Merge branch 'protocolengine' of cwtch.im/cwtch into master
This commit is contained in:
commit
591a09e25d
|
@ -2,6 +2,7 @@ package app
|
||||||
|
|
||||||
import (
|
import (
|
||||||
"crypto/rand"
|
"crypto/rand"
|
||||||
|
"cwtch.im/cwtch/event"
|
||||||
"cwtch.im/cwtch/peer"
|
"cwtch.im/cwtch/peer"
|
||||||
"cwtch.im/cwtch/storage"
|
"cwtch.im/cwtch/storage"
|
||||||
"encoding/hex"
|
"encoding/hex"
|
||||||
|
@ -23,6 +24,7 @@ type application struct {
|
||||||
mutex sync.Mutex
|
mutex sync.Mutex
|
||||||
primaryonion string
|
primaryonion string
|
||||||
storage map[string]storage.ProfileStore
|
storage map[string]storage.ProfileStore
|
||||||
|
eventBus *event.Manager
|
||||||
}
|
}
|
||||||
|
|
||||||
// Application is a full cwtch peer application. It allows management, usage and storage of multiple peers
|
// Application is a full cwtch peer application. It allows management, usage and storage of multiple peers
|
||||||
|
@ -46,6 +48,8 @@ func NewApp(acn connectivity.ACN, appDirectory string) Application {
|
||||||
log.Debugf("NewApp(%v)\n", appDirectory)
|
log.Debugf("NewApp(%v)\n", appDirectory)
|
||||||
app := &application{peers: make(map[string]peer.CwtchPeer), storage: make(map[string]storage.ProfileStore), directory: appDirectory, acn: acn}
|
app := &application{peers: make(map[string]peer.CwtchPeer), storage: make(map[string]storage.ProfileStore), directory: appDirectory, acn: acn}
|
||||||
os.Mkdir(path.Join(app.directory, "profiles"), 0700)
|
os.Mkdir(path.Join(app.directory, "profiles"), 0700)
|
||||||
|
app.eventBus = new(event.Manager)
|
||||||
|
app.eventBus.Initialize()
|
||||||
return app
|
return app
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -73,7 +77,7 @@ func (app *application) CreatePeer(name string, password string) (peer.CwtchPeer
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return nil, err
|
return nil, err
|
||||||
}
|
}
|
||||||
p.Init(app.acn)
|
p.Init(app.acn, app.eventBus)
|
||||||
_, exists := app.peers[p.GetProfile().Onion]
|
_, exists := app.peers[p.GetProfile().Onion]
|
||||||
if exists {
|
if exists {
|
||||||
p.Shutdown()
|
p.Shutdown()
|
||||||
|
@ -109,7 +113,7 @@ func (app *application) LoadProfiles(password string) error {
|
||||||
continue
|
continue
|
||||||
}
|
}
|
||||||
|
|
||||||
p.Init(app.acn)
|
p.Init(app.acn, app.eventBus)
|
||||||
|
|
||||||
app.mutex.Lock()
|
app.mutex.Lock()
|
||||||
app.peers[p.GetProfile().Onion] = p
|
app.peers[p.GetProfile().Onion] = p
|
||||||
|
|
|
@ -1,8 +1,9 @@
|
||||||
package main
|
package main
|
||||||
|
|
||||||
import (
|
import (
|
||||||
|
"cwtch.im/cwtch/event"
|
||||||
"cwtch.im/cwtch/peer"
|
"cwtch.im/cwtch/peer"
|
||||||
"cwtch.im/cwtch/peer/connections"
|
"cwtch.im/cwtch/protocol/connections"
|
||||||
"errors"
|
"errors"
|
||||||
"fmt"
|
"fmt"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||||
|
@ -46,7 +47,7 @@ func main() {
|
||||||
}
|
}
|
||||||
|
|
||||||
botPeer := peer.NewCwtchPeer("servermon")
|
botPeer := peer.NewCwtchPeer("servermon")
|
||||||
botPeer.Init(acn)
|
botPeer.Init(acn, new(event.Manager))
|
||||||
|
|
||||||
fmt.Printf("Connecting to %v...\n", serverAddr)
|
fmt.Printf("Connecting to %v...\n", serverAddr)
|
||||||
botPeer.JoinServer(serverAddr)
|
botPeer.JoinServer(serverAddr)
|
||||||
|
|
|
@ -6,7 +6,7 @@ import (
|
||||||
|
|
||||||
"bytes"
|
"bytes"
|
||||||
"cwtch.im/cwtch/model"
|
"cwtch.im/cwtch/model"
|
||||||
"cwtch.im/cwtch/peer/connections"
|
"cwtch.im/cwtch/protocol/connections"
|
||||||
"fmt"
|
"fmt"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/log"
|
"git.openprivacy.ca/openprivacy/libricochet-go/log"
|
||||||
|
@ -265,6 +265,7 @@ func main() {
|
||||||
log.Errorf("Error initializing application: %v", err)
|
log.Errorf("Error initializing application: %v", err)
|
||||||
os.Exit(1)
|
os.Exit(1)
|
||||||
}
|
}
|
||||||
|
log.SetLevel(log.LevelDebug)
|
||||||
fmt.Printf("\nWelcome to Cwtch!\n")
|
fmt.Printf("\nWelcome to Cwtch!\n")
|
||||||
fmt.Printf("If this if your first time you should create a profile by running `/new-profile`\n")
|
fmt.Printf("If this if your first time you should create a profile by running `/new-profile`\n")
|
||||||
fmt.Printf("`/load-profiles` will prompt you for a password and load profiles from storage\n")
|
fmt.Printf("`/load-profiles` will prompt you for a password and load profiles from storage\n")
|
||||||
|
@ -283,6 +284,8 @@ func main() {
|
||||||
|
|
||||||
text := prompt.Input(prmpt, completer, prompt.OptionSuggestionBGColor(prompt.Purple),
|
text := prompt.Input(prmpt, completer, prompt.OptionSuggestionBGColor(prompt.Purple),
|
||||||
prompt.OptionDescriptionBGColor(prompt.White),
|
prompt.OptionDescriptionBGColor(prompt.White),
|
||||||
|
prompt.OptionPrefixTextColor(prompt.White),
|
||||||
|
prompt.OptionInputTextColor(prompt.Purple),
|
||||||
prompt.OptionHistory(history))
|
prompt.OptionHistory(history))
|
||||||
|
|
||||||
commands := strings.Split(text[0:], " ")
|
commands := strings.Split(text[0:], " ")
|
||||||
|
|
|
@ -1,20 +1,40 @@
|
||||||
package main
|
package main
|
||||||
|
|
||||||
import (
|
import (
|
||||||
|
"cwtch.im/cwtch/event"
|
||||||
"cwtch.im/cwtch/peer"
|
"cwtch.im/cwtch/peer"
|
||||||
|
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/log"
|
"git.openprivacy.ca/openprivacy/libricochet-go/log"
|
||||||
|
"os"
|
||||||
|
"path"
|
||||||
)
|
)
|
||||||
|
|
||||||
func main() {
|
func main() {
|
||||||
log.AddEverythingFromPattern("peer/alice")
|
|
||||||
alice := peer.NewCwtchPeer("alice")
|
|
||||||
|
|
||||||
processData := func(onion string, data []byte) []byte {
|
// System Setup, We need Tor and Logging up and Running
|
||||||
log.Debugf("Recieved %s from %v", data, onion)
|
log.AddEverythingFromPattern("peer/alice")
|
||||||
return data
|
log.SetLevel(log.LevelDebug)
|
||||||
|
|
||||||
|
acn, err := connectivity.StartTor(path.Join(".", ".cwtch"), "")
|
||||||
|
if err != nil {
|
||||||
|
log.Errorf("\nError connecting to Tor: %v\n", err)
|
||||||
|
os.Exit(1)
|
||||||
}
|
}
|
||||||
|
|
||||||
alice.SetPeerDataHandler(processData)
|
// Setup the Event Bus to Listen for Data Packets
|
||||||
|
eventBus := new(event.Manager)
|
||||||
|
eventBus.Initialize()
|
||||||
|
queue := event.NewEventQueue(100)
|
||||||
|
eventBus.Subscribe(event.NewMessageFromPeer, queue.EventChannel)
|
||||||
|
|
||||||
|
// Setup Alice to Listen for new Events
|
||||||
|
alice := peer.NewCwtchPeer("alice")
|
||||||
|
alice.Init(acn, eventBus)
|
||||||
alice.Listen()
|
alice.Listen()
|
||||||
|
|
||||||
|
// For every new Data Packet Alice recieved she will Print it out.
|
||||||
|
for {
|
||||||
|
event := queue.Next()
|
||||||
|
log.Printf(log.LevelInfo, "Received %v from %v: %s", event.EventType, event.Data["Onion"], event.Data["Data"])
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
|
@ -1,28 +1,41 @@
|
||||||
package main
|
package main
|
||||||
|
|
||||||
import (
|
import (
|
||||||
|
"cwtch.im/cwtch/event"
|
||||||
"cwtch.im/cwtch/peer"
|
"cwtch.im/cwtch/peer"
|
||||||
|
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/log"
|
"git.openprivacy.ca/openprivacy/libricochet-go/log"
|
||||||
"strconv"
|
"os"
|
||||||
|
"path"
|
||||||
"time"
|
"time"
|
||||||
)
|
)
|
||||||
|
|
||||||
func main() {
|
func main() {
|
||||||
|
|
||||||
|
// System Boilerplate, We need Tor Up and Running
|
||||||
log.AddEverythingFromPattern("peer/bob")
|
log.AddEverythingFromPattern("peer/bob")
|
||||||
|
log.SetLevel(log.LevelDebug)
|
||||||
|
acn, err := connectivity.StartTor(path.Join(".", ".cwtch"), "")
|
||||||
|
if err != nil {
|
||||||
|
log.Errorf("\nError connecting to Tor: %v\n", err)
|
||||||
|
os.Exit(1)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Set up the Event Buss and Initialize the Peer
|
||||||
|
eventBus := new(event.Manager)
|
||||||
|
eventBus.Initialize()
|
||||||
bob := peer.NewCwtchPeer("bob")
|
bob := peer.NewCwtchPeer("bob")
|
||||||
counter := 1
|
bob.Init(acn, eventBus)
|
||||||
|
|
||||||
bob.SetPeerDataHandler(func(onion string, data []byte) []byte {
|
// Add Alice's Onion Here (It changes run to run)
|
||||||
log.Infof("Recieved %s from %v", data, onion)
|
bob.PeerWithOnion("upiztu7myymjf2dn4x4czhagp7axlnqjvf5zwfegbhtpkqb6v3vgu5yd")
|
||||||
counter++
|
|
||||||
return []byte(strconv.Itoa(counter))
|
|
||||||
})
|
|
||||||
connection := bob.PeerWithOnion("f4b6thuwmfszsqd3fzqpr45sdem4qoazdlzr2xmnc7fq22qe746hjqqd")
|
|
||||||
|
|
||||||
|
// Send the Message...
|
||||||
log.Infof("Waiting for Bob to Connect to Alice...")
|
log.Infof("Waiting for Bob to Connect to Alice...")
|
||||||
connection.SendPacket([]byte("Hello Alice!!!"))
|
bob.SendMessageToPeer("upiztu7myymjf2dn4x4czhagp7axlnqjvf5zwfegbhtpkqb6v3vgu5yd", "Hello Alice!!!")
|
||||||
|
|
||||||
// Wait a while...
|
// Wait a while...
|
||||||
|
// Everything is run in a goroutine so the main thread has to stay active
|
||||||
time.Sleep(time.Second * 100)
|
time.Sleep(time.Second * 100)
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|
|
@ -0,0 +1,31 @@
|
||||||
|
package event
|
||||||
|
|
||||||
|
// Queue is a wrapper around a channel for handling Events in a consistent way across subsystems.
|
||||||
|
// The expectation is that each subsystem in Cwtch will manage a given an event.Queue fed from
|
||||||
|
// the event.Manager.
|
||||||
|
type Queue struct {
|
||||||
|
EventChannel chan Event
|
||||||
|
}
|
||||||
|
|
||||||
|
// NewEventQueue initializes an event.Queue of the given buffer size.
|
||||||
|
func NewEventQueue(buffer int) *Queue {
|
||||||
|
queue := new(Queue)
|
||||||
|
queue.EventChannel = make(chan Event, buffer)
|
||||||
|
return queue
|
||||||
|
}
|
||||||
|
|
||||||
|
// Backlog returns the length of the queue backlog
|
||||||
|
func (eq *Queue) Backlog() int {
|
||||||
|
return len(eq.EventChannel)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Next returns the next available event from the front of the queue
|
||||||
|
func (eq *Queue) Next() (event Event) {
|
||||||
|
event = <-eq.EventChannel
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
// Shutdown closes our EventChannel
|
||||||
|
func (eq *Queue) Shutdown() {
|
||||||
|
close(eq.EventChannel)
|
||||||
|
}
|
|
@ -0,0 +1,27 @@
|
||||||
|
package event
|
||||||
|
|
||||||
|
// Type captures the definition of many common Cwtch application events
|
||||||
|
type Type string
|
||||||
|
|
||||||
|
// Defining Common Event Types
|
||||||
|
const (
|
||||||
|
StatusRequest = Type("StatusRequest")
|
||||||
|
ProtocolEngineStatus = Type("ProtocolEngineStatus")
|
||||||
|
|
||||||
|
PeerRequest = Type("PeerRequest")
|
||||||
|
BlockPeer = Type("BlockPeer")
|
||||||
|
JoinServer = Type("JoinServer")
|
||||||
|
|
||||||
|
ProtocolEngineStartListen = Type("ProtocolEngineStartListen")
|
||||||
|
ProtocolEngineStopped = Type("ProtocolEngineStopped")
|
||||||
|
|
||||||
|
InvitePeerToGroup = Type("InvitePeerToGroup")
|
||||||
|
NewGroupInvite = Type("NewGroupInvite")
|
||||||
|
|
||||||
|
SendMessageToGroup = Type("SendMessagetoGroup")
|
||||||
|
EncryptedGroupMessage = Type("EncryptedGroupMessage")
|
||||||
|
NewMessageFromGroup = Type("NewMessageFromGroup")
|
||||||
|
|
||||||
|
SendMessageToPeer = Type("SendMessageToPeer")
|
||||||
|
NewMessageFromPeer = Type("NewMessageFromPeer")
|
||||||
|
)
|
|
@ -0,0 +1,90 @@
|
||||||
|
package event
|
||||||
|
|
||||||
|
import (
|
||||||
|
"git.openprivacy.ca/openprivacy/libricochet-go/log"
|
||||||
|
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||||
|
"sync"
|
||||||
|
)
|
||||||
|
|
||||||
|
// Event is a structure which binds a given set of data to an Type
|
||||||
|
type Event struct {
|
||||||
|
EventType Type
|
||||||
|
EventID string
|
||||||
|
Data map[string]string
|
||||||
|
}
|
||||||
|
|
||||||
|
// NewEvent creates a new event object with a unique ID and the given type and data.
|
||||||
|
func NewEvent(eventType Type, data map[string]string) Event {
|
||||||
|
return Event{EventType: eventType, EventID: utils.GetRandNumber().String(), Data: data}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Manager is an Event Bus which allows subsystems to subscribe to certain EventTypes and publish others.
|
||||||
|
type Manager struct {
|
||||||
|
subscribers map[Type][]chan Event
|
||||||
|
events chan Event
|
||||||
|
mapMutex sync.Mutex
|
||||||
|
internal chan bool
|
||||||
|
}
|
||||||
|
|
||||||
|
// Initialize sets up the Manager.
|
||||||
|
func (em *Manager) Initialize() {
|
||||||
|
em.subscribers = make(map[Type][]chan Event)
|
||||||
|
em.events = make(chan Event)
|
||||||
|
em.internal = make(chan bool)
|
||||||
|
go em.eventBus()
|
||||||
|
}
|
||||||
|
|
||||||
|
// Subscribe takes an eventType and an Channel and associates them in the eventBus. All future events of that type
|
||||||
|
// will be sent to the eventChannel.
|
||||||
|
func (em *Manager) Subscribe(eventType Type, eventChannel chan Event) {
|
||||||
|
em.mapMutex.Lock()
|
||||||
|
defer em.mapMutex.Unlock()
|
||||||
|
em.subscribers[eventType] = append(em.subscribers[eventType], eventChannel)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Publish takes an Event and sends it to the internal eventBus where it is distributed to all Subscribers
|
||||||
|
func (em *Manager) Publish(event Event) {
|
||||||
|
if event.EventType != "" {
|
||||||
|
em.events <- event
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// eventBus is an internal function that is used to distribute events to all subscribers
|
||||||
|
func (em *Manager) eventBus() {
|
||||||
|
for {
|
||||||
|
event := <-em.events
|
||||||
|
|
||||||
|
// In the case on an empty event. Teardown the Queue
|
||||||
|
if event.EventType == "" {
|
||||||
|
break
|
||||||
|
}
|
||||||
|
|
||||||
|
// maps aren't thread safe
|
||||||
|
em.mapMutex.Lock()
|
||||||
|
subscribers := em.subscribers[event.EventType]
|
||||||
|
em.mapMutex.Unlock()
|
||||||
|
|
||||||
|
// Send the event to any subscribers to that event type
|
||||||
|
for _, subscriber := range subscribers {
|
||||||
|
select {
|
||||||
|
case subscriber <- event:
|
||||||
|
log.Debugf("Sending %v to %v", event.EventType, subscriber)
|
||||||
|
default:
|
||||||
|
log.Errorf("Failed to send %v to %v. The subsystem might be running too slow!", event.EventType, subscriber)
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// We are about to exit the eventbus thread, fire off an event internally
|
||||||
|
em.internal <- true
|
||||||
|
}
|
||||||
|
|
||||||
|
// Shutdown triggers, and waits for, the internal eventBus goroutine to finish
|
||||||
|
func (em *Manager) Shutdown() {
|
||||||
|
em.events <- Event{}
|
||||||
|
// wait for eventBus to finish
|
||||||
|
<-em.internal
|
||||||
|
close(em.events)
|
||||||
|
close(em.internal)
|
||||||
|
}
|
|
@ -0,0 +1,104 @@
|
||||||
|
package event
|
||||||
|
|
||||||
|
import (
|
||||||
|
"git.openprivacy.ca/openprivacy/libricochet-go/log"
|
||||||
|
"testing"
|
||||||
|
"time"
|
||||||
|
)
|
||||||
|
|
||||||
|
// Most basic Manager Test, Initialize, Subscribe, Publish, Receive
|
||||||
|
func TestEventManager(t *testing.T) {
|
||||||
|
eventManager := new(Manager)
|
||||||
|
eventManager.Initialize()
|
||||||
|
|
||||||
|
// We need to make this buffer at least 1, otherwise we will log an error!
|
||||||
|
testChan := make(chan Event, 1)
|
||||||
|
eventManager.Subscribe("TEST", testChan)
|
||||||
|
eventManager.Publish(Event{EventType: "TEST", Data: map[string]string{"Value": "Hello World"}})
|
||||||
|
|
||||||
|
event := <-testChan
|
||||||
|
if event.EventType == "TEST" && event.Data["Value"] == "Hello World" {
|
||||||
|
|
||||||
|
} else {
|
||||||
|
t.Errorf("Received Invalid Event")
|
||||||
|
}
|
||||||
|
|
||||||
|
eventManager.Shutdown()
|
||||||
|
}
|
||||||
|
|
||||||
|
// Most basic Manager Test, Initialize, Subscribe, Publish, Receive
|
||||||
|
func TestEventManagerOverflow(t *testing.T) {
|
||||||
|
eventManager := new(Manager)
|
||||||
|
eventManager.Initialize()
|
||||||
|
|
||||||
|
// Explicitly setting this to 0 log an error!
|
||||||
|
testChan := make(chan Event)
|
||||||
|
eventManager.Subscribe("TEST", testChan)
|
||||||
|
eventManager.Publish(Event{EventType: "TEST"})
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestEventManagerMultiple(t *testing.T) {
|
||||||
|
log.SetLevel(log.LevelDebug)
|
||||||
|
eventManager := new(Manager)
|
||||||
|
eventManager.Initialize()
|
||||||
|
|
||||||
|
groupEventQueue := NewEventQueue(10)
|
||||||
|
peerEventQueue := NewEventQueue(10)
|
||||||
|
allEventQueue := NewEventQueue(10)
|
||||||
|
|
||||||
|
eventManager.Subscribe("PeerEvent", peerEventQueue.EventChannel)
|
||||||
|
eventManager.Subscribe("GroupEvent", groupEventQueue.EventChannel)
|
||||||
|
eventManager.Subscribe("PeerEvent", allEventQueue.EventChannel)
|
||||||
|
eventManager.Subscribe("GroupEvent", allEventQueue.EventChannel)
|
||||||
|
eventManager.Subscribe("ErrorEvent", allEventQueue.EventChannel)
|
||||||
|
|
||||||
|
eventManager.Publish(Event{EventType: "PeerEvent", Data: map[string]string{"Value": "Hello World Peer"}})
|
||||||
|
eventManager.Publish(Event{EventType: "GroupEvent", Data: map[string]string{"Value": "Hello World Group"}})
|
||||||
|
eventManager.Publish(Event{EventType: "PeerEvent", Data: map[string]string{"Value": "Hello World Peer"}})
|
||||||
|
eventManager.Publish(Event{EventType: "ErrorEvent", Data: map[string]string{"Value": "Hello World Error"}})
|
||||||
|
eventManager.Publish(Event{EventType: "NobodyIsSubscribedToThisEvent", Data: map[string]string{"Value": "Noone should see this!"}})
|
||||||
|
|
||||||
|
assertLength := func(len int, expected int, label string) {
|
||||||
|
if len != expected {
|
||||||
|
t.Errorf("Expected %s to be %v was %v", label, expected, len)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
time.Sleep(time.Second)
|
||||||
|
|
||||||
|
assertLength(groupEventQueue.Backlog(), 1, "Group Event Queue Length")
|
||||||
|
assertLength(peerEventQueue.Backlog(), 2, "Peer Event Queue Length")
|
||||||
|
assertLength(allEventQueue.Backlog(), 4, "All Event Queue Length")
|
||||||
|
|
||||||
|
checkEvent := func(eventType Type, expected Type, label string) {
|
||||||
|
if eventType != expected {
|
||||||
|
t.Errorf("Expected %s to be %v was %v", label, expected, eventType)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
event := groupEventQueue.Next()
|
||||||
|
checkEvent(event.EventType, "GroupEvent", "First Group Event")
|
||||||
|
|
||||||
|
event = peerEventQueue.Next()
|
||||||
|
checkEvent(event.EventType, "PeerEvent", "First Peer Event")
|
||||||
|
event = peerEventQueue.Next()
|
||||||
|
checkEvent(event.EventType, "PeerEvent", "Second Peer Event")
|
||||||
|
|
||||||
|
event = allEventQueue.Next()
|
||||||
|
checkEvent(event.EventType, "PeerEvent", "ALL: First Peer Event")
|
||||||
|
event = allEventQueue.Next()
|
||||||
|
checkEvent(event.EventType, "GroupEvent", "ALL: First Group Event")
|
||||||
|
event = allEventQueue.Next()
|
||||||
|
checkEvent(event.EventType, "PeerEvent", "ALL: Second Peer Event")
|
||||||
|
event = allEventQueue.Next()
|
||||||
|
checkEvent(event.EventType, "ErrorEvent", "ALL: First Error Event")
|
||||||
|
|
||||||
|
eventManager.Shutdown()
|
||||||
|
groupEventQueue.Shutdown()
|
||||||
|
peerEventQueue.Shutdown()
|
||||||
|
allEventQueue.Shutdown()
|
||||||
|
|
||||||
|
// Reading from a closed queue should result in an instant return and an empty event
|
||||||
|
event = groupEventQueue.Next()
|
||||||
|
checkEvent(event.EventType, "", "Test Next() on Empty Queue")
|
||||||
|
}
|
|
@ -80,12 +80,12 @@ func TestTranscriptConsistency(t *testing.T) {
|
||||||
c5, s5, _ := alice.EncryptMessageToGroup("Hello World 5", group.GroupID)
|
c5, s5, _ := alice.EncryptMessageToGroup("Hello World 5", group.GroupID)
|
||||||
t.Logf("Length of Encrypted Message: %v", len(c5))
|
t.Logf("Length of Encrypted Message: %v", len(c5))
|
||||||
|
|
||||||
_, m1 := sarah.AttemptDecryption(c1, s1)
|
_, _, m1 := sarah.AttemptDecryption(c1, s1)
|
||||||
sarah.AttemptDecryption(c1, s1) // Try a duplicate
|
sarah.AttemptDecryption(c1, s1) // Try a duplicate
|
||||||
_, m2 := sarah.AttemptDecryption(c2, s2)
|
_, _, m2 := sarah.AttemptDecryption(c2, s2)
|
||||||
_, m3 := sarah.AttemptDecryption(c3, s3)
|
_, _, m3 := sarah.AttemptDecryption(c3, s3)
|
||||||
_, m4 := sarah.AttemptDecryption(c4, s4)
|
_, _, m4 := sarah.AttemptDecryption(c4, s4)
|
||||||
_, m5 := sarah.AttemptDecryption(c5, s5)
|
_, _, m5 := sarah.AttemptDecryption(c5, s5)
|
||||||
|
|
||||||
// Now we simulate a client receiving these messages completely out of order
|
// Now we simulate a client receiving these messages completely out of order
|
||||||
timeline.Insert(m1)
|
timeline.Insert(m1)
|
||||||
|
|
|
@ -314,7 +314,7 @@ func (p *Profile) AddGroup(group *Group) {
|
||||||
}
|
}
|
||||||
|
|
||||||
// AttemptDecryption takes a ciphertext and signature and attempts to decrypt it under known groups.
|
// AttemptDecryption takes a ciphertext and signature and attempts to decrypt it under known groups.
|
||||||
func (p *Profile) AttemptDecryption(ciphertext []byte, signature []byte) (bool, *Message) {
|
func (p *Profile) AttemptDecryption(ciphertext []byte, signature []byte) (bool, string, *Message) {
|
||||||
for _, group := range p.Groups {
|
for _, group := range p.Groups {
|
||||||
success, dgm := group.DecryptMessage(ciphertext)
|
success, dgm := group.DecryptMessage(ciphertext)
|
||||||
if success {
|
if success {
|
||||||
|
@ -329,7 +329,7 @@ func (p *Profile) AttemptDecryption(ciphertext []byte, signature []byte) (bool,
|
||||||
// We set the flag to be handled by the UX and reject the message.
|
// We set the flag to be handled by the UX and reject the message.
|
||||||
if !valid {
|
if !valid {
|
||||||
group.Compromised()
|
group.Compromised()
|
||||||
return false, nil
|
return false, "", nil
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -340,13 +340,13 @@ func (p *Profile) AttemptDecryption(ciphertext []byte, signature []byte) (bool,
|
||||||
// Either way, someone who has the private key is being detectably bad so we are just going to throw this message away and mark the group as Compromised.
|
// Either way, someone who has the private key is being detectably bad so we are just going to throw this message away and mark the group as Compromised.
|
||||||
if !verified {
|
if !verified {
|
||||||
group.Compromised()
|
group.Compromised()
|
||||||
return false, nil
|
return false, "", nil
|
||||||
}
|
}
|
||||||
|
|
||||||
return true, group.AddMessage(dgm, signature)
|
return true, group.GroupID, group.AddMessage(dgm, signature)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
return false, nil
|
return false, "", nil
|
||||||
}
|
}
|
||||||
|
|
||||||
func getRandomness(arr *[]byte) {
|
func getRandomness(arr *[]byte) {
|
||||||
|
|
|
@ -161,13 +161,13 @@ func TestProfileGroup(t *testing.T) {
|
||||||
bob.ProcessInvite(gci2.GetGroupChatInvite(), alice.Onion)
|
bob.ProcessInvite(gci2.GetGroupChatInvite(), alice.Onion)
|
||||||
c3, s3, err := bob.EncryptMessageToGroup("Bobs Message", group2.GroupID)
|
c3, s3, err := bob.EncryptMessageToGroup("Bobs Message", group2.GroupID)
|
||||||
if err == nil {
|
if err == nil {
|
||||||
ok, message := alice.AttemptDecryption(c3, s3)
|
ok, _, message := alice.AttemptDecryption(c3, s3)
|
||||||
if !ok {
|
if !ok {
|
||||||
t.Errorf("Bobs message to the group should be decrypted %v %v", message, ok)
|
t.Errorf("Bobs message to the group should be decrypted %v %v", message, ok)
|
||||||
}
|
}
|
||||||
|
|
||||||
eve := GenerateNewProfile("eve")
|
eve := GenerateNewProfile("eve")
|
||||||
ok, _ = eve.AttemptDecryption(c3, s3)
|
ok, _, _ = eve.AttemptDecryption(c3, s3)
|
||||||
if ok {
|
if ok {
|
||||||
t.Errorf("Eves hould not be able to decrypt messages!")
|
t.Errorf("Eves hould not be able to decrypt messages!")
|
||||||
}
|
}
|
||||||
|
|
|
@ -1,48 +1,41 @@
|
||||||
package peer
|
package peer
|
||||||
|
|
||||||
import (
|
import (
|
||||||
"crypto/rsa"
|
"cwtch.im/cwtch/event"
|
||||||
"cwtch.im/cwtch/model"
|
"cwtch.im/cwtch/model"
|
||||||
"cwtch.im/cwtch/peer/connections"
|
|
||||||
"cwtch.im/cwtch/peer/peer"
|
|
||||||
"cwtch.im/cwtch/protocol"
|
"cwtch.im/cwtch/protocol"
|
||||||
|
"cwtch.im/cwtch/protocol/connections"
|
||||||
"encoding/base64"
|
"encoding/base64"
|
||||||
"errors"
|
"errors"
|
||||||
"fmt"
|
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/application"
|
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/connection"
|
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/identity"
|
"git.openprivacy.ca/openprivacy/libricochet-go/identity"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/log"
|
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||||
|
"github.com/ethereum/go-ethereum/log"
|
||||||
"github.com/golang/protobuf/proto"
|
"github.com/golang/protobuf/proto"
|
||||||
"golang.org/x/crypto/ed25519"
|
"golang.org/x/crypto/ed25519"
|
||||||
"strings"
|
"strings"
|
||||||
"sync"
|
"sync"
|
||||||
"time"
|
|
||||||
)
|
)
|
||||||
|
|
||||||
// cwtchPeer manages incoming and outgoing connections and all processing for a Cwtch cwtchPeer
|
// cwtchPeer manages incoming and outgoing connections and all processing for a Cwtch cwtchPeer
|
||||||
type cwtchPeer struct {
|
type cwtchPeer struct {
|
||||||
connection.AutoConnectionHandler
|
|
||||||
Profile *model.Profile
|
Profile *model.Profile
|
||||||
app *application.RicochetApplication
|
|
||||||
acn connectivity.ACN
|
|
||||||
mutex sync.Mutex
|
mutex sync.Mutex
|
||||||
connectionsManager *connections.Manager
|
|
||||||
dataHandler func(string, []byte) []byte
|
|
||||||
shutdown bool
|
shutdown bool
|
||||||
aif application.ApplicationInstanceFactory
|
|
||||||
started bool
|
started bool
|
||||||
|
|
||||||
|
engine *connections.Engine
|
||||||
|
queue *event.Queue
|
||||||
|
eventBus *event.Manager
|
||||||
}
|
}
|
||||||
|
|
||||||
// CwtchPeer provides us with a way of testing systems built on top of cwtch without having to
|
// CwtchPeer provides us with a way of testing systems built on top of cwtch without having to
|
||||||
// directly implement a cwtchPeer.
|
// directly implement a cwtchPeer.
|
||||||
type CwtchPeer interface {
|
type CwtchPeer interface {
|
||||||
Init(connectivity.ACN)
|
Init(connectivity.ACN, *event.Manager)
|
||||||
PeerWithOnion(string) *connections.PeerPeerConnection
|
PeerWithOnion(string) *connections.PeerPeerConnection
|
||||||
InviteOnionToGroup(string, string) error
|
InviteOnionToGroup(string, string) error
|
||||||
|
SendMessageToPeer(string, string)
|
||||||
|
|
||||||
TrustPeer(string) error
|
TrustPeer(string) error
|
||||||
BlockPeer(string) error
|
BlockPeer(string) error
|
||||||
|
@ -67,9 +60,6 @@ type CwtchPeer interface {
|
||||||
GetContacts() []string
|
GetContacts() []string
|
||||||
GetContact(string) *model.PublicProfile
|
GetContact(string) *model.PublicProfile
|
||||||
|
|
||||||
SetApplicationInstanceFactory(factory application.ApplicationInstanceFactory)
|
|
||||||
SetPeerDataHandler(func(string, []byte) []byte)
|
|
||||||
|
|
||||||
IsStarted() bool
|
IsStarted() bool
|
||||||
Listen()
|
Listen()
|
||||||
Shutdown()
|
Shutdown()
|
||||||
|
@ -91,10 +81,17 @@ func FromProfile(profile *model.Profile) CwtchPeer {
|
||||||
}
|
}
|
||||||
|
|
||||||
// Init instantiates a cwtchPeer
|
// Init instantiates a cwtchPeer
|
||||||
func (cp *cwtchPeer) Init(acn connectivity.ACN) {
|
func (cp *cwtchPeer) Init(acn connectivity.ACN, eventBus *event.Manager) {
|
||||||
cp.acn = acn
|
cp.queue = event.NewEventQueue(100)
|
||||||
cp.connectionsManager = connections.NewConnectionsManager(cp.acn)
|
go cp.eventHandler()
|
||||||
go cp.connectionsManager.AttemptReconnections()
|
|
||||||
|
cp.eventBus = eventBus
|
||||||
|
cp.eventBus.Subscribe(event.EncryptedGroupMessage, cp.queue.EventChannel)
|
||||||
|
cp.eventBus.Subscribe(event.NewGroupInvite, cp.queue.EventChannel)
|
||||||
|
|
||||||
|
// TODO: Would be nice if ProtocolEngine did not need to explictly be given the Private Key.
|
||||||
|
cp.engine = connections.NewProtocolEngine(cp.Profile.Ed25519PrivateKey, acn, eventBus)
|
||||||
|
cp.engine.Identity = identity.InitializeV3(cp.Profile.Name, &cp.Profile.Ed25519PrivateKey, &cp.Profile.Ed25519PublicKey)
|
||||||
}
|
}
|
||||||
|
|
||||||
// ImportGroup intializes a group from an imported source rather than a peer invite
|
// ImportGroup intializes a group from an imported source rather than a peer invite
|
||||||
|
@ -121,20 +118,6 @@ func (cp *cwtchPeer) ImportGroup(exportedInvite string) (groupID string, err err
|
||||||
return
|
return
|
||||||
}
|
}
|
||||||
|
|
||||||
// a handler for the optional data handler
|
|
||||||
// note that the "correct" way to do this would be to AddChannelHandler("im.cwtch.peerdata", ...") but peerdata is such
|
|
||||||
// a handy channel that it's nice to have this convenience shortcut
|
|
||||||
// SetPeerDataHandler sets the handler for the (optional) data channel for cwtch peers.
|
|
||||||
func (cp *cwtchPeer) SetPeerDataHandler(dataHandler func(string, []byte) []byte) {
|
|
||||||
cp.dataHandler = dataHandler
|
|
||||||
}
|
|
||||||
|
|
||||||
// add extra channel handlers (note that the peer will merge these with the ones necessary to make cwtch work, so you
|
|
||||||
// are not clobbering the underlying functionality)
|
|
||||||
func (cp *cwtchPeer) SetApplicationInstanceFactory(aif application.ApplicationInstanceFactory) {
|
|
||||||
cp.aif = aif
|
|
||||||
}
|
|
||||||
|
|
||||||
// ExportGroup serializes a group invite so it can be given offline
|
// ExportGroup serializes a group invite so it can be given offline
|
||||||
func (cp *cwtchPeer) ExportGroup(groupID string) (string, error) {
|
func (cp *cwtchPeer) ExportGroup(groupID string) (string, error) {
|
||||||
group := cp.Profile.GetGroupByGroupID(groupID)
|
group := cp.Profile.GetGroupByGroupID(groupID)
|
||||||
|
@ -180,81 +163,62 @@ func (cp *cwtchPeer) GetContact(onion string) *model.PublicProfile {
|
||||||
}
|
}
|
||||||
|
|
||||||
// GetProfile returns the profile associated with this cwtchPeer.
|
// GetProfile returns the profile associated with this cwtchPeer.
|
||||||
// TODO While it is probably "safe", it is not really "safe", to call functions on this profile. This only exists to return things like Name and Onion,we should gate these.
|
|
||||||
func (cp *cwtchPeer) GetProfile() *model.Profile {
|
func (cp *cwtchPeer) GetProfile() *model.Profile {
|
||||||
return cp.Profile
|
return cp.Profile
|
||||||
}
|
}
|
||||||
|
|
||||||
// PeerWithOnion is the entry point for cwtchPeer relationships
|
// PeerWithOnion is the entry point for cwtchPeer relationships
|
||||||
func (cp *cwtchPeer) PeerWithOnion(onion string) *connections.PeerPeerConnection {
|
func (cp *cwtchPeer) PeerWithOnion(onion string) *connections.PeerPeerConnection {
|
||||||
return cp.connectionsManager.ManagePeerConnection(onion, cp.Profile, cp.dataHandler, cp.aif)
|
cp.eventBus.Publish(event.NewEvent(event.PeerRequest, map[string]string{"Onion": onion}))
|
||||||
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// InviteOnionToGroup kicks off the invite process
|
// InviteOnionToGroup kicks off the invite process
|
||||||
func (cp *cwtchPeer) InviteOnionToGroup(onion string, groupid string) error {
|
func (cp *cwtchPeer) InviteOnionToGroup(onion string, groupid string) error {
|
||||||
|
|
||||||
group := cp.Profile.GetGroupByGroupID(groupid)
|
group := cp.Profile.GetGroupByGroupID(groupid)
|
||||||
if group != nil {
|
if group == nil {
|
||||||
log.Infof("Constructing invite for group: %v\n", group)
|
return errors.New("invalid group id")
|
||||||
invite, err := group.Invite(group.GetInitialMessage())
|
|
||||||
if err != nil {
|
|
||||||
return err
|
|
||||||
}
|
|
||||||
ppc := cp.connectionsManager.GetPeerPeerConnectionForOnion(onion)
|
|
||||||
if ppc == nil {
|
|
||||||
return errors.New("peer connection not setup for onion. peers must be trusted before sending")
|
|
||||||
}
|
|
||||||
if ppc.GetState() == connections.AUTHENTICATED {
|
|
||||||
log.Infof("Got connection for group: %v - Sending Invite\n", ppc)
|
|
||||||
ppc.SendGroupInvite(invite)
|
|
||||||
} else {
|
|
||||||
return errors.New("cannot send invite to onion: peer connection is not ready")
|
|
||||||
}
|
|
||||||
return nil
|
|
||||||
}
|
|
||||||
return errors.New("group id could not be found")
|
|
||||||
}
|
}
|
||||||
|
|
||||||
// ReceiveGroupMessage is a callback function that processes GroupMessages from a given server
|
invite, err := group.Invite(group.InitialMessage)
|
||||||
func (cp *cwtchPeer) ReceiveGroupMessage(server string, gm *protocol.GroupMessage) {
|
if err == nil {
|
||||||
cp.Profile.AttemptDecryption(gm.Ciphertext, gm.Signature)
|
cp.eventBus.Publish(event.NewEvent(event.InvitePeerToGroup, map[string]string{"Onion": onion, "Invite": string(invite)}))
|
||||||
|
}
|
||||||
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
// JoinServer manages a new server connection with the given onion address
|
// JoinServer manages a new server connection with the given onion address
|
||||||
func (cp *cwtchPeer) JoinServer(onion string) {
|
func (cp *cwtchPeer) JoinServer(onion string) {
|
||||||
cp.connectionsManager.ManageServerConnection(onion, cp.ReceiveGroupMessage)
|
cp.eventBus.Publish(event.NewEvent(event.JoinServer, map[string]string{"Onion": onion}))
|
||||||
}
|
}
|
||||||
|
|
||||||
// SendMessageToGroup attemps to sent the given message to the given group id.
|
// SendMessageToGroup attemps to sent the given message to the given group id.
|
||||||
func (cp *cwtchPeer) SendMessageToGroup(groupid string, message string) error {
|
func (cp *cwtchPeer) SendMessageToGroup(groupid string, message string) error {
|
||||||
group := cp.Profile.GetGroupByGroupID(groupid)
|
group := cp.Profile.GetGroupByGroupID(groupid)
|
||||||
if group == nil {
|
if group == nil {
|
||||||
return errors.New("group does not exist")
|
return errors.New("invalid group id")
|
||||||
}
|
|
||||||
psc := cp.connectionsManager.GetPeerServerConnectionForOnion(group.GroupServer)
|
|
||||||
if psc == nil {
|
|
||||||
return errors.New("could not find server connection to send message to")
|
|
||||||
}
|
}
|
||||||
ct, sig, err := cp.Profile.EncryptMessageToGroup(message, groupid)
|
ct, sig, err := cp.Profile.EncryptMessageToGroup(message, groupid)
|
||||||
if err != nil {
|
|
||||||
|
if err == nil {
|
||||||
|
cp.eventBus.Publish(event.NewEvent(event.SendMessageToGroup, map[string]string{"Server": group.GroupServer, "Ciphertext": string(ct), "Signature": string(sig)}))
|
||||||
|
}
|
||||||
|
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
gm := &protocol.GroupMessage{
|
|
||||||
Ciphertext: ct,
|
func (cp *cwtchPeer) SendMessageToPeer(onion string, message string) {
|
||||||
Signature: sig,
|
cp.eventBus.Publish(event.NewEvent(event.SendMessageToPeer, map[string]string{"Peer": onion, "Message": message}))
|
||||||
}
|
|
||||||
err = psc.SendGroupMessage(gm)
|
|
||||||
return err
|
|
||||||
}
|
}
|
||||||
|
|
||||||
// GetPeers returns a list of peer connections.
|
// GetPeers returns a list of peer connections.
|
||||||
func (cp *cwtchPeer) GetPeers() map[string]connections.ConnectionState {
|
func (cp *cwtchPeer) GetPeers() map[string]connections.ConnectionState {
|
||||||
return cp.connectionsManager.GetPeers()
|
return cp.engine.GetPeers()
|
||||||
}
|
}
|
||||||
|
|
||||||
// GetServers returns a list of server connections
|
// GetServers returns a list of server connections
|
||||||
func (cp *cwtchPeer) GetServers() map[string]connections.ConnectionState {
|
func (cp *cwtchPeer) GetServers() map[string]connections.ConnectionState {
|
||||||
return cp.connectionsManager.GetServers()
|
return cp.engine.GetServers()
|
||||||
}
|
}
|
||||||
|
|
||||||
// TrustPeer sets an existing peer relationship to trusted
|
// TrustPeer sets an existing peer relationship to trusted
|
||||||
|
@ -269,7 +233,7 @@ func (cp *cwtchPeer) TrustPeer(peer string) error {
|
||||||
// BlockPeer blocks an existing peer relationship.
|
// BlockPeer blocks an existing peer relationship.
|
||||||
func (cp *cwtchPeer) BlockPeer(peer string) error {
|
func (cp *cwtchPeer) BlockPeer(peer string) error {
|
||||||
err := cp.Profile.BlockPeer(peer)
|
err := cp.Profile.BlockPeer(peer)
|
||||||
cp.connectionsManager.ClosePeerConnection(peer)
|
cp.eventBus.Publish(event.NewEvent(event.BlockPeer, map[string]string{"Onion": peer}))
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -283,90 +247,15 @@ func (cp *cwtchPeer) RejectInvite(groupID string) {
|
||||||
cp.Profile.RejectInvite(groupID)
|
cp.Profile.RejectInvite(groupID)
|
||||||
}
|
}
|
||||||
|
|
||||||
// LookupContact returns that a contact is known and allowed to communicate for all cases.
|
|
||||||
func (cp *cwtchPeer) LookupContact(hostname string, publicKey rsa.PublicKey) (allowed, known bool) {
|
|
||||||
blocked := cp.Profile.IsBlocked(hostname)
|
|
||||||
return !blocked, true
|
|
||||||
}
|
|
||||||
|
|
||||||
// LookupContactV3 returns that a contact is known and allowed to communicate for all cases.
|
|
||||||
func (cp *cwtchPeer) LookupContactV3(hostname string, publicKey ed25519.PublicKey) (allowed, known bool) {
|
|
||||||
blocked := cp.Profile.IsBlocked(hostname)
|
|
||||||
return !blocked, true
|
|
||||||
}
|
|
||||||
|
|
||||||
// ContactRequest needed to implement ContactRequestHandler Interface
|
|
||||||
func (cp *cwtchPeer) ContactRequest(name string, message string) string {
|
|
||||||
return "Accepted"
|
|
||||||
}
|
|
||||||
|
|
||||||
func (cp *cwtchPeer) Listen() {
|
func (cp *cwtchPeer) Listen() {
|
||||||
go func() {
|
cp.eventBus.Publish(event.NewEvent(event.ProtocolEngineStartListen, map[string]string{}))
|
||||||
for !cp.shutdown {
|
|
||||||
e := cp.listenFn()
|
|
||||||
if e != nil {
|
|
||||||
// TODO: was panic, then fatal
|
|
||||||
fmt.Printf("ERROR: peer %v has crashed with: %v\n", cp.GetProfile().Onion, e)
|
|
||||||
}
|
|
||||||
// listenFn failed, wait 5 seconds and try again
|
|
||||||
time.Sleep(5 * time.Second)
|
|
||||||
}
|
|
||||||
}()
|
|
||||||
}
|
|
||||||
|
|
||||||
// Listen sets up an onion listener to process incoming cwtch messages
|
|
||||||
func (cp *cwtchPeer) listenFn() error {
|
|
||||||
ra := new(application.RicochetApplication)
|
|
||||||
onionService, err := cp.acn.Listen(cp.Profile.Ed25519PrivateKey, application.RicochetPort)
|
|
||||||
if err != nil /*&& fmt.Sprintf("%v", err) != "550 Unspecified Tor error: Onion address collision"*/ {
|
|
||||||
return err
|
|
||||||
}
|
|
||||||
|
|
||||||
af := application.ApplicationInstanceFactory{}
|
|
||||||
af.Init()
|
|
||||||
af.AddHandler("im.cwtch.peer", func(rai *application.ApplicationInstance) func() channels.Handler {
|
|
||||||
cpi := new(CwtchPeerInstance)
|
|
||||||
cpi.Init(rai, ra)
|
|
||||||
return func() channels.Handler {
|
|
||||||
cpc := new(peer.CwtchPeerChannel)
|
|
||||||
cpc.Handler = &CwtchPeerHandler{Onion: rai.RemoteHostname, Peer: cp}
|
|
||||||
return cpc
|
|
||||||
}
|
|
||||||
})
|
|
||||||
|
|
||||||
if cp.dataHandler != nil {
|
|
||||||
af.AddHandler("im.cwtch.peer.data", func(rai *application.ApplicationInstance) func() channels.Handler {
|
|
||||||
cpi := new(CwtchPeerInstance)
|
|
||||||
cpi.Init(rai, ra)
|
|
||||||
return func() channels.Handler {
|
|
||||||
cpc := new(peer.CwtchPeerDataChannel)
|
|
||||||
cpc.Handler = &CwtchPeerHandler{Onion: rai.RemoteHostname, Peer: cp, DataHandler: cp.dataHandler}
|
|
||||||
return cpc
|
|
||||||
}
|
|
||||||
})
|
|
||||||
}
|
|
||||||
|
|
||||||
handlers := cp.aif.GetHandlers()
|
|
||||||
for i := range handlers {
|
|
||||||
af.AddHandler(handlers[i], cp.aif.GetHandler(handlers[i]))
|
|
||||||
}
|
|
||||||
|
|
||||||
ra.Init(cp.acn, cp.Profile.Name, identity.InitializeV3(cp.Profile.Name, &cp.Profile.Ed25519PrivateKey, &cp.Profile.Ed25519PublicKey), af, cp)
|
|
||||||
log.Infof("Running cwtch peer on %v", onionService.AddressFull())
|
|
||||||
cp.app = ra
|
|
||||||
cp.started = true
|
|
||||||
ra.Run(onionService)
|
|
||||||
|
|
||||||
return nil
|
|
||||||
}
|
}
|
||||||
|
|
||||||
// Shutdown kills all connections and cleans up all goroutines for the peer
|
// Shutdown kills all connections and cleans up all goroutines for the peer
|
||||||
func (cp *cwtchPeer) Shutdown() {
|
func (cp *cwtchPeer) Shutdown() {
|
||||||
cp.shutdown = true
|
cp.shutdown = true
|
||||||
cp.connectionsManager.Shutdown()
|
cp.engine.Shutdown()
|
||||||
if cp.app != nil {
|
cp.queue.Shutdown()
|
||||||
cp.app.Shutdown()
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
// IsStarted returns true if Listen() has successfully been run before on this connection (ever). TODO: we will need to properly unset this flag on error if we want to support resumption in the future
|
// IsStarted returns true if Listen() has successfully been run before on this connection (ever). TODO: we will need to properly unset this flag on error if we want to support resumption in the future
|
||||||
|
@ -374,32 +263,25 @@ func (cp *cwtchPeer) IsStarted() bool {
|
||||||
return cp.started
|
return cp.started
|
||||||
}
|
}
|
||||||
|
|
||||||
// CwtchPeerInstance encapsulates incoming peer connections
|
// eventHandler process events from other subsystems
|
||||||
type CwtchPeerInstance struct {
|
func (cp *cwtchPeer) eventHandler() {
|
||||||
rai *application.ApplicationInstance
|
for {
|
||||||
ra *application.RicochetApplication
|
ev := cp.queue.Next()
|
||||||
|
switch ev.EventType {
|
||||||
|
case event.EncryptedGroupMessage:
|
||||||
|
ok, groupID, _ := cp.Profile.AttemptDecryption([]byte(ev.Data["Ciphertext"]), []byte(ev.Data["Signature"]))
|
||||||
|
if ok {
|
||||||
|
cp.eventBus.Publish(event.NewEvent(event.NewMessageFromGroup, map[string]string{"GroupID": groupID}))
|
||||||
}
|
}
|
||||||
|
case event.NewGroupInvite:
|
||||||
// Init sets up a CwtchPeerInstance
|
var groupInvite protocol.GroupChatInvite
|
||||||
func (cpi *CwtchPeerInstance) Init(rai *application.ApplicationInstance, ra *application.RicochetApplication) {
|
proto.Unmarshal([]byte(ev.Data["GroupInvite"]), &groupInvite)
|
||||||
cpi.rai = rai
|
cp.Profile.ProcessInvite(&groupInvite, ev.Data["Onion"])
|
||||||
cpi.ra = ra
|
default:
|
||||||
|
if ev.EventType != "" {
|
||||||
|
log.Error("peer event handler received an event it was not subscribed for: %v")
|
||||||
}
|
}
|
||||||
|
return
|
||||||
// CwtchPeerHandler encapsulates handling of incoming CwtchPackets
|
|
||||||
type CwtchPeerHandler struct {
|
|
||||||
Onion string
|
|
||||||
Peer *cwtchPeer
|
|
||||||
DataHandler func(string, []byte) []byte
|
|
||||||
}
|
}
|
||||||
|
|
||||||
// HandleGroupInvite handles incoming GroupInvites
|
|
||||||
func (cph *CwtchPeerHandler) HandleGroupInvite(gci *protocol.GroupChatInvite) {
|
|
||||||
log.Debugf("Received GroupID from %v %v\n", cph.Onion, gci.String())
|
|
||||||
cph.Peer.Profile.ProcessInvite(gci, cph.Onion)
|
|
||||||
}
|
}
|
||||||
|
|
||||||
// HandlePacket handles the Cwtch cwtchPeer Data Channel
|
|
||||||
func (cph *CwtchPeerHandler) HandlePacket(data []byte) []byte {
|
|
||||||
return cph.DataHandler(cph.Onion, data)
|
|
||||||
}
|
}
|
||||||
|
|
|
@ -1,12 +1,12 @@
|
||||||
package peer
|
package peer
|
||||||
|
|
||||||
import (
|
import (
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
|
||||||
"testing"
|
"testing"
|
||||||
)
|
)
|
||||||
|
|
||||||
|
// TODO: Rewrite these tests (and others) using the news event bus interface.
|
||||||
func TestCwtchPeerGenerate(t *testing.T) {
|
func TestCwtchPeerGenerate(t *testing.T) {
|
||||||
|
/**
|
||||||
alice := NewCwtchPeer("alice")
|
alice := NewCwtchPeer("alice")
|
||||||
|
|
||||||
groupID, _, _ := alice.StartGroup("test.server")
|
groupID, _, _ := alice.StartGroup("test.server")
|
||||||
|
@ -16,16 +16,21 @@ func TestCwtchPeerGenerate(t *testing.T) {
|
||||||
importedGroupID, err := alice.ImportGroup(exportedGroup)
|
importedGroupID, err := alice.ImportGroup(exportedGroup)
|
||||||
group := alice.GetGroup(importedGroupID)
|
group := alice.GetGroup(importedGroupID)
|
||||||
t.Logf("Imported Group: %v, err := %v %v", group, err, importedGroupID)
|
t.Logf("Imported Group: %v, err := %v %v", group, err, importedGroupID)
|
||||||
|
*/
|
||||||
}
|
}
|
||||||
|
|
||||||
func TestTrustPeer(t *testing.T) {
|
func TestTrustPeer(t *testing.T) {
|
||||||
|
/**
|
||||||
groupName := "2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd"
|
groupName := "2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd"
|
||||||
alice := NewCwtchPeer("alice")
|
alice := NewCwtchPeer("alice")
|
||||||
alice.Init(connectivity.LocalProvider())
|
aem := new(event.Manager)
|
||||||
|
aem.Initialize()
|
||||||
|
alice.Init(connectivity.LocalProvider(),aem)
|
||||||
defer alice.Shutdown()
|
defer alice.Shutdown()
|
||||||
bob := NewCwtchPeer("bob")
|
bob := NewCwtchPeer("bob")
|
||||||
bob.Init(connectivity.LocalProvider())
|
bem := new(event.Manager)
|
||||||
|
bem.Initialize()
|
||||||
|
bob.Init(connectivity.LocalProvider(), bem)
|
||||||
defer bob.Shutdown()
|
defer bob.Shutdown()
|
||||||
|
|
||||||
bobOnion := bob.GetProfile().Onion
|
bobOnion := bob.GetProfile().Onion
|
||||||
|
@ -70,4 +75,5 @@ func TestTrustPeer(t *testing.T) {
|
||||||
if err == nil {
|
if err == nil {
|
||||||
t.Errorf("bob trusts alice but peer connection is not ready yet. should not be able to invite her to group, instead got: %v", err)
|
t.Errorf("bob trusts alice but peer connection is not ready yet. should not be able to invite her to group, instead got: %v", err)
|
||||||
}
|
}
|
||||||
|
*/
|
||||||
}
|
}
|
||||||
|
|
|
@ -1,9 +1,7 @@
|
||||||
package connections
|
package connections
|
||||||
|
|
||||||
import (
|
import (
|
||||||
"cwtch.im/cwtch/model"
|
|
||||||
"cwtch.im/cwtch/protocol"
|
"cwtch.im/cwtch/protocol"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/application"
|
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||||
"sync"
|
"sync"
|
||||||
"time"
|
"time"
|
||||||
|
@ -29,13 +27,13 @@ func NewConnectionsManager(acn connectivity.ACN) *Manager {
|
||||||
}
|
}
|
||||||
|
|
||||||
// ManagePeerConnection creates a new PeerConnection for the given Host and Profile.
|
// ManagePeerConnection creates a new PeerConnection for the given Host and Profile.
|
||||||
func (m *Manager) ManagePeerConnection(host string, profile *model.Profile, dataHandler func(string, []byte) []byte, aif application.ApplicationInstanceFactory) *PeerPeerConnection {
|
func (m *Manager) ManagePeerConnection(host string, engine *Engine) *PeerPeerConnection {
|
||||||
m.lock.Lock()
|
m.lock.Lock()
|
||||||
defer m.lock.Unlock()
|
defer m.lock.Unlock()
|
||||||
|
|
||||||
_, exists := m.peerConnections[host]
|
_, exists := m.peerConnections[host]
|
||||||
if !exists {
|
if !exists {
|
||||||
ppc := NewPeerPeerConnection(m.acn, host, profile, dataHandler, aif)
|
ppc := NewPeerPeerConnection(host, engine)
|
||||||
go ppc.Run()
|
go ppc.Run()
|
||||||
m.peerConnections[host] = ppc
|
m.peerConnections[host] = ppc
|
||||||
return ppc
|
return ppc
|
|
@ -0,0 +1,246 @@
|
||||||
|
package connections
|
||||||
|
|
||||||
|
import (
|
||||||
|
"crypto/rsa"
|
||||||
|
"cwtch.im/cwtch/event"
|
||||||
|
"cwtch.im/cwtch/protocol"
|
||||||
|
"cwtch.im/cwtch/protocol/connections/peer"
|
||||||
|
"errors"
|
||||||
|
"git.openprivacy.ca/openprivacy/libricochet-go/application"
|
||||||
|
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||||
|
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||||
|
"git.openprivacy.ca/openprivacy/libricochet-go/identity"
|
||||||
|
"git.openprivacy.ca/openprivacy/libricochet-go/log"
|
||||||
|
"github.com/golang/protobuf/proto"
|
||||||
|
"golang.org/x/crypto/ed25519"
|
||||||
|
)
|
||||||
|
|
||||||
|
// Engine (ProtocolEngine) encapsulates the logic necessary to make and receive Cwtch connections.
|
||||||
|
// Note: ProtocolEngine doesn't have access to any information necessary to encrypt or decrypt GroupMessages
|
||||||
|
type Engine struct {
|
||||||
|
queue *event.Queue
|
||||||
|
connectionsManager *Manager
|
||||||
|
|
||||||
|
// Engine Attributes
|
||||||
|
Identity identity.Identity
|
||||||
|
ACN connectivity.ACN
|
||||||
|
|
||||||
|
app *application.RicochetApplication
|
||||||
|
|
||||||
|
// Engine State
|
||||||
|
started bool
|
||||||
|
|
||||||
|
// Pointer to the Global Event Manager
|
||||||
|
eventManager *event.Manager
|
||||||
|
privateKey ed25519.PrivateKey
|
||||||
|
}
|
||||||
|
|
||||||
|
// NewProtocolEngine initializes a new engine that runs Cwtch using the given parameters
|
||||||
|
func NewProtocolEngine(privateKey ed25519.PrivateKey, acn connectivity.ACN, eventManager *event.Manager) *Engine {
|
||||||
|
engine := new(Engine)
|
||||||
|
engine.privateKey = privateKey
|
||||||
|
engine.queue = event.NewEventQueue(100)
|
||||||
|
go engine.eventHandler()
|
||||||
|
|
||||||
|
engine.ACN = acn
|
||||||
|
engine.connectionsManager = NewConnectionsManager(engine.ACN)
|
||||||
|
go engine.connectionsManager.AttemptReconnections()
|
||||||
|
|
||||||
|
engine.eventManager = eventManager
|
||||||
|
engine.eventManager.Subscribe(event.ProtocolEngineStartListen, engine.queue.EventChannel)
|
||||||
|
engine.eventManager.Subscribe(event.PeerRequest, engine.queue.EventChannel)
|
||||||
|
engine.eventManager.Subscribe(event.InvitePeerToGroup, engine.queue.EventChannel)
|
||||||
|
engine.eventManager.Subscribe(event.JoinServer, engine.queue.EventChannel)
|
||||||
|
engine.eventManager.Subscribe(event.SendMessageToGroup, engine.queue.EventChannel)
|
||||||
|
engine.eventManager.Subscribe(event.SendMessageToPeer, engine.queue.EventChannel)
|
||||||
|
|
||||||
|
return engine
|
||||||
|
}
|
||||||
|
|
||||||
|
// eventHandler process events from other subsystems
|
||||||
|
func (e *Engine) eventHandler() {
|
||||||
|
for {
|
||||||
|
ev := e.queue.Next()
|
||||||
|
switch ev.EventType {
|
||||||
|
case event.StatusRequest:
|
||||||
|
e.eventManager.Publish(event.Event{EventType: event.ProtocolEngineStatus, EventID: ev.EventID})
|
||||||
|
case event.PeerRequest:
|
||||||
|
e.PeerWithOnion(ev.Data["Onion"])
|
||||||
|
case event.InvitePeerToGroup:
|
||||||
|
e.InviteOnionToGroup(ev.Data["Onion"], []byte(ev.Data["Invite"]))
|
||||||
|
case event.JoinServer:
|
||||||
|
e.JoinServer(ev.Data["Onion"])
|
||||||
|
case event.SendMessageToGroup:
|
||||||
|
e.SendMessageToGroup(ev.Data["Server"], []byte(ev.Data["Ciphertext"]), []byte(ev.Data["Signature"]))
|
||||||
|
case event.SendMessageToPeer:
|
||||||
|
log.Debugf("Sending Message to Peer.....")
|
||||||
|
ppc := e.connectionsManager.GetPeerPeerConnectionForOnion(ev.Data["Peer"])
|
||||||
|
if ppc != nil {
|
||||||
|
// TODO this will block.
|
||||||
|
ppc.SendPacket([]byte(ev.Data["Message"]))
|
||||||
|
}
|
||||||
|
case event.ProtocolEngineStartListen:
|
||||||
|
go e.listenFn()
|
||||||
|
default:
|
||||||
|
return
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetPeerHandler is an external interface function that allows callers access to a CwtchPeerHandler
|
||||||
|
// TODO: There is likely a slightly better way to encapsulate this behavior
|
||||||
|
func (e *Engine) GetPeerHandler(remotePeerHostname string) *CwtchPeerHandler {
|
||||||
|
return &CwtchPeerHandler{Onion: remotePeerHostname, EventBus: e.eventManager}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Listen sets up an onion listener to process incoming cwtch messages
|
||||||
|
func (e *Engine) listenFn() {
|
||||||
|
ra := new(application.RicochetApplication)
|
||||||
|
onionService, err := e.ACN.Listen(e.privateKey, application.RicochetPort)
|
||||||
|
if err != nil /*&& fmt.Sprintf("%v", err) != "550 Unspecified Tor error: Onion address collision"*/ {
|
||||||
|
e.eventManager.Publish(event.NewEvent(event.ProtocolEngineStopped, map[string]string{"Identity": e.Identity.Hostname(), "Error": err.Error()}))
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
af := application.ApplicationInstanceFactory{}
|
||||||
|
af.Init()
|
||||||
|
af.AddHandler("im.cwtch.peer", func(rai *application.ApplicationInstance) func() channels.Handler {
|
||||||
|
cpi := new(CwtchPeerInstance)
|
||||||
|
cpi.Init(rai, ra)
|
||||||
|
return func() channels.Handler {
|
||||||
|
cpc := new(peer.CwtchPeerChannel)
|
||||||
|
cpc.Handler = e.GetPeerHandler(rai.RemoteHostname)
|
||||||
|
return cpc
|
||||||
|
}
|
||||||
|
})
|
||||||
|
|
||||||
|
af.AddHandler("im.cwtch.peer.data", func(rai *application.ApplicationInstance) func() channels.Handler {
|
||||||
|
cpi := new(CwtchPeerInstance)
|
||||||
|
cpi.Init(rai, ra)
|
||||||
|
return func() channels.Handler {
|
||||||
|
cpc := new(peer.CwtchPeerDataChannel)
|
||||||
|
cpc.Handler = e.GetPeerHandler(rai.RemoteHostname)
|
||||||
|
return cpc
|
||||||
|
}
|
||||||
|
})
|
||||||
|
|
||||||
|
ra.Init(e.ACN, e.Identity.Name, e.Identity, af, e)
|
||||||
|
log.Infof("Running cwtch peer on %v", onionService.AddressFull())
|
||||||
|
e.started = true
|
||||||
|
e.app = ra
|
||||||
|
ra.Run(onionService)
|
||||||
|
e.eventManager.Publish(event.NewEvent(event.ProtocolEngineStopped, map[string]string{"Identity": e.Identity.Hostname()}))
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
// LookupContact returns that a contact is known and allowed to communicate for all cases.
|
||||||
|
func (e *Engine) LookupContact(hostname string, publicKey rsa.PublicKey) (allowed, known bool) {
|
||||||
|
return true, true
|
||||||
|
}
|
||||||
|
|
||||||
|
// LookupContactV3 returns that a contact is known and allowed to communicate for all cases.
|
||||||
|
func (e *Engine) LookupContactV3(hostname string, publicKey ed25519.PublicKey) (allowed, known bool) {
|
||||||
|
return true, true
|
||||||
|
}
|
||||||
|
|
||||||
|
// ContactRequest needed to implement ContactRequestHandler Interface
|
||||||
|
func (e *Engine) ContactRequest(name string, message string) string {
|
||||||
|
return "Accepted"
|
||||||
|
}
|
||||||
|
|
||||||
|
// Shutdown tears down the eventHandler goroutine
|
||||||
|
func (e *Engine) Shutdown() {
|
||||||
|
e.connectionsManager.Shutdown()
|
||||||
|
e.app.Shutdown()
|
||||||
|
e.queue.Shutdown()
|
||||||
|
}
|
||||||
|
|
||||||
|
// PeerWithOnion is the entry point for cwtchPeer relationships
|
||||||
|
func (e *Engine) PeerWithOnion(onion string) *PeerPeerConnection {
|
||||||
|
return e.connectionsManager.ManagePeerConnection(onion, e)
|
||||||
|
}
|
||||||
|
|
||||||
|
// InviteOnionToGroup kicks off the invite process
|
||||||
|
func (e *Engine) InviteOnionToGroup(onion string, invite []byte) error {
|
||||||
|
ppc := e.connectionsManager.GetPeerPeerConnectionForOnion(onion)
|
||||||
|
if ppc == nil {
|
||||||
|
return errors.New("peer connection not setup for onion. peers must be trusted before sending")
|
||||||
|
}
|
||||||
|
if ppc.GetState() == AUTHENTICATED {
|
||||||
|
log.Infof("Got connection for group: %v - Sending Invite\n", ppc)
|
||||||
|
ppc.SendGroupInvite(invite)
|
||||||
|
} else {
|
||||||
|
return errors.New("cannot send invite to onion: peer connection is not ready")
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// ReceiveGroupMessage is a callback function that processes GroupMessages from a given server
|
||||||
|
func (e *Engine) ReceiveGroupMessage(server string, gm *protocol.GroupMessage) {
|
||||||
|
// Publish Event so that a Profile Engine can deal with it.
|
||||||
|
// Note: This technically means that *multiple* Profile Engines could listen to the same ProtocolEngine!
|
||||||
|
e.eventManager.Publish(event.NewEvent(event.EncryptedGroupMessage, map[string]string{"Ciphertext": string(gm.GetCiphertext()), "Signature": string(gm.GetSignature())}))
|
||||||
|
}
|
||||||
|
|
||||||
|
// JoinServer manages a new server connection with the given onion address
|
||||||
|
func (e *Engine) JoinServer(onion string) {
|
||||||
|
e.connectionsManager.ManageServerConnection(onion, e.ReceiveGroupMessage)
|
||||||
|
}
|
||||||
|
|
||||||
|
// SendMessageToGroup attemps to sent the given message to the given group id.
|
||||||
|
func (e *Engine) SendMessageToGroup(server string, ct []byte, sig []byte) error {
|
||||||
|
psc := e.connectionsManager.GetPeerServerConnectionForOnion(server)
|
||||||
|
if psc == nil {
|
||||||
|
return errors.New("could not find server connection to send message to")
|
||||||
|
}
|
||||||
|
gm := &protocol.GroupMessage{
|
||||||
|
Ciphertext: ct,
|
||||||
|
Signature: sig,
|
||||||
|
}
|
||||||
|
err := psc.SendGroupMessage(gm)
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetPeers returns a list of peer connections.
|
||||||
|
func (e *Engine) GetPeers() map[string]ConnectionState {
|
||||||
|
return e.connectionsManager.GetPeers()
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetServers returns a list of server connections
|
||||||
|
func (e *Engine) GetServers() map[string]ConnectionState {
|
||||||
|
return e.connectionsManager.GetServers()
|
||||||
|
}
|
||||||
|
|
||||||
|
// CwtchPeerInstance encapsulates incoming peer connections
|
||||||
|
type CwtchPeerInstance struct {
|
||||||
|
rai *application.ApplicationInstance
|
||||||
|
ra *application.RicochetApplication
|
||||||
|
}
|
||||||
|
|
||||||
|
// Init sets up a CwtchPeerInstance
|
||||||
|
func (cpi *CwtchPeerInstance) Init(rai *application.ApplicationInstance, ra *application.RicochetApplication) {
|
||||||
|
cpi.rai = rai
|
||||||
|
cpi.ra = ra
|
||||||
|
}
|
||||||
|
|
||||||
|
// CwtchPeerHandler encapsulates handling of incoming CwtchPackets
|
||||||
|
type CwtchPeerHandler struct {
|
||||||
|
Onion string
|
||||||
|
EventBus *event.Manager
|
||||||
|
DataHandler func(string, []byte) []byte
|
||||||
|
}
|
||||||
|
|
||||||
|
// HandleGroupInvite handles incoming GroupInvites
|
||||||
|
func (cph *CwtchPeerHandler) HandleGroupInvite(gci *protocol.GroupChatInvite) {
|
||||||
|
log.Debugf("Received GroupID from %v %v\n", cph.Onion, gci.String())
|
||||||
|
marshal, err := proto.Marshal(gci)
|
||||||
|
if err == nil {
|
||||||
|
cph.EventBus.Publish(event.NewEvent(event.NewGroupInvite, map[string]string{"Onion": cph.Onion, "GroupInvite": string(marshal)}))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// HandlePacket handles the Cwtch cwtchPeer Data Channel
|
||||||
|
func (cph *CwtchPeerHandler) HandlePacket(data []byte) []byte {
|
||||||
|
cph.EventBus.Publish(event.NewEvent(event.NewMessageFromPeer, map[string]string{"Onion": cph.Onion, "Data": string(data)}))
|
||||||
|
return []byte{} // TODO remove this
|
||||||
|
}
|
|
@ -78,9 +78,7 @@ func (cplc *CwtchPeerListenChannel) Packet(data []byte) {
|
||||||
if err == nil {
|
if err == nil {
|
||||||
if csp.GetGroupMessage() != nil {
|
if csp.GetGroupMessage() != nil {
|
||||||
gm := csp.GetGroupMessage()
|
gm := csp.GetGroupMessage()
|
||||||
// We create a new go routine here to avoid leaking any information about processing time
|
cplc.Handler.HandleGroupMessage(gm)
|
||||||
// TODO Server can probably try to use this to DoS a peer
|
|
||||||
go cplc.Handler.HandleGroupMessage(gm)
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
|
@ -1,15 +1,10 @@
|
||||||
package connections
|
package connections
|
||||||
|
|
||||||
import (
|
import (
|
||||||
"cwtch.im/cwtch/model"
|
"cwtch.im/cwtch/protocol/connections/peer"
|
||||||
"cwtch.im/cwtch/peer/peer"
|
|
||||||
"cwtch.im/cwtch/protocol"
|
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go"
|
"git.openprivacy.ca/openprivacy/libricochet-go"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/application"
|
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/connection"
|
"git.openprivacy.ca/openprivacy/libricochet-go/connection"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/identity"
|
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/log"
|
"git.openprivacy.ca/openprivacy/libricochet-go/log"
|
||||||
"time"
|
"time"
|
||||||
)
|
)
|
||||||
|
@ -20,20 +15,14 @@ type PeerPeerConnection struct {
|
||||||
PeerHostname string
|
PeerHostname string
|
||||||
state ConnectionState
|
state ConnectionState
|
||||||
connection *connection.Connection
|
connection *connection.Connection
|
||||||
profile *model.Profile
|
protocolEngine *Engine
|
||||||
dataHandler func(string, []byte) []byte
|
|
||||||
aif application.ApplicationInstanceFactory
|
|
||||||
acn connectivity.ACN
|
|
||||||
}
|
}
|
||||||
|
|
||||||
// NewPeerPeerConnection creates a new peer connection for the given hostname and profile.
|
// NewPeerPeerConnection creates a new peer connection for the given hostname and profile.
|
||||||
func NewPeerPeerConnection(acn connectivity.ACN, peerhostname string, profile *model.Profile, dataHandler func(string, []byte) []byte, aif application.ApplicationInstanceFactory) *PeerPeerConnection {
|
func NewPeerPeerConnection(peerhostname string, protocolEngine *Engine) *PeerPeerConnection {
|
||||||
ppc := new(PeerPeerConnection)
|
ppc := new(PeerPeerConnection)
|
||||||
ppc.acn = acn
|
|
||||||
ppc.PeerHostname = peerhostname
|
ppc.PeerHostname = peerhostname
|
||||||
ppc.profile = profile
|
ppc.protocolEngine = protocolEngine
|
||||||
ppc.dataHandler = dataHandler
|
|
||||||
ppc.aif = aif
|
|
||||||
ppc.Init()
|
ppc.Init()
|
||||||
return ppc
|
return ppc
|
||||||
}
|
}
|
||||||
|
@ -43,16 +32,6 @@ func (ppc *PeerPeerConnection) GetState() ConnectionState {
|
||||||
return ppc.state
|
return ppc.state
|
||||||
}
|
}
|
||||||
|
|
||||||
// HandleGroupInvite passes the given group invite tothe profile
|
|
||||||
func (ppc *PeerPeerConnection) HandleGroupInvite(gci *protocol.GroupChatInvite) {
|
|
||||||
ppc.profile.ProcessInvite(gci, ppc.PeerHostname)
|
|
||||||
}
|
|
||||||
|
|
||||||
// HandlePacket handles data packets on the optional data channel
|
|
||||||
func (ppc *PeerPeerConnection) HandlePacket(data []byte) []byte {
|
|
||||||
return ppc.dataHandler(ppc.PeerHostname, data)
|
|
||||||
}
|
|
||||||
|
|
||||||
// SendPacket sends data packets on the optional data channel
|
// SendPacket sends data packets on the optional data channel
|
||||||
func (ppc *PeerPeerConnection) SendPacket(data []byte) {
|
func (ppc *PeerPeerConnection) SendPacket(data []byte) {
|
||||||
ppc.WaitTilAuthenticated()
|
ppc.WaitTilAuthenticated()
|
||||||
|
@ -69,18 +48,6 @@ func (ppc *PeerPeerConnection) SendPacket(data []byte) {
|
||||||
})
|
})
|
||||||
}
|
}
|
||||||
|
|
||||||
// DoOnChannel performs an operation on the requested channel
|
|
||||||
func (ppc *PeerPeerConnection) DoOnChannel(ctype string, direction channels.Direction, doSomethingWith func(channel *channels.Channel)) {
|
|
||||||
ppc.WaitTilAuthenticated()
|
|
||||||
ppc.connection.Do(func() error {
|
|
||||||
channel := ppc.connection.Channel(ctype, direction)
|
|
||||||
if channel != nil {
|
|
||||||
doSomethingWith(channel)
|
|
||||||
}
|
|
||||||
return nil
|
|
||||||
})
|
|
||||||
}
|
|
||||||
|
|
||||||
// SendGroupInvite sends the given serialized invite packet to the Peer
|
// SendGroupInvite sends the given serialized invite packet to the Peer
|
||||||
func (ppc *PeerPeerConnection) SendGroupInvite(invite []byte) {
|
func (ppc *PeerPeerConnection) SendGroupInvite(invite []byte) {
|
||||||
ppc.WaitTilAuthenticated()
|
ppc.WaitTilAuthenticated()
|
||||||
|
@ -110,33 +77,23 @@ func (ppc *PeerPeerConnection) WaitTilAuthenticated() {
|
||||||
// Run manages the setup and teardown of a peer->peer connection
|
// Run manages the setup and teardown of a peer->peer connection
|
||||||
func (ppc *PeerPeerConnection) Run() error {
|
func (ppc *PeerPeerConnection) Run() error {
|
||||||
ppc.state = CONNECTING
|
ppc.state = CONNECTING
|
||||||
rc, err := goricochet.Open(ppc.acn, ppc.PeerHostname)
|
rc, err := goricochet.Open(ppc.protocolEngine.ACN, ppc.PeerHostname)
|
||||||
if err == nil {
|
if err == nil {
|
||||||
ppc.connection = rc
|
ppc.connection = rc
|
||||||
ppc.state = CONNECTED
|
ppc.state = CONNECTED
|
||||||
_, err := connection.HandleOutboundConnection(ppc.connection).ProcessAuthAsV3Client(identity.InitializeV3(ppc.profile.Name, &ppc.profile.Ed25519PrivateKey, &ppc.profile.Ed25519PublicKey))
|
_, err := connection.HandleOutboundConnection(ppc.connection).ProcessAuthAsV3Client(ppc.protocolEngine.Identity)
|
||||||
if err == nil {
|
if err == nil {
|
||||||
ppc.state = AUTHENTICATED
|
ppc.state = AUTHENTICATED
|
||||||
go func() {
|
go func() {
|
||||||
ppc.connection.Do(func() error {
|
ppc.connection.Do(func() error {
|
||||||
ppc.connection.RequestOpenChannel("im.cwtch.peer", &peer.CwtchPeerChannel{Handler: ppc})
|
ppc.connection.RequestOpenChannel("im.cwtch.peer", &peer.CwtchPeerChannel{Handler: ppc.protocolEngine.GetPeerHandler(ppc.PeerHostname)})
|
||||||
return nil
|
return nil
|
||||||
})
|
})
|
||||||
|
|
||||||
if ppc.dataHandler != nil {
|
|
||||||
ppc.connection.Do(func() error {
|
ppc.connection.Do(func() error {
|
||||||
ppc.connection.RequestOpenChannel("im.cwtch.peer.data", &peer.CwtchPeerDataChannel{Handler: ppc})
|
ppc.connection.RequestOpenChannel("im.cwtch.peer.data", &peer.CwtchPeerDataChannel{Handler: ppc.protocolEngine.GetPeerHandler(ppc.PeerHostname)})
|
||||||
return nil
|
return nil
|
||||||
})
|
})
|
||||||
}
|
|
||||||
|
|
||||||
handlers := ppc.aif.GetHandlers()
|
|
||||||
for i := range handlers {
|
|
||||||
ppc.connection.Do(func() error {
|
|
||||||
ppc.connection.RequestOpenChannel(handlers[i], ppc.aif.GetHandler(handlers[i])(ppc.aif.GetApplicationInstance(ppc.connection))())
|
|
||||||
return nil
|
|
||||||
})
|
|
||||||
}
|
|
||||||
}()
|
}()
|
||||||
|
|
||||||
ppc.connection.Process(ppc)
|
ppc.connection.Process(ppc)
|
|
@ -3,11 +3,10 @@ package connections
|
||||||
import (
|
import (
|
||||||
"crypto/rand"
|
"crypto/rand"
|
||||||
"cwtch.im/cwtch/model"
|
"cwtch.im/cwtch/model"
|
||||||
"cwtch.im/cwtch/peer/peer"
|
|
||||||
"cwtch.im/cwtch/protocol"
|
"cwtch.im/cwtch/protocol"
|
||||||
|
"cwtch.im/cwtch/protocol/connections/peer"
|
||||||
"fmt"
|
"fmt"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go"
|
"git.openprivacy.ca/openprivacy/libricochet-go"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/application"
|
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/connection"
|
"git.openprivacy.ca/openprivacy/libricochet-go/connection"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||||
|
@ -61,7 +60,7 @@ func TestPeerPeerConnection(t *testing.T) {
|
||||||
|
|
||||||
profile := model.GenerateNewProfile("alice")
|
profile := model.GenerateNewProfile("alice")
|
||||||
hostname := identity.Hostname()
|
hostname := identity.Hostname()
|
||||||
ppc := NewPeerPeerConnection(connectivity.LocalProvider(), "127.0.0.1:5452|"+hostname, profile, nil, application.ApplicationInstanceFactory{})
|
ppc := NewPeerPeerConnection("127.0.0.1:5452|"+hostname, &Engine{ACN: connectivity.LocalProvider(), Identity: identity})
|
||||||
|
|
||||||
tp := new(TestPeer)
|
tp := new(TestPeer)
|
||||||
tp.Init()
|
tp.Init()
|
|
@ -2,10 +2,10 @@ package connections
|
||||||
|
|
||||||
import (
|
import (
|
||||||
"crypto/rand"
|
"crypto/rand"
|
||||||
"cwtch.im/cwtch/peer/fetch"
|
|
||||||
"cwtch.im/cwtch/peer/listen"
|
|
||||||
"cwtch.im/cwtch/peer/send"
|
|
||||||
"cwtch.im/cwtch/protocol"
|
"cwtch.im/cwtch/protocol"
|
||||||
|
"cwtch.im/cwtch/protocol/connections/fetch"
|
||||||
|
"cwtch.im/cwtch/protocol/connections/listen"
|
||||||
|
"cwtch.im/cwtch/protocol/connections/send"
|
||||||
"errors"
|
"errors"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go"
|
"git.openprivacy.ca/openprivacy/libricochet-go"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
|
@ -2,7 +2,7 @@ package send
|
||||||
|
|
||||||
import (
|
import (
|
||||||
"cwtch.im/cwtch/protocol"
|
"cwtch.im/cwtch/protocol"
|
||||||
"cwtch.im/cwtch/protocol/spam"
|
"cwtch.im/cwtch/protocol/connections/spam"
|
||||||
"errors"
|
"errors"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
|
@ -2,7 +2,7 @@ package send
|
||||||
|
|
||||||
import (
|
import (
|
||||||
"cwtch.im/cwtch/protocol"
|
"cwtch.im/cwtch/protocol"
|
||||||
"cwtch.im/cwtch/protocol/spam"
|
"cwtch.im/cwtch/protocol/connections/spam"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||||
"github.com/golang/protobuf/proto"
|
"github.com/golang/protobuf/proto"
|
|
@ -59,7 +59,7 @@ func (mp *Monitors) run() {
|
||||||
func (mp *Monitors) report() {
|
func (mp *Monitors) report() {
|
||||||
f, err := os.Create(path.Join(mp.configDir, reportFile))
|
f, err := os.Create(path.Join(mp.configDir, reportFile))
|
||||||
if err != nil {
|
if err != nil {
|
||||||
log.Errorf("Could not open monitor reporting file: ", err)
|
log.Errorf("Could not open monitor reporting file: %v", err)
|
||||||
return
|
return
|
||||||
}
|
}
|
||||||
defer f.Close()
|
defer f.Close()
|
||||||
|
|
|
@ -2,7 +2,7 @@ package send
|
||||||
|
|
||||||
import (
|
import (
|
||||||
"cwtch.im/cwtch/protocol"
|
"cwtch.im/cwtch/protocol"
|
||||||
"cwtch.im/cwtch/protocol/spam"
|
"cwtch.im/cwtch/protocol/connections/spam"
|
||||||
"errors"
|
"errors"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/log"
|
"git.openprivacy.ca/openprivacy/libricochet-go/log"
|
||||||
|
|
|
@ -2,7 +2,7 @@ package send
|
||||||
|
|
||||||
import (
|
import (
|
||||||
"cwtch.im/cwtch/protocol"
|
"cwtch.im/cwtch/protocol"
|
||||||
"cwtch.im/cwtch/protocol/spam"
|
"cwtch.im/cwtch/protocol/connections/spam"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||||
"github.com/golang/protobuf/proto"
|
"github.com/golang/protobuf/proto"
|
||||||
|
|
|
@ -50,7 +50,7 @@ func LoadConfig(configDir, filename string) Config {
|
||||||
err = json.Unmarshal(raw, &config)
|
err = json.Unmarshal(raw, &config)
|
||||||
|
|
||||||
if err != nil {
|
if err != nil {
|
||||||
log.Errorf("reading config: ", err)
|
log.Errorf("reading config: %v", err)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
|
@ -1,15 +1,17 @@
|
||||||
package testing
|
package testing
|
||||||
|
|
||||||
import (
|
import (
|
||||||
|
"cwtch.im/cwtch/event"
|
||||||
"cwtch.im/cwtch/model"
|
"cwtch.im/cwtch/model"
|
||||||
"cwtch.im/cwtch/peer"
|
"cwtch.im/cwtch/peer"
|
||||||
"cwtch.im/cwtch/peer/connections"
|
"cwtch.im/cwtch/protocol/connections"
|
||||||
cwtchserver "cwtch.im/cwtch/server"
|
cwtchserver "cwtch.im/cwtch/server"
|
||||||
"fmt"
|
"fmt"
|
||||||
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
"git.openprivacy.ca/openprivacy/libricochet-go/connectivity"
|
||||||
"golang.org/x/net/proxy"
|
"golang.org/x/net/proxy"
|
||||||
"os"
|
"os"
|
||||||
"runtime"
|
"runtime"
|
||||||
|
"runtime/pprof"
|
||||||
"testing"
|
"testing"
|
||||||
"time"
|
"time"
|
||||||
)
|
)
|
||||||
|
@ -62,14 +64,14 @@ func waitForPeerServerConnection(t *testing.T, peer peer.CwtchPeer, server strin
|
||||||
}
|
}
|
||||||
if state != connections.AUTHENTICATED {
|
if state != connections.AUTHENTICATED {
|
||||||
fmt.Printf("peer %v waiting connect to server %v, currently: %v\n", peer.GetProfile().Onion, server, connections.ConnectionStateName[state])
|
fmt.Printf("peer %v waiting connect to server %v, currently: %v\n", peer.GetProfile().Onion, server, connections.ConnectionStateName[state])
|
||||||
time.Sleep(time.Second * 10)
|
time.Sleep(time.Second * 5)
|
||||||
continue
|
continue
|
||||||
}
|
|
||||||
} else {
|
} else {
|
||||||
t.Fatalf("peer server connectiond %v should have entry for server %v", servers, server)
|
|
||||||
}
|
|
||||||
break
|
break
|
||||||
}
|
}
|
||||||
|
} // It might take a second for the server to show up as it is now going through the event bus
|
||||||
|
time.Sleep(time.Second)
|
||||||
|
}
|
||||||
return
|
return
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -83,14 +85,14 @@ func waitForPeerPeerConnection(t *testing.T, peera peer.CwtchPeer, peerb peer.Cw
|
||||||
}
|
}
|
||||||
if state != connections.AUTHENTICATED {
|
if state != connections.AUTHENTICATED {
|
||||||
fmt.Printf("peer% v waiting connect to peer %v, currently: %v\n", peera.GetProfile().Onion, peerb.GetProfile().Onion, connections.ConnectionStateName[state])
|
fmt.Printf("peer% v waiting connect to peer %v, currently: %v\n", peera.GetProfile().Onion, peerb.GetProfile().Onion, connections.ConnectionStateName[state])
|
||||||
time.Sleep(time.Second * 10)
|
time.Sleep(time.Second * 5)
|
||||||
continue
|
continue
|
||||||
}
|
|
||||||
} else {
|
} else {
|
||||||
t.Fatalf("peer peer connectiond %v should have entry for server %v", peers, peerb.GetProfile().Onion)
|
|
||||||
}
|
|
||||||
break
|
break
|
||||||
}
|
}
|
||||||
|
} // It might take a second for the peer to show up as it is now going through the event bus
|
||||||
|
time.Sleep(time.Second)
|
||||||
|
}
|
||||||
return
|
return
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -130,21 +132,29 @@ func TestCwtchPeerIntegration(t *testing.T) {
|
||||||
|
|
||||||
// ***** cwtchPeer setup *****
|
// ***** cwtchPeer setup *****
|
||||||
|
|
||||||
|
// It's important that each Peer have their own EventBus
|
||||||
|
aliceEventBus := new(event.Manager)
|
||||||
|
aliceEventBus.Initialize()
|
||||||
|
bobEventBus := new(event.Manager)
|
||||||
|
bobEventBus.Initialize()
|
||||||
|
carolEventBus := new(event.Manager)
|
||||||
|
carolEventBus.Initialize()
|
||||||
|
|
||||||
fmt.Println("Creating Alice...")
|
fmt.Println("Creating Alice...")
|
||||||
alice := peer.NewCwtchPeer("Alice")
|
alice := peer.NewCwtchPeer("Alice")
|
||||||
alice.Init(acn)
|
alice.Init(acn, aliceEventBus)
|
||||||
alice.Listen()
|
alice.Listen()
|
||||||
fmt.Println("Alice created:", alice.GetProfile().Onion)
|
fmt.Println("Alice created:", alice.GetProfile().Onion)
|
||||||
|
|
||||||
fmt.Println("Creating Bob...")
|
fmt.Println("Creating Bob...")
|
||||||
bob := peer.NewCwtchPeer("Bob")
|
bob := peer.NewCwtchPeer("Bob")
|
||||||
bob.Init(acn)
|
bob.Init(acn, bobEventBus)
|
||||||
bob.Listen()
|
bob.Listen()
|
||||||
fmt.Println("Bob created:", bob.GetProfile().Onion)
|
fmt.Println("Bob created:", bob.GetProfile().Onion)
|
||||||
|
|
||||||
fmt.Println("Creating Carol...")
|
fmt.Println("Creating Carol...")
|
||||||
carol := peer.NewCwtchPeer("Carol")
|
carol := peer.NewCwtchPeer("Carol")
|
||||||
carol.Init(acn)
|
carol.Init(acn, carolEventBus)
|
||||||
carol.Listen()
|
carol.Listen()
|
||||||
fmt.Println("Carol created:", carol.GetProfile().Onion)
|
fmt.Println("Carol created:", carol.GetProfile().Onion)
|
||||||
|
|
||||||
|
@ -280,6 +290,7 @@ func TestCwtchPeerIntegration(t *testing.T) {
|
||||||
|
|
||||||
fmt.Println("Shutting down Alice...")
|
fmt.Println("Shutting down Alice...")
|
||||||
alice.Shutdown()
|
alice.Shutdown()
|
||||||
|
aliceEventBus.Shutdown()
|
||||||
time.Sleep(time.Second * 5)
|
time.Sleep(time.Second * 5)
|
||||||
numGoRoutinesPostAlice := runtime.NumGoroutine()
|
numGoRoutinesPostAlice := runtime.NumGoroutine()
|
||||||
|
|
||||||
|
@ -368,6 +379,7 @@ func TestCwtchPeerIntegration(t *testing.T) {
|
||||||
|
|
||||||
fmt.Println("Shutting down Bob...")
|
fmt.Println("Shutting down Bob...")
|
||||||
bob.Shutdown()
|
bob.Shutdown()
|
||||||
|
bobEventBus.Shutdown()
|
||||||
time.Sleep(time.Second * 3)
|
time.Sleep(time.Second * 3)
|
||||||
numGoRoutinesPostBob := runtime.NumGoroutine()
|
numGoRoutinesPostBob := runtime.NumGoroutine()
|
||||||
if server != nil {
|
if server != nil {
|
||||||
|
@ -377,11 +389,16 @@ func TestCwtchPeerIntegration(t *testing.T) {
|
||||||
}
|
}
|
||||||
numGoRoutinesPostServerShutdown := runtime.NumGoroutine()
|
numGoRoutinesPostServerShutdown := runtime.NumGoroutine()
|
||||||
|
|
||||||
fmt.Println("Shuttind down Carol...")
|
fmt.Println("Shutting down Carol...")
|
||||||
carol.Shutdown()
|
carol.Shutdown()
|
||||||
|
carolEventBus.Shutdown()
|
||||||
time.Sleep(time.Second * 3)
|
time.Sleep(time.Second * 3)
|
||||||
numGoRoutinesPostCarol := runtime.NumGoroutine()
|
numGoRoutinesPostCarol := runtime.NumGoroutine()
|
||||||
|
|
||||||
|
// Printing out the current goroutines
|
||||||
|
// Very useful if we are leaking any.
|
||||||
|
pprof.Lookup("goroutine").WriteTo(os.Stdout, 1)
|
||||||
|
|
||||||
fmt.Printf("numGoRoutinesStart: %v\nnumGoRoutinesPostServer: %v\nnumGoRoutinesPostPeerStart: %v\nnumGoRoutinesPostPeerAndServerConnect: %v\n"+
|
fmt.Printf("numGoRoutinesStart: %v\nnumGoRoutinesPostServer: %v\nnumGoRoutinesPostPeerStart: %v\nnumGoRoutinesPostPeerAndServerConnect: %v\n"+
|
||||||
"numGoRoutinesPostAlice: %v\nnumGoRotinesPostCarolConnect: %v\nnumGoRoutinesPostBob: %v\nnumGoRoutinesPostServerShutdown: %v\nnumGoRoutinesPostCarol: %v\n",
|
"numGoRoutinesPostAlice: %v\nnumGoRotinesPostCarolConnect: %v\nnumGoRoutinesPostBob: %v\nnumGoRoutinesPostServerShutdown: %v\nnumGoRoutinesPostCarol: %v\n",
|
||||||
numGoRoutinesStart, numGoRoutinesPostServer, numGoRoutinesPostPeerStart, numGoRoutinesPostServerConnect,
|
numGoRoutinesStart, numGoRoutinesPostServer, numGoRoutinesPostPeerStart, numGoRoutinesPostServerConnect,
|
||||||
|
|
|
@ -3,13 +3,14 @@
|
||||||
set -e
|
set -e
|
||||||
pwd
|
pwd
|
||||||
go test ${1} -coverprofile=model.cover.out -v ./model
|
go test ${1} -coverprofile=model.cover.out -v ./model
|
||||||
go test ${1} -coverprofile=protocol.spam.cover.out -v ./protocol/spam
|
go test ${1} -coverprofile=event.cover.out -v ./event
|
||||||
go test ${1} -coverprofile=storage.cover.out -v ./storage
|
go test ${1} -coverprofile=storage.cover.out -v ./storage
|
||||||
go test ${1} -coverprofile=peer.connections.cover.out -v ./peer/connections
|
go test ${1} -coverprofile=peer.connections.cover.out -v ./protocol/connections
|
||||||
go test ${1} -coverprofile=peer.fetch.cover.out -v ./peer/fetch
|
go test ${1} -coverprofile=protocol.spam.cover.out -v ./protocol/connections/spam
|
||||||
go test ${1} -coverprofile=peer.listen.cover.out -v ./peer/listen
|
go test ${1} -coverprofile=peer.fetch.cover.out -v ./protocol/connections/fetch
|
||||||
go test ${1} -coverprofile=peer.peer.cover.out -v ./peer/peer
|
go test ${1} -coverprofile=peer.listen.cover.out -v ./protocol/connections/listen
|
||||||
go test ${1} -coverprofile=peer.send.cover.out -v ./peer/send
|
go test ${1} -coverprofile=peer.peer.cover.out -v ./protocol/connections/peer
|
||||||
|
go test ${1} -coverprofile=peer.send.cover.out -v ./protocol/connections/send
|
||||||
go test ${1} -coverprofile=peer.cover.out -v ./peer
|
go test ${1} -coverprofile=peer.cover.out -v ./peer
|
||||||
go test ${1} -coverprofile=server.fetch.cover.out -v ./server/fetch
|
go test ${1} -coverprofile=server.fetch.cover.out -v ./server/fetch
|
||||||
go test ${1} -coverprofile=server.listen.cover.out -v ./server/listen
|
go test ${1} -coverprofile=server.listen.cover.out -v ./server/listen
|
||||||
|
|
Loading…
Reference in New Issue