (m *CwtchPeerPacket) GetCwtchIdentify() *CwtchIdentity {
|
||||
if m != nil {
|
||||
return m.CwtchIdentify
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *CwtchPeerPacket) GetGroupChatInvite() *GroupChatInvite {
|
||||
if m != nil {
|
||||
return m.GroupChatInvite
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
type CwtchIdentity struct {
|
||||
Name string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"`
|
||||
Ed25519PublicKey []byte `protobuf:"bytes,2,opt,name=ed25519_public_key,json=ed25519PublicKey,proto3" json:"ed25519_public_key,omitempty"`
|
||||
}
|
||||
|
||||
func (m *CwtchIdentity) Reset() { *m = CwtchIdentity{} }
|
||||
func (m *CwtchIdentity) String() string { return proto.CompactTextString(m) }
|
||||
func (*CwtchIdentity) ProtoMessage() {}
|
||||
func (*CwtchIdentity) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{1} }
|
||||
|
||||
func (m *CwtchIdentity) GetName() string {
|
||||
if m != nil {
|
||||
return m.Name
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
func (m *CwtchIdentity) GetEd25519PublicKey() []byte {
|
||||
if m != nil {
|
||||
return m.Ed25519PublicKey
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// [name] has invited you to join a group chat: [message]
|
||||
type GroupChatInvite struct {
|
||||
GroupName string `protobuf:"bytes,1,opt,name=group_name,json=groupName" json:"group_name,omitempty"`
|
||||
GroupSharedKey []byte `protobuf:"bytes,2,opt,name=group_shared_key,json=groupSharedKey,proto3" json:"group_shared_key,omitempty"`
|
||||
ServerHost string `protobuf:"bytes,3,opt,name=server_host,json=serverHost" json:"server_host,omitempty"`
|
||||
SignedGroupId []byte `protobuf:"bytes,4,opt,name=signed_group_id,json=signedGroupId,proto3" json:"signed_group_id,omitempty"`
|
||||
InitialMessage []byte `protobuf:"bytes,5,opt,name=initial_message,json=initialMessage,proto3" json:"initial_message,omitempty"`
|
||||
}
|
||||
|
||||
func (m *GroupChatInvite) Reset() { *m = GroupChatInvite{} }
|
||||
func (m *GroupChatInvite) String() string { return proto.CompactTextString(m) }
|
||||
func (*GroupChatInvite) ProtoMessage() {}
|
||||
func (*GroupChatInvite) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{2} }
|
||||
|
||||
func (m *GroupChatInvite) GetGroupName() string {
|
||||
if m != nil {
|
||||
return m.GroupName
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
func (m *GroupChatInvite) GetGroupSharedKey() []byte {
|
||||
if m != nil {
|
||||
return m.GroupSharedKey
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *GroupChatInvite) GetServerHost() string {
|
||||
if m != nil {
|
||||
return m.ServerHost
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
func (m *GroupChatInvite) GetSignedGroupId() []byte {
|
||||
if m != nil {
|
||||
return m.SignedGroupId
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *GroupChatInvite) GetInitialMessage() []byte {
|
||||
if m != nil {
|
||||
return m.InitialMessage
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func init() {
|
||||
proto.RegisterType((*CwtchPeerPacket)(nil), "protocol.CwtchPeerPacket")
|
||||
proto.RegisterType((*CwtchIdentity)(nil), "protocol.CwtchIdentity")
|
||||
proto.RegisterType((*GroupChatInvite)(nil), "protocol.GroupChatInvite")
|
||||
}
|
||||
|
||||
func init() { proto.RegisterFile("cwtch-profile.proto", fileDescriptor0) }
|
|
@ -0,0 +1,21 @@
|
|||
syntax = "proto3";
|
||||
package protocol;
|
||||
|
||||
message CwtchPeerPacket {
|
||||
CwtchIdentity cwtch_identify = 1;
|
||||
GroupChatInvite group_chat_invite = 2;
|
||||
}
|
||||
|
||||
message CwtchIdentity {
|
||||
string name = 1;
|
||||
bytes ed25519_public_key = 2;
|
||||
}
|
||||
|
||||
// [name] has invited you to join a group chat: [message]
|
||||
message GroupChatInvite {
|
||||
string group_name = 1;
|
||||
bytes group_shared_key = 2;
|
||||
string server_host = 3;
|
||||
bytes signed_group_id = 4;
|
||||
bytes initial_message = 5;
|
||||
}
|
|
@ -1,87 +0,0 @@
|
|||
package files
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"fmt"
|
||||
"strconv"
|
||||
"strings"
|
||||
)
|
||||
|
||||
// ChunkSpec is a wrapper around an uncompressed array of chunk identifiers
|
||||
type ChunkSpec []uint64
|
||||
|
||||
// CreateChunkSpec given a full list of chunks with their downloaded status (true for downloaded, false otherwise)
|
||||
// derives a list of identifiers of chunks that have not been downloaded yet
|
||||
func CreateChunkSpec(progress []bool) ChunkSpec {
|
||||
chunks := ChunkSpec{}
|
||||
for i, p := range progress {
|
||||
if !p {
|
||||
chunks = append(chunks, uint64(i))
|
||||
}
|
||||
}
|
||||
return chunks
|
||||
}
|
||||
|
||||
// Deserialize takes in a compressed chunk spec and returns an uncompressed ChunkSpec or an error
|
||||
// if the serialized chunk spec has format errors
|
||||
func Deserialize(serialized string) (*ChunkSpec, error) {
|
||||
|
||||
var chunkSpec ChunkSpec
|
||||
|
||||
if len(serialized) == 0 {
|
||||
return &chunkSpec, nil
|
||||
}
|
||||
|
||||
ranges := strings.Split(serialized, ",")
|
||||
for _, r := range ranges {
|
||||
parts := strings.Split(r, ":")
|
||||
if len(parts) == 1 {
|
||||
single, err := strconv.Atoi(r)
|
||||
if err != nil {
|
||||
return nil, errors.New("invalid chunk spec")
|
||||
}
|
||||
chunkSpec = append(chunkSpec, uint64(single))
|
||||
} else if len(parts) == 2 {
|
||||
start, err1 := strconv.Atoi(parts[0])
|
||||
end, err2 := strconv.Atoi(parts[1])
|
||||
if err1 != nil || err2 != nil {
|
||||
return nil, errors.New("invalid chunk spec")
|
||||
}
|
||||
for i := start; i <= end; i++ {
|
||||
chunkSpec = append(chunkSpec, uint64(i))
|
||||
}
|
||||
} else {
|
||||
return nil, errors.New("invalid chunk spec")
|
||||
}
|
||||
}
|
||||
return &chunkSpec, nil
|
||||
}
|
||||
|
||||
// Serialize compresses the ChunkSpec into a list of inclusive ranges e.g. 1,2,3,5,6,7 becomes "1:3,5:7"
|
||||
func (cs ChunkSpec) Serialize() string {
|
||||
result := ""
|
||||
|
||||
i := 0
|
||||
|
||||
for {
|
||||
if i >= len(cs) {
|
||||
break
|
||||
}
|
||||
j := i + 1
|
||||
for ; j < len(cs) && cs[j] == cs[j-1]+1; j++ {
|
||||
}
|
||||
|
||||
if result != "" {
|
||||
result += ","
|
||||
}
|
||||
|
||||
if j == i+1 {
|
||||
result += fmt.Sprintf("%d", cs[i])
|
||||
} else {
|
||||
result += fmt.Sprintf("%d:%d", cs[i], cs[j-1])
|
||||
}
|
||||
i = j
|
||||
}
|
||||
|
||||
return result
|
||||
}
|
|
@ -1,37 +0,0 @@
|
|||
package files
|
||||
|
||||
import "testing"
|
||||
|
||||
func TestChunkSpec(t *testing.T) {
|
||||
|
||||
var testCases = map[string]ChunkSpec{
|
||||
"0": CreateChunkSpec([]bool{false}),
|
||||
"0:10": CreateChunkSpec([]bool{false, false, false, false, false, false, false, false, false, false, false}),
|
||||
"0:1,3:5,7:9": CreateChunkSpec([]bool{false, false, true, false, false, false, true, false, false, false, true}),
|
||||
"": CreateChunkSpec([]bool{true, true, true, true, true, true, true, true, true, true, true}),
|
||||
"2,5,8,10": CreateChunkSpec([]bool{true, true, false, true, true, false, true, true, false, true, false}),
|
||||
//
|
||||
"0,2:10": CreateChunkSpec([]bool{false, true, false, false, false, false, false, false, false, false, false}),
|
||||
"0:8,10": CreateChunkSpec([]bool{false, false, false, false, false, false, false, false, false, true, false}),
|
||||
"1:9": CreateChunkSpec([]bool{true, false, false, false, false, false, false, false, false, false, true}),
|
||||
}
|
||||
|
||||
for k, v := range testCases {
|
||||
if k != v.Serialize() {
|
||||
t.Fatalf("got %v but expected %v", v.Serialize(), k)
|
||||
}
|
||||
t.Logf("%v == %v", k, v.Serialize())
|
||||
}
|
||||
|
||||
for k, v := range testCases {
|
||||
if cs, err := Deserialize(k); err != nil {
|
||||
t.Fatalf("error deserialized key: %v %v", k, err)
|
||||
} else {
|
||||
if v.Serialize() != cs.Serialize() {
|
||||
t.Fatalf("got %v but expected %v", v.Serialize(), cs.Serialize())
|
||||
}
|
||||
t.Logf("%v == %v", cs.Serialize(), v.Serialize())
|
||||
}
|
||||
}
|
||||
|
||||
}
|
|
@ -1,249 +0,0 @@
|
|||
package files
|
||||
|
||||
import (
|
||||
"encoding/hex"
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
path "path/filepath"
|
||||
"strconv"
|
||||
"strings"
|
||||
"sync"
|
||||
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/protocol/model"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
)
|
||||
|
||||
// FileSharingSubSystem encapsulates the functionality necessary to share and download files via Cwtch
|
||||
type FileSharingSubSystem struct {
|
||||
|
||||
// for sharing files
|
||||
activeShares sync.Map // file key to manifest
|
||||
|
||||
// for downloading files
|
||||
prospectiveManifests sync.Map // file key to serialized manifests
|
||||
activeDownloads sync.Map // file key to manifests
|
||||
}
|
||||
|
||||
// ShareFile given a file key and a serialized manifest, allow the serialized manifest to be downloaded
|
||||
// by Cwtch profiles in possession of the fileKey
|
||||
func (fsss *FileSharingSubSystem) ShareFile(fileKey string, serializedManifest string) {
|
||||
var manifest Manifest
|
||||
err := json.Unmarshal([]byte(serializedManifest), &manifest)
|
||||
if err != nil {
|
||||
log.Errorf("could not share file %v", err)
|
||||
return
|
||||
}
|
||||
log.Debugf("sharing file: %v %v", fileKey, serializedManifest)
|
||||
fsss.activeShares.Store(fileKey, &manifest)
|
||||
}
|
||||
|
||||
// StopFileShare given a file key removes the serialized manifest from consideration by the file sharing
|
||||
// subsystem. Future requests on this manifest will fail, as will any in-progress chunk requests.
|
||||
func (fsss *FileSharingSubSystem) StopFileShare(fileKey string) {
|
||||
fsss.activeShares.Delete(fileKey)
|
||||
}
|
||||
|
||||
// StopAllFileShares removes all active file shares from consideration
|
||||
func (fsss *FileSharingSubSystem) StopAllFileShares() {
|
||||
fsss.activeShares.Range(func(key, value interface{}) bool {
|
||||
fsss.activeShares.Delete(key)
|
||||
return true
|
||||
})
|
||||
}
|
||||
|
||||
// FetchManifest given a file key and knowledge of the manifest size in chunks (obtained via an attribute lookup)
|
||||
// construct a request to download the manifest.
|
||||
func (fsss *FileSharingSubSystem) FetchManifest(fileKey string, manifestSize uint64) model.PeerMessage {
|
||||
fsss.prospectiveManifests.Store(fileKey, strings.Repeat("\"", int(manifestSize*DefaultChunkSize)))
|
||||
return model.PeerMessage{
|
||||
Context: event.ContextRequestManifest,
|
||||
ID: fileKey,
|
||||
Data: []byte{},
|
||||
}
|
||||
}
|
||||
|
||||
// CompileChunkRequests takes in a complete serializedManifest and returns a set of chunk request messages
|
||||
// TODO in the future we will want this to return the handles of contacts to request chunks from
|
||||
func (fsss *FileSharingSubSystem) CompileChunkRequests(fileKey, serializedManifest, tempFile, title string) []model.PeerMessage {
|
||||
var manifest Manifest
|
||||
err := json.Unmarshal([]byte(serializedManifest), &manifest)
|
||||
var messages []model.PeerMessage
|
||||
if err == nil {
|
||||
manifest.TempFileName = tempFile
|
||||
manifest.Title = title
|
||||
err := manifest.PrepareDownload()
|
||||
if err == nil {
|
||||
fsss.activeDownloads.Store(fileKey, &manifest)
|
||||
log.Debugf("downloading file chunks: %v", manifest.GetChunkRequest().Serialize())
|
||||
messages = append(messages, model.PeerMessage{
|
||||
ID: fileKey,
|
||||
Context: event.ContextRequestFile,
|
||||
Data: []byte(manifest.GetChunkRequest().Serialize()),
|
||||
})
|
||||
} else {
|
||||
log.Errorf("couldn't prepare download: %v", err)
|
||||
}
|
||||
}
|
||||
return messages
|
||||
}
|
||||
|
||||
// RequestManifestParts given a fileKey construct a set of messages representing requests to download various
|
||||
// parts of the Manifest
|
||||
func (fsss *FileSharingSubSystem) RequestManifestParts(fileKey string) []model.PeerMessage {
|
||||
manifestI, exists := fsss.activeShares.Load(fileKey)
|
||||
var messages []model.PeerMessage
|
||||
if exists {
|
||||
oldManifest := manifestI.(*Manifest)
|
||||
serializedOldManifest := oldManifest.Serialize()
|
||||
log.Debugf("found serialized manifest")
|
||||
|
||||
// copy so we dont get threading issues by modifying the original
|
||||
// and then redact the file path before sending
|
||||
// nb: manifest.size has already been corrected elsewhere
|
||||
var manifest Manifest
|
||||
json.Unmarshal([]byte(serializedOldManifest), &manifest)
|
||||
manifest.FileName = path.Base(manifest.FileName)
|
||||
serializedManifest := manifest.Serialize()
|
||||
|
||||
chunkID := 0
|
||||
for i := 0; i < len(serializedManifest); i += DefaultChunkSize {
|
||||
offset := i
|
||||
end := i + DefaultChunkSize
|
||||
// truncate end
|
||||
if end > len(serializedManifest) {
|
||||
end = len(serializedManifest)
|
||||
}
|
||||
chunk := serializedManifest[offset:end]
|
||||
// request this manifest part
|
||||
messages = append(messages, model.PeerMessage{
|
||||
Context: event.ContextSendManifest,
|
||||
ID: fmt.Sprintf("%s.%d", fileKey, chunkID),
|
||||
Data: chunk,
|
||||
})
|
||||
chunkID++
|
||||
}
|
||||
}
|
||||
return messages
|
||||
}
|
||||
|
||||
// ReceiveManifestPart given a manifestKey reconstruct part the manifest from the provided part
|
||||
func (fsss *FileSharingSubSystem) ReceiveManifestPart(manifestKey string, part []byte) (fileKey string, serializedManifest string) {
|
||||
fileKeyParts := strings.Split(manifestKey, ".")
|
||||
if len(fileKeyParts) == 3 { // rootHash.nonce.manifestPart
|
||||
fileKey = fmt.Sprintf("%s.%s", fileKeyParts[0], fileKeyParts[1])
|
||||
log.Debugf("manifest filekey: %s", fileKey)
|
||||
manifestPart, err := strconv.Atoi(fileKeyParts[2])
|
||||
if err == nil {
|
||||
serializedManifest, exists := fsss.prospectiveManifests.Load(fileKey)
|
||||
if exists {
|
||||
serializedManifest := serializedManifest.(string)
|
||||
log.Debugf("loaded manifest")
|
||||
offset := manifestPart * DefaultChunkSize
|
||||
end := (manifestPart + 1) * DefaultChunkSize
|
||||
|
||||
log.Debugf("storing manifest part %v %v", offset, end)
|
||||
serializedManifestBytes := []byte(serializedManifest)
|
||||
if len(serializedManifestBytes) > offset && len(serializedManifestBytes) >= end {
|
||||
copy(serializedManifestBytes[offset:end], part[:])
|
||||
|
||||
if len(part) < DefaultChunkSize {
|
||||
serializedManifestBytes = serializedManifestBytes[0 : len(serializedManifestBytes)-(DefaultChunkSize-len(part))]
|
||||
}
|
||||
|
||||
serializedManifest = string(serializedManifestBytes)
|
||||
fsss.prospectiveManifests.Store(fileKey, serializedManifest)
|
||||
log.Debugf("current manifest: [%s]", serializedManifest)
|
||||
var manifest Manifest
|
||||
err := json.Unmarshal([]byte(serializedManifest), &manifest)
|
||||
if err == nil && hex.EncodeToString(manifest.RootHash) == fileKeyParts[0] {
|
||||
log.Debugf("valid manifest received! %x", manifest.RootHash)
|
||||
return fileKey, serializedManifest
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
return "", ""
|
||||
}
|
||||
|
||||
// ProcessChunkRequest given a fileKey, and a chunk request, compile a set of responses for each requested Chunk
|
||||
func (fsss *FileSharingSubSystem) ProcessChunkRequest(fileKey string, serializedChunkRequest []byte) []model.PeerMessage {
|
||||
log.Debugf("chunk request: %v", fileKey)
|
||||
// fileKey is rootHash.nonce
|
||||
manifestI, exists := fsss.activeShares.Load(fileKey)
|
||||
var messages []model.PeerMessage
|
||||
if exists {
|
||||
manifest := manifestI.(*Manifest)
|
||||
log.Debugf("manifest found: %x", manifest.RootHash)
|
||||
chunkSpec, err := Deserialize(string(serializedChunkRequest))
|
||||
log.Debugf("deserialized chunk spec found: %v [%s]", chunkSpec, serializedChunkRequest)
|
||||
if err == nil {
|
||||
for _, chunk := range *chunkSpec {
|
||||
contents, err := manifest.GetChunkBytes(chunk)
|
||||
if err == nil {
|
||||
log.Debugf("sending chunk: %v %x", chunk, contents)
|
||||
messages = append(messages, model.PeerMessage{
|
||||
ID: fmt.Sprintf("%v.%d", fileKey, chunk),
|
||||
Context: event.ContextSendFile,
|
||||
Data: contents,
|
||||
})
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
return messages
|
||||
}
|
||||
|
||||
// ProcessChunk given a chunk key and a chunk attempt to store and verify the chunk as part of an active download
|
||||
// If this results in the file download being completed return downloaded = true
|
||||
// Always return the progress of a matched download if it exists along with the total number of chunks and the
|
||||
// given chunk ID
|
||||
// If not such active download exists then return an empty file key and ignore all further processing.
|
||||
func (fsss *FileSharingSubSystem) ProcessChunk(chunkKey string, chunk []byte) (fileKey string, progress uint64, totalChunks uint64, chunkID uint64, title string) {
|
||||
fileKeyParts := strings.Split(chunkKey, ".")
|
||||
log.Debugf("got chunk for %s", fileKeyParts)
|
||||
if len(fileKeyParts) == 3 { // fileKey is rootHash.nonce.chunk
|
||||
// recalculate file key
|
||||
fileKey = fmt.Sprintf("%s.%s", fileKeyParts[0], fileKeyParts[1])
|
||||
derivedChunkID, err := strconv.Atoi(fileKeyParts[2])
|
||||
if err == nil {
|
||||
chunkID = uint64(derivedChunkID)
|
||||
log.Debugf("got chunk id %d", chunkID)
|
||||
manifestI, exists := fsss.activeDownloads.Load(fileKey)
|
||||
if exists {
|
||||
manifest := manifestI.(*Manifest)
|
||||
totalChunks = uint64(len(manifest.Chunks))
|
||||
title = manifest.Title
|
||||
log.Debugf("found active manifest %v", manifest)
|
||||
progress, err = manifest.StoreChunk(chunkID, chunk)
|
||||
log.Debugf("attempts to store chunk %v %v", progress, err)
|
||||
if err != nil {
|
||||
log.Debugf("error storing chunk: %v", err)
|
||||
// malicious contacts who share conversations can share random chunks
|
||||
// these will not match the chunk hash and as such will fail.
|
||||
// at this point we can't differentiate between a malicious chunk and failure to store a
|
||||
// legitimate chunk, so if there is an error we silently drop it and expect the higher level callers (e.g. the ui)
|
||||
//to detect and respond to missing chunks if it detects them..
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
// VerifyFile returns true if the file has been downloaded, false otherwise
|
||||
// as well as the temporary filename, if one was used
|
||||
func (fsss *FileSharingSubSystem) VerifyFile(fileKey string) (tempFile string, filePath string, downloaded bool) {
|
||||
manifestI, exists := fsss.activeDownloads.Load(fileKey)
|
||||
if exists {
|
||||
manifest := manifestI.(*Manifest)
|
||||
if manifest.VerifyFile() == nil {
|
||||
manifest.Close()
|
||||
fsss.activeDownloads.Delete(fileKey)
|
||||
log.Debugf("file verified and downloaded!")
|
||||
return manifest.TempFileName, manifest.FileName, true
|
||||
}
|
||||
}
|
||||
return "", "", false
|
||||
}
|
|
@ -1,338 +0,0 @@
|
|||
package files
|
||||
|
||||
import (
|
||||
"bufio"
|
||||
"crypto/sha256"
|
||||
"crypto/sha512"
|
||||
"crypto/subtle"
|
||||
"encoding/json"
|
||||
"errors"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"io"
|
||||
"os"
|
||||
"sync"
|
||||
)
|
||||
|
||||
// Chunk is a wrapper around a hash
|
||||
type Chunk []byte
|
||||
|
||||
// DefaultChunkSize is the default value of a manifest chunk
|
||||
const DefaultChunkSize = 4096
|
||||
|
||||
// MaxManifestSize is the maximum size of a manifest (in DefaultChunkSize)
|
||||
// Because we reconstruct the manifest in memory we have to practically limit this size.
|
||||
// 2622000 * 4096 ~= 10GB using 4096 byte chunks
|
||||
// This makes the actual manifest size ~125Mb which seems reasonable for a 10Gb file.
|
||||
// most file transfers are expected to have manifest that are much smaller.
|
||||
const MaxManifestSize = 2622000
|
||||
|
||||
// Manifest is a collection of hashes and other metadata needed to reconstruct a file and verify contents given a root hash
|
||||
type Manifest struct {
|
||||
Chunks []Chunk
|
||||
FileName string
|
||||
RootHash []byte
|
||||
FileSizeInBytes uint64
|
||||
ChunkSizeInBytes uint64
|
||||
TempFileName string `json:"-"`
|
||||
Title string `json:"-"`
|
||||
|
||||
chunkComplete []bool
|
||||
openFd *os.File
|
||||
progress uint64
|
||||
lock sync.Mutex
|
||||
}
|
||||
|
||||
// CreateManifest takes in a file path and constructs a file sharing manifest of hashes along with
|
||||
// other information necessary to download, reconstruct and verify the file.
|
||||
func CreateManifest(path string) (*Manifest, error) {
|
||||
// Process file into Chunks
|
||||
f, err := os.Open(path)
|
||||
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
defer f.Close()
|
||||
|
||||
reader := bufio.NewReader(f)
|
||||
buf := make([]byte, DefaultChunkSize)
|
||||
|
||||
var chunks []Chunk
|
||||
fileSizeInBytes := uint64(0)
|
||||
|
||||
rootHash := sha512.New()
|
||||
|
||||
for {
|
||||
n, err := reader.Read(buf)
|
||||
if err != nil {
|
||||
if err != io.EOF {
|
||||
return nil, err
|
||||
}
|
||||
break
|
||||
}
|
||||
hash := sha256.New()
|
||||
hash.Write(buf[0:n])
|
||||
rootHash.Write(buf[0:n])
|
||||
chunkHash := hash.Sum(nil)
|
||||
chunks = append(chunks, chunkHash)
|
||||
fileSizeInBytes += uint64(n)
|
||||
}
|
||||
|
||||
return &Manifest{
|
||||
Chunks: chunks,
|
||||
FileName: path,
|
||||
RootHash: rootHash.Sum(nil),
|
||||
ChunkSizeInBytes: DefaultChunkSize,
|
||||
FileSizeInBytes: fileSizeInBytes,
|
||||
chunkComplete: make([]bool, len(chunks)),
|
||||
}, nil
|
||||
}
|
||||
|
||||
// GetChunkBytes takes in a chunk identifier and returns the bytes associated with that chunk
|
||||
// it does not attempt to validate the chunk Hash.
|
||||
func (m *Manifest) GetChunkBytes(id uint64) ([]byte, error) {
|
||||
m.lock.Lock()
|
||||
defer m.lock.Unlock()
|
||||
if id >= uint64(len(m.Chunks)) {
|
||||
return nil, errors.New("chunk not found")
|
||||
}
|
||||
|
||||
if err := m.getFileHandle(); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
// Seek to Chunk
|
||||
offset, err := m.openFd.Seek(int64(id*m.ChunkSizeInBytes), 0)
|
||||
if (uint64(offset) != id*m.ChunkSizeInBytes) || err != nil {
|
||||
return nil, errors.New("chunk not found")
|
||||
}
|
||||
|
||||
// Read chunk into memory and return...
|
||||
reader := bufio.NewReader(m.openFd)
|
||||
buf := make([]byte, m.ChunkSizeInBytes)
|
||||
n, err := reader.Read(buf)
|
||||
if err != nil {
|
||||
if err != io.EOF {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
return buf[0:n], nil
|
||||
}
|
||||
|
||||
// LoadManifest reads in a json serialized Manifest from a file
|
||||
func LoadManifest(filename string) (*Manifest, error) {
|
||||
bytes, err := os.ReadFile(filename)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
manifest := new(Manifest)
|
||||
err = json.Unmarshal(bytes, manifest)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
manifest.chunkComplete = make([]bool, len(manifest.Chunks))
|
||||
return manifest, nil
|
||||
}
|
||||
|
||||
// VerifyFile attempts to calculate the rootHash of a file and compare it to the expected rootHash stored in the
|
||||
// manifest
|
||||
func (m *Manifest) VerifyFile() error {
|
||||
m.lock.Lock()
|
||||
defer m.lock.Unlock()
|
||||
if err := m.getFileHandle(); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
offset, err := m.openFd.Seek(0, 0)
|
||||
if offset != 0 || err != nil {
|
||||
return errors.New("chunk not found")
|
||||
}
|
||||
|
||||
rootHash := sha512.New()
|
||||
reader := bufio.NewReader(m.openFd)
|
||||
buf := make([]byte, m.ChunkSizeInBytes)
|
||||
for {
|
||||
n, err := reader.Read(buf)
|
||||
rootHash.Write(buf[0:n])
|
||||
if err != nil {
|
||||
if err != io.EOF {
|
||||
return err
|
||||
}
|
||||
break
|
||||
}
|
||||
}
|
||||
|
||||
calculatedRootHash := rootHash.Sum(nil)
|
||||
if subtle.ConstantTimeCompare(m.RootHash, calculatedRootHash) != 1 {
|
||||
return fmt.Errorf("hashes do not match %x %x", m.RootHash, calculatedRootHash)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// StoreChunk takes in a chunk id and contents, verifies the chunk has the expected hash and if so store the contents
|
||||
// in the file.
|
||||
func (m *Manifest) StoreChunk(id uint64, contents []byte) (uint64, error) {
|
||||
m.lock.Lock()
|
||||
defer m.lock.Unlock()
|
||||
// Check the chunk id
|
||||
if id >= uint64(len(m.Chunks)) {
|
||||
return 0, errors.New("invalid chunk id")
|
||||
}
|
||||
|
||||
// Validate the chunk hash
|
||||
hash := sha256.New()
|
||||
hash.Write(contents)
|
||||
chunkHash := hash.Sum(nil)
|
||||
|
||||
if subtle.ConstantTimeCompare(chunkHash, m.Chunks[id]) != 1 {
|
||||
return 0, fmt.Errorf("invalid chunk hash %x %x", chunkHash, m.Chunks[id])
|
||||
}
|
||||
|
||||
if err := m.getFileHandle(); err != nil {
|
||||
return 0, err
|
||||
}
|
||||
|
||||
offset, err := m.openFd.Seek(int64(id*m.ChunkSizeInBytes), 0)
|
||||
if (uint64(offset) != id*m.ChunkSizeInBytes) || err != nil {
|
||||
return 0, errors.New("chunk not found")
|
||||
}
|
||||
|
||||
// Write the contents of the chunk to the file
|
||||
_, err = m.openFd.Write(contents)
|
||||
|
||||
if err == nil && !m.chunkComplete[id] {
|
||||
m.chunkComplete[id] = true
|
||||
m.progress++
|
||||
}
|
||||
|
||||
return m.progress, err
|
||||
}
|
||||
|
||||
// private function to set the internal file handle
|
||||
func (m *Manifest) getFileHandle() error {
|
||||
// Seek to the chunk in the file
|
||||
if m.openFd == nil {
|
||||
useFileName := m.FileName
|
||||
if m.TempFileName != "" {
|
||||
useFileName = m.TempFileName
|
||||
}
|
||||
fd, err := os.OpenFile(useFileName, os.O_RDWR, 0600)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
m.openFd = fd
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// GetChunkRequest returns an uncompressed list of Chunks needed to complete the file described in the manifest
|
||||
func (m *Manifest) GetChunkRequest() ChunkSpec {
|
||||
return CreateChunkSpec(m.chunkComplete)
|
||||
}
|
||||
|
||||
// PrepareDownload creates an empty file of the expected size of the file described by the manifest
|
||||
// If the file already exists it assumes it is the correct file and that it is resuming from when it left off.
|
||||
func (m *Manifest) PrepareDownload() error {
|
||||
m.lock.Lock()
|
||||
defer m.lock.Unlock()
|
||||
|
||||
m.chunkComplete = make([]bool, len(m.Chunks))
|
||||
if m.ChunkSizeInBytes == 0 || m.FileSizeInBytes == 0 {
|
||||
return fmt.Errorf("manifest is invalid")
|
||||
}
|
||||
|
||||
if info, err := os.Stat(m.FileName); os.IsNotExist(err) {
|
||||
useFileName := m.FileName
|
||||
if m.TempFileName != "" {
|
||||
useFileName = m.TempFileName
|
||||
}
|
||||
|
||||
fd, err := os.Create(useFileName)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
m.openFd = fd
|
||||
|
||||
writer := bufio.NewWriter(m.openFd)
|
||||
buf := make([]byte, m.ChunkSizeInBytes)
|
||||
for chunk := 0; chunk < len(m.Chunks)-1; chunk++ {
|
||||
_, err := writer.Write(buf)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
|
||||
lastChunkSize := m.FileSizeInBytes % m.ChunkSizeInBytes
|
||||
if lastChunkSize > 0 {
|
||||
buf = make([]byte, lastChunkSize)
|
||||
_, err := writer.Write(buf)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
writer.Flush()
|
||||
} else {
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
if uint64(info.Size()) != m.FileSizeInBytes {
|
||||
return fmt.Errorf("file exists but is the wrong size")
|
||||
}
|
||||
|
||||
if err := m.getFileHandle(); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
// Calculate Progress
|
||||
reader := bufio.NewReader(m.openFd)
|
||||
buf := make([]byte, m.ChunkSizeInBytes)
|
||||
chunkI := 0
|
||||
for {
|
||||
n, err := reader.Read(buf)
|
||||
if err != nil {
|
||||
if err != io.EOF {
|
||||
return err
|
||||
}
|
||||
break
|
||||
}
|
||||
|
||||
if chunkI >= len(m.Chunks) {
|
||||
log.Errorf("file is larger than the number of chunks assigned. Assuming manifest was corrupted.")
|
||||
return fmt.Errorf("file is larger than the number of chunks assigned. Assuming manifest was corrupted")
|
||||
}
|
||||
|
||||
hash := sha512.New()
|
||||
hash.Write(buf[0:n])
|
||||
chunkHash := hash.Sum(nil)
|
||||
m.progress = 0
|
||||
if subtle.ConstantTimeCompare(chunkHash, m.Chunks[chunkI]) == 1 {
|
||||
m.chunkComplete[chunkI] = true
|
||||
m.progress++
|
||||
}
|
||||
chunkI++
|
||||
}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// Close closes the underlying file descriptor
|
||||
func (m *Manifest) Close() {
|
||||
m.lock.Lock()
|
||||
defer m.lock.Unlock()
|
||||
if m.openFd != nil {
|
||||
m.openFd.Close()
|
||||
}
|
||||
}
|
||||
|
||||
// Save writes a JSON encoded byte array version of the manifest to path
|
||||
func (m *Manifest) Save(path string) error {
|
||||
return os.WriteFile(path, m.Serialize(), 0600)
|
||||
}
|
||||
|
||||
// Serialize returns the manifest as a JSON encoded byte array
|
||||
func (m *Manifest) Serialize() []byte {
|
||||
data, _ := json.Marshal(m)
|
||||
return data
|
||||
}
|
|
@ -1,150 +0,0 @@
|
|||
package files
|
||||
|
||||
import (
|
||||
"encoding/hex"
|
||||
"encoding/json"
|
||||
"math"
|
||||
"os"
|
||||
"testing"
|
||||
)
|
||||
|
||||
func TestManifest(t *testing.T) {
|
||||
manifest, err := CreateManifest("testdata/example.txt")
|
||||
if err != nil {
|
||||
t.Fatalf("manifest create error: %v", err)
|
||||
}
|
||||
|
||||
if len(manifest.Chunks) != 1 {
|
||||
t.Fatalf("manifest had unepxected Chunks : %v", manifest.Chunks)
|
||||
}
|
||||
|
||||
if manifest.FileSizeInBytes != 12 {
|
||||
t.Fatalf("manifest had unepxected length : %v", manifest.FileSizeInBytes)
|
||||
}
|
||||
|
||||
if hex.EncodeToString(manifest.RootHash) != "861844d6704e8573fec34d967e20bcfef3d424cf48be04e6dc08f2bd58c729743371015ead891cc3cf1c9d34b49264b510751b1ff9e537937bc46b5d6ff4ecc8" {
|
||||
t.Fatalf("manifest had incorrect root Hash : %v", manifest.RootHash)
|
||||
}
|
||||
|
||||
t.Logf("%v", manifest)
|
||||
|
||||
// Try to read the chunk
|
||||
_, err = manifest.GetChunkBytes(1)
|
||||
if err == nil {
|
||||
t.Fatalf("chunk fetch should have thrown an error")
|
||||
}
|
||||
|
||||
_, err = manifest.GetChunkBytes(0)
|
||||
if err != nil {
|
||||
t.Fatalf("chunk fetch error: %v", err)
|
||||
}
|
||||
_, err = manifest.GetChunkBytes(0)
|
||||
if err != nil {
|
||||
t.Fatalf("chunk fetch error: %v", err)
|
||||
}
|
||||
|
||||
_, err = manifest.GetChunkBytes(0)
|
||||
if err != nil {
|
||||
t.Fatalf("chunk fetch error: %v", err)
|
||||
}
|
||||
|
||||
json, _ := json.Marshal(manifest)
|
||||
t.Logf("%s", json)
|
||||
|
||||
}
|
||||
|
||||
func TestManifestLarge(t *testing.T) {
|
||||
manifest, err := CreateManifest("testdata/cwtch.png")
|
||||
if err != nil {
|
||||
t.Fatalf("manifest create error: %v", err)
|
||||
}
|
||||
|
||||
if len(manifest.Chunks) != int(math.Ceil(float64(51791)/DefaultChunkSize)) {
|
||||
t.Fatalf("manifest had unexpected Chunks : %v", manifest.Chunks)
|
||||
}
|
||||
|
||||
if manifest.FileSizeInBytes != 51791 {
|
||||
t.Fatalf("manifest had unepxected length : %v", manifest.FileSizeInBytes)
|
||||
}
|
||||
|
||||
if hex.EncodeToString(manifest.RootHash) != "8f0ed73bbb30db45b6a740b1251cae02945f48e4f991464d5f3607685c45dcd136a325dab2e5f6429ce2b715e602b20b5b16bf7438fb6235fefe912adcedb5fd" {
|
||||
t.Fatalf("manifest had incorrect root Hash : %v", manifest.RootHash)
|
||||
}
|
||||
|
||||
t.Logf("%v", len(manifest.Chunks))
|
||||
|
||||
json, _ := json.Marshal(manifest)
|
||||
t.Logf("%v %s", len(json), json)
|
||||
|
||||
// Pretend we downloaded the manifest
|
||||
os.WriteFile("testdata/cwtch.png.manifest", json, 0600)
|
||||
|
||||
// Load the manifest from a file
|
||||
cwtchPngManifest, err := LoadManifest("testdata/cwtch.png.manifest")
|
||||
if err != nil {
|
||||
t.Fatalf("manifest create error: %v", err)
|
||||
}
|
||||
defer cwtchPngManifest.Close()
|
||||
t.Logf("%v", cwtchPngManifest)
|
||||
|
||||
// Test verifying the hash
|
||||
if cwtchPngManifest.VerifyFile() != nil {
|
||||
t.Fatalf("hashes do not validate error: %v", err)
|
||||
}
|
||||
|
||||
// Prepare Download
|
||||
cwtchPngOutManifest, err := LoadManifest("testdata/cwtch.png.manifest")
|
||||
|
||||
if err != nil {
|
||||
t.Fatalf("could not prepare download %v", err)
|
||||
}
|
||||
|
||||
cwtchPngOutManifest.FileName = "testdata/cwtch.out.png"
|
||||
|
||||
defer cwtchPngOutManifest.Close()
|
||||
err = cwtchPngOutManifest.PrepareDownload()
|
||||
if err != nil {
|
||||
t.Fatalf("could not prepare download %v", err)
|
||||
}
|
||||
|
||||
for i := 0; i < len(cwtchPngManifest.Chunks); i++ {
|
||||
|
||||
t.Logf("Sending Chunk %v %x from %v", i, cwtchPngManifest.Chunks[i], cwtchPngManifest.FileName)
|
||||
|
||||
contents, err := cwtchPngManifest.GetChunkBytes(uint64(i))
|
||||
|
||||
if err != nil {
|
||||
t.Fatalf("could not get chunk %v %v", i, err)
|
||||
}
|
||||
t.Logf("Progress: %v", cwtchPngOutManifest.chunkComplete)
|
||||
_, err = cwtchPngOutManifest.StoreChunk(uint64(i), contents)
|
||||
if err != nil {
|
||||
t.Fatalf("could not store chunk %v %v", i, err)
|
||||
}
|
||||
|
||||
// Attempt to store the chunk in an invalid position...
|
||||
_, err = cwtchPngOutManifest.StoreChunk(uint64(i+1), contents)
|
||||
if err == nil {
|
||||
t.Fatalf("incorrect chunk store")
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
// Attempt to store an invalid chunk...should trigger an error
|
||||
_, err = cwtchPngOutManifest.StoreChunk(uint64(len(cwtchPngManifest.Chunks)), []byte{0xff})
|
||||
if err == nil {
|
||||
t.Fatalf("incorrect chunk store")
|
||||
}
|
||||
|
||||
err = cwtchPngOutManifest.VerifyFile()
|
||||
if err != nil {
|
||||
t.Fatalf("could not verify file %v", err)
|
||||
}
|
||||
|
||||
// Test that changing the hash throws an error
|
||||
cwtchPngManifest.RootHash[3] = 0xFF
|
||||
if cwtchPngManifest.VerifyFile() == nil {
|
||||
t.Fatalf("hashes should not validate error")
|
||||
}
|
||||
|
||||
}
|
Binary file not shown.
Before Width: | Height: | Size: 51 KiB |
Binary file not shown.
Before Width: | Height: | Size: 51 KiB |
|
@ -1 +0,0 @@
|
|||
{"Chunks":["BXbFagOrWyDwcsnW+f1O6fddCqJywEISjUrzI31FAE0=","1SZcGk0NSduL093Hh0hZ4WVcx2o6VKgL3kUy2WqmdLY=","R4wwVcR4andJJ0fkXlp/td1ZSjH7xHi3Egh8aloWONA=","TAuI06kog7TYVDSO8AgWprAGY8LSlGBwqZvpgMymhZE=","XQLxqLjiM0qIAeOmGIrZJkyuCEfJ4t+ikgbV1ohudiY=","aXInp/WF58A5/TGkwAwniNvIU2ZlRjVtrpClw0sBcVM=","oSCjcrenQ4+Pix4jtgNCRt40K0kQ41eCumSJO0Gqo/0=","FebZSfHuyVdRWkS8/IaWA6UooEURkf9vPxnqZXKII8g=","tITbm77ca1YmExGzbX4WBP5fAOh4bUzDtceN1VBYcBI=","VJd8rWuMtrZzqobdKam0n6t4Vgo72GcsNRNzMk46PsI=","7ywzxLV44HVk9wz+QQHvvVQJAFkTU6/pHyVFjE0uF40=","PoHUwEoQOSXv8ZpJ9bGeCZqiwY34bXcFcBki2OPxd8o=","eogaSYPKrl0MFEqVP1mwUMczMCcnjjwUmUz/0DsAF48="],"FileName":"testdata/cwtch.png","RootHash":"jw7XO7sw20W2p0CxJRyuApRfSOT5kUZNXzYHaFxF3NE2oyXasuX2QpzitxXmArILWxa/dDj7YjX+/pEq3O21/Q==","FileSizeInBytes":51791,"ChunkSizeInBytes":4096}
|
|
@ -1 +0,0 @@
|
|||
Hello World!
|
|
@ -0,0 +1,188 @@
|
|||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// source: group_message.proto
|
||||
|
||||
package protocol
|
||||
|
||||
import proto "github.com/golang/protobuf/proto"
|
||||
import fmt "fmt"
|
||||
import math "math"
|
||||
import control "git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
|
||||
// Reference imports to suppress errors if they are not otherwise used.
|
||||
var _ = proto.Marshal
|
||||
var _ = fmt.Errorf
|
||||
var _ = math.Inf
|
||||
|
||||
type CwtchServerPacket struct {
|
||||
GroupMessage *GroupMessage `protobuf:"bytes,1,opt,name=group_message,json=groupMessage" json:"group_message,omitempty"`
|
||||
FetchMessage *FetchMessage `protobuf:"bytes,2,opt,name=fetch_message,json=fetchMessage" json:"fetch_message,omitempty"`
|
||||
XXX_unrecognized []byte `json:"-"`
|
||||
}
|
||||
|
||||
func (m *CwtchServerPacket) Reset() { *m = CwtchServerPacket{} }
|
||||
func (m *CwtchServerPacket) String() string { return proto.CompactTextString(m) }
|
||||
func (*CwtchServerPacket) ProtoMessage() {}
|
||||
func (*CwtchServerPacket) Descriptor() ([]byte, []int) { return fileDescriptor2, []int{0} }
|
||||
|
||||
func (m *CwtchServerPacket) GetGroupMessage() *GroupMessage {
|
||||
if m != nil {
|
||||
return m.GroupMessage
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *CwtchServerPacket) GetFetchMessage() *FetchMessage {
|
||||
if m != nil {
|
||||
return m.FetchMessage
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
type FetchMessage struct {
|
||||
XXX_unrecognized []byte `json:"-"`
|
||||
}
|
||||
|
||||
func (m *FetchMessage) Reset() { *m = FetchMessage{} }
|
||||
func (m *FetchMessage) String() string { return proto.CompactTextString(m) }
|
||||
func (*FetchMessage) ProtoMessage() {}
|
||||
func (*FetchMessage) Descriptor() ([]byte, []int) { return fileDescriptor2, []int{1} }
|
||||
|
||||
type GroupMessage struct {
|
||||
Ciphertext []byte `protobuf:"bytes,1,req,name=ciphertext" json:"ciphertext,omitempty"`
|
||||
Spamguard []byte `protobuf:"bytes,2,req,name=spamguard" json:"spamguard,omitempty"`
|
||||
Signature []byte `protobuf:"bytes,3,req,name=signature" json:"signature,omitempty"`
|
||||
XXX_unrecognized []byte `json:"-"`
|
||||
}
|
||||
|
||||
func (m *GroupMessage) Reset() { *m = GroupMessage{} }
|
||||
func (m *GroupMessage) String() string { return proto.CompactTextString(m) }
|
||||
func (*GroupMessage) ProtoMessage() {}
|
||||
func (*GroupMessage) Descriptor() ([]byte, []int) { return fileDescriptor2, []int{2} }
|
||||
|
||||
func (m *GroupMessage) GetCiphertext() []byte {
|
||||
if m != nil {
|
||||
return m.Ciphertext
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *GroupMessage) GetSpamguard() []byte {
|
||||
if m != nil {
|
||||
return m.Spamguard
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *GroupMessage) GetSignature() []byte {
|
||||
if m != nil {
|
||||
return m.Signature
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// DecryptedGroupMessage is *never* sent in the clear on the wire
|
||||
// and is only ever sent when encrypted in the ciphertext parameter of
|
||||
// GroupMessage
|
||||
type DecryptedGroupMessage struct {
|
||||
Onion *string `protobuf:"bytes,1,req,name=onion" json:"onion,omitempty"`
|
||||
Timestamp *int32 `protobuf:"varint,2,req,name=timestamp" json:"timestamp,omitempty"`
|
||||
Text *string `protobuf:"bytes,3,req,name=text" json:"text,omitempty"`
|
||||
SignedGroupId []byte `protobuf:"bytes,4,req,name=signed_group_id,json=signedGroupId" json:"signed_group_id,omitempty"`
|
||||
PreviousMessageSig []byte `protobuf:"bytes,5,req,name=previous_message_sig,json=previousMessageSig" json:"previous_message_sig,omitempty"`
|
||||
// Used to prevent analysis on text length, length is 1024 - len(text)
|
||||
Padding []byte `protobuf:"bytes,6,req,name=padding" json:"padding,omitempty"`
|
||||
XXX_unrecognized []byte `json:"-"`
|
||||
}
|
||||
|
||||
func (m *DecryptedGroupMessage) Reset() { *m = DecryptedGroupMessage{} }
|
||||
func (m *DecryptedGroupMessage) String() string { return proto.CompactTextString(m) }
|
||||
func (*DecryptedGroupMessage) ProtoMessage() {}
|
||||
func (*DecryptedGroupMessage) Descriptor() ([]byte, []int) { return fileDescriptor2, []int{3} }
|
||||
|
||||
func (m *DecryptedGroupMessage) GetOnion() string {
|
||||
if m != nil && m.Onion != nil {
|
||||
return *m.Onion
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
func (m *DecryptedGroupMessage) GetTimestamp() int32 {
|
||||
if m != nil && m.Timestamp != nil {
|
||||
return *m.Timestamp
|
||||
}
|
||||
return 0
|
||||
}
|
||||
|
||||
func (m *DecryptedGroupMessage) GetText() string {
|
||||
if m != nil && m.Text != nil {
|
||||
return *m.Text
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
func (m *DecryptedGroupMessage) GetSignedGroupId() []byte {
|
||||
if m != nil {
|
||||
return m.SignedGroupId
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *DecryptedGroupMessage) GetPreviousMessageSig() []byte {
|
||||
if m != nil {
|
||||
return m.PreviousMessageSig
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *DecryptedGroupMessage) GetPadding() []byte {
|
||||
if m != nil {
|
||||
return m.Padding
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
var E_ServerNonce = &proto.ExtensionDesc{
|
||||
ExtendedType: (*control.ChannelResult)(nil),
|
||||
ExtensionType: ([]byte)(nil),
|
||||
Field: 8200,
|
||||
Name: "protocol.server_nonce",
|
||||
Tag: "bytes,8200,opt,name=server_nonce,json=serverNonce",
|
||||
Filename: "group_message.proto",
|
||||
}
|
||||
|
||||
func init() {
|
||||
proto.RegisterType((*CwtchServerPacket)(nil), "protocol.CwtchServerPacket")
|
||||
proto.RegisterType((*FetchMessage)(nil), "protocol.FetchMessage")
|
||||
proto.RegisterType((*GroupMessage)(nil), "protocol.GroupMessage")
|
||||
proto.RegisterType((*DecryptedGroupMessage)(nil), "protocol.DecryptedGroupMessage")
|
||||
proto.RegisterExtension(E_ServerNonce)
|
||||
}
|
||||
|
||||
func init() { proto.RegisterFile("group_message.proto", fileDescriptor2) }
|
||||
|
||||
var fileDescriptor2 = []byte{
|
||||
// 360 bytes of a gzipped FileDescriptorProto
|
||||
0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x5c, 0x92, 0x4d, 0x6e, 0xdb, 0x30,
|
||||
0x10, 0x85, 0x21, 0xff, 0xb4, 0xf5, 0x58, 0x6e, 0x51, 0xd6, 0x6d, 0x89, 0xa2, 0x28, 0x0c, 0x2d,
|
||||
0x0a, 0xaf, 0x8c, 0x20, 0xcb, 0x78, 0x13, 0xc0, 0x41, 0x82, 0x2c, 0x12, 0x04, 0xf2, 0x01, 0x04,
|
||||
0x42, 0x1a, 0x53, 0x4c, 0x24, 0x92, 0x20, 0x29, 0x27, 0xb9, 0x41, 0x36, 0x39, 0x5d, 0x2e, 0x14,
|
||||
0x88, 0xb2, 0x6c, 0x39, 0x2b, 0x69, 0xde, 0x37, 0x6f, 0xde, 0x80, 0x24, 0xfc, 0xe0, 0x46, 0x55,
|
||||
0x3a, 0x29, 0xd1, 0x5a, 0xc6, 0x71, 0xa1, 0x8d, 0x72, 0x8a, 0x7c, 0xf1, 0x9f, 0x54, 0x15, 0x7f,
|
||||
0xa6, 0x2b, 0x25, 0x9d, 0x51, 0xc5, 0x2a, 0x67, 0x52, 0x62, 0xd1, 0xf0, 0xe8, 0x35, 0x80, 0xef,
|
||||
0xab, 0x47, 0x97, 0xe6, 0x6b, 0x34, 0x5b, 0x34, 0x77, 0x2c, 0x7d, 0x40, 0x47, 0x96, 0x30, 0x39,
|
||||
0x1a, 0x46, 0x83, 0x59, 0x30, 0x1f, 0x9f, 0xfe, 0x5a, 0xb4, 0xd3, 0x16, 0x57, 0x35, 0xbe, 0x69,
|
||||
0x68, 0x1c, 0xf2, 0x4e, 0x55, 0x9b, 0x37, 0xe8, 0xd2, 0x7c, 0x6f, 0xee, 0x7d, 0x34, 0x5f, 0xd6,
|
||||
0x78, 0x6f, 0xde, 0x74, 0xaa, 0xe8, 0x2b, 0x84, 0x5d, 0x1a, 0xdd, 0x43, 0xd8, 0x8d, 0x22, 0xff,
|
||||
0x00, 0x52, 0xa1, 0x73, 0x34, 0x0e, 0x9f, 0x1c, 0x0d, 0x66, 0xbd, 0x79, 0x18, 0x77, 0x14, 0xf2,
|
||||
0x17, 0x46, 0x56, 0xb3, 0x92, 0x57, 0xcc, 0x64, 0xb4, 0xe7, 0xf1, 0x41, 0xf0, 0x54, 0x70, 0xc9,
|
||||
0x5c, 0x65, 0x90, 0xf6, 0x77, 0xb4, 0x15, 0xa2, 0xb7, 0x00, 0x7e, 0x5e, 0x60, 0x6a, 0x9e, 0xb5,
|
||||
0xc3, 0xec, 0x28, 0x75, 0x0a, 0x43, 0x25, 0x85, 0x92, 0x3e, 0x70, 0x14, 0x37, 0x45, 0x3d, 0xcd,
|
||||
0x89, 0x12, 0xad, 0x63, 0xa5, 0xf6, 0x59, 0xc3, 0xf8, 0x20, 0x10, 0x02, 0x03, 0xbf, 0x63, 0xdf,
|
||||
0x5b, 0xfc, 0x3f, 0xf9, 0x0f, 0xdf, 0xea, 0x38, 0xcc, 0x92, 0xe6, 0x78, 0x45, 0x46, 0x07, 0x7e,
|
||||
0x8b, 0x49, 0x23, 0xfb, 0xd0, 0xeb, 0x8c, 0x9c, 0xc0, 0x54, 0x1b, 0xdc, 0x0a, 0x55, 0xd9, 0xf6,
|
||||
0x14, 0x13, 0x2b, 0x38, 0x1d, 0xfa, 0x66, 0xd2, 0xb2, 0xdd, 0x7a, 0x6b, 0xc1, 0x09, 0x85, 0xcf,
|
||||
0x9a, 0x65, 0x99, 0x90, 0x9c, 0x7e, 0xf2, 0x4d, 0x6d, 0x79, 0xb6, 0x84, 0xd0, 0xfa, 0xbb, 0x4d,
|
||||
0xa4, 0x92, 0x29, 0x92, 0xdf, 0x87, 0x7b, 0xd8, 0x3d, 0x85, 0x18, 0x6d, 0x55, 0x38, 0xfa, 0x72,
|
||||
0x3e, 0x0b, 0xe6, 0x61, 0x3c, 0x6e, 0xba, 0x6f, 0xeb, 0xe6, 0xf7, 0x00, 0x00, 0x00, 0xff, 0xff,
|
||||
0x33, 0x30, 0xca, 0x8b, 0x54, 0x02, 0x00, 0x00,
|
||||
}
|
|
@ -0,0 +1,35 @@
|
|||
syntax = "proto2";
|
||||
package protocol;
|
||||
|
||||
import "ControlChannel.proto";
|
||||
|
||||
message CwtchServerPacket {
|
||||
optional GroupMessage group_message = 1;
|
||||
optional FetchMessage fetch_message = 2;
|
||||
}
|
||||
|
||||
extend protocol.ChannelResult {
|
||||
optional bytes server_nonce = 8200; // 32 random bytes
|
||||
}
|
||||
|
||||
message FetchMessage {
|
||||
}
|
||||
|
||||
message GroupMessage {
|
||||
required bytes ciphertext = 1;
|
||||
required bytes spamguard = 2;
|
||||
required bytes signature = 3;
|
||||
}
|
||||
|
||||
// DecryptedGroupMessage is *never* sent in the clear on the wire
|
||||
// and is only ever sent when encrypted in the ciphertext parameter of
|
||||
// GroupMessage
|
||||
message DecryptedGroupMessage {
|
||||
required string onion = 1;
|
||||
required int32 timestamp = 2;
|
||||
required string text = 3;
|
||||
required bytes signed_group_id = 4;
|
||||
required bytes previous_message_sig =5;
|
||||
// Used to prevent analysis on text length, length is 1024 - len(text)
|
||||
required bytes padding = 6;
|
||||
}
|
|
@ -1,101 +0,0 @@
|
|||
package groups
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"git.openprivacy.ca/cwtch.im/tapir"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives/privacypass"
|
||||
)
|
||||
|
||||
// CwtchServerSyncedCapability is used to indicate that a given cwtch server is synced
|
||||
const CwtchServerSyncedCapability = tapir.Capability("CwtchServerSyncedCapability")
|
||||
|
||||
// GroupInvite provides a structured type for communicating group information to peers
|
||||
type GroupInvite struct {
|
||||
GroupID string
|
||||
GroupName string
|
||||
SignedGroupID []byte
|
||||
Timestamp uint64
|
||||
SharedKey []byte
|
||||
ServerHost string
|
||||
}
|
||||
|
||||
// DecryptedGroupMessage is the main encapsulation of group message data
|
||||
type DecryptedGroupMessage struct {
|
||||
Text string
|
||||
Onion string
|
||||
Timestamp uint64
|
||||
// NOTE: SignedGroupID is now a misnomer, the only way this is signed is indirectly via the signed encrypted group messages
|
||||
// We now treat GroupID as binding to a server/key rather than an "owner" - additional validation logic (to e.g.
|
||||
// respect particular group constitutions) can be built on top of group messages, but the underlying groups are
|
||||
// now agnostic to those models.
|
||||
SignedGroupID []byte
|
||||
PreviousMessageSig []byte
|
||||
Padding []byte
|
||||
}
|
||||
|
||||
// EncryptedGroupMessage provides an encapsulation of the encrypted group message stored on the server
|
||||
type EncryptedGroupMessage struct {
|
||||
Ciphertext []byte
|
||||
Signature []byte
|
||||
}
|
||||
|
||||
// CachedEncryptedGroupMessage provides an encapsulation of the encrypted group message for local caching / error reporting
|
||||
type CachedEncryptedGroupMessage struct {
|
||||
EncryptedGroupMessage
|
||||
Group string
|
||||
}
|
||||
|
||||
// ToBytes converts the encrypted group message to a set of bytes for serialization
|
||||
func (egm EncryptedGroupMessage) ToBytes() []byte {
|
||||
data, _ := json.Marshal(egm)
|
||||
return data
|
||||
}
|
||||
|
||||
// MessageType defines the enum for TokenBoard messages
|
||||
type MessageType int
|
||||
|
||||
// Message Types
|
||||
const (
|
||||
ReplayRequestMessage MessageType = iota
|
||||
ReplayResultMessage
|
||||
PostRequestMessage
|
||||
PostResultMessage
|
||||
NewMessageMessage
|
||||
)
|
||||
|
||||
// Message encapsulates the application protocol
|
||||
type Message struct {
|
||||
MessageType MessageType
|
||||
PostRequest *PostRequest `json:",omitempty"`
|
||||
PostResult *PostResult `json:",omitempty"`
|
||||
NewMessage *NewMessage `json:",omitempty"`
|
||||
ReplayRequest *ReplayRequest `json:",omitempty"`
|
||||
ReplayResult *ReplayResult `json:",omitempty"`
|
||||
}
|
||||
|
||||
// ReplayRequest requests a reply from the given Commit
|
||||
type ReplayRequest struct {
|
||||
LastCommit []byte
|
||||
}
|
||||
|
||||
// PostRequest requests to post the message to the board with the given token
|
||||
type PostRequest struct {
|
||||
Token privacypass.SpentToken
|
||||
EGM EncryptedGroupMessage
|
||||
}
|
||||
|
||||
// PostResult returns the success of a given post attempt
|
||||
type PostResult struct {
|
||||
Success bool
|
||||
}
|
||||
|
||||
// ReplayResult is sent by the server before a stream of replayed messages
|
||||
type ReplayResult struct {
|
||||
NumMessages int
|
||||
}
|
||||
|
||||
// NewMessage is used to send a new bulletin board message to interested peers.
|
||||
type NewMessage struct {
|
||||
//Token privacypass.SpentToken
|
||||
EGM EncryptedGroupMessage
|
||||
}
|
|
@ -1,53 +0,0 @@
|
|||
package model
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"errors"
|
||||
)
|
||||
|
||||
// PeerMessage is an encapsulation that can be used by higher level applications
|
||||
type PeerMessage struct {
|
||||
// ID **must** only contain alphanumeric characters separated by period.
|
||||
ID string // A unique Message ID (primarily used for acknowledgments)
|
||||
|
||||
// Context **must** only contain alphanumeric characters separated by period.
|
||||
Context string // A unique context identifier i.e. im.cwtch.chat
|
||||
|
||||
// Data can contain anything
|
||||
Data []byte // A data packet.
|
||||
}
|
||||
|
||||
// Serialize constructs an efficient serialized representation
|
||||
// Format: [ID String] | [Context String] | Binary Data
|
||||
func (m *PeerMessage) Serialize() []byte {
|
||||
return append(append([]byte(m.ID+"|"), []byte(m.Context+"|")...), m.Data...)
|
||||
}
|
||||
|
||||
// ParsePeerMessage returns either a deserialized PeerMessage or an error if it is malformed
|
||||
func ParsePeerMessage(message []byte) (*PeerMessage, error) {
|
||||
|
||||
// find the identifier prefix
|
||||
idTerminator := bytes.IndexByte(message, '|')
|
||||
if idTerminator != -1 && idTerminator+1 < len(message) {
|
||||
// find the context terminator prefix
|
||||
contextbegin := idTerminator + 1
|
||||
contextTerminator := bytes.IndexByte(message[contextbegin:], '|')
|
||||
if contextTerminator != -1 {
|
||||
|
||||
// check that we have data
|
||||
dataBegin := contextbegin + contextTerminator + 1
|
||||
var data []byte
|
||||
if dataBegin < len(message) {
|
||||
data = message[dataBegin:]
|
||||
}
|
||||
|
||||
// compile the message
|
||||
return &PeerMessage{
|
||||
ID: string(message[0:idTerminator]),
|
||||
Context: string(message[contextbegin : contextbegin+contextTerminator]),
|
||||
Data: data,
|
||||
}, nil
|
||||
}
|
||||
}
|
||||
return nil, errors.New("invalid message")
|
||||
}
|
|
@ -0,0 +1,100 @@
|
|||
package spam
|
||||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"crypto/sha256"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"io"
|
||||
//"fmt"
|
||||
)
|
||||
|
||||
// Guard implements a spam protection mechanism for Cwtch Servers.
|
||||
type Guard struct {
|
||||
Difficulty int
|
||||
nonce [24]byte
|
||||
}
|
||||
|
||||
func getRandomness(arr *[24]byte) {
|
||||
if _, err := io.ReadFull(rand.Reader, arr[:]); err != nil {
|
||||
utils.CheckError(err)
|
||||
}
|
||||
}
|
||||
|
||||
//GenerateChallenge returns a channel result packet with a spamguard challenge nonce
|
||||
func (sg *Guard) GenerateChallenge(channelID int32) []byte {
|
||||
|
||||
cr := &Protocol_Data_Control.ChannelResult{
|
||||
ChannelIdentifier: proto.Int32(channelID),
|
||||
Opened: proto.Bool(true),
|
||||
}
|
||||
|
||||
var nonce [24]byte
|
||||
getRandomness(&nonce)
|
||||
sg.nonce = nonce
|
||||
err := proto.SetExtension(cr, protocol.E_ServerNonce, sg.nonce[:])
|
||||
utils.CheckError(err)
|
||||
|
||||
pc := &Protocol_Data_Control.Packet{
|
||||
ChannelResult: cr,
|
||||
}
|
||||
ret, err := proto.Marshal(pc)
|
||||
utils.CheckError(err)
|
||||
return ret
|
||||
}
|
||||
|
||||
// SolveChallenge takes in a challenge and a message and returns a solution
|
||||
// The solution is a 24 byte nonce which when hashed with the challenge and the message
|
||||
// produces a sha256 hash with Difficulty leading 0s
|
||||
func (sg *Guard) SolveChallenge(challenge []byte, message []byte) []byte {
|
||||
solved := false
|
||||
var spamguard [24]byte
|
||||
sum := sha256.Sum256([]byte{})
|
||||
solve := make([]byte, len(challenge)+len(message)+len(spamguard))
|
||||
for !solved {
|
||||
|
||||
getRandomness(&spamguard)
|
||||
|
||||
copy(solve[0:], challenge[:])
|
||||
copy(solve[len(challenge):], message[:])
|
||||
copy(solve[len(challenge)+len(message):], spamguard[:])
|
||||
|
||||
sum = sha256.Sum256(solve)
|
||||
|
||||
solved = true
|
||||
for i := 0; i < sg.Difficulty; i++ {
|
||||
if sum[i] != 0x00 {
|
||||
solved = false
|
||||
}
|
||||
}
|
||||
}
|
||||
//fmt.Printf("[SOLVED] %x\n",sha256.Sum256(solve))
|
||||
return spamguard[:]
|
||||
}
|
||||
|
||||
// ValidateChallenge returns true if the message and spamguard pass the challenge
|
||||
func (sg *Guard) ValidateChallenge(message []byte, spamguard []byte) bool {
|
||||
if len(spamguard) != 24 {
|
||||
return false
|
||||
}
|
||||
|
||||
// If the message is too large just throw it away.
|
||||
if len(message) > 2048 {
|
||||
return false
|
||||
}
|
||||
|
||||
solve := make([]byte, len(sg.nonce)+len(message)+len(spamguard))
|
||||
copy(solve[0:], sg.nonce[:])
|
||||
copy(solve[len(sg.nonce):], message[:])
|
||||
copy(solve[len(sg.nonce)+len(message):], spamguard[:])
|
||||
sum := sha256.Sum256(solve)
|
||||
|
||||
for i := 0; i < sg.Difficulty; i++ {
|
||||
if sum[i] != 0x00 {
|
||||
return false
|
||||
}
|
||||
}
|
||||
return true
|
||||
}
|
Some files were not shown because too many files have changed in this diff Show More
Loading…
Reference in New Issue