forked from cwtch.im/cwtch
Compare commits
1 Commits
Author | SHA1 | Date |
---|---|---|
erinn | dc8d90263d |
36
.drone.yml
36
.drone.yml
|
@ -5,43 +5,28 @@ workspace:
|
|||
pipeline:
|
||||
fetch:
|
||||
image: golang
|
||||
when:
|
||||
repo: cwtch.im/cwtch
|
||||
branch: master
|
||||
event: [ push, pull_request ]
|
||||
commands:
|
||||
- wget https://git.openprivacy.ca/openprivacy/buildfiles/raw/master/tor/tor
|
||||
- wget https://git.openprivacy.ca/openprivacy/buildfiles/raw/master/tor/torrc
|
||||
- wget https://git.openprivacy.ca/openprivacy/buildfiles/raw/master/bin/tor
|
||||
- wget https://git.openprivacy.ca/openprivacy/buildfiles/raw/master/torrc
|
||||
- chmod a+x tor
|
||||
- go get -u golang.org/x/lint/golint
|
||||
- export GO111MODULE=on
|
||||
- go mod vendor
|
||||
- go list ./... | xargs go get
|
||||
- go get -u github.com/golang/lint/golint
|
||||
quality:
|
||||
image: golang
|
||||
when:
|
||||
repo: cwtch.im/cwtch
|
||||
branch: master
|
||||
event: [ push, pull_request ]
|
||||
commands:
|
||||
- go list ./... | xargs go vet
|
||||
- go list ./... | xargs golint -set_exit_status
|
||||
units-tests:
|
||||
image: golang
|
||||
when:
|
||||
repo: cwtch.im/cwtch
|
||||
branch: master
|
||||
event: [ push, pull_request ]
|
||||
commands:
|
||||
- export PATH=$PATH:/go/src/cwtch.im/cwtch
|
||||
- sh testing/tests.sh
|
||||
integ-test:
|
||||
image: golang
|
||||
when:
|
||||
repo: cwtch.im/cwtch
|
||||
branch: master
|
||||
event: [ push, pull_request ]
|
||||
commands:
|
||||
- go test -race -v cwtch.im/cwtch/testing/
|
||||
- ./tor -f ./torrc
|
||||
- sleep 15
|
||||
- go test -v cwtch.im/cwtch/testing
|
||||
notify-email:
|
||||
image: drillster/drone-email
|
||||
host: build.openprivacy.ca
|
||||
|
@ -49,15 +34,10 @@ pipeline:
|
|||
skip_verify: true
|
||||
from: drone@openprivacy.ca
|
||||
when:
|
||||
repo: cwtch.im/cwtch
|
||||
branch: master
|
||||
event: [ push, pull_request ]
|
||||
status: [ failure ]
|
||||
status: [ success, changed, failure ]
|
||||
notify-gogs:
|
||||
image: openpriv/drone-gogs
|
||||
when:
|
||||
repo: cwtch.im/cwtch
|
||||
branch: master
|
||||
event: pull_request
|
||||
status: [ success, changed, failure ]
|
||||
secrets: [gogs_account_token]
|
||||
|
|
|
@ -3,12 +3,9 @@
|
|||
*private_key*
|
||||
*.messages
|
||||
*.test
|
||||
*/*test_*
|
||||
*/*_test*
|
||||
*.json
|
||||
*/messages/*
|
||||
server/app/messages
|
||||
.reviewboardrc
|
||||
/vendor/
|
||||
/testing/tor/
|
||||
/storage/*/testing/
|
||||
/storage/testing/
|
||||
/testing/storage/
|
||||
|
|
|
@ -1,60 +0,0 @@
|
|||
image: golang:latest
|
||||
|
||||
#before_script:
|
||||
|
||||
stages:
|
||||
- test
|
||||
- docker-push
|
||||
- deploy-staging
|
||||
|
||||
test-server:
|
||||
stage: test
|
||||
script:
|
||||
- mkdir /go/src/cwtch.im
|
||||
- ln -s /builds/${CI_PROJECT_NAMESPACE}/cwtch /go/src/cwtch.im/cwtch
|
||||
- cd /go/src/cwtch.im/cwtch/server/app/
|
||||
- go get
|
||||
- go tool vet -composites=false -shadow=true *.go
|
||||
- go test
|
||||
|
||||
test-client:
|
||||
stage: test
|
||||
script:
|
||||
- mkdir /go/src/cwtch.im
|
||||
- ln -s /builds/${CI_PROJECT_NAMESPACE}/cwtch /go/src/cwtch.im/cwtch
|
||||
- cd /go/src/cwtch.im/cwtch/app/cli/
|
||||
- go get
|
||||
- go tool vet -composites=false -shadow=true *.go
|
||||
- go test
|
||||
# We don't really care about the client here but it's useful to know what's
|
||||
# happening on t'other side of the coin
|
||||
allow_failure: true
|
||||
|
||||
|
||||
gitlab-registry:
|
||||
stage: docker-push
|
||||
image: docker:latest
|
||||
services:
|
||||
- docker:dind
|
||||
tags:
|
||||
script:
|
||||
- docker login -u gitlab-ci-token -p $CI_JOB_TOKEN ${CI_REGISTRY}
|
||||
- docker build -t ${CI_REGISTRY_IMAGE}:latest -t ${CI_REGISTRY_IMAGE}:${CI_COMMIT_SHA:0:8} .
|
||||
- docker push ${CI_REGISTRY_IMAGE}:latest
|
||||
- docker push ${CI_REGISTRY_IMAGE}:${CI_COMMIT_SHA:0:8}
|
||||
dependencies:
|
||||
- test-server
|
||||
|
||||
docker-hub:
|
||||
stage: docker-push
|
||||
image: docker:latest
|
||||
services:
|
||||
- docker:dind
|
||||
tags:
|
||||
script:
|
||||
- docker login -u ${DOCKER_HUB_ID} -p ${DOCKER_HUB_PASSWORD} registry.hub.docker.com
|
||||
- docker build -t registry.hub.docker.com/${DOCKER_HUB_ID}/cwtch:latest -t registry.hub.docker.com/${DOCKER_HUB_ID}/cwtch:${CI_COMMIT_SHA:0:8} .
|
||||
- docker push registry.hub.docker.com/${DOCKER_HUB_ID}/cwtch:latest
|
||||
- docker push registry.hub.docker.com/${DOCKER_HUB_ID}/cwtch:${CI_COMMIT_SHA:0:8}
|
||||
dependencies:
|
||||
- test-server
|
78
Dockerfile
78
Dockerfile
|
@ -1,78 +0,0 @@
|
|||
FROM golang as server-build-stage
|
||||
ENV CGO_ENABLED=0 GOOS=linux
|
||||
|
||||
WORKDIR /go/src/cwtch.im/cwtch
|
||||
COPY . .
|
||||
|
||||
RUN go get -d -v ./...
|
||||
#RUN go install -v ./...
|
||||
WORKDIR /go/src/cwtch.im/cwtch/server/app/
|
||||
RUN go build -ldflags "-extldflags '-static'"
|
||||
|
||||
|
||||
|
||||
#----------------------------------------------
|
||||
FROM alpine:latest as tor-build-stage
|
||||
|
||||
# Install prerequisites
|
||||
RUN apk --no-cache add --update \
|
||||
gnupg \
|
||||
build-base \
|
||||
libevent \
|
||||
libevent-dev \
|
||||
libressl \
|
||||
libressl-dev \
|
||||
xz-libs \
|
||||
xz-dev \
|
||||
zlib \
|
||||
zlib-dev \
|
||||
zstd \
|
||||
zstd-dev \
|
||||
&& wget -q https://www.torproject.org/dist/tor-0.3.5.3-alpha.tar.gz \
|
||||
&& tar xf tor-0.3.5.3-alpha.tar.gz \
|
||||
&& cd tor-0.3.5.3-alpha \
|
||||
&& ./configure \
|
||||
&& make install \
|
||||
&& ls -R /usr/local/
|
||||
|
||||
FROM alpine:latest
|
||||
MAINTAINER Ablative Hosting <support@ablative.hosting>
|
||||
|
||||
#BSD habits die hard
|
||||
ENV TOR_USER=_tor
|
||||
|
||||
# Installing dependencies of Tor and pwgen
|
||||
RUN apk --no-cache add --update \
|
||||
libevent \
|
||||
libressl \
|
||||
xz-libs \
|
||||
zlib \
|
||||
zstd \
|
||||
zstd-dev \
|
||||
pwgen
|
||||
|
||||
# Copy Tor
|
||||
COPY --from=tor-build-stage /usr/local/ /usr/local/
|
||||
|
||||
# Create an unprivileged tor user
|
||||
RUN addgroup -S $TOR_USER && adduser -G $TOR_USER -S $TOR_USER && adduser -G _tor -S cwtchd && mkdir /run/tor
|
||||
|
||||
# Copy Tor configuration file
|
||||
COPY ./server/docker/torrc /etc/tor/torrc
|
||||
|
||||
# Copy docker-entrypoint
|
||||
COPY ./server/docker/docker-entrypoint /usr/local/bin/
|
||||
|
||||
# Copy across cwtch
|
||||
COPY --from=server-build-stage /go/src/cwtch.im/cwtch/server/app/app /usr/local/bin/cwtch_server
|
||||
|
||||
# Persist data
|
||||
VOLUME /etc/tor /var/lib/tor /etc/cwtch
|
||||
|
||||
ENTRYPOINT ["docker-entrypoint"]
|
||||
|
||||
#cwtchd is in the _tor group so can access the socket but that's it
|
||||
#USER cwtchd
|
||||
|
||||
#Launches the cwtchd daemon
|
||||
CMD ["/usr/local/bin/cwtch_server"]
|
28
README.md
28
README.md
|
@ -27,32 +27,4 @@ More Information: [https://cwtch.im](https://cwtch.im)
|
|||
|
||||
Development and Contributing information in [CONTRIBUTING.md](https://git.openprivacy.ca/cwtch.im/cwtch/src/master/CONTRIBUTING.md)
|
||||
|
||||
## Running Cwtch
|
||||
### Server
|
||||
#### Docker
|
||||
This repository contains a `Dockerfile` allowing you to build and run the server as a [docker](https://www.docker.com/) container.
|
||||
|
||||
To get started issue `docker build -t openpriv/cwtch-server:latest .`, this will create 2 temporary docker containers, one to build the Tor daemon and one to build Cwtch. The compiled binaries will then be bundled into a new image and tagged as `openpriv/cwtch-server:latest`.
|
||||
|
||||
To run Cwtch in the foreground execute `docker run openpriv/cwtch-server:latest`, you will see a small amount of output from Tor and then Cwtch will output your server address. When you `Ctrl + C` the container will terminate. To run Cwtch in the background execute `docker run --name my-cwtch-server -d openpriv/cwtch-server:latest`. To get your Cwtch server address issue `docker logs my-cwtch-server`.
|
||||
|
||||
The image creates 3 volumes, for /etc/cwtch, /etc/tor, /var/lib/tor
|
||||
|
||||
##### Upgrading
|
||||
|
||||
To upgrade with continuity
|
||||
|
||||
```
|
||||
# Stop current container/service
|
||||
docker stop my-cwtch-server
|
||||
|
||||
docker pull openpriv/cwtch-server
|
||||
|
||||
# Create a new container and copy the volumes (cwtch/onion keys, message store)
|
||||
docker create --name my-cwtch-server-2 --volumes-from my-cwtch-server openpriv/cwtch-server:latest
|
||||
|
||||
# Resume service with the new container
|
||||
docker start my-cwtch-server-2
|
||||
```
|
||||
|
||||
![](https://git.openprivacy.ca/avatars/5?s=140)
|
||||
|
|
356
app/app.go
356
app/app.go
|
@ -1,294 +1,182 @@
|
|||
package app
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/app/plugins"
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/model"
|
||||
"crypto/rand"
|
||||
"cwtch.im/cwtch/connectivity/tor"
|
||||
"cwtch.im/cwtch/peer"
|
||||
"cwtch.im/cwtch/protocol/connections"
|
||||
"cwtch.im/cwtch/storage"
|
||||
"encoding/hex"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives"
|
||||
"git.openprivacy.ca/openprivacy/connectivity"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"io/ioutil"
|
||||
"log"
|
||||
"os"
|
||||
"path"
|
||||
"strconv"
|
||||
"path/filepath"
|
||||
"sync"
|
||||
)
|
||||
|
||||
// AttributeTag is a const name for a peer attribute that can be set at creation time, for example for versioning info
|
||||
const AttributeTag = "tag"
|
||||
|
||||
type applicationCore struct {
|
||||
eventBuses map[string]event.Manager
|
||||
|
||||
directory string
|
||||
coremutex sync.Mutex
|
||||
}
|
||||
|
||||
type application struct {
|
||||
applicationCore
|
||||
appletPeers
|
||||
appletACN
|
||||
appletPlugins
|
||||
storage map[string]storage.ProfileStore
|
||||
engines map[string]connections.Engine
|
||||
appBus event.Manager
|
||||
appmutex sync.Mutex
|
||||
peers map[string]peer.CwtchPeer
|
||||
torManager *tor.Manager
|
||||
directory string
|
||||
mutex sync.Mutex
|
||||
primaryonion string
|
||||
}
|
||||
|
||||
// Application is a full cwtch peer application. It allows management, usage and storage of multiple peers
|
||||
type Application interface {
|
||||
LoadProfiles(password string)
|
||||
CreatePeer(name string, password string)
|
||||
CreateTaggedPeer(name string, password string, tag string)
|
||||
DeletePeer(onion string)
|
||||
AddPeerPlugin(onion string, pluginID plugins.PluginID)
|
||||
ChangePeerPassword(onion, oldpass, newpass string)
|
||||
LaunchPeers()
|
||||
|
||||
GetPrimaryBus() event.Manager
|
||||
GetEventBus(onion string) event.Manager
|
||||
QueryACNStatus()
|
||||
QueryACNVersion()
|
||||
|
||||
ShutdownPeer(string)
|
||||
Shutdown()
|
||||
LoadProfiles(password string) error
|
||||
CreatePeer(name string, password string) (peer.CwtchPeer, error)
|
||||
|
||||
PrimaryIdentity() peer.CwtchPeer
|
||||
GetPeer(onion string) peer.CwtchPeer
|
||||
ListPeers() map[string]string
|
||||
}
|
||||
|
||||
// LoadProfileFn is the function signature for a function in an app that loads a profile
|
||||
type LoadProfileFn func(profile *model.Profile, store storage.ProfileStore)
|
||||
GetTorStatus() (map[string]string, error)
|
||||
|
||||
func newAppCore(appDirectory string) *applicationCore {
|
||||
appCore := &applicationCore{eventBuses: make(map[string]event.Manager), directory: appDirectory}
|
||||
os.MkdirAll(path.Join(appCore.directory, "profiles"), 0700)
|
||||
return appCore
|
||||
Shutdown()
|
||||
}
|
||||
|
||||
// NewApp creates a new app with some environment awareness and initializes a Tor Manager
|
||||
func NewApp(acn connectivity.ACN, appDirectory string) Application {
|
||||
log.Debugf("NewApp(%v)\n", appDirectory)
|
||||
app := &application{storage: make(map[string]storage.ProfileStore), engines: make(map[string]connections.Engine), applicationCore: *newAppCore(appDirectory), appBus: event.NewEventManager()}
|
||||
app.appletPeers.init()
|
||||
func NewApp(appDirectory string, torPath string) (Application, error) {
|
||||
log.Printf("NewApp(%v, %v)\n", appDirectory, torPath)
|
||||
app := &application{peers: make(map[string]peer.CwtchPeer), directory: appDirectory}
|
||||
os.MkdirAll(path.Join(appDirectory, "tor"), 0700)
|
||||
os.Mkdir(path.Join(app.directory, "profiles"), 0700)
|
||||
|
||||
app.appletACN.init(acn, app.getACNStatusHandler())
|
||||
return app
|
||||
err := app.startTor(torPath)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return app, nil
|
||||
}
|
||||
|
||||
// CreatePeer creates a new Peer with a given name and core required accessories (eventbus)
|
||||
func (ac *applicationCore) CreatePeer(name string) (*model.Profile, error) {
|
||||
log.Debugf("CreatePeer(%v)\n", name)
|
||||
func generateRandomFilename() string {
|
||||
randBytes := make([]byte, 16)
|
||||
rand.Read(randBytes)
|
||||
return filepath.Join(hex.EncodeToString(randBytes))
|
||||
}
|
||||
|
||||
profile := storage.NewProfile(name)
|
||||
// NewProfile creates a new cwtchPeer with a given name.
|
||||
func (app *application) CreatePeer(name string, password string) (peer.CwtchPeer, error) {
|
||||
log.Printf("CreatePeer(%v)\n", name)
|
||||
|
||||
ac.coremutex.Lock()
|
||||
defer ac.coremutex.Unlock()
|
||||
randomFileName := generateRandomFilename()
|
||||
p, err := peer.NewCwtchPeer(name, password, path.Join(app.directory, "profiles", randomFileName))
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
err = p.Save()
|
||||
if err != nil {
|
||||
p.Shutdown() //attempt
|
||||
return nil, fmt.Errorf("Error attempting to save new profile: %v", err)
|
||||
}
|
||||
app.startPeer(p)
|
||||
|
||||
_, exists := ac.eventBuses[profile.Onion]
|
||||
_, exists := app.peers[p.GetProfile().Onion]
|
||||
if exists {
|
||||
return nil, fmt.Errorf("error: profile for onion %v already exists", profile.Onion)
|
||||
p.Shutdown()
|
||||
return nil, fmt.Errorf("Error: profile for onion %v already exists", p.GetProfile().Onion)
|
||||
}
|
||||
app.mutex.Lock()
|
||||
app.peers[p.GetProfile().Onion] = p
|
||||
app.mutex.Unlock()
|
||||
|
||||
eventBus := event.NewEventManager()
|
||||
ac.eventBuses[profile.Onion] = eventBus
|
||||
|
||||
return profile, nil
|
||||
return p, nil
|
||||
}
|
||||
|
||||
func (ac *applicationCore) DeletePeer(onion string) {
|
||||
ac.coremutex.Lock()
|
||||
defer ac.coremutex.Unlock()
|
||||
|
||||
ac.eventBuses[onion].Shutdown()
|
||||
delete(ac.eventBuses, onion)
|
||||
}
|
||||
|
||||
func (app *application) CreateTaggedPeer(name string, password string, tag string) {
|
||||
profile, err := app.applicationCore.CreatePeer(name)
|
||||
func (app *application) LoadProfiles(password string) error {
|
||||
files, err := ioutil.ReadDir(path.Join(app.directory, "profiles"))
|
||||
if err != nil {
|
||||
app.appBus.Publish(event.NewEventList(event.PeerError, event.Error, err.Error()))
|
||||
return
|
||||
}
|
||||
|
||||
profileStore := storage.CreateProfileWriterStore(app.eventBuses[profile.Onion], path.Join(app.directory, "profiles", profile.LocalID), password, profile)
|
||||
app.storage[profile.Onion] = profileStore
|
||||
|
||||
pc := app.storage[profile.Onion].GetProfileCopy(true)
|
||||
p := peer.FromProfile(pc)
|
||||
p.Init(app.eventBuses[profile.Onion])
|
||||
|
||||
peerAuthorizations := profile.ContactsAuthorizations()
|
||||
// TODO: Would be nice if ProtocolEngine did not need to explicitly be given the Private Key.
|
||||
identity := primitives.InitializeIdentity(profile.Name, &profile.Ed25519PrivateKey, &profile.Ed25519PublicKey)
|
||||
engine := connections.NewProtocolEngine(identity, profile.Ed25519PrivateKey, app.acn, app.eventBuses[profile.Onion], peerAuthorizations)
|
||||
|
||||
app.peers[profile.Onion] = p
|
||||
app.engines[profile.Onion] = engine
|
||||
|
||||
if tag != "" {
|
||||
p.SetAttribute(AttributeTag, tag)
|
||||
}
|
||||
|
||||
app.appBus.Publish(event.NewEvent(event.NewPeer, map[event.Field]string{event.Identity: profile.Onion, event.Created: event.True}))
|
||||
}
|
||||
|
||||
// CreatePeer creates a new Peer with the given name and required accessories (eventbus, storage, protocol engine)
|
||||
func (app *application) CreatePeer(name string, password string) {
|
||||
app.CreateTaggedPeer(name, password, "")
|
||||
}
|
||||
|
||||
func (app *application) DeletePeer(onion string) {
|
||||
log.Infof("DeletePeer called on %v\n", onion)
|
||||
app.appmutex.Lock()
|
||||
defer app.appmutex.Unlock()
|
||||
|
||||
app.appletPlugins.ShutdownPeer(onion)
|
||||
app.plugins.Delete(onion)
|
||||
|
||||
app.peers[onion].Shutdown()
|
||||
delete(app.peers, onion)
|
||||
|
||||
app.engines[onion].Shutdown()
|
||||
delete(app.engines, onion)
|
||||
|
||||
app.storage[onion].Shutdown()
|
||||
app.storage[onion].Delete()
|
||||
delete(app.storage, onion)
|
||||
|
||||
app.eventBuses[onion].Publish(event.NewEventList(event.ShutdownPeer, event.Identity, onion))
|
||||
|
||||
app.applicationCore.DeletePeer(onion)
|
||||
log.Debugf("Delete peer for %v Done\n", onion)
|
||||
}
|
||||
|
||||
func (app *application) ChangePeerPassword(onion, oldpass, newpass string) {
|
||||
app.eventBuses[onion].Publish(event.NewEventList(event.ChangePassword, event.Password, oldpass, event.NewPassword, newpass))
|
||||
}
|
||||
|
||||
func (app *application) AddPeerPlugin(onion string, pluginID plugins.PluginID) {
|
||||
app.AddPlugin(onion, pluginID, app.eventBuses[onion], app.acn)
|
||||
}
|
||||
|
||||
// LoadProfiles takes a password and attempts to load any profiles it can from storage with it and create Peers for them
|
||||
func (ac *applicationCore) LoadProfiles(password string, timeline bool, loadProfileFn LoadProfileFn) error {
|
||||
files, err := ioutil.ReadDir(path.Join(ac.directory, "profiles"))
|
||||
if err != nil {
|
||||
return fmt.Errorf("error: cannot read profiles directory: %v", err)
|
||||
return fmt.Errorf("Error: cannot read profiles directory: %v", err)
|
||||
}
|
||||
|
||||
for _, file := range files {
|
||||
eventBus := event.NewEventManager()
|
||||
profileStore, err := storage.LoadProfileWriterStore(eventBus, path.Join(ac.directory, "profiles", file.Name()), password)
|
||||
p, err := peer.LoadCwtchPeer(path.Join(app.directory, "profiles", file.Name()), password)
|
||||
if err != nil {
|
||||
continue
|
||||
}
|
||||
|
||||
profile := profileStore.GetProfileCopy(timeline)
|
||||
|
||||
_, exists := ac.eventBuses[profile.Onion]
|
||||
_, exists := app.peers[p.GetProfile().Onion]
|
||||
if exists {
|
||||
profileStore.Shutdown()
|
||||
eventBus.Shutdown()
|
||||
log.Errorf("profile for onion %v already exists", profile.Onion)
|
||||
p.Shutdown()
|
||||
log.Printf("Error: profile for onion %v already exists", p.GetProfile().Onion)
|
||||
continue
|
||||
}
|
||||
|
||||
ac.coremutex.Lock()
|
||||
ac.eventBuses[profile.Onion] = eventBus
|
||||
ac.coremutex.Unlock()
|
||||
|
||||
loadProfileFn(profile, profileStore)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// LoadProfiles takes a password and attempts to load any profiles it can from storage with it and create Peers for them
|
||||
func (app *application) LoadProfiles(password string) {
|
||||
count := 0
|
||||
app.applicationCore.LoadProfiles(password, true, func(profile *model.Profile, profileStore storage.ProfileStore) {
|
||||
peer := peer.FromProfile(profile)
|
||||
peer.Init(app.eventBuses[profile.Onion])
|
||||
|
||||
peerAuthorizations := profile.ContactsAuthorizations()
|
||||
identity := primitives.InitializeIdentity(profile.Name, &profile.Ed25519PrivateKey, &profile.Ed25519PublicKey)
|
||||
engine := connections.NewProtocolEngine(identity, profile.Ed25519PrivateKey, app.acn, app.eventBuses[profile.Onion], peerAuthorizations)
|
||||
app.appmutex.Lock()
|
||||
app.peers[profile.Onion] = peer
|
||||
app.storage[profile.Onion] = profileStore
|
||||
app.engines[profile.Onion] = engine
|
||||
app.appmutex.Unlock()
|
||||
app.appBus.Publish(event.NewEvent(event.NewPeer, map[event.Field]string{event.Identity: profile.Onion, event.Created: event.False}))
|
||||
count++
|
||||
})
|
||||
if count == 0 {
|
||||
message := event.NewEventList(event.AppError, event.Error, event.AppErrLoaded0)
|
||||
app.appBus.Publish(message)
|
||||
}
|
||||
}
|
||||
|
||||
// GetPrimaryBus returns the bus the Application uses for events that aren't peer specific
|
||||
func (app *application) GetPrimaryBus() event.Manager {
|
||||
return app.appBus
|
||||
}
|
||||
|
||||
// GetEventBus returns a cwtchPeer's event bus
|
||||
func (ac *applicationCore) GetEventBus(onion string) event.Manager {
|
||||
if manager, ok := ac.eventBuses[onion]; ok {
|
||||
return manager
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (app *application) getACNStatusHandler() func(int, string) {
|
||||
return func(progress int, status string) {
|
||||
progStr := strconv.Itoa(progress)
|
||||
app.peerLock.Lock()
|
||||
app.appBus.Publish(event.NewEventList(event.ACNStatus, event.Progress, progStr, event.Status, status))
|
||||
for _, bus := range app.eventBuses {
|
||||
bus.Publish(event.NewEventList(event.ACNStatus, event.Progress, progStr, event.Status, status))
|
||||
app.startPeer(p)
|
||||
app.mutex.Lock()
|
||||
app.peers[p.GetProfile().Onion] = p
|
||||
if app.primaryonion == "" {
|
||||
app.primaryonion = p.GetProfile().Onion
|
||||
}
|
||||
app.peerLock.Unlock()
|
||||
app.mutex.Unlock()
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (app *application) QueryACNStatus() {
|
||||
prog, status := app.acn.GetBootstrapStatus()
|
||||
app.getACNStatusHandler()(prog, status)
|
||||
// startTor will create a local torrc if needed
|
||||
func (app *application) startTor(torPath string) error {
|
||||
// Creating a local cwtch tor server config for the user
|
||||
// creating $app.directory/torrc file
|
||||
// SOCKSPort socksPort
|
||||
// ControlPort controlPort
|
||||
torrc := path.Join(app.directory, "tor", "torrc")
|
||||
if _, err := os.Stat(torrc); os.IsNotExist(err) {
|
||||
log.Printf("writing torrc to: %v\n", torrc)
|
||||
file, err := os.Create(torrc)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
fmt.Fprintf(file, "SOCKSPort %d\nControlPort %d\nCookieAuthentication 0\nSafeSocks 1\n", 9050, 9051)
|
||||
file.Close()
|
||||
}
|
||||
|
||||
tm, err := tor.NewTorManager(9050, 9051, torPath, torrc)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
app.torManager = tm
|
||||
return nil
|
||||
}
|
||||
|
||||
func (app *application) QueryACNVersion() {
|
||||
version := app.acn.GetVersion()
|
||||
app.appBus.Publish(event.NewEventList(event.ACNVersion, event.Data, version))
|
||||
func (app *application) startPeer(peer peer.CwtchPeer) {
|
||||
go func() {
|
||||
e := peer.Listen()
|
||||
if e != nil {
|
||||
log.Fatalf("ERROR: peer %v has crashed with: %v\n", peer.GetProfile().Onion, e)
|
||||
}
|
||||
}()
|
||||
}
|
||||
|
||||
// ShutdownPeer shuts down a peer and removes it from the app's management
|
||||
func (app *application) ShutdownPeer(onion string) {
|
||||
app.appmutex.Lock()
|
||||
defer app.appmutex.Unlock()
|
||||
app.eventBuses[onion].Shutdown()
|
||||
delete(app.eventBuses, onion)
|
||||
app.peers[onion].Shutdown()
|
||||
delete(app.peers, onion)
|
||||
app.engines[onion].Shutdown()
|
||||
delete(app.engines, onion)
|
||||
app.storage[onion].Shutdown()
|
||||
delete(app.storage, onion)
|
||||
app.appletPlugins.Shutdown()
|
||||
// ListPeers returns a map of onions to their profile's Name
|
||||
func (app *application) ListPeers() map[string]string {
|
||||
keys := map[string]string{}
|
||||
for k, p := range app.peers {
|
||||
keys[k] = p.GetProfile().Name
|
||||
}
|
||||
return keys
|
||||
}
|
||||
|
||||
// PrimaryIdentity returns a Peer for a given onion address
|
||||
func (app *application) PrimaryIdentity() peer.CwtchPeer {
|
||||
return app.peers[app.primaryonion]
|
||||
}
|
||||
|
||||
// GetPeer returns a Peer for a given onion address
|
||||
func (app *application) GetPeer(onion string) peer.CwtchPeer {
|
||||
if peer, ok := app.peers[onion]; ok {
|
||||
return peer
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// GetTorStatus returns tor control port bootstrap-phase status info in a map
|
||||
func (app *application) GetTorStatus() (map[string]string, error) {
|
||||
return app.torManager.GetStatus()
|
||||
}
|
||||
|
||||
// Shutdown shutsdown all peers of an app and then the tormanager
|
||||
func (app *application) Shutdown() {
|
||||
for id, peer := range app.peers {
|
||||
for _, peer := range app.peers {
|
||||
peer.Shutdown()
|
||||
app.appletPlugins.ShutdownPeer(id)
|
||||
app.engines[id].Shutdown()
|
||||
app.storage[id].Shutdown()
|
||||
app.eventBuses[id].Shutdown()
|
||||
}
|
||||
app.appBus.Shutdown()
|
||||
app.torManager.Shutdown()
|
||||
}
|
||||
|
|
|
@ -1,39 +0,0 @@
|
|||
package app
|
||||
|
||||
import "cwtch.im/cwtch/event"
|
||||
import "git.openprivacy.ca/openprivacy/log"
|
||||
|
||||
const (
|
||||
// DestApp should be used as a destination for IPC messages that are for the application itself an not a peer
|
||||
DestApp = "app"
|
||||
)
|
||||
|
||||
type applicationBridge struct {
|
||||
applicationCore
|
||||
|
||||
bridge event.IPCBridge
|
||||
handle func(*event.Event)
|
||||
}
|
||||
|
||||
func (ab *applicationBridge) listen() {
|
||||
log.Infoln("ab.listen()")
|
||||
for {
|
||||
ipcMessage, ok := ab.bridge.Read()
|
||||
log.Debugf("listen() got %v for %v\n", ipcMessage.Message.EventType, ipcMessage.Dest)
|
||||
if !ok {
|
||||
log.Debugln("exiting appBridge.listen()")
|
||||
return
|
||||
}
|
||||
|
||||
if ipcMessage.Dest == DestApp {
|
||||
ab.handle(&ipcMessage.Message)
|
||||
} else {
|
||||
if eventBus, exists := ab.eventBuses[ipcMessage.Dest]; exists {
|
||||
eventBus.PublishLocal(ipcMessage.Message)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (ab *applicationBridge) Shutdown() {
|
||||
}
|
176
app/appClient.go
176
app/appClient.go
|
@ -1,176 +0,0 @@
|
|||
package app
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/app/plugins"
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/peer"
|
||||
"cwtch.im/cwtch/storage"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"path"
|
||||
"strconv"
|
||||
"sync"
|
||||
)
|
||||
|
||||
type applicationClient struct {
|
||||
applicationBridge
|
||||
appletPeers
|
||||
|
||||
appBus event.Manager
|
||||
acmutex sync.Mutex
|
||||
}
|
||||
|
||||
// NewAppClient returns an Application that acts as a client to a AppService, connected by the IPCBridge supplied
|
||||
func NewAppClient(appDirectory string, bridge event.IPCBridge) Application {
|
||||
appClient := &applicationClient{appletPeers: appletPeers{peers: make(map[string]peer.CwtchPeer)}, applicationBridge: applicationBridge{applicationCore: *newAppCore(appDirectory), bridge: bridge}, appBus: event.NewEventManager()}
|
||||
appClient.handle = appClient.handleEvent
|
||||
|
||||
go appClient.listen()
|
||||
|
||||
appClient.bridge.Write(&event.IPCMessage{Dest: DestApp, Message: event.NewEventList(event.ReloadClient)})
|
||||
|
||||
log.Infoln("Created new App Client")
|
||||
return appClient
|
||||
}
|
||||
|
||||
// GetPrimaryBus returns the bus the Application uses for events that aren't peer specific
|
||||
func (ac *applicationClient) GetPrimaryBus() event.Manager {
|
||||
return ac.appBus
|
||||
}
|
||||
|
||||
func (ac *applicationClient) handleEvent(ev *event.Event) {
|
||||
switch ev.EventType {
|
||||
case event.NewPeer:
|
||||
localID := ev.Data[event.Identity]
|
||||
key := ev.Data[event.Key]
|
||||
salt := ev.Data[event.Salt]
|
||||
reload := ev.Data[event.Status] == event.StorageRunning
|
||||
created := ev.Data[event.Created]
|
||||
ac.newPeer(localID, key, salt, reload, created)
|
||||
case event.DeletePeer:
|
||||
onion := ev.Data[event.Identity]
|
||||
ac.handleDeletedPeer(onion)
|
||||
case event.PeerError:
|
||||
ac.appBus.Publish(*ev)
|
||||
case event.AppError:
|
||||
ac.appBus.Publish(*ev)
|
||||
case event.ACNStatus:
|
||||
ac.appBus.Publish(*ev)
|
||||
case event.ACNVersion:
|
||||
ac.appBus.Publish(*ev)
|
||||
case event.ReloadDone:
|
||||
ac.appBus.Publish(*ev)
|
||||
}
|
||||
}
|
||||
|
||||
func (ac *applicationClient) newPeer(localID, key, salt string, reload bool, created string) {
|
||||
var keyBytes [32]byte
|
||||
var saltBytes [128]byte
|
||||
copy(keyBytes[:], key)
|
||||
copy(saltBytes[:], salt)
|
||||
profile, err := storage.ReadProfile(path.Join(ac.directory, "profiles", localID), keyBytes, saltBytes)
|
||||
if err != nil {
|
||||
log.Errorf("Could not read profile for NewPeer event: %v\n", err)
|
||||
ac.appBus.Publish(event.NewEventList(event.PeerError, event.Error, fmt.Sprintf("Could not read profile for NewPeer event: %v\n", err)))
|
||||
return
|
||||
}
|
||||
|
||||
_, exists := ac.peers[profile.Onion]
|
||||
if exists {
|
||||
log.Errorf("profile for onion %v already exists", profile.Onion)
|
||||
ac.appBus.Publish(event.NewEventList(event.PeerError, event.Error, fmt.Sprintf("profile for onion %v already exists", profile.Onion)))
|
||||
return
|
||||
}
|
||||
|
||||
eventBus := event.NewIPCEventManager(ac.bridge, profile.Onion)
|
||||
peer := peer.FromProfile(profile)
|
||||
peer.Init(eventBus)
|
||||
|
||||
ac.peerLock.Lock()
|
||||
defer ac.peerLock.Unlock()
|
||||
ac.peers[profile.Onion] = peer
|
||||
ac.eventBuses[profile.Onion] = eventBus
|
||||
npEvent := event.NewEvent(event.NewPeer, map[event.Field]string{event.Identity: profile.Onion, event.Created: created})
|
||||
if reload {
|
||||
npEvent.Data[event.Status] = event.StorageRunning
|
||||
}
|
||||
ac.appBus.Publish(npEvent)
|
||||
|
||||
if reload {
|
||||
ac.bridge.Write(&event.IPCMessage{Dest: DestApp, Message: event.NewEventList(event.ReloadPeer, event.Identity, profile.Onion)})
|
||||
}
|
||||
}
|
||||
|
||||
// CreatePeer messages the service to create a new Peer with the given name
|
||||
func (ac *applicationClient) CreatePeer(name string, password string) {
|
||||
ac.CreateTaggedPeer(name, password, "")
|
||||
}
|
||||
|
||||
func (ac *applicationClient) CreateTaggedPeer(name, password, tag string) {
|
||||
log.Infof("appClient CreatePeer %v\n", name)
|
||||
message := event.IPCMessage{Dest: DestApp, Message: event.NewEvent(event.CreatePeer, map[event.Field]string{event.ProfileName: name, event.Password: password, event.Data: tag})}
|
||||
ac.bridge.Write(&message)
|
||||
}
|
||||
|
||||
// DeletePeer messages tehe service to delete a peer
|
||||
func (ac *applicationClient) DeletePeer(onion string) {
|
||||
message := event.IPCMessage{Dest: DestApp, Message: event.NewEvent(event.DeletePeer, map[event.Field]string{event.Identity: onion})}
|
||||
ac.bridge.Write(&message)
|
||||
}
|
||||
|
||||
func (ac *applicationClient) ChangePeerPassword(onion, oldpass, newpass string) {
|
||||
message := event.IPCMessage{Dest: onion, Message: event.NewEventList(event.ChangePassword, event.Password, oldpass, event.NewPassword, newpass)}
|
||||
ac.bridge.Write(&message)
|
||||
}
|
||||
|
||||
func (ac *applicationClient) handleDeletedPeer(onion string) {
|
||||
ac.acmutex.Lock()
|
||||
defer ac.acmutex.Unlock()
|
||||
ac.peers[onion].Shutdown()
|
||||
delete(ac.peers, onion)
|
||||
ac.eventBuses[onion].Publish(event.NewEventList(event.ShutdownPeer, event.Identity, onion))
|
||||
|
||||
ac.applicationCore.DeletePeer(onion)
|
||||
}
|
||||
|
||||
func (ac *applicationClient) AddPeerPlugin(onion string, pluginID plugins.PluginID) {
|
||||
message := event.IPCMessage{Dest: DestApp, Message: event.NewEvent(event.AddPeerPlugin, map[event.Field]string{event.Identity: onion, event.Data: strconv.Itoa(int(pluginID))})}
|
||||
ac.bridge.Write(&message)
|
||||
}
|
||||
|
||||
// LoadProfiles messages the service to load any profiles for the given password
|
||||
func (ac *applicationClient) LoadProfiles(password string) {
|
||||
message := event.IPCMessage{Dest: DestApp, Message: event.NewEvent(event.LoadProfiles, map[event.Field]string{event.Password: password})}
|
||||
ac.bridge.Write(&message)
|
||||
}
|
||||
|
||||
func (ac *applicationClient) QueryACNStatus() {
|
||||
message := event.IPCMessage{Dest: DestApp, Message: event.NewEvent(event.GetACNStatus, map[event.Field]string{})}
|
||||
ac.bridge.Write(&message)
|
||||
}
|
||||
|
||||
func (ac *applicationClient) QueryACNVersion() {
|
||||
message := event.IPCMessage{Dest: DestApp, Message: event.NewEvent(event.GetACNVersion, map[event.Field]string{})}
|
||||
ac.bridge.Write(&message)
|
||||
}
|
||||
|
||||
// ShutdownPeer shuts down a peer and removes it from the app's management
|
||||
func (ac *applicationClient) ShutdownPeer(onion string) {
|
||||
ac.acmutex.Lock()
|
||||
defer ac.acmutex.Unlock()
|
||||
ac.eventBuses[onion].Shutdown()
|
||||
delete(ac.eventBuses, onion)
|
||||
ac.peers[onion].Shutdown()
|
||||
delete(ac.peers, onion)
|
||||
message := event.IPCMessage{Dest: DestApp, Message: event.NewEvent(event.ShutdownPeer, map[event.Field]string{event.Identity: onion})}
|
||||
ac.bridge.Write(&message)
|
||||
}
|
||||
|
||||
// Shutdown shuts down the application client and all front end peer components
|
||||
func (ac *applicationClient) Shutdown() {
|
||||
for id := range ac.peers {
|
||||
ac.ShutdownPeer(id)
|
||||
}
|
||||
ac.applicationBridge.Shutdown()
|
||||
ac.appBus.Shutdown()
|
||||
}
|
|
@ -1,201 +0,0 @@
|
|||
package app
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/app/plugins"
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/protocol/connections"
|
||||
"cwtch.im/cwtch/storage"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives"
|
||||
"git.openprivacy.ca/openprivacy/connectivity"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"path"
|
||||
"strconv"
|
||||
"sync"
|
||||
)
|
||||
|
||||
type applicationService struct {
|
||||
applicationBridge
|
||||
appletACN
|
||||
appletPlugins
|
||||
|
||||
storage map[string]storage.ProfileStore
|
||||
engines map[string]connections.Engine
|
||||
asmutex sync.Mutex
|
||||
}
|
||||
|
||||
// ApplicationService is the back end of an application that manages engines and writing storage and communicates to an ApplicationClient by an IPCBridge
|
||||
type ApplicationService interface {
|
||||
Shutdown()
|
||||
}
|
||||
|
||||
// NewAppService returns an ApplicationService that runs the backend of an app and communicates with a client by the supplied IPCBridge
|
||||
func NewAppService(acn connectivity.ACN, appDirectory string, bridge event.IPCBridge) ApplicationService {
|
||||
appService := &applicationService{storage: make(map[string]storage.ProfileStore), engines: make(map[string]connections.Engine), applicationBridge: applicationBridge{applicationCore: *newAppCore(appDirectory), bridge: bridge}}
|
||||
|
||||
appService.appletACN.init(acn, appService.getACNStatusHandler())
|
||||
appService.handle = appService.handleEvent
|
||||
|
||||
go appService.listen()
|
||||
|
||||
log.Infoln("Created new App Service")
|
||||
return appService
|
||||
}
|
||||
|
||||
func (as *applicationService) handleEvent(ev *event.Event) {
|
||||
log.Infof("app Service handleEvent %v\n", ev.EventType)
|
||||
switch ev.EventType {
|
||||
case event.CreatePeer:
|
||||
profileName := ev.Data[event.ProfileName]
|
||||
password := ev.Data[event.Password]
|
||||
tag := ev.Data[event.Data]
|
||||
as.createPeer(profileName, password, tag)
|
||||
case event.DeletePeer:
|
||||
onion := ev.Data[event.Identity]
|
||||
as.deletePeer(onion)
|
||||
|
||||
message := event.IPCMessage{Dest: DestApp, Message: *ev}
|
||||
as.bridge.Write(&message)
|
||||
case event.AddPeerPlugin:
|
||||
onion := ev.Data[event.Identity]
|
||||
pluginID, _ := strconv.Atoi(ev.Data[event.Data])
|
||||
as.AddPlugin(onion, plugins.PluginID(pluginID), as.eventBuses[onion], as.acn)
|
||||
case event.LoadProfiles:
|
||||
password := ev.Data[event.Password]
|
||||
as.loadProfiles(password)
|
||||
case event.ReloadClient:
|
||||
for _, storage := range as.storage {
|
||||
peerMsg := *storage.GetNewPeerMessage()
|
||||
peerMsg.Data[event.Status] = event.StorageRunning
|
||||
peerMsg.Data[event.Created] = event.False
|
||||
message := event.IPCMessage{Dest: DestApp, Message: peerMsg}
|
||||
as.bridge.Write(&message)
|
||||
}
|
||||
|
||||
message := event.IPCMessage{Dest: DestApp, Message: event.NewEventList(event.ReloadDone)}
|
||||
as.bridge.Write(&message)
|
||||
case event.ReloadPeer:
|
||||
onion := ev.Data[event.Identity]
|
||||
events := as.storage[onion].GetStatusMessages()
|
||||
|
||||
for _, ev := range events {
|
||||
message := event.IPCMessage{Dest: onion, Message: *ev}
|
||||
as.bridge.Write(&message)
|
||||
}
|
||||
case event.GetACNStatus:
|
||||
prog, status := as.acn.GetBootstrapStatus()
|
||||
as.getACNStatusHandler()(prog, status)
|
||||
case event.GetACNVersion:
|
||||
version := as.acn.GetVersion()
|
||||
as.bridge.Write(&event.IPCMessage{Dest: DestApp, Message: event.NewEventList(event.ACNVersion, event.Data, version)})
|
||||
case event.ShutdownPeer:
|
||||
onion := ev.Data[event.Identity]
|
||||
as.ShutdownPeer(onion)
|
||||
}
|
||||
}
|
||||
|
||||
func (as *applicationService) createPeer(name, password, tag string) {
|
||||
log.Infof("app Service create peer %v %v\n", name, password)
|
||||
profile, err := as.applicationCore.CreatePeer(name)
|
||||
as.eventBuses[profile.Onion] = event.IPCEventManagerFrom(as.bridge, profile.Onion, as.eventBuses[profile.Onion])
|
||||
if err != nil {
|
||||
log.Errorf("Could not create Peer: %v\n", err)
|
||||
message := event.IPCMessage{Dest: DestApp, Message: event.NewEventList(event.PeerError, event.Error, err.Error())}
|
||||
as.bridge.Write(&message)
|
||||
return
|
||||
}
|
||||
|
||||
if tag != "" {
|
||||
profile.SetAttribute(AttributeTag, tag)
|
||||
}
|
||||
|
||||
profileStore := storage.CreateProfileWriterStore(as.eventBuses[profile.Onion], path.Join(as.directory, "profiles", profile.LocalID), password, profile)
|
||||
|
||||
peerAuthorizations := profile.ContactsAuthorizations()
|
||||
// TODO: Would be nice if ProtocolEngine did not need to explicitly be given the Private Key.
|
||||
identity := primitives.InitializeIdentity(profile.Name, &profile.Ed25519PrivateKey, &profile.Ed25519PublicKey)
|
||||
engine := connections.NewProtocolEngine(identity, profile.Ed25519PrivateKey, as.acn, as.eventBuses[profile.Onion], peerAuthorizations)
|
||||
|
||||
as.storage[profile.Onion] = profileStore
|
||||
as.engines[profile.Onion] = engine
|
||||
|
||||
peerMsg := *profileStore.GetNewPeerMessage()
|
||||
peerMsg.Data[event.Created] = event.True
|
||||
peerMsg.Data[event.Status] = event.StorageNew
|
||||
message := event.IPCMessage{Dest: DestApp, Message: peerMsg}
|
||||
as.bridge.Write(&message)
|
||||
}
|
||||
|
||||
func (as *applicationService) loadProfiles(password string) {
|
||||
count := 0
|
||||
as.applicationCore.LoadProfiles(password, false, func(profile *model.Profile, profileStore storage.ProfileStore) {
|
||||
as.eventBuses[profile.Onion] = event.IPCEventManagerFrom(as.bridge, profile.Onion, as.eventBuses[profile.Onion])
|
||||
|
||||
peerAuthorizations := profile.ContactsAuthorizations()
|
||||
identity := primitives.InitializeIdentity(profile.Name, &profile.Ed25519PrivateKey, &profile.Ed25519PublicKey)
|
||||
engine := connections.NewProtocolEngine(identity, profile.Ed25519PrivateKey, as.acn, as.eventBuses[profile.Onion], peerAuthorizations)
|
||||
as.asmutex.Lock()
|
||||
as.storage[profile.Onion] = profileStore
|
||||
as.engines[profile.Onion] = engine
|
||||
as.asmutex.Unlock()
|
||||
|
||||
peerMsg := *profileStore.GetNewPeerMessage()
|
||||
peerMsg.Data[event.Created] = event.False
|
||||
peerMsg.Data[event.Status] = event.StorageNew
|
||||
message := event.IPCMessage{Dest: DestApp, Message: peerMsg}
|
||||
as.bridge.Write(&message)
|
||||
count++
|
||||
})
|
||||
if count == 0 {
|
||||
message := event.IPCMessage{Dest: DestApp, Message: event.NewEventList(event.AppError, event.Error, event.AppErrLoaded0)}
|
||||
as.bridge.Write(&message)
|
||||
}
|
||||
}
|
||||
|
||||
func (as *applicationService) getACNStatusHandler() func(int, string) {
|
||||
return func(progress int, status string) {
|
||||
progStr := strconv.Itoa(progress)
|
||||
as.bridge.Write(&event.IPCMessage{Dest: DestApp, Message: event.NewEventList(event.ACNStatus, event.Progress, progStr, event.Status, status)})
|
||||
as.applicationCore.coremutex.Lock()
|
||||
defer as.applicationCore.coremutex.Unlock()
|
||||
for _, bus := range as.eventBuses {
|
||||
bus.Publish(event.NewEventList(event.ACNStatus, event.Progress, progStr, event.Status, status))
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (as *applicationService) deletePeer(onion string) {
|
||||
as.asmutex.Lock()
|
||||
defer as.asmutex.Unlock()
|
||||
|
||||
as.appletPlugins.ShutdownPeer(onion)
|
||||
as.plugins.Delete(onion)
|
||||
|
||||
as.engines[onion].Shutdown()
|
||||
delete(as.engines, onion)
|
||||
|
||||
as.storage[onion].Shutdown()
|
||||
as.storage[onion].Delete()
|
||||
delete(as.storage, onion)
|
||||
|
||||
as.applicationCore.DeletePeer(onion)
|
||||
}
|
||||
|
||||
func (as *applicationService) ShutdownPeer(onion string) {
|
||||
as.engines[onion].Shutdown()
|
||||
delete(as.engines, onion)
|
||||
as.storage[onion].Shutdown()
|
||||
delete(as.storage, onion)
|
||||
as.eventBuses[onion].Shutdown()
|
||||
delete(as.eventBuses, onion)
|
||||
}
|
||||
|
||||
// Shutdown shuts down the application Service and all peer related backend parts
|
||||
func (as *applicationService) Shutdown() {
|
||||
log.Debugf("shutting down application service...")
|
||||
as.appletPlugins.Shutdown()
|
||||
for id := range as.engines {
|
||||
log.Debugf("shutting down application service peer engine %v", id)
|
||||
as.ShutdownPeer(id)
|
||||
}
|
||||
}
|
121
app/applets.go
121
app/applets.go
|
@ -1,121 +0,0 @@
|
|||
package app
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"git.openprivacy.ca/openprivacy/connectivity"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"sync"
|
||||
|
||||
"cwtch.im/cwtch/app/plugins"
|
||||
"cwtch.im/cwtch/peer"
|
||||
)
|
||||
|
||||
type appletPeers struct {
|
||||
peerLock sync.Mutex
|
||||
peers map[string]peer.CwtchPeer
|
||||
launched bool // bit hacky, place holder while we transition to full multi peer support and a better api
|
||||
}
|
||||
|
||||
type appletACN struct {
|
||||
acn connectivity.ACN
|
||||
}
|
||||
|
||||
type appletPlugins struct {
|
||||
plugins sync.Map //map[string] []plugins.Plugin
|
||||
}
|
||||
|
||||
// ***** applet ACN
|
||||
|
||||
func (a *appletACN) init(acn connectivity.ACN, publish func(int, string)) {
|
||||
a.acn = acn
|
||||
acn.SetStatusCallback(publish)
|
||||
prog, status := acn.GetBootstrapStatus()
|
||||
publish(prog, status)
|
||||
}
|
||||
|
||||
func (a *appletACN) Shutdown() {
|
||||
a.acn.Close()
|
||||
}
|
||||
|
||||
// ***** appletPeers
|
||||
|
||||
func (ap *appletPeers) init() {
|
||||
ap.peers = make(map[string]peer.CwtchPeer)
|
||||
ap.launched = false
|
||||
}
|
||||
|
||||
// LaunchPeers starts each peer Listening and connecting to peers and groups
|
||||
func (ap *appletPeers) LaunchPeers() {
|
||||
log.Debugf("appletPeers LaunchPeers\n")
|
||||
ap.peerLock.Lock()
|
||||
defer ap.peerLock.Unlock()
|
||||
if ap.launched {
|
||||
return
|
||||
}
|
||||
for pid, p := range ap.peers {
|
||||
log.Debugf("Launching %v\n", pid)
|
||||
p.Listen()
|
||||
log.Debugf("done Listen() for %v\n", pid)
|
||||
p.StartPeersConnections()
|
||||
log.Debugf("done StartPeersConnections() for %v\n", pid)
|
||||
}
|
||||
ap.launched = true
|
||||
}
|
||||
|
||||
// ListPeers returns a map of onions to their profile's Name
|
||||
func (ap *appletPeers) ListPeers() map[string]string {
|
||||
keys := map[string]string{}
|
||||
|
||||
ap.peerLock.Lock()
|
||||
defer ap.peerLock.Unlock()
|
||||
for k, p := range ap.peers {
|
||||
keys[k] = p.GetOnion()
|
||||
}
|
||||
return keys
|
||||
}
|
||||
|
||||
// GetPeer returns a cwtchPeer for a given onion address
|
||||
func (ap *appletPeers) GetPeer(onion string) peer.CwtchPeer {
|
||||
if peer, ok := ap.peers[onion]; ok {
|
||||
return peer
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// ***** applet Plugins
|
||||
|
||||
func (ap *appletPlugins) Shutdown() {
|
||||
log.Debugf("shutting down applet plugins...")
|
||||
ap.plugins.Range(func(k, v interface{}) bool {
|
||||
log.Debugf("shutting down plugins for %v", k)
|
||||
ap.ShutdownPeer(k.(string))
|
||||
return true
|
||||
})
|
||||
}
|
||||
|
||||
func (ap *appletPlugins) ShutdownPeer(peerid string) {
|
||||
log.Debugf("shutting down plugins for %v", peerid)
|
||||
pluginsI, ok := ap.plugins.Load(peerid)
|
||||
if ok {
|
||||
plugins := pluginsI.([]plugins.Plugin)
|
||||
for _, plugin := range plugins {
|
||||
log.Debugf("shutting down plugin: %v", plugin)
|
||||
plugin.Shutdown()
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (ap *appletPlugins) AddPlugin(peerid string, id plugins.PluginID, bus event.Manager, acn connectivity.ACN) {
|
||||
if _, exists := ap.plugins.Load(peerid); !exists {
|
||||
ap.plugins.Store(peerid, []plugins.Plugin{})
|
||||
}
|
||||
|
||||
pluginsinf, _ := ap.plugins.Load(peerid)
|
||||
peerPlugins := pluginsinf.([]plugins.Plugin)
|
||||
|
||||
newp := plugins.Get(id, bus, acn, peerid)
|
||||
newp.Start()
|
||||
peerPlugins = append(peerPlugins, newp)
|
||||
log.Debugf("storing plugin for %v %v", peerid, peerPlugins)
|
||||
ap.plugins.Store(peerid, peerPlugins)
|
||||
}
|
|
@ -1,86 +0,0 @@
|
|||
package main
|
||||
|
||||
import (
|
||||
app2 "cwtch.im/cwtch/app"
|
||||
"cwtch.im/cwtch/app/utils"
|
||||
"cwtch.im/cwtch/peer"
|
||||
"cwtch.im/cwtch/protocol/connections"
|
||||
"errors"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/openprivacy/connectivity/tor"
|
||||
"os"
|
||||
"time"
|
||||
)
|
||||
|
||||
func waitForPeerGroupConnection(peer peer.CwtchPeer, groupID string) error {
|
||||
for {
|
||||
group := peer.GetGroup(groupID)
|
||||
if group != nil {
|
||||
state, _ := peer.GetGroupState(groupID)
|
||||
if state == connections.FAILED {
|
||||
return errors.New("Connection to group " + groupID + " failed!")
|
||||
}
|
||||
if state != connections.AUTHENTICATED {
|
||||
fmt.Printf("peer %v waiting to authenticate with group %v 's server, current state: %v\n", peer.GetOnion(), groupID, connections.ConnectionStateName[state])
|
||||
time.Sleep(time.Second * 10)
|
||||
continue
|
||||
}
|
||||
} else {
|
||||
return errors.New("peer server connections should have entry for server but do not")
|
||||
}
|
||||
break
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func main() {
|
||||
if len(os.Args) != 2 {
|
||||
fmt.Printf("Usage: ./servermon SERVER_ADDRESS\n")
|
||||
os.Exit(1)
|
||||
}
|
||||
|
||||
serverAddr := os.Args[1]
|
||||
|
||||
acn, err := tor.NewTorACN(".", "")
|
||||
if err != nil {
|
||||
fmt.Printf("Could not start tor: %v\n", err)
|
||||
os.Exit(1)
|
||||
}
|
||||
|
||||
app := app2.NewApp(acn, ".")
|
||||
|
||||
app.CreatePeer("servermon", "be gay, do crimes")
|
||||
|
||||
botPeer := utils.WaitGetPeer(app, "servermon")
|
||||
|
||||
fmt.Printf("Connecting to %v...\n", serverAddr)
|
||||
botPeer.JoinServer(serverAddr)
|
||||
groupID, _, err := botPeer.StartGroup(serverAddr)
|
||||
if err != nil {
|
||||
fmt.Printf("Error creating group on server %v: %v\n", serverAddr, err)
|
||||
os.Exit(1)
|
||||
}
|
||||
|
||||
err = waitForPeerGroupConnection(botPeer, groupID)
|
||||
if err != nil {
|
||||
fmt.Printf("Could not connect to server %v: %v\n", serverAddr, err)
|
||||
os.Exit(1)
|
||||
}
|
||||
|
||||
timeout := 1 * time.Second
|
||||
timeElapsed := 0 * time.Second
|
||||
for {
|
||||
_, err := botPeer.SendMessageToGroupTracked(groupID, timeout.String())
|
||||
if err != nil {
|
||||
fmt.Printf("Sent to group on server %v failed at interval %v of total %v with: %v\n", serverAddr, timeout, timeElapsed, err)
|
||||
os.Exit(1)
|
||||
} else {
|
||||
fmt.Printf("Successfully sent message to %v at interval %v of total %v\n", serverAddr, timeout, timeElapsed)
|
||||
}
|
||||
time.Sleep(timeout)
|
||||
timeElapsed += timeout
|
||||
if timeout < 2*time.Minute {
|
||||
timeout = timeout * 2
|
||||
}
|
||||
}
|
||||
}
|
|
@ -0,0 +1,591 @@
|
|||
package main
|
||||
|
||||
import (
|
||||
app2 "cwtch.im/cwtch/app"
|
||||
peer2 "cwtch.im/cwtch/peer"
|
||||
|
||||
"bytes"
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/peer/connections"
|
||||
"fmt"
|
||||
"github.com/c-bata/go-prompt"
|
||||
"golang.org/x/crypto/ssh/terminal"
|
||||
"log"
|
||||
"os"
|
||||
"os/exec"
|
||||
"os/user"
|
||||
"path"
|
||||
"strings"
|
||||
"syscall"
|
||||
"time"
|
||||
)
|
||||
|
||||
var app app2.Application
|
||||
var peer peer2.CwtchPeer
|
||||
var group *model.Group
|
||||
var groupFollowBreakChan chan bool
|
||||
var prmpt string
|
||||
|
||||
var suggestionsBase = []prompt.Suggest{
|
||||
{Text: "/new-profile", Description: "create a new profile"},
|
||||
{Text: "/load-profiles", Description: "loads profiles with a password"},
|
||||
{Text: "/list-profiles", Description: "list active profiles"},
|
||||
{Text: "/select-profile", Description: "selects an active profile to use"},
|
||||
{Text: "/help", Description: "print list of commands"},
|
||||
{Text: "/quit", Description: "quit cwtch"},
|
||||
}
|
||||
|
||||
var suggestionsSelectedProfile = []prompt.Suggest{
|
||||
{Text: "/info", Description: "show user info"},
|
||||
{Text: "/list-contacts", Description: "retrieve a list of contacts"},
|
||||
{Text: "/list-groups", Description: "retrieve a list of groups"},
|
||||
{Text: "/new-group", Description: "create a new group on a server"},
|
||||
{Text: "/select-group", Description: "selects a group to follow"},
|
||||
{Text: "/unselect-group", Description: "stop following the current group"},
|
||||
{Text: "/invite", Description: "invite a new contact"},
|
||||
{Text: "/invite-to-group", Description: "invite an existing contact to join an existing group"},
|
||||
{Text: "/accept-invite", Description: "accept the invite of a group"},
|
||||
{Text: "/list-servers", Description: "retrieve a list of servers and their connection status"},
|
||||
{Text: "/list-peers", Description: "retrieve a list of peers and their connection status"},
|
||||
{Text: "/export-group", Description: "export a group invite: prints as a string"},
|
||||
{Text: "/trust", Description: "trust a peer"},
|
||||
{Text: "/block", Description: "block a peer - you will no longer see messages or connect to this peer"},
|
||||
}
|
||||
|
||||
var suggestions = suggestionsBase
|
||||
|
||||
var usages = map[string]string{
|
||||
"/new-profile": "/new-profile [name]",
|
||||
"/load-profiles": "/load-profiles",
|
||||
"/list-profiles": "",
|
||||
"/select-profile": "/select-profile [onion]",
|
||||
"/quit": "",
|
||||
"/list-servers": "",
|
||||
"/list-peers": "",
|
||||
"/list-contacts": "",
|
||||
"/list-groups": "",
|
||||
"/select-group": "/select-group [groupid]",
|
||||
"/unselect-group": "",
|
||||
"/export-group": "/export-group [groupid]",
|
||||
"/info": "",
|
||||
"/send": "/send [groupid] [message]",
|
||||
"/timeline": "/timeline [groupid]",
|
||||
"/accept-invite": "/accept-invite [groupid]",
|
||||
"/invite": "/invite [peerid]",
|
||||
"/invite-to-group": "/invite-to-group [groupid] [peerid]",
|
||||
"/new-group": "/new-group [server]",
|
||||
"/help": "",
|
||||
"/trust": "/trust [peerid]",
|
||||
"/block": "/block [peerid]",
|
||||
}
|
||||
|
||||
func printMessage(m model.Message) {
|
||||
p := peer.GetContact(m.PeerID)
|
||||
name := "unknown"
|
||||
if p != nil {
|
||||
name = p.Name
|
||||
} else if peer.GetProfile().Onion == m.PeerID {
|
||||
name = peer.GetProfile().Name
|
||||
}
|
||||
|
||||
fmt.Printf("%v %v (%v): %v\n", m.Timestamp, name, m.PeerID, m.Message)
|
||||
}
|
||||
|
||||
func startGroupFollow() {
|
||||
groupFollowBreakChan = make(chan bool)
|
||||
go func() {
|
||||
for {
|
||||
l := len(group.Timeline.GetMessages())
|
||||
select {
|
||||
case <-time.After(1 * time.Second):
|
||||
if group == nil {
|
||||
return
|
||||
}
|
||||
gms := group.Timeline.GetMessages()
|
||||
if len(gms) != l {
|
||||
fmt.Printf("\n")
|
||||
for ; l < len(gms); l++ {
|
||||
printMessage(gms[l])
|
||||
}
|
||||
fmt.Printf(prmpt)
|
||||
}
|
||||
case <-groupFollowBreakChan:
|
||||
return
|
||||
}
|
||||
}
|
||||
}()
|
||||
}
|
||||
|
||||
func stopGroupFollow() {
|
||||
if group != nil {
|
||||
groupFollowBreakChan <- true
|
||||
group = nil
|
||||
}
|
||||
}
|
||||
|
||||
func completer(d prompt.Document) []prompt.Suggest {
|
||||
|
||||
var s []prompt.Suggest
|
||||
|
||||
if d.FindStartOfPreviousWord() == 0 {
|
||||
return prompt.FilterHasPrefix(suggestions, d.GetWordBeforeCursor(), true)
|
||||
}
|
||||
|
||||
w := d.CurrentLine()
|
||||
|
||||
// Suggest a profile id
|
||||
if strings.HasPrefix(w, "/select-profile") {
|
||||
s = []prompt.Suggest{}
|
||||
peerlist := app.ListPeers()
|
||||
for onion, peername := range peerlist {
|
||||
s = append(s, prompt.Suggest{Text: onion, Description: peername})
|
||||
}
|
||||
}
|
||||
|
||||
if peer == nil {
|
||||
return s
|
||||
}
|
||||
|
||||
// Suggest groupid
|
||||
if /*strings.HasPrefix(w, "send") || strings.HasPrefix(w, "timeline") ||*/ strings.HasPrefix(w, "/export-group") || strings.HasPrefix(w, "/select-group") {
|
||||
s = []prompt.Suggest{}
|
||||
groups := peer.GetGroups()
|
||||
for _, groupID := range groups {
|
||||
group := peer.GetGroup(groupID)
|
||||
s = append(s, prompt.Suggest{Text: group.GroupID, Description: "Group owned by " + group.Owner + " on " + group.GroupServer})
|
||||
}
|
||||
return prompt.FilterHasPrefix(s, d.GetWordBeforeCursor(), true)
|
||||
}
|
||||
|
||||
// Suggest unaccepted group
|
||||
if strings.HasPrefix(w, "/accept-invite") {
|
||||
s = []prompt.Suggest{}
|
||||
groups := peer.GetGroups()
|
||||
for _, groupID := range groups {
|
||||
group := peer.GetGroup(groupID)
|
||||
if group.Accepted == false {
|
||||
s = append(s, prompt.Suggest{Text: group.GroupID, Description: "Group owned by " + group.Owner + " on " + group.GroupServer})
|
||||
}
|
||||
}
|
||||
return prompt.FilterHasPrefix(s, d.GetWordBeforeCursor(), true)
|
||||
}
|
||||
|
||||
// suggest groupid AND peerid
|
||||
if strings.HasPrefix(w, "/invite-to-group") {
|
||||
|
||||
if d.FindStartOfPreviousWordWithSpace() == 0 {
|
||||
s = []prompt.Suggest{}
|
||||
groups := peer.GetGroups()
|
||||
for _, groupID := range groups {
|
||||
group := peer.GetGroup(groupID)
|
||||
if group.Owner == "self" {
|
||||
s = append(s, prompt.Suggest{Text: group.GroupID, Description: "Group owned by " + group.Owner + " on " + group.GroupServer})
|
||||
}
|
||||
}
|
||||
return prompt.FilterHasPrefix(s, d.GetWordBeforeCursor(), true)
|
||||
}
|
||||
|
||||
s = []prompt.Suggest{}
|
||||
contacts := peer.GetContacts()
|
||||
for _, onion := range contacts {
|
||||
contact := peer.GetContact(onion)
|
||||
s = append(s, prompt.Suggest{Text: contact.Onion, Description: contact.Name})
|
||||
}
|
||||
return prompt.FilterHasPrefix(s, d.GetWordBeforeCursor(), true)
|
||||
}
|
||||
|
||||
// Suggest contact onion / peerid
|
||||
if strings.HasPrefix(w, "/block") || strings.HasPrefix(w, "/trust") || strings.HasPrefix(w, "/invite") {
|
||||
s = []prompt.Suggest{}
|
||||
contacts := peer.GetContacts()
|
||||
for _, onion := range contacts {
|
||||
contact := peer.GetContact(onion)
|
||||
s = append(s, prompt.Suggest{Text: contact.Onion, Description: contact.Name})
|
||||
}
|
||||
return prompt.FilterHasPrefix(s, d.GetWordBeforeCursor(), true)
|
||||
}
|
||||
|
||||
return s
|
||||
}
|
||||
|
||||
func main() {
|
||||
|
||||
cwtch :=
|
||||
`
|
||||
#, #'
|
||||
@@@@@@:
|
||||
@@@@@@.
|
||||
@'@@+#' @@@@+
|
||||
''''''@ #+@ :
|
||||
@''''+;+' . '
|
||||
@''@' :+' , ; ##, +'
|
||||
,@@ ;' #'#@''. #''@''#
|
||||
# ''''''#:,,#'''''@
|
||||
: @''''@ :+'''@
|
||||
' @;+'@ @'#
|
||||
.:# '#..# '# @
|
||||
@@@@@@
|
||||
@@@@@@
|
||||
'@@@@
|
||||
@# . .
|
||||
+++, #'@+'@
|
||||
''', ''''''#
|
||||
.#+# ''', @'''+,
|
||||
@''# ''', .#@
|
||||
:; '@''# .;. ''', ' : ;. ,
|
||||
@+'''@ '+'+ @++ @+'@+''''+@ #+'''#: ''';#''+@ @@@@ @@@@@@@@@ :@@@@#
|
||||
#''''''# +''. +'': +'''''''''+ @'''''''# '''+'''''@ @@@@ @@@@@@@@@@@@@@@@:
|
||||
@'''@@'''@ @''# ,'''@ ''+ @@''+#+ :'''@@+''' ''''@@'''' @@@@ @@@@@@@@@@@@@@@@@
|
||||
'''# @''# +''@ @'''# ;''@ +''+ @''@ ,+'', '''@ #'''. @@@@ @@@@ '@@@# @@@@
|
||||
;''' @@; '''# #'@'' @''@ @''+ +''# .@@ ''', '''. @@@@ @@@ @@@ .@@@
|
||||
@''# #'' ''#''#@''. #''# '''. '''. +'', @@@@ @@@ @@@ @@@
|
||||
@''# @''@'' #'@+'+ #''# '''. ''', +'', +@@@.@@@ @@@@ @@@, @@@ ,@@@
|
||||
;''+ @, +''@'# @'+''@ @''# +''; '+ ''', +'', @@@@@@@@# @@@@ @@@. .@@@ .@@@
|
||||
'''# ++'+ ''''@ ,''''# #''' @''@ '@''+ ''', ''', @@@@@@@@: @@@@ @@@; .@@@' ;@@@
|
||||
@'''@@'''@ #'''. +'''' ;'''#@ :'''#@+''+ ''', ''', @@@@@@# @@@@ @@@+ ,@@@. @@@@
|
||||
#''''''# @''+ @''+ +'''' @'''''''# ''', ''', #@@@. @@@@ @@@+ @@@ @@@@
|
||||
@+''+@ '++@ ;++@ '#''@ ##'''@: +++, +++, :@ @@@@ @@@' @@@ '@@@
|
||||
:' ' '`
|
||||
fmt.Printf("%v\n\n", cwtch)
|
||||
|
||||
quit := false
|
||||
|
||||
torPath, err := exec.LookPath("tor")
|
||||
if err != nil {
|
||||
log.Fatal("tor could not be found on this system. Please install it in the system $PATH")
|
||||
}
|
||||
|
||||
usr, err := user.Current()
|
||||
if err != nil {
|
||||
log.Fatalf("\nError: could not load current user: %v\n", err)
|
||||
}
|
||||
|
||||
app, err = app2.NewApp(path.Join(usr.HomeDir, ".cwtch"), torPath)
|
||||
if err != nil {
|
||||
log.Fatalf("Error initializing application: %v", err)
|
||||
}
|
||||
fmt.Printf("\nWelcome to Cwtch!\n")
|
||||
fmt.Printf("If this if your first time you should create a profile by running `/new-profile`\n")
|
||||
fmt.Printf("`/load-profiles` will prompt you for a password and load profiles from storage\n")
|
||||
fmt.Printf("`/help` will show you other available commands\n")
|
||||
fmt.Printf("There is full [TAB] completion support\n\n")
|
||||
|
||||
var history []string
|
||||
for !quit {
|
||||
|
||||
prmpt = "cwtch> "
|
||||
if group != nil {
|
||||
prmpt = fmt.Sprintf("cwtch %v (%v) [%v] say> ", peer.GetProfile().Name, peer.GetProfile().Onion, group.GroupID)
|
||||
} else if peer != nil {
|
||||
prmpt = fmt.Sprintf("cwtch %v (%v)> ", peer.GetProfile().Name, peer.GetProfile().Onion)
|
||||
}
|
||||
|
||||
text := prompt.Input(prmpt, completer, prompt.OptionSuggestionBGColor(prompt.Purple),
|
||||
prompt.OptionDescriptionBGColor(prompt.White),
|
||||
prompt.OptionHistory(history))
|
||||
|
||||
commands := strings.Split(text[0:], " ")
|
||||
history = append(history, text)
|
||||
|
||||
if peer == nil {
|
||||
if commands[0] != "/help" && commands[0] != "/quit" && commands[0] != "/new-profile" && commands[0] != "/load-profiles" && commands[0] != "/select-profile" && commands[0] != "/list-profiles" {
|
||||
fmt.Printf("Profile needs to be set\n")
|
||||
continue
|
||||
}
|
||||
}
|
||||
|
||||
// Send
|
||||
if group != nil && !strings.HasPrefix(commands[0], "/") {
|
||||
err := peer.SendMessageToGroup(group.GroupID, text)
|
||||
if err != nil {
|
||||
fmt.Printf("Error sending message: %v\n", err)
|
||||
}
|
||||
}
|
||||
|
||||
switch commands[0] {
|
||||
case "/quit":
|
||||
if peer != nil {
|
||||
peer.Save()
|
||||
}
|
||||
quit = true
|
||||
case "/new-profile":
|
||||
if len(commands) == 2 {
|
||||
fmt.Print("** WARNING: PASSWORDS CANNOT BE RECOVERED! **\n")
|
||||
|
||||
password := ""
|
||||
failcount := 0
|
||||
for ; failcount < 3; failcount++ {
|
||||
fmt.Print("Enter a password to encrypt the profile: ")
|
||||
bytePassword, _ := terminal.ReadPassword(int(syscall.Stdin))
|
||||
if string(bytePassword) == "" {
|
||||
fmt.Print("\nBlank password not allowed.")
|
||||
continue
|
||||
}
|
||||
fmt.Print("\nRe-enter password: ")
|
||||
bytePassword2, _ := terminal.ReadPassword(int(syscall.Stdin))
|
||||
if bytes.Equal(bytePassword, bytePassword2) {
|
||||
password = string(bytePassword)
|
||||
break
|
||||
} else {
|
||||
fmt.Print("\nPASSWORDS DIDN'T MATCH! Try again.\n")
|
||||
}
|
||||
}
|
||||
|
||||
if failcount >= 3 {
|
||||
fmt.Printf("Error creating profile for %v: Your password entries must match!\n", commands[1])
|
||||
} else {
|
||||
p, err := app.CreatePeer(commands[1], password)
|
||||
if err == nil {
|
||||
stopGroupFollow()
|
||||
fmt.Printf("\nNew profile created for %v\n", commands[1])
|
||||
peer = p
|
||||
suggestions = append(suggestionsBase, suggestionsSelectedProfile...)
|
||||
|
||||
} else {
|
||||
fmt.Printf("\nError creating profile for %v: %v\n", commands[1], err)
|
||||
}
|
||||
}
|
||||
} else {
|
||||
fmt.Printf("Error creating New Profile, usage: %s\n", usages[commands[0]])
|
||||
}
|
||||
case "/load-profiles":
|
||||
fmt.Print("Enter a password to decrypt the profile: ")
|
||||
bytePassword, err := terminal.ReadPassword(int(syscall.Stdin))
|
||||
|
||||
err = app.LoadProfiles(string(bytePassword))
|
||||
if err == nil {
|
||||
profiles := app.ListPeers()
|
||||
fmt.Printf("\n%v profiles active now\n", len(profiles))
|
||||
fmt.Printf("You should run `select-profile` to use a profile or `list-profiles` to view loaded profiles\n")
|
||||
} else {
|
||||
fmt.Printf("\nError loading profiles: %v\n", err)
|
||||
}
|
||||
|
||||
case "/list-profiles":
|
||||
peerlist := app.ListPeers()
|
||||
for onion, peername := range peerlist {
|
||||
fmt.Printf(" %v\t%v\n", onion, peername)
|
||||
}
|
||||
case "/select-profile":
|
||||
if len(commands) == 2 {
|
||||
p := app.GetPeer(commands[1])
|
||||
if p == nil {
|
||||
fmt.Printf("Error: profile '%v' does not exist\n", commands[1])
|
||||
} else {
|
||||
stopGroupFollow()
|
||||
peer = p
|
||||
suggestions = append(suggestionsBase, suggestionsSelectedProfile...)
|
||||
}
|
||||
|
||||
// Auto Peer / Join Server
|
||||
// TODO There are some privacy implications with this that we should
|
||||
// think over.
|
||||
for _, name := range p.GetProfile().GetContacts() {
|
||||
profile := p.GetContact(name)
|
||||
if profile.Trusted && !profile.Blocked {
|
||||
p.PeerWithOnion(profile.Onion)
|
||||
}
|
||||
}
|
||||
|
||||
for _, groupid := range p.GetGroups() {
|
||||
group := p.GetGroup(groupid)
|
||||
if group.Accepted || group.Owner == "self" {
|
||||
p.JoinServer(group.GroupServer)
|
||||
}
|
||||
}
|
||||
|
||||
} else {
|
||||
fmt.Printf("Error selecting profile, usage: %s\n", usages[commands[0]])
|
||||
}
|
||||
case "/info":
|
||||
if peer != nil {
|
||||
fmt.Printf("Address cwtch:%v\n", peer.GetProfile().Onion)
|
||||
} else {
|
||||
fmt.Printf("Profile needs to be set\n")
|
||||
}
|
||||
case "/invite":
|
||||
if len(commands) == 2 {
|
||||
fmt.Printf("Inviting cwtch:%v\n", commands[1])
|
||||
peer.PeerWithOnion(commands[1])
|
||||
} else {
|
||||
fmt.Printf("Error inviting peer, usage: %s\n", usages[commands[0]])
|
||||
}
|
||||
case "/list-peers":
|
||||
peers := peer.GetPeers()
|
||||
for p, s := range peers {
|
||||
fmt.Printf("Name: %v Status: %v\n", p, connections.ConnectionStateName[s])
|
||||
}
|
||||
case "/list-servers":
|
||||
servers := peer.GetServers()
|
||||
for s, st := range servers {
|
||||
fmt.Printf("Name: %v Status: %v\n", s, connections.ConnectionStateName[st])
|
||||
}
|
||||
case "/list-contacts":
|
||||
contacts := peer.GetContacts()
|
||||
for _, onion := range contacts {
|
||||
c := peer.GetContact(onion)
|
||||
fmt.Printf("Name: %v Onion: %v Trusted: %v\n", c.Name, c.Onion, c.Trusted)
|
||||
}
|
||||
case "/list-groups":
|
||||
for _, gid := range peer.GetGroups() {
|
||||
g := peer.GetGroup(gid)
|
||||
fmt.Printf("Group Id: %v Owner: %v Accepted:%v\n", gid, g.Owner, g.Accepted)
|
||||
}
|
||||
case "/trust":
|
||||
if len(commands) == 2 {
|
||||
peer.TrustPeer(commands[1])
|
||||
} else {
|
||||
fmt.Printf("Error trusting peer, usage: %s\n", usages[commands[0]])
|
||||
}
|
||||
case "/block":
|
||||
if len(commands) == 2 {
|
||||
peer.BlockPeer(commands[1])
|
||||
} else {
|
||||
fmt.Printf("Error blocking peer, usage: %s\n", usages[commands[0]])
|
||||
}
|
||||
case "/accept-invite":
|
||||
if len(commands) == 2 {
|
||||
groupID := commands[1]
|
||||
err := peer.AcceptInvite(groupID)
|
||||
if err != nil {
|
||||
fmt.Printf("Error: %v\n", err)
|
||||
} else {
|
||||
peer.Save()
|
||||
group := peer.GetGroup(groupID)
|
||||
if group == nil {
|
||||
fmt.Printf("Error: group does not exist\n")
|
||||
} else {
|
||||
peer.JoinServer(group.GroupServer)
|
||||
}
|
||||
}
|
||||
} else {
|
||||
fmt.Printf("Error accepting invite, usage: %s\n", usages[commands[0]])
|
||||
}
|
||||
case "/invite-to-group":
|
||||
if len(commands) == 3 {
|
||||
fmt.Printf("Inviting %v to %v\n", commands[1], commands[2])
|
||||
err := peer.InviteOnionToGroup(commands[2], commands[1])
|
||||
if err != nil {
|
||||
fmt.Printf("Error: %v\n", err)
|
||||
}
|
||||
} else {
|
||||
fmt.Printf("Error inviting peer to group, usage: %s\n", usages[commands[0]])
|
||||
}
|
||||
case "/new-group":
|
||||
if len(commands) == 2 && commands[1] != "" {
|
||||
fmt.Printf("Setting up a new group on server:%v\n", commands[1])
|
||||
id, _, err := peer.StartGroup(commands[1])
|
||||
if err == nil {
|
||||
fmt.Printf("New Group [%v] created for server %v\n", id, commands[1])
|
||||
peer.Save()
|
||||
group := peer.GetGroup(id)
|
||||
if group == nil {
|
||||
fmt.Printf("Error: group does not exist\n")
|
||||
} else {
|
||||
peer.JoinServer(group.GroupServer)
|
||||
}
|
||||
} else {
|
||||
fmt.Printf("Error creating new group: %v", err)
|
||||
}
|
||||
} else {
|
||||
fmt.Printf("Error creating a new group, usage: %s\n", usages[commands[0]])
|
||||
}
|
||||
case "/select-group":
|
||||
if len(commands) == 2 {
|
||||
g := peer.GetGroup(commands[1])
|
||||
if g == nil {
|
||||
fmt.Printf("Error: group %s not found!\n", commands[1])
|
||||
} else {
|
||||
stopGroupFollow()
|
||||
group = g
|
||||
|
||||
fmt.Printf("--------------- %v ---------------\n", group.GroupID)
|
||||
gms := group.Timeline.Messages
|
||||
max := 20
|
||||
if len(gms) < max {
|
||||
max = len(gms)
|
||||
}
|
||||
for i := len(gms) - max; i < len(gms); i++ {
|
||||
printMessage(gms[i])
|
||||
}
|
||||
fmt.Printf("------------------------------\n")
|
||||
|
||||
startGroupFollow()
|
||||
}
|
||||
} else {
|
||||
fmt.Printf("Error selecting a group, usage: %s\n", usages[commands[0]])
|
||||
}
|
||||
case "/unselect-group":
|
||||
stopGroupFollow()
|
||||
case "/export-group":
|
||||
if len(commands) == 2 {
|
||||
group := peer.GetGroup(commands[1])
|
||||
if group == nil {
|
||||
fmt.Printf("Error: group does not exist\n")
|
||||
} else {
|
||||
invite, _ := peer.ExportGroup(commands[1])
|
||||
fmt.Printf("Invite: %v\n", invite)
|
||||
}
|
||||
} else {
|
||||
fmt.Printf("Error exporting group, usage: %s\n", usages[commands[0]])
|
||||
}
|
||||
case "/save":
|
||||
peer.Save()
|
||||
case "/help":
|
||||
for _, command := range suggestions {
|
||||
fmt.Printf("%-18s%-56s%s\n", command.Text, command.Description, usages[command.Text])
|
||||
}
|
||||
case "/sendlots":
|
||||
if len(commands) == 2 {
|
||||
group := peer.GetGroup(commands[1])
|
||||
if group == nil {
|
||||
fmt.Printf("Error: group does not exist\n")
|
||||
} else {
|
||||
for i := 0; i < 100; i++ {
|
||||
fmt.Printf("Sending message: %v\n", i)
|
||||
err := peer.SendMessageToGroup(commands[1], fmt.Sprintf("this is message %v", i))
|
||||
if err != nil {
|
||||
fmt.Printf("could not send message %v because %v\n", i, err)
|
||||
}
|
||||
}
|
||||
fmt.Printf("Waiting 5 seconds for message to process...\n")
|
||||
time.Sleep(time.Second * 5)
|
||||
timeline := group.GetTimeline()
|
||||
totalLatency := time.Duration(0)
|
||||
maxLatency := time.Duration(0)
|
||||
totalMessages := 0
|
||||
for i := 0; i < 100; i++ {
|
||||
found := false
|
||||
for _, m := range timeline {
|
||||
if m.Message == fmt.Sprintf("this is message %v", i) && m.PeerID == peer.GetProfile().Onion {
|
||||
found = true
|
||||
latency := m.Received.Sub(m.Timestamp)
|
||||
fmt.Printf("Latency for Message %v was %v\n", i, latency)
|
||||
totalLatency = totalLatency + latency
|
||||
if maxLatency < latency {
|
||||
maxLatency = latency
|
||||
}
|
||||
totalMessages++
|
||||
}
|
||||
}
|
||||
|
||||
if !found {
|
||||
fmt.Printf("message %v was never received\n", i)
|
||||
}
|
||||
}
|
||||
|
||||
fmt.Printf("Average Latency for %v messages was: %vms\n", totalMessages, time.Duration(int64(totalLatency)/int64(totalMessages)))
|
||||
fmt.Printf("Max Latency for %v messages was: %vms\n", totalMessages, maxLatency)
|
||||
|
||||
}
|
||||
}
|
||||
}
|
||||
if peer != nil {
|
||||
peer.Save()
|
||||
}
|
||||
}
|
||||
|
||||
app.Shutdown()
|
||||
os.Exit(0)
|
||||
|
||||
}
|
|
@ -1,159 +0,0 @@
|
|||
package main
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"os"
|
||||
//"bufio"
|
||||
//"cwtch.im/cwtch/storage"
|
||||
)
|
||||
|
||||
func convertTorFile(filename string, password string) error {
|
||||
return errors.New("this code doesn't work and can never work :( it's a math thing")
|
||||
|
||||
/*name, _ := diceware.Generate(2)
|
||||
sk, err := ioutil.ReadFile("hs_ed25519_secret_key")
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
sk = sk[32:]
|
||||
|
||||
pk, err := ioutil.ReadFile("hs_ed25519_public_key")
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
pk = pk[32:]
|
||||
|
||||
onion, err := ioutil.ReadFile("hostname")
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
onion = onion[:56]
|
||||
|
||||
peer := libpeer.NewCwtchPeer(strings.Join(name, "-"))
|
||||
|
||||
fmt.Printf("%d %d %s\n", len(peer.GetProfile().Ed25519PublicKey), len(peer.GetProfile().Ed25519PrivateKey), peer.GetProfile().Onion)
|
||||
peer.GetProfile().Ed25519PrivateKey = sk
|
||||
peer.GetProfile().Ed25519PublicKey = pk
|
||||
peer.GetProfile().Onion = string(onion)
|
||||
fileStore := storage2.NewFileStore(filename, password)
|
||||
err = fileStore.save(peer)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
log.Infof("success! loaded %d byte pk and %d byte sk for %s.onion\n", len(pk), len(sk), onion)
|
||||
return nil*/
|
||||
}
|
||||
|
||||
/*
|
||||
func vanity() error {
|
||||
for {
|
||||
pk, sk, err := ed25519.GenerateKey(rand.Reader)
|
||||
if err != nil {
|
||||
continue
|
||||
}
|
||||
onion := utils.GetTorV3Hostname(pk)
|
||||
for i := 4; i < len(os.Args); i++ {
|
||||
if strings.HasPrefix(onion, os.Args[i]) {
|
||||
peer := libpeer.NewCwtchPeer(os.Args[i])
|
||||
peer.GetProfile().Ed25519PrivateKey = sk
|
||||
peer.GetProfile().Ed25519PublicKey = pk
|
||||
peer.GetProfile().Onion = onion
|
||||
profileStore, _ := storage2.NewProfileStore(nil, os.Args[3], onion+".cwtch")
|
||||
profileStore.Init("")
|
||||
// need to signal new onion? impossible
|
||||
log.Infof("found %s.onion\n", onion)
|
||||
}
|
||||
}
|
||||
}
|
||||
}*/
|
||||
|
||||
func printHelp() {
|
||||
log.Infoln("usage: cwtchutil {help, convert-cwtch-file, convert-tor-file, changepw, vanity}")
|
||||
}
|
||||
|
||||
func main() {
|
||||
log.SetLevel(log.LevelInfo)
|
||||
if len(os.Args) < 2 {
|
||||
printHelp()
|
||||
os.Exit(1)
|
||||
}
|
||||
|
||||
switch os.Args[1] {
|
||||
default:
|
||||
printHelp()
|
||||
case "help":
|
||||
printHelp()
|
||||
case "convert-tor-file":
|
||||
if len(os.Args) != 4 {
|
||||
fmt.Println("example: cwtchutil convert-tor-file /var/lib/tor/hs1 passw0rd")
|
||||
os.Exit(1)
|
||||
}
|
||||
err := convertTorFile(os.Args[2], os.Args[3])
|
||||
if err != nil {
|
||||
log.Errorln(err)
|
||||
}
|
||||
/*case "vanity":
|
||||
if len(os.Args) < 5 {
|
||||
fmt.Println("example: cwtchutil vanity 4 passw0rd erinn openpriv")
|
||||
os.Exit(1)
|
||||
}
|
||||
|
||||
goroutines, err := strconv.Atoi(os.Args[2])
|
||||
if err != nil {
|
||||
log.Errorf("first parameter after vanity should be a number\n")
|
||||
os.Exit(1)
|
||||
}
|
||||
log.Infoln("searching. press ctrl+c to stop")
|
||||
for i := 0; i < goroutines; i++ {
|
||||
go vanity()
|
||||
}
|
||||
|
||||
for { // run until ctrl+c
|
||||
time.Sleep(time.Hour * 24)
|
||||
}*/
|
||||
/*case "changepw":
|
||||
if len(os.Args) != 3 {
|
||||
fmt.Println("example: cwtch changepw ~/.cwtch/profiles/XXX")
|
||||
os.Exit(1)
|
||||
}
|
||||
|
||||
fmt.Printf("old password: ")
|
||||
reader := bufio.NewReader(os.Stdin)
|
||||
pw, err := reader.ReadString('\n')
|
||||
if err != nil {
|
||||
log.Errorln(err)
|
||||
os.Exit(1)
|
||||
}
|
||||
pw = pw[:len(pw)-1]
|
||||
|
||||
profileStore, _ := storage.NewProfileStore(nil, os.Args[2], pw)
|
||||
|
||||
err = profileStore.Read()
|
||||
if err != nil {
|
||||
log.Errorln(err)
|
||||
os.Exit(1)
|
||||
}
|
||||
|
||||
fmt.Printf("new password: ")
|
||||
newpw1, err := reader.ReadString('\n')
|
||||
if err != nil {
|
||||
log.Errorln(err)
|
||||
os.Exit(1)
|
||||
}
|
||||
newpw1 = newpw1[:len(newpw1)-1] // fuck go with this linebreak shit ^ea
|
||||
|
||||
fileStore2, _ := storage.NewProfileStore(nil, os.Args[2], newpw1)
|
||||
// No way to copy, populate this method
|
||||
err = fileStore2.save(peer)
|
||||
if err != nil {
|
||||
log.Errorln(err)
|
||||
os.Exit(1)
|
||||
}
|
||||
|
||||
log.Infoln("success!")
|
||||
*/
|
||||
}
|
||||
}
|
|
@ -1,38 +1,18 @@
|
|||
package main
|
||||
|
||||
import (
|
||||
app2 "cwtch.im/cwtch/app"
|
||||
"cwtch.im/cwtch/app/utils"
|
||||
"cwtch.im/cwtch/event"
|
||||
"git.openprivacy.ca/openprivacy/connectivity/tor"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"os"
|
||||
"path"
|
||||
"cwtch.im/cwtch/peer"
|
||||
"log"
|
||||
)
|
||||
|
||||
func main() {
|
||||
alice, _ := peer.NewCwtchPeer("alice", "password", ".")
|
||||
|
||||
// System Setup, We need Tor and Logging up and Running
|
||||
log.AddEverythingFromPattern("peer/alice")
|
||||
log.SetLevel(log.LevelDebug)
|
||||
|
||||
acn, err := tor.NewTorACN(path.Join(".", ".cwtch"), "")
|
||||
if err != nil {
|
||||
log.Errorf("\nError connecting to Tor: %v\n", err)
|
||||
os.Exit(1)
|
||||
processData := func(onion string, data []byte) []byte {
|
||||
log.Printf("Recieved %s from %v", data, onion)
|
||||
return data
|
||||
}
|
||||
|
||||
app := app2.NewApp(acn, ".")
|
||||
app.CreatePeer("alice", "be gay, do crimes")
|
||||
alice := utils.WaitGetPeer(app, "alice")
|
||||
app.LaunchPeers()
|
||||
eventBus := app.GetEventBus(alice.GetOnion())
|
||||
queue := event.NewQueue()
|
||||
eventBus.Subscribe(event.NewMessageFromPeer, queue)
|
||||
|
||||
// For every new Data Packet Alice received she will Print it out.
|
||||
for {
|
||||
event := queue.Next()
|
||||
log.Printf(log.LevelInfo, "Received %v from %v: %s", event.EventType, event.Data["Onion"], event.Data["Data"])
|
||||
}
|
||||
alice.SetPeerDataHandler(processData)
|
||||
alice.Listen()
|
||||
}
|
||||
|
|
|
@ -1,39 +1,27 @@
|
|||
package main
|
||||
|
||||
import (
|
||||
app2 "cwtch.im/cwtch/app"
|
||||
"cwtch.im/cwtch/app/utils"
|
||||
"git.openprivacy.ca/openprivacy/connectivity/tor"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"os"
|
||||
"path"
|
||||
"cwtch.im/cwtch/peer"
|
||||
"log"
|
||||
"strconv"
|
||||
"time"
|
||||
)
|
||||
|
||||
func main() {
|
||||
bob, _ := peer.NewCwtchPeer("bob", "password", ".")
|
||||
counter := 1
|
||||
|
||||
// System Boilerplate, We need Tor Up and Running
|
||||
log.AddEverythingFromPattern("peer/bob")
|
||||
log.SetLevel(log.LevelDebug)
|
||||
acn, err := tor.NewTorACN(path.Join(".", ".cwtch"), "")
|
||||
if err != nil {
|
||||
log.Errorf("\nError connecting to Tor: %v\n", err)
|
||||
os.Exit(1)
|
||||
}
|
||||
bob.SetPeerDataHandler(func(onion string, data []byte) []byte {
|
||||
log.Printf("Recieved %s from %v", data, onion)
|
||||
counter++
|
||||
return []byte(strconv.Itoa(counter))
|
||||
})
|
||||
connection := bob.PeerWithOnion("f4b6thuwmfszsqd3fzqpr45sdem4qoazdlzr2xmnc7fq22qe746hjqqd")
|
||||
|
||||
app := app2.NewApp(acn, ".")
|
||||
app.CreatePeer("bob", "be gay, do crimes")
|
||||
bob := utils.WaitGetPeer(app, "bob")
|
||||
|
||||
// Add Alice's Onion Here (It changes run to run)
|
||||
bob.PeerWithOnion("upiztu7myymjf2dn4x4czhagp7axlnqjvf5zwfegbhtpkqb6v3vgu5yd")
|
||||
|
||||
// Send the Message...
|
||||
log.Infof("Waiting for Bob to Connect to Alice...")
|
||||
bob.SendMessageToPeer("upiztu7myymjf2dn4x4czhagp7axlnqjvf5zwfegbhtpkqb6v3vgu5yd", "Hello Alice!!!")
|
||||
log.Printf("Waiting for Bob to Connect to Alice...")
|
||||
connection.SendPacket([]byte("Hello Alice!!!"))
|
||||
|
||||
// Wait a while...
|
||||
// Everything is run in a goroutine so the main thread has to stay active
|
||||
time.Sleep(time.Second * 100)
|
||||
|
||||
}
|
||||
|
|
|
@ -1,161 +0,0 @@
|
|||
package plugins
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/protocol/connections"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"sync"
|
||||
"time"
|
||||
)
|
||||
|
||||
const tickTime = 10 * time.Second
|
||||
const maxBakoff int = 32 // 320 seconds or ~5 min
|
||||
|
||||
type connectionType int
|
||||
|
||||
const (
|
||||
peerConn connectionType = iota
|
||||
serverConn
|
||||
)
|
||||
|
||||
type contact struct {
|
||||
id string
|
||||
state connections.ConnectionState
|
||||
ctype connectionType
|
||||
|
||||
ticks int
|
||||
backoff int
|
||||
}
|
||||
|
||||
type contactRetry struct {
|
||||
bus event.Manager
|
||||
queue event.Queue
|
||||
networkUp bool
|
||||
running bool
|
||||
breakChan chan bool
|
||||
onion string
|
||||
lastCheck time.Time
|
||||
|
||||
connections sync.Map //[string]*contact
|
||||
}
|
||||
|
||||
// NewConnectionRetry returns a Plugin that when started will retry connecting to contacts with a backoff timing
|
||||
func NewConnectionRetry(bus event.Manager, onion string) Plugin {
|
||||
cr := &contactRetry{bus: bus, queue: event.NewQueue(), breakChan: make(chan bool), connections: sync.Map{}, networkUp: false, onion: onion}
|
||||
return cr
|
||||
}
|
||||
|
||||
func (cr *contactRetry) Start() {
|
||||
if !cr.running {
|
||||
go cr.run()
|
||||
} else {
|
||||
log.Errorf("Attempted to start Contact Retry plugin twice for %v", cr.onion)
|
||||
}
|
||||
}
|
||||
|
||||
func (cr *contactRetry) run() {
|
||||
cr.running = true
|
||||
cr.bus.Subscribe(event.PeerStateChange, cr.queue)
|
||||
cr.bus.Subscribe(event.ACNStatus, cr.queue)
|
||||
cr.bus.Subscribe(event.ServerStateChange, cr.queue)
|
||||
|
||||
for {
|
||||
if time.Since(cr.lastCheck) > tickTime {
|
||||
cr.retryDisconnected()
|
||||
cr.lastCheck = time.Now()
|
||||
}
|
||||
select {
|
||||
case e := <-cr.queue.OutChan():
|
||||
switch e.EventType {
|
||||
case event.PeerStateChange:
|
||||
state := connections.ConnectionStateToType()[e.Data[event.ConnectionState]]
|
||||
peer := e.Data[event.RemotePeer]
|
||||
cr.handleEvent(peer, state, peerConn)
|
||||
|
||||
case event.ServerStateChange:
|
||||
state := connections.ConnectionStateToType()[e.Data[event.ConnectionState]]
|
||||
server := e.Data[event.GroupServer]
|
||||
cr.handleEvent(server, state, serverConn)
|
||||
|
||||
case event.ACNStatus:
|
||||
prog := e.Data[event.Progress]
|
||||
if prog == "100" && !cr.networkUp {
|
||||
cr.networkUp = true
|
||||
cr.connections.Range(func(k, v interface{}) bool {
|
||||
p := v.(*contact)
|
||||
p.ticks = 0
|
||||
p.backoff = 1
|
||||
if p.ctype == peerConn {
|
||||
cr.bus.Publish(event.NewEvent(event.RetryPeerRequest, map[event.Field]string{event.RemotePeer: p.id}))
|
||||
}
|
||||
if p.ctype == serverConn {
|
||||
cr.bus.Publish(event.NewEvent(event.RetryServerRequest, map[event.Field]string{event.GroupServer: p.id}))
|
||||
}
|
||||
return true
|
||||
})
|
||||
} else if prog != "100" {
|
||||
cr.networkUp = false
|
||||
}
|
||||
}
|
||||
|
||||
case <-time.After(tickTime):
|
||||
continue
|
||||
|
||||
case <-cr.breakChan:
|
||||
cr.running = false
|
||||
return
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (cr *contactRetry) retryDisconnected() {
|
||||
cr.connections.Range(func(k, v interface{}) bool {
|
||||
p := v.(*contact)
|
||||
|
||||
if p.state == connections.DISCONNECTED {
|
||||
p.ticks++
|
||||
if p.ticks >= p.backoff {
|
||||
p.ticks = 0
|
||||
if cr.networkUp {
|
||||
if p.ctype == peerConn {
|
||||
cr.bus.Publish(event.NewEvent(event.RetryPeerRequest, map[event.Field]string{event.RemotePeer: p.id}))
|
||||
}
|
||||
if p.ctype == serverConn {
|
||||
cr.bus.Publish(event.NewEvent(event.RetryServerRequest, map[event.Field]string{event.GroupServer: p.id}))
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
return true
|
||||
})
|
||||
}
|
||||
|
||||
func (cr *contactRetry) handleEvent(id string, state connections.ConnectionState, ctype connectionType) {
|
||||
if _, exists := cr.connections.Load(id); !exists {
|
||||
p := &contact{id: id, state: connections.DISCONNECTED, backoff: 0, ticks: 0, ctype: ctype}
|
||||
cr.connections.Store(id, p)
|
||||
return
|
||||
}
|
||||
|
||||
pinf, _ := cr.connections.Load(id)
|
||||
p := pinf.(*contact)
|
||||
if state == connections.DISCONNECTED || state == connections.FAILED || state == connections.KILLED {
|
||||
p.state = connections.DISCONNECTED
|
||||
if p.backoff == 0 {
|
||||
p.backoff = 1
|
||||
} else if p.backoff < maxBakoff {
|
||||
p.backoff *= 2
|
||||
}
|
||||
p.ticks = 0
|
||||
} else if state == connections.CONNECTING || state == connections.CONNECTED {
|
||||
p.state = state
|
||||
} else if state == connections.AUTHENTICATED {
|
||||
p.state = state
|
||||
p.backoff = 0
|
||||
}
|
||||
}
|
||||
|
||||
func (cr *contactRetry) Shutdown() {
|
||||
cr.breakChan <- true
|
||||
|
||||
}
|
|
@ -1,175 +0,0 @@
|
|||
package plugins
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/protocol/connections"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/openprivacy/connectivity"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"sync"
|
||||
"time"
|
||||
)
|
||||
|
||||
// NetworkCheckError is a status for when the NetworkCheck Plugin has had an error making an out going connection indicating it may be offline
|
||||
const NetworkCheckError = "Error"
|
||||
|
||||
// NetworkCheckSuccess is a status for when the NetworkCheck Plugin has had a successful message from a peer, indicating it is online right now
|
||||
const NetworkCheckSuccess = "Success"
|
||||
|
||||
// networkCheck is a convenience plugin for testing high level availability of onion services
|
||||
type networkCheck struct {
|
||||
bus event.Manager
|
||||
queue event.Queue
|
||||
acn connectivity.ACN
|
||||
onionsToCheck sync.Map // onion:string => true:bool
|
||||
breakChan chan bool
|
||||
running bool
|
||||
offline bool
|
||||
offlineLock sync.Mutex
|
||||
}
|
||||
|
||||
// NewNetworkCheck returns a Plugin that when started will attempt various network tests
|
||||
func NewNetworkCheck(bus event.Manager, acn connectivity.ACN) Plugin {
|
||||
nc := &networkCheck{bus: bus, acn: acn, queue: event.NewQueue(), breakChan: make(chan bool, 1)}
|
||||
return nc
|
||||
}
|
||||
|
||||
func (nc *networkCheck) Start() {
|
||||
go nc.run()
|
||||
}
|
||||
|
||||
func (nc *networkCheck) run() {
|
||||
nc.running = true
|
||||
nc.offline = true
|
||||
nc.bus.Subscribe(event.ProtocolEngineStartListen, nc.queue)
|
||||
nc.bus.Subscribe(event.NewMessageFromPeer, nc.queue)
|
||||
nc.bus.Subscribe(event.PeerAcknowledgement, nc.queue)
|
||||
nc.bus.Subscribe(event.EncryptedGroupMessage, nc.queue)
|
||||
nc.bus.Subscribe(event.PeerStateChange, nc.queue)
|
||||
nc.bus.Subscribe(event.ServerStateChange, nc.queue)
|
||||
nc.bus.Subscribe(event.NewGetValMessageFromPeer, nc.queue)
|
||||
nc.bus.Subscribe(event.NewRetValMessageFromPeer, nc.queue)
|
||||
var lastMessageReceived time.Time
|
||||
for {
|
||||
select {
|
||||
case <-nc.breakChan:
|
||||
nc.running = false
|
||||
return
|
||||
case e := <-nc.queue.OutChan():
|
||||
switch e.EventType {
|
||||
// On receipt of a Listen request for an onion service we will add the onion to our list
|
||||
// and then we will wait a minute and check the connection for the first time (the onion should be up)
|
||||
// under normal operating circumstances
|
||||
case event.ProtocolEngineStartListen:
|
||||
if _, exists := nc.onionsToCheck.Load(e.Data[event.Onion]); !exists {
|
||||
log.Debugf("initiating connection check for %v", e.Data[event.Onion])
|
||||
nc.onionsToCheck.Store(e.Data[event.Onion], true)
|
||||
if time.Since(lastMessageReceived) > time.Minute {
|
||||
nc.selfTest()
|
||||
}
|
||||
}
|
||||
case event.PeerStateChange:
|
||||
fallthrough
|
||||
case event.ServerStateChange:
|
||||
// if we successfully connect / authenticated to a remote server / peer then we obviously have internet
|
||||
connectionState := e.Data[event.ConnectionState]
|
||||
nc.offlineLock.Lock()
|
||||
if connectionState == connections.ConnectionStateName[connections.AUTHENTICATED] || connectionState == connections.ConnectionStateName[connections.CONNECTED] {
|
||||
lastMessageReceived = time.Now()
|
||||
|
||||
if nc.offline {
|
||||
nc.bus.Publish(event.NewEvent(event.NetworkStatus, map[event.Field]string{event.Error: "", event.Status: NetworkCheckSuccess}))
|
||||
nc.offline = false
|
||||
}
|
||||
}
|
||||
nc.offlineLock.Unlock()
|
||||
default:
|
||||
// if we receive either an encrypted group message or a peer acknowledgement we can assume the network
|
||||
// is up and running (our onion service might still not be available, but we would aim to detect that
|
||||
// through other actions
|
||||
// we reset out timer
|
||||
lastMessageReceived = time.Now()
|
||||
nc.offlineLock.Lock()
|
||||
if nc.offline {
|
||||
nc.bus.Publish(event.NewEvent(event.NetworkStatus, map[event.Field]string{event.Error: "", event.Status: NetworkCheckSuccess}))
|
||||
nc.offline = false
|
||||
}
|
||||
nc.offlineLock.Unlock()
|
||||
}
|
||||
case <-time.After(tickTime):
|
||||
// if we haven't received an action in the last minute...kick off a set of testing
|
||||
if time.Since(lastMessageReceived) > time.Minute {
|
||||
nc.selfTest()
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (nc *networkCheck) Shutdown() {
|
||||
if nc.running {
|
||||
nc.queue.Shutdown()
|
||||
log.Debugf("shutting down network status plugin")
|
||||
nc.breakChan <- true
|
||||
}
|
||||
}
|
||||
|
||||
func (nc *networkCheck) selfTest() {
|
||||
nc.onionsToCheck.Range(func(key, val interface{}) bool {
|
||||
go nc.checkConnection(key.(string))
|
||||
return true
|
||||
})
|
||||
}
|
||||
|
||||
//
|
||||
func (nc *networkCheck) checkConnection(onion string) {
|
||||
prog, _ := nc.acn.GetBootstrapStatus()
|
||||
if prog != 100 {
|
||||
return
|
||||
}
|
||||
|
||||
// we want to definitively time these actions out faster than tor will, because these onions should definitely be
|
||||
// online
|
||||
ClientTimeout := TimeoutPolicy(time.Second * 60)
|
||||
err := ClientTimeout.ExecuteAction(func() error {
|
||||
conn, _, err := nc.acn.Open(onion)
|
||||
if err == nil {
|
||||
conn.Close()
|
||||
}
|
||||
return err
|
||||
})
|
||||
nc.offlineLock.Lock()
|
||||
defer nc.offlineLock.Unlock()
|
||||
// regardless of the outcome we want to report a status to let anyone who might care know that we did do a check
|
||||
if err != nil {
|
||||
log.Debugf("publishing network error for %v -- %v\n", onion, err)
|
||||
nc.bus.Publish(event.NewEvent(event.NetworkStatus, map[event.Field]string{event.Onion: onion, event.Error: err.Error(), event.Status: NetworkCheckError}))
|
||||
nc.offline = true
|
||||
} else {
|
||||
log.Debugf("publishing network success for %v", onion)
|
||||
nc.bus.Publish(event.NewEvent(event.NetworkStatus, map[event.Field]string{event.Onion: onion, event.Error: "", event.Status: NetworkCheckSuccess}))
|
||||
nc.offline = false
|
||||
}
|
||||
}
|
||||
|
||||
// TODO we might want to reuse this, but for now it is only used by this plugin so it can live here
|
||||
|
||||
// TimeoutPolicy is an interface for enforcing common timeout patterns
|
||||
type TimeoutPolicy time.Duration
|
||||
|
||||
// ExecuteAction runs a function and returns an error if it hasn't returned
|
||||
// by the time specified by TimeoutPolicy
|
||||
func (tp *TimeoutPolicy) ExecuteAction(action func() error) error {
|
||||
|
||||
c := make(chan error)
|
||||
go func() {
|
||||
c <- action()
|
||||
}()
|
||||
|
||||
tick := time.NewTicker(time.Duration(*tp))
|
||||
select {
|
||||
case <-tick.C:
|
||||
return fmt.Errorf("ActionTimedOutError")
|
||||
case err := <-c:
|
||||
return err
|
||||
}
|
||||
}
|
|
@ -1,33 +0,0 @@
|
|||
package plugins
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"git.openprivacy.ca/openprivacy/connectivity"
|
||||
)
|
||||
|
||||
// PluginID is used as an ID for signaling plugin activities
|
||||
type PluginID int
|
||||
|
||||
// These are the plugin IDs for the supplied plugins
|
||||
const (
|
||||
CONNECTIONRETRY PluginID = iota
|
||||
NETWORKCHECK
|
||||
)
|
||||
|
||||
// Plugin is the interface for a plugin
|
||||
type Plugin interface {
|
||||
Start()
|
||||
Shutdown()
|
||||
}
|
||||
|
||||
// Get is a plugin factory for the requested plugin
|
||||
func Get(id PluginID, bus event.Manager, acn connectivity.ACN, onion string) Plugin {
|
||||
switch id {
|
||||
case CONNECTIONRETRY:
|
||||
return NewConnectionRetry(bus, onion)
|
||||
case NETWORKCHECK:
|
||||
return NewNetworkCheck(bus, acn)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
|
@ -1,25 +0,0 @@
|
|||
package utils
|
||||
|
||||
import (
|
||||
app2 "cwtch.im/cwtch/app"
|
||||
"cwtch.im/cwtch/model/attr"
|
||||
"cwtch.im/cwtch/peer"
|
||||
"time"
|
||||
)
|
||||
|
||||
// WaitGetPeer is a helper function for utility apps not written using the event bus
|
||||
// Proper use of an App is to call CreatePeer and then process the NewPeer event
|
||||
// however for small utility use, this function which polls the app until the peer is created
|
||||
// may fill that usecase better
|
||||
func WaitGetPeer(app app2.Application, name string) peer.CwtchPeer {
|
||||
for {
|
||||
for id := range app.ListPeers() {
|
||||
peer := app.GetPeer(id)
|
||||
localName, _ := peer.GetAttribute(attr.GetLocalScope("name"))
|
||||
if localName == name {
|
||||
return peer
|
||||
}
|
||||
}
|
||||
time.Sleep(100 * time.Millisecond)
|
||||
}
|
||||
}
|
|
@ -0,0 +1,168 @@
|
|||
package tor
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"fmt"
|
||||
"github.com/yawning/bulb"
|
||||
"log"
|
||||
"net"
|
||||
"net/http"
|
||||
"net/url"
|
||||
"os"
|
||||
"os/exec"
|
||||
"path"
|
||||
"strings"
|
||||
"time"
|
||||
)
|
||||
|
||||
// Manager checks connectivity of the Tor process used to support Cwtch
|
||||
type Manager struct {
|
||||
socksPort int
|
||||
controlPort int
|
||||
process *exec.Cmd
|
||||
}
|
||||
|
||||
// NewTorManager Instantiates a new connection manager, returns non-nil error if it fails to connect to a tor daemon on the given ports.
|
||||
func NewTorManager(socksPort int, controlPort int, torPath string, torrc string) (*Manager, error) {
|
||||
torManager := new(Manager)
|
||||
torManager.socksPort = socksPort
|
||||
torManager.controlPort = controlPort
|
||||
|
||||
err := torManager.TestConnection()
|
||||
|
||||
if err == nil {
|
||||
log.Printf("using existing tor proxy")
|
||||
return torManager, nil
|
||||
}
|
||||
|
||||
// try to start tor
|
||||
|
||||
cmd := exec.Command(torPath, "-f", torrc)
|
||||
|
||||
// on Android, home can be set to '/' which is not writeable
|
||||
if os.Getenv("HOME") == "" {
|
||||
cmd.Env = append(os.Environ(), fmt.Sprintf("HOME=%s", path.Dir(torrc)))
|
||||
}
|
||||
|
||||
log.Printf("starting local tor proxy")
|
||||
err = cmd.Start()
|
||||
if err != nil {
|
||||
log.Printf("starting tor failed %v", err)
|
||||
return nil, err
|
||||
}
|
||||
torManager.process = cmd
|
||||
|
||||
// for 30 seconds check every 5 if tor is up and working
|
||||
for i := 0; i < 6; i++ {
|
||||
time.Sleep(time.Second * 5)
|
||||
err = torManager.TestConnection()
|
||||
if err == nil {
|
||||
break
|
||||
}
|
||||
}
|
||||
return torManager, err
|
||||
}
|
||||
|
||||
type proxyStatus int
|
||||
|
||||
const (
|
||||
proxyStatusOK proxyStatus = iota
|
||||
proxyStatusWrongType
|
||||
proxyStatusCannotConnect
|
||||
proxyStatusTimeout
|
||||
)
|
||||
|
||||
// Shutdown kills the managed Tor Process
|
||||
func (tm *Manager) Shutdown() {
|
||||
if tm.process != nil {
|
||||
if err := tm.process.Process.Kill(); err != nil {
|
||||
log.Fatal("failed to kill process: ", err)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Detect whether a proxy is connectable and is a Tor proxy
|
||||
func checkTorProxy(proxyAddress string) proxyStatus {
|
||||
// A trick to do this without making an outward connection is,
|
||||
// paradoxically, to try to open it as http.
|
||||
// This is documented in section 4 here: https://github.com/torproject/torspec/blob/master/socks-extensions.txt
|
||||
client := &http.Client{Timeout: 2 * time.Second}
|
||||
response, err := client.Get("http://" + proxyAddress + "/")
|
||||
if err != nil {
|
||||
switch t := err.(type) {
|
||||
case *url.Error:
|
||||
switch t.Err.(type) {
|
||||
case *net.OpError: // Network-level error. Will in turn contain a os.SyscallError
|
||||
return proxyStatusCannotConnect
|
||||
default:
|
||||
// http.error unfortunately not exported, need to match on string
|
||||
// net/http: request canceled
|
||||
if strings.Index(t.Err.Error(), "request canceled") != -1 {
|
||||
return proxyStatusTimeout
|
||||
}
|
||||
}
|
||||
}
|
||||
// Protocol-level errors mean that http failed, so it's not Tor
|
||||
return proxyStatusWrongType
|
||||
}
|
||||
defer response.Body.Close()
|
||||
if response.Status != "501 Tor is not an HTTP Proxy" {
|
||||
return proxyStatusWrongType
|
||||
}
|
||||
return proxyStatusOK
|
||||
}
|
||||
|
||||
func proxyStatusMessage(status proxyStatus) string {
|
||||
switch status {
|
||||
case proxyStatusWrongType:
|
||||
return "Proxy specified is not a Tor proxy"
|
||||
case proxyStatusCannotConnect:
|
||||
return "Cannot connect to Tor proxy"
|
||||
case proxyStatusTimeout:
|
||||
return "Proxy timeout"
|
||||
default:
|
||||
return "Unknown proxy error"
|
||||
}
|
||||
}
|
||||
|
||||
// TestConnection returns nil if both the socks and control ports of the Tor connection are active, otherwise it returns an error.
|
||||
func (tm *Manager) TestConnection() error {
|
||||
proxyStatus := checkTorProxy(fmt.Sprintf("127.0.0.1:%d", tm.socksPort))
|
||||
controlAddress := fmt.Sprintf("127.0.0.1:%d", tm.controlPort)
|
||||
if proxyStatus == proxyStatusOK {
|
||||
c, err := bulb.Dial("tcp4", controlAddress)
|
||||
if c != nil {
|
||||
c.Close()
|
||||
}
|
||||
if err == nil {
|
||||
return nil
|
||||
}
|
||||
return fmt.Errorf("could not connect to Tor Control Port %v %v", tm.controlPort, err)
|
||||
}
|
||||
return errors.New(proxyStatusMessage(proxyStatus))
|
||||
}
|
||||
|
||||
// GetStatus returns tor control port bootstrap-phase status info in a map
|
||||
func (tm *Manager) GetStatus() (map[string]string, error) {
|
||||
controlAddress := fmt.Sprintf("127.0.0.1:%d", tm.controlPort)
|
||||
c, err := bulb.Dial("tcp4", controlAddress)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
defer c.Close()
|
||||
c.Request("AUTHENTICATE \"\"")
|
||||
resp, err := c.Request("GETINFO status/bootstrap-phase")
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
lines := strings.SplitN(resp.RawLines[0], " ", 5)
|
||||
var resps = make(map[string]string)
|
||||
for _, l := range lines {
|
||||
kv := strings.Split(l, "=")
|
||||
if len(kv) == 2 {
|
||||
resps[kv[0]] = kv[1]
|
||||
}
|
||||
}
|
||||
return resps, nil
|
||||
}
|
|
@ -0,0 +1,31 @@
|
|||
package tor
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"os"
|
||||
"os/exec"
|
||||
"testing"
|
||||
)
|
||||
|
||||
func TestTorManager(t *testing.T) {
|
||||
tor, err := exec.LookPath("tor")
|
||||
if err != nil {
|
||||
t.Errorf("tor not found in PATH")
|
||||
}
|
||||
os.Remove("/tmp/torrc")
|
||||
file, _ := os.Create("/tmp/torrc")
|
||||
fmt.Fprintf(file, "SOCKSPort %d\nControlPort %d\nDataDirectory /tmp/tor\n", 10050, 10051)
|
||||
file.Close()
|
||||
tm, err := NewTorManager(10050, 10051, tor, "/tmp/torrc")
|
||||
if err != nil {
|
||||
t.Errorf("creating a new tor manager failed: %v", err)
|
||||
} else {
|
||||
|
||||
tm2, err := NewTorManager(10050, 10051, tor, "/tmp/torrc")
|
||||
if err != nil {
|
||||
t.Errorf("creating a new tor manager failed: %v", err)
|
||||
}
|
||||
tm2.Shutdown() // should not noop
|
||||
}
|
||||
tm.Shutdown()
|
||||
}
|
|
@ -1,57 +0,0 @@
|
|||
package bridge
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"sync"
|
||||
)
|
||||
|
||||
type goChanBridge struct {
|
||||
in chan event.IPCMessage
|
||||
out chan event.IPCMessage
|
||||
closedChan chan bool
|
||||
closed bool
|
||||
lock sync.Mutex
|
||||
}
|
||||
|
||||
// MakeGoChanBridge returns a simple testing IPCBridge made from inprocess go channels
|
||||
func MakeGoChanBridge() (b1, b2 event.IPCBridge) {
|
||||
chan1 := make(chan event.IPCMessage)
|
||||
chan2 := make(chan event.IPCMessage)
|
||||
closed := make(chan bool)
|
||||
|
||||
a := &goChanBridge{in: chan1, out: chan2, closedChan: closed, closed: false}
|
||||
b := &goChanBridge{in: chan2, out: chan1, closedChan: closed, closed: false}
|
||||
|
||||
go monitor(a, b)
|
||||
|
||||
return a, b
|
||||
}
|
||||
|
||||
func monitor(a, b *goChanBridge) {
|
||||
<-a.closedChan
|
||||
a.closed = true
|
||||
b.closed = true
|
||||
a.closedChan <- true
|
||||
}
|
||||
|
||||
func (pb *goChanBridge) Read() (*event.IPCMessage, bool) {
|
||||
message, ok := <-pb.in
|
||||
return &message, ok
|
||||
}
|
||||
|
||||
func (pb *goChanBridge) Write(message *event.IPCMessage) {
|
||||
pb.lock.Lock()
|
||||
defer pb.lock.Unlock()
|
||||
if !pb.closed {
|
||||
pb.out <- *message
|
||||
}
|
||||
}
|
||||
|
||||
func (pb *goChanBridge) Shutdown() {
|
||||
if !pb.closed {
|
||||
close(pb.in)
|
||||
close(pb.out)
|
||||
pb.closedChan <- true
|
||||
<-pb.closedChan
|
||||
}
|
||||
}
|
|
@ -1,72 +0,0 @@
|
|||
package bridge
|
||||
|
||||
/* Todo: When go generics ships, refactor this and event.infiniteChannel into one */
|
||||
|
||||
// InfiniteChannel implements the Channel interface with an infinite buffer between the input and the output.
|
||||
type InfiniteChannel struct {
|
||||
input, output chan interface{}
|
||||
length chan int
|
||||
buffer *InfiniteQueue
|
||||
}
|
||||
|
||||
func newInfiniteChannel() *InfiniteChannel {
|
||||
ch := &InfiniteChannel{
|
||||
input: make(chan interface{}),
|
||||
output: make(chan interface{}),
|
||||
length: make(chan int),
|
||||
buffer: newInfiniteQueue(),
|
||||
}
|
||||
go ch.infiniteBuffer()
|
||||
return ch
|
||||
}
|
||||
|
||||
// In returns the input channel
|
||||
func (ch *InfiniteChannel) In() chan<- interface{} {
|
||||
return ch.input
|
||||
}
|
||||
|
||||
// Out returns the output channel
|
||||
func (ch *InfiniteChannel) Out() <-chan interface{} {
|
||||
return ch.output
|
||||
}
|
||||
|
||||
// Len returns the length of items in queue
|
||||
func (ch *InfiniteChannel) Len() int {
|
||||
return <-ch.length
|
||||
}
|
||||
|
||||
// Close closes the InfiniteChanel
|
||||
func (ch *InfiniteChannel) Close() {
|
||||
close(ch.input)
|
||||
}
|
||||
|
||||
func (ch *InfiniteChannel) infiniteBuffer() {
|
||||
var input, output chan interface{}
|
||||
var next interface{}
|
||||
input = ch.input
|
||||
|
||||
for input != nil || output != nil {
|
||||
select {
|
||||
case elem, open := <-input:
|
||||
if open {
|
||||
ch.buffer.Add(elem)
|
||||
} else {
|
||||
input = nil
|
||||
}
|
||||
case output <- next:
|
||||
ch.buffer.Remove()
|
||||
case ch.length <- ch.buffer.Length():
|
||||
}
|
||||
|
||||
if ch.buffer.Length() > 0 {
|
||||
output = ch.output
|
||||
next = ch.buffer.Peek()
|
||||
} else {
|
||||
output = nil
|
||||
next = nil
|
||||
}
|
||||
}
|
||||
|
||||
close(ch.output)
|
||||
close(ch.length)
|
||||
}
|
|
@ -1,105 +0,0 @@
|
|||
package bridge
|
||||
|
||||
/* Todo: When go generics ships, refactor this and event.infinitQueue channel into one */
|
||||
|
||||
/*
|
||||
Package queue provides a fast, ring-buffer queue based on the version suggested by Dariusz Górecki.
|
||||
Using this instead of other, simpler, queue implementations (slice+append or linked list) provides
|
||||
substantial memory and time benefits, and fewer GC pauses.
|
||||
|
||||
The queue implemented here is as fast as it is for an additional reason: it is *not* thread-safe.
|
||||
*/
|
||||
|
||||
// minQueueLen is smallest capacity that queue may have.
|
||||
// Must be power of 2 for bitwise modulus: x % n == x & (n - 1).
|
||||
const minQueueLen = 16
|
||||
|
||||
// InfiniteQueue represents a single instance of the queue data structure.
|
||||
type InfiniteQueue struct {
|
||||
buf []interface{}
|
||||
head, tail, count int
|
||||
}
|
||||
|
||||
// New constructs and returns a new Queue.
|
||||
func newInfiniteQueue() *InfiniteQueue {
|
||||
return &InfiniteQueue{
|
||||
buf: make([]interface{}, minQueueLen),
|
||||
}
|
||||
}
|
||||
|
||||
// Length returns the number of elements currently stored in the queue.
|
||||
func (q *InfiniteQueue) Length() int {
|
||||
return q.count
|
||||
}
|
||||
|
||||
// resizes the queue to fit exactly twice its current contents
|
||||
// this can result in shrinking if the queue is less than half-full
|
||||
func (q *InfiniteQueue) resize() {
|
||||
newBuf := make([]interface{}, q.count<<1)
|
||||
|
||||
if q.tail > q.head {
|
||||
copy(newBuf, q.buf[q.head:q.tail])
|
||||
} else {
|
||||
n := copy(newBuf, q.buf[q.head:])
|
||||
copy(newBuf[n:], q.buf[:q.tail])
|
||||
}
|
||||
|
||||
q.head = 0
|
||||
q.tail = q.count
|
||||
q.buf = newBuf
|
||||
}
|
||||
|
||||
// Add puts an element on the end of the queue.
|
||||
func (q *InfiniteQueue) Add(elem interface{}) {
|
||||
if q.count == len(q.buf) {
|
||||
q.resize()
|
||||
}
|
||||
|
||||
q.buf[q.tail] = elem
|
||||
// bitwise modulus
|
||||
q.tail = (q.tail + 1) & (len(q.buf) - 1)
|
||||
q.count++
|
||||
}
|
||||
|
||||
// Peek returns the element at the head of the queue. This call panics
|
||||
// if the queue is empty.
|
||||
func (q *InfiniteQueue) Peek() interface{} {
|
||||
if q.count <= 0 {
|
||||
panic("queue: Peek() called on empty queue")
|
||||
}
|
||||
return q.buf[q.head]
|
||||
}
|
||||
|
||||
// Get returns the element at index i in the queue. If the index is
|
||||
// invalid, the call will panic. This method accepts both positive and
|
||||
// negative index values. Index 0 refers to the first element, and
|
||||
// index -1 refers to the last.
|
||||
func (q *InfiniteQueue) Get(i int) interface{} {
|
||||
// If indexing backwards, convert to positive index.
|
||||
if i < 0 {
|
||||
i += q.count
|
||||
}
|
||||
if i < 0 || i >= q.count {
|
||||
panic("queue: Get() called with index out of range")
|
||||
}
|
||||
// bitwise modulus
|
||||
return q.buf[(q.head+i)&(len(q.buf)-1)]
|
||||
}
|
||||
|
||||
// Remove removes and returns the element from the front of the queue. If the
|
||||
// queue is empty, the call will panic.
|
||||
func (q *InfiniteQueue) Remove() interface{} {
|
||||
if q.count <= 0 {
|
||||
panic("queue: Remove() called on empty queue")
|
||||
}
|
||||
ret := q.buf[q.head]
|
||||
q.buf[q.head] = nil
|
||||
// bitwise modulus
|
||||
q.head = (q.head + 1) & (len(q.buf) - 1)
|
||||
q.count--
|
||||
// Resize down if buffer 1/4 full.
|
||||
if len(q.buf) > minQueueLen && (q.count<<2) == len(q.buf) {
|
||||
q.resize()
|
||||
}
|
||||
return ret
|
||||
}
|
|
@ -1,19 +0,0 @@
|
|||
// +build windows
|
||||
|
||||
package bridge
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"log"
|
||||
)
|
||||
|
||||
func NewPipeBridgeClient(inFilename, outFilename string) event.IPCBridge {
|
||||
log.Fatal("Not supported on windows")
|
||||
return nil
|
||||
}
|
||||
|
||||
// NewPipeBridgeService returns a pipe backed IPCBridge for a service
|
||||
func NewPipeBridgeService(inFilename, outFilename string) event.IPCBridge {
|
||||
log.Fatal("Not supported on windows")
|
||||
return nil
|
||||
}
|
|
@ -1,357 +0,0 @@
|
|||
// +build !windows
|
||||
|
||||
package bridge
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/protocol/connections"
|
||||
"encoding/base64"
|
||||
"encoding/binary"
|
||||
"encoding/json"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"os"
|
||||
"sync"
|
||||
"syscall"
|
||||
"time"
|
||||
)
|
||||
|
||||
/* pipeBridge creates a pair of named pipes
|
||||
Needs a call to new client and service to fully successfully open
|
||||
*/
|
||||
|
||||
const maxBufferSize = 1000
|
||||
|
||||
const serviceName = "service"
|
||||
const clientName = "client"
|
||||
|
||||
const syn = "SYN"
|
||||
const synack = "SYNACK"
|
||||
const ack = "ACK"
|
||||
|
||||
type pipeBridge struct {
|
||||
infile, outfile string
|
||||
in, out *os.File
|
||||
read chan event.IPCMessage
|
||||
write *InfiniteChannel
|
||||
closedChan chan bool
|
||||
state connections.ConnectionState
|
||||
lock sync.Mutex
|
||||
threeShake func() bool
|
||||
|
||||
// For logging / debugging purposes
|
||||
name string
|
||||
}
|
||||
|
||||
func newPipeBridge(inFilename, outFilename string) *pipeBridge {
|
||||
syscall.Mkfifo(inFilename, 0600)
|
||||
syscall.Mkfifo(outFilename, 0600)
|
||||
pb := &pipeBridge{infile: inFilename, outfile: outFilename, state: connections.DISCONNECTED}
|
||||
pb.read = make(chan event.IPCMessage, maxBufferSize)
|
||||
pb.write = newInfiniteChannel() //make(chan event.IPCMessage, maxBufferSize)
|
||||
return pb
|
||||
}
|
||||
|
||||
// NewPipeBridgeClient returns a pipe backed IPCBridge for a client
|
||||
func NewPipeBridgeClient(inFilename, outFilename string) event.IPCBridge {
|
||||
log.Debugf("Making new PipeBridge Client...\n")
|
||||
pb := newPipeBridge(inFilename, outFilename)
|
||||
pb.name = clientName
|
||||
pb.threeShake = pb.threeShakeClient
|
||||
go pb.connectionManager()
|
||||
|
||||
return pb
|
||||
}
|
||||
|
||||
// NewPipeBridgeService returns a pipe backed IPCBridge for a service
|
||||
func NewPipeBridgeService(inFilename, outFilename string) event.IPCBridge {
|
||||
log.Debugf("Making new PipeBridge Service...\n")
|
||||
pb := newPipeBridge(inFilename, outFilename)
|
||||
pb.name = serviceName
|
||||
pb.threeShake = pb.threeShakeService
|
||||
|
||||
go pb.connectionManager()
|
||||
|
||||
log.Debugf("Successfully created new PipeBridge Service!\n")
|
||||
return pb
|
||||
}
|
||||
|
||||
func (pb *pipeBridge) setState(state connections.ConnectionState) {
|
||||
pb.lock.Lock()
|
||||
defer pb.lock.Unlock()
|
||||
|
||||
pb.state = state
|
||||
}
|
||||
|
||||
func (pb *pipeBridge) getState() connections.ConnectionState {
|
||||
pb.lock.Lock()
|
||||
defer pb.lock.Unlock()
|
||||
|
||||
return pb.state
|
||||
}
|
||||
|
||||
func (pb *pipeBridge) connectionManager() {
|
||||
for pb.getState() != connections.KILLED {
|
||||
log.Debugf("clientConnManager loop start init\n")
|
||||
pb.setState(connections.CONNECTING)
|
||||
|
||||
var err error
|
||||
log.Debugf("%v open file infile\n", pb.name)
|
||||
pb.in, err = os.OpenFile(pb.infile, os.O_RDWR, 0600)
|
||||
if err != nil {
|
||||
pb.setState(connections.DISCONNECTED)
|
||||
continue
|
||||
}
|
||||
|
||||
log.Debugf("%v open file outfile\n", pb.name)
|
||||
pb.out, err = os.OpenFile(pb.outfile, os.O_RDWR, 0600)
|
||||
if err != nil {
|
||||
pb.setState(connections.DISCONNECTED)
|
||||
continue
|
||||
}
|
||||
|
||||
log.Debugf("Successfully connected PipeBridge %v!\n", pb.name)
|
||||
|
||||
pb.handleConns()
|
||||
}
|
||||
log.Debugf("exiting %v ConnectionManager\n", pb.name)
|
||||
|
||||
}
|
||||
|
||||
// threeShake performs a 3way handshake sync up
|
||||
func (pb *pipeBridge) threeShakeService() bool {
|
||||
synacked := false
|
||||
|
||||
for {
|
||||
resp, err := pb.readString()
|
||||
if err != nil {
|
||||
return false
|
||||
}
|
||||
|
||||
if string(resp) == syn {
|
||||
if !synacked {
|
||||
err = pb.writeString([]byte(synack))
|
||||
if err != nil {
|
||||
return false
|
||||
}
|
||||
synacked = true
|
||||
}
|
||||
} else if string(resp) == ack {
|
||||
return true
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (pb *pipeBridge) synLoop(stop chan bool) {
|
||||
delay := time.Duration(0)
|
||||
for {
|
||||
select {
|
||||
case <-time.After(delay):
|
||||
err := pb.writeString([]byte(syn))
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
delay = time.Second
|
||||
case <-stop:
|
||||
return
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (pb *pipeBridge) threeShakeClient() bool {
|
||||
stop := make(chan bool)
|
||||
go pb.synLoop(stop)
|
||||
for {
|
||||
resp, err := pb.readString()
|
||||
if err != nil {
|
||||
return false
|
||||
}
|
||||
|
||||
if string(resp) == synack {
|
||||
stop <- true
|
||||
err := pb.writeString([]byte(ack))
|
||||
return err == nil
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (pb *pipeBridge) handleConns() {
|
||||
|
||||
if !pb.threeShake() {
|
||||
pb.setState(connections.FAILED)
|
||||
pb.closeReset()
|
||||
return
|
||||
}
|
||||
|
||||
pb.setState(connections.AUTHENTICATED)
|
||||
|
||||
pb.closedChan = make(chan bool, 5)
|
||||
|
||||
log.Debugf("handleConns authed, %v 2xgo\n", pb.name)
|
||||
|
||||
go pb.handleRead()
|
||||
go pb.handleWrite()
|
||||
|
||||
<-pb.closedChan
|
||||
log.Debugf("handleConns <-closedChan (%v)\n", pb.name)
|
||||
if pb.getState() != connections.KILLED {
|
||||
pb.setState(connections.FAILED)
|
||||
}
|
||||
pb.closeReset()
|
||||
log.Debugf("handleConns done for %v, exit\n", pb.name)
|
||||
}
|
||||
|
||||
func (pb *pipeBridge) closeReset() {
|
||||
pb.in.Close()
|
||||
pb.out.Close()
|
||||
close(pb.read)
|
||||
pb.write.Close()
|
||||
|
||||
if pb.getState() != connections.KILLED {
|
||||
pb.read = make(chan event.IPCMessage, maxBufferSize)
|
||||
pb.write = newInfiniteChannel()
|
||||
}
|
||||
}
|
||||
|
||||
func (pb *pipeBridge) handleWrite() {
|
||||
log.Debugf("handleWrite() %v\n", pb.name)
|
||||
defer log.Debugf("exiting handleWrite() %v\n", pb.name)
|
||||
|
||||
for {
|
||||
select {
|
||||
case messageInf := <-pb.write.output:
|
||||
if messageInf == nil {
|
||||
pb.closedChan <- true
|
||||
return
|
||||
}
|
||||
message := messageInf.(event.IPCMessage)
|
||||
if message.Message.EventType == event.EncryptedGroupMessage || message.Message.EventType == event.SendMessageToGroup || message.Message.EventType == event.NewMessageFromGroup {
|
||||
log.Debugf("handleWrite <- message: %v %v ...\n", message.Dest, message.Message.EventType)
|
||||
} else {
|
||||
log.Debugf("handleWrite <- message: %v\n", message)
|
||||
}
|
||||
if pb.getState() == connections.AUTHENTICATED {
|
||||
encMessage := &event.IPCMessage{Dest: message.Dest, Message: event.Event{EventType: message.Message.EventType, EventID: message.Message.EventID, Data: make(map[event.Field]string)}}
|
||||
for k, v := range message.Message.Data {
|
||||
encMessage.Message.Data[k] = base64.StdEncoding.EncodeToString([]byte(v))
|
||||
}
|
||||
|
||||
messageJSON, _ := json.Marshal(encMessage)
|
||||
err := pb.writeString(messageJSON)
|
||||
if err != nil {
|
||||
pb.closedChan <- true
|
||||
return
|
||||
}
|
||||
} else {
|
||||
return
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (pb *pipeBridge) handleRead() {
|
||||
log.Debugf("handleRead() %v\n", pb.name)
|
||||
defer log.Debugf("exiting handleRead() %v", pb.name)
|
||||
|
||||
for {
|
||||
log.Debugf("Waiting to handleRead()...\n")
|
||||
|
||||
buffer, err := pb.readString()
|
||||
if err != nil {
|
||||
pb.closedChan <- true
|
||||
return
|
||||
}
|
||||
|
||||
var message event.IPCMessage
|
||||
err = json.Unmarshal(buffer, &message)
|
||||
if err != nil {
|
||||
log.Errorf("Read error: '%v', value: '%v'", err, buffer)
|
||||
pb.closedChan <- true
|
||||
return // probably new connection trying to initialize
|
||||
}
|
||||
for k, v := range message.Message.Data {
|
||||
val, _ := base64.StdEncoding.DecodeString(v)
|
||||
message.Message.Data[k] = string(val)
|
||||
}
|
||||
if message.Message.EventType == event.EncryptedGroupMessage || message.Message.EventType == event.SendMessageToGroup || message.Message.EventType == event.NewMessageFromGroup {
|
||||
log.Debugf("handleRead read<-: %v %v ...\n", message.Dest, message.Message.EventType)
|
||||
} else {
|
||||
log.Debugf("handleRead read<-: %v\n", message)
|
||||
}
|
||||
pb.read <- message
|
||||
log.Debugf("handleRead wrote\n")
|
||||
}
|
||||
}
|
||||
|
||||
func (pb *pipeBridge) Read() (*event.IPCMessage, bool) {
|
||||
log.Debugf("Read() %v...\n", pb.name)
|
||||
var ok = false
|
||||
var message event.IPCMessage
|
||||
for !ok && pb.getState() != connections.KILLED {
|
||||
message, ok = <-pb.read
|
||||
if message.Message.EventType == event.EncryptedGroupMessage || message.Message.EventType == event.SendMessageToGroup || message.Message.EventType == event.NewMessageFromGroup {
|
||||
log.Debugf("Read %v: %v %v ...\n", pb.name, message.Dest, message.Message.EventType)
|
||||
} else {
|
||||
log.Debugf("Read %v: %v\n", pb.name, message)
|
||||
}
|
||||
}
|
||||
return &message, pb.getState() != connections.KILLED
|
||||
}
|
||||
|
||||
func (pb *pipeBridge) Write(message *event.IPCMessage) {
|
||||
if message.Message.EventType == event.EncryptedGroupMessage || message.Message.EventType == event.SendMessageToGroup || message.Message.EventType == event.NewMessageFromGroup {
|
||||
log.Debugf("Write %v: %v %v ...\n", pb.name, message.Dest, message.Message.EventType)
|
||||
} else {
|
||||
log.Debugf("Write %v: %v\n", pb.name, message)
|
||||
}
|
||||
pb.write.input <- *message
|
||||
log.Debugf("Wrote\n")
|
||||
}
|
||||
|
||||
func (pb *pipeBridge) Shutdown() {
|
||||
log.Debugf("pb.Shutdown() for %v currently in state: %v\n", pb.name, connections.ConnectionStateName[pb.getState()])
|
||||
pb.state = connections.KILLED
|
||||
pb.closedChan <- true
|
||||
log.Debugf("Done Shutdown for %v\n", pb.name)
|
||||
}
|
||||
|
||||
func (pb *pipeBridge) writeString(message []byte) error {
|
||||
size := make([]byte, 2)
|
||||
binary.LittleEndian.PutUint16(size, uint16(len(message)))
|
||||
pb.out.Write(size)
|
||||
|
||||
for pos := 0; pos < len(message); {
|
||||
n, err := pb.out.Write(message[pos:])
|
||||
if err != nil {
|
||||
log.Errorf("Writing out on pipeBridge: %v\n", err)
|
||||
return err
|
||||
}
|
||||
pos += n
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (pb *pipeBridge) readString() ([]byte, error) {
|
||||
var n int
|
||||
size := make([]byte, 2)
|
||||
var err error
|
||||
|
||||
n, err = pb.in.Read(size)
|
||||
if err != nil || n != 2 {
|
||||
log.Errorf("Could not read len int from stream: %v\n", err)
|
||||
return nil, err
|
||||
}
|
||||
|
||||
n = int(binary.LittleEndian.Uint16(size))
|
||||
pos := 0
|
||||
buffer := make([]byte, n)
|
||||
for n > 0 {
|
||||
m, err := pb.in.Read(buffer[pos:])
|
||||
if err != nil {
|
||||
log.Errorf("Reading into buffer from pipe: %v\n", err)
|
||||
return nil, err
|
||||
}
|
||||
n -= m
|
||||
pos += m
|
||||
}
|
||||
return buffer, nil
|
||||
}
|
|
@ -1,131 +0,0 @@
|
|||
package bridge
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"os"
|
||||
"testing"
|
||||
"time"
|
||||
)
|
||||
|
||||
var (
|
||||
clientPipe = "./client"
|
||||
servicePipe = "./service"
|
||||
)
|
||||
|
||||
func clientHelper(t *testing.T, in, out string, messageOrig *event.IPCMessage, done chan bool) {
|
||||
client := NewPipeBridgeClient(in, out)
|
||||
|
||||
messageAfter, ok := client.Read()
|
||||
if !ok {
|
||||
t.Errorf("Reading from client IPCBridge failed")
|
||||
done <- true
|
||||
return
|
||||
}
|
||||
|
||||
if messageOrig.Dest != messageAfter.Dest {
|
||||
t.Errorf("Dest's value differs expected: %v actaul: %v", messageOrig.Dest, messageAfter.Dest)
|
||||
}
|
||||
|
||||
if messageOrig.Message.EventType != messageAfter.Message.EventType {
|
||||
t.Errorf("EventTypes's value differs expected: %v actaul: %v", messageOrig.Message.EventType, messageAfter.Message.EventType)
|
||||
}
|
||||
|
||||
if messageOrig.Message.Data[event.Identity] != messageAfter.Message.Data[event.Identity] {
|
||||
t.Errorf("Data[Identity]'s value differs expected: %v actaul: %v", messageOrig.Message.Data[event.Identity], messageAfter.Message.Data[event.Identity])
|
||||
}
|
||||
|
||||
done <- true
|
||||
}
|
||||
|
||||
func serviceHelper(t *testing.T, in, out string, messageOrig *event.IPCMessage, done chan bool) {
|
||||
service := NewPipeBridgeService(in, out)
|
||||
|
||||
service.Write(messageOrig)
|
||||
|
||||
done <- true
|
||||
}
|
||||
|
||||
func TestPipeBridge(t *testing.T) {
|
||||
os.Remove(servicePipe)
|
||||
os.Remove(clientPipe)
|
||||
|
||||
messageOrig := &event.IPCMessage{Dest: "ABC", Message: event.NewEventList(event.NewPeer, event.Identity, "It is I")}
|
||||
serviceDone := make(chan bool)
|
||||
clientDone := make(chan bool)
|
||||
|
||||
go clientHelper(t, clientPipe, servicePipe, messageOrig, clientDone)
|
||||
go serviceHelper(t, servicePipe, clientPipe, messageOrig, serviceDone)
|
||||
|
||||
<-serviceDone
|
||||
<-clientDone
|
||||
}
|
||||
|
||||
func restartingClient(t *testing.T, in, out string, done chan bool) {
|
||||
client := NewPipeBridgeClient(in, out)
|
||||
|
||||
message1 := &event.IPCMessage{Dest: "ABC", Message: event.NewEventList(event.NewPeer)}
|
||||
log.Infoln("client writing message 1")
|
||||
client.Write(message1)
|
||||
|
||||
time.Sleep(100 * time.Millisecond)
|
||||
log.Infoln("client shutdown")
|
||||
client.Shutdown()
|
||||
|
||||
log.Infoln("client new client")
|
||||
client = NewPipeBridgeClient(in, out)
|
||||
message2 := &event.IPCMessage{Dest: "ABC", Message: event.NewEventList(event.DeleteContact)}
|
||||
log.Infoln("client2 write message2")
|
||||
client.Write(message2)
|
||||
|
||||
done <- true
|
||||
}
|
||||
|
||||
func stableService(t *testing.T, in, out string, done chan bool) {
|
||||
service := NewPipeBridgeService(in, out)
|
||||
|
||||
log.Infoln("service wait read 1")
|
||||
message1, ok := service.Read()
|
||||
log.Infof("service read 1 %v ok:%v\n", message1, ok)
|
||||
if !ok {
|
||||
t.Errorf("Reading from client IPCBridge 1st time failed")
|
||||
done <- true
|
||||
return
|
||||
}
|
||||
if message1.Message.EventType != event.NewPeer {
|
||||
t.Errorf("Wrong message received, expected NewPeer\n")
|
||||
done <- true
|
||||
return
|
||||
}
|
||||
|
||||
log.Infoln("service wait read 2")
|
||||
message2, ok := service.Read()
|
||||
log.Infof("service read 2 got %v ok:%v\n", message2, ok)
|
||||
if !ok {
|
||||
t.Errorf("Reading from client IPCBridge 2nd time failed")
|
||||
done <- true
|
||||
return
|
||||
}
|
||||
if message2.Message.EventType != event.DeleteContact {
|
||||
t.Errorf("Wrong message received, expected DeleteContact, got %v\n", message2)
|
||||
done <- true
|
||||
return
|
||||
}
|
||||
|
||||
done <- true
|
||||
}
|
||||
|
||||
func TestReconnect(t *testing.T) {
|
||||
log.Infoln("TestReconnect")
|
||||
os.Remove(servicePipe)
|
||||
os.Remove(clientPipe)
|
||||
|
||||
serviceDone := make(chan bool)
|
||||
clientDone := make(chan bool)
|
||||
|
||||
go restartingClient(t, clientPipe, servicePipe, clientDone)
|
||||
go stableService(t, servicePipe, clientPipe, serviceDone)
|
||||
|
||||
<-serviceDone
|
||||
<-clientDone
|
||||
}
|
351
event/common.go
351
event/common.go
|
@ -1,351 +0,0 @@
|
|||
package event
|
||||
|
||||
// Type captures the definition of many common Cwtch application events
|
||||
type Type string
|
||||
|
||||
// Defining Common Event Types
|
||||
const (
|
||||
StatusRequest = Type("StatusRequest")
|
||||
ProtocolEngineStatus = Type("ProtocolEngineStatus")
|
||||
|
||||
// Attempt to outbound peer with a given remote peer
|
||||
// attributes:
|
||||
// RemotePeer: [eg "chpr7qm6op5vfcg2pi4vllco3h6aa7exexc4rqwnlupqhoogx2zgd6qd"
|
||||
PeerRequest = Type("PeerRequest")
|
||||
|
||||
// RetryPeerRequest
|
||||
// Identical to PeerRequest, but allows Engine to make decisions regarding blocked peers
|
||||
// attributes:
|
||||
// RemotePeer: [eg "chpr7qm6op5vfcg2pi4vllco3h6aa7exexc4rqwnlupqhoogx2zgd6qd"
|
||||
RetryPeerRequest = Type("RetryPeerRequest")
|
||||
|
||||
// RetryServerRequest
|
||||
// Asks CwtchPeer to retry a server connection...
|
||||
// GroupServer: [eg "chpr7qm6op5vfcg2pi4vllco3h6aa7exexc4rqwnlupqhoogx2zgd6qd"
|
||||
RetryServerRequest = Type("RetryServerRequest")
|
||||
|
||||
// RemotePeer
|
||||
// Authorization(model.peer.Auth_...)
|
||||
SetPeerAuthorization = Type("UpdatePeerAuthorization")
|
||||
|
||||
// Turn on/off blocking of unknown peers (if peers aren't in the contact list then they will be autoblocked
|
||||
BlockUnknownPeers = Type("BlockUnknownPeers")
|
||||
AllowUnknownPeers = Type("AllowUnknownPeers")
|
||||
|
||||
// GroupServer
|
||||
JoinServer = Type("JoinServer")
|
||||
|
||||
// attributes GroupServer - the onion of the server to leave
|
||||
LeaveServer = Type("LeaveServer")
|
||||
|
||||
ProtocolEngineStartListen = Type("ProtocolEngineStartListen")
|
||||
ProtocolEngineStopped = Type("ProtocolEngineStopped")
|
||||
|
||||
InvitePeerToGroup = Type("InvitePeerToGroup")
|
||||
|
||||
// a group invite has been received from a remote peer
|
||||
// attributes:
|
||||
// TimestampReceived [eg time.Now().Format(time.RFC3339Nano)]
|
||||
// RemotePeer: [eg "chpr7qm6op5vfcg2pi4vllco3h6aa7exexc4rqwnlupqhoogx2zgd6qd"]
|
||||
// GroupInvite: [eg "torv3....."]
|
||||
// Imported
|
||||
NewGroupInvite = Type("NewGroupInvite")
|
||||
|
||||
// Inform the UI about a new group
|
||||
// GroupID: groupID (allows them to fetch from the peer)
|
||||
NewGroup = Type("NewGroup")
|
||||
|
||||
// GroupID
|
||||
AcceptGroupInvite = Type("AcceptGroupInvite")
|
||||
RejectGroupInvite = Type("RejectGroupInvite")
|
||||
|
||||
SendMessageToGroup = Type("SendMessagetoGroup")
|
||||
|
||||
//Ciphertext, Signature:
|
||||
EncryptedGroupMessage = Type("EncryptedGroupMessage")
|
||||
//TimestampReceived, TimestampSent, Data(Message), GroupID, Signature, PreviousSignature, RemotePeer
|
||||
NewMessageFromGroup = Type("NewMessageFromGroup")
|
||||
|
||||
// Sent if a Group Key is detected as being used outside of expected parameters (e.g. with tampered signatures)
|
||||
// GroupID: The ID of the Group that is presumed compromised
|
||||
GroupCompromised = Type("GroupCompromised")
|
||||
|
||||
// an error was encountered trying to send a particular Message to a group
|
||||
// attributes:
|
||||
// GroupServer: The server the Message was sent to
|
||||
// Signature: The signature of the Message that failed to send
|
||||
// Error: string describing the error
|
||||
SendMessageToGroupError = Type("SendMessageToGroupError")
|
||||
|
||||
SendMessageToPeer = Type("SendMessageToPeer")
|
||||
NewMessageFromPeer = Type("NewMessageFromPeer")
|
||||
|
||||
// RemotePeer, scope, path
|
||||
NewGetValMessageFromPeer = Type("NewGetValMessageFromPeer")
|
||||
|
||||
// RemotePeer, val, exists
|
||||
SendRetValMessageToPeer = Type("SendRetValMessageToPeer")
|
||||
|
||||
// RemotePeer, scope, val
|
||||
SendGetValMessageToPeer = Type("SendGetValMessageToPeer")
|
||||
|
||||
// RemotePeer, scope, path, data, exists
|
||||
NewRetValMessageFromPeer = Type("NewRetValMessageFromPeer")
|
||||
|
||||
// Peer acknowledges a previously sent message
|
||||
// attributes
|
||||
// EventID: The original event id that the peer is responding too.
|
||||
// RemotePeer: The peer associated with the acknowledgement
|
||||
PeerAcknowledgement = Type("PeerAcknowledgement")
|
||||
|
||||
// Like PeerAcknowledgement but with message index instead of event ID
|
||||
// attributes
|
||||
// Index: The original index of the message that the peer is responding too.
|
||||
// RemotePeer: The peer associated with the acknowledgement
|
||||
IndexedAcknowledgement = Type("IndexedAcknowledgement")
|
||||
|
||||
// Like PeerAcknowledgement but with message index instead of event ID
|
||||
// attributes
|
||||
// Index: The original index of the message that the peer is responding too.
|
||||
// RemotePeer: The peer associated with the acknowledgement
|
||||
IndexedFailure = Type("IndexedFailure")
|
||||
|
||||
// UpdateMessageFlags will change the flags associated with a given message.
|
||||
// Handle
|
||||
// Message Index
|
||||
// Flags
|
||||
UpdateMessageFlags = Type("UpdateMessageFlags")
|
||||
|
||||
// attributes:
|
||||
// RemotePeer: [eg "chpr7qm6op5vfcg2pi4vllco3h6aa7exexc4rqwnlupqhoogx2zgd6qd"]
|
||||
// Error: string describing the error
|
||||
SendMessageToPeerError = Type("SendMessageToPeerError")
|
||||
|
||||
// REQUESTS TO STORAGE ENGINE
|
||||
|
||||
// a peer contact has been added
|
||||
// attributes:
|
||||
// RemotePeer [eg ""]
|
||||
// Authorization
|
||||
PeerCreated = Type("PeerCreated")
|
||||
|
||||
// Password, NewPassword
|
||||
ChangePassword = Type("ChangePassword")
|
||||
|
||||
// Error(err), EventID
|
||||
ChangePasswordError = Type("ChangePasswordError")
|
||||
|
||||
// EventID
|
||||
ChangePasswordSuccess = Type("ChangePasswordSuccess")
|
||||
|
||||
// a group has been successfully added or newly created
|
||||
// attributes:
|
||||
// Data [serialized *model.Group]
|
||||
GroupCreated = Type("GroupCreated")
|
||||
|
||||
// RemotePeer
|
||||
DeleteContact = Type("DeleteContact")
|
||||
|
||||
// GroupID
|
||||
DeleteGroup = Type("DeleteGroup")
|
||||
|
||||
// change the .Name attribute of a profile (careful - this is not a custom attribute. it is used in the underlying protocol during handshakes!)
|
||||
// attributes:
|
||||
// ProfileName [eg "erinn"]
|
||||
SetProfileName = Type("SetProfileName")
|
||||
|
||||
// request to store a profile-wide attribute (good for e.g. per-profile settings like theme prefs)
|
||||
// attributes:
|
||||
// Key [eg "fontcolor"]
|
||||
// Data [eg "red"]
|
||||
SetAttribute = Type("SetAttribute")
|
||||
|
||||
// request to store a per-contact attribute (e.g. display names for a peer)
|
||||
// attributes:
|
||||
// RemotePeer [eg ""]
|
||||
// Key [eg "nick"]
|
||||
// Data [eg "erinn"]
|
||||
SetPeerAttribute = Type("SetPeerAttribute")
|
||||
|
||||
// request to store a per-cwtch-group attribute (e.g. display name for a group)
|
||||
// attributes:
|
||||
// GroupID [eg ""]
|
||||
// Key [eg "nick"]
|
||||
// Data [eg "open privacy board"]
|
||||
SetGroupAttribute = Type("SetGroupAttribute")
|
||||
|
||||
// PeerStateChange servers as a new incoming connection message as well, and can/is consumed by frontends to alert of new p2p connections
|
||||
// RemotePeer
|
||||
// ConnectionState
|
||||
PeerStateChange = Type("PeerStateChange")
|
||||
|
||||
// GroupServer
|
||||
// ConnectionState
|
||||
ServerStateChange = Type("ServerStateChange")
|
||||
|
||||
/***** Application client / service messages *****/
|
||||
|
||||
// ProfileName, Password, Data(tag)
|
||||
CreatePeer = Type("CreatePeer")
|
||||
|
||||
// app: Identity(onion), Created(bool)
|
||||
// service -> client: Identity(localId), Password, [Status(new/default=blank || from reload='running')], Created(bool)
|
||||
NewPeer = Type("NewPeer")
|
||||
|
||||
// Identity(onion)
|
||||
DeletePeer = Type("DeletePeer")
|
||||
|
||||
// Identity(onion), Data(pluginID)
|
||||
AddPeerPlugin = Type("AddPeerPlugin")
|
||||
|
||||
// Password
|
||||
LoadProfiles = Type("LoadProfiles")
|
||||
|
||||
// Client has reloaded, triggers NewPeer s then ReloadDone
|
||||
ReloadClient = Type("ReloadClient")
|
||||
|
||||
ReloadDone = Type("ReloadDone")
|
||||
|
||||
// Identity - Ask service to resend all connection states
|
||||
ReloadPeer = Type("ReloadPeer")
|
||||
|
||||
// Identity(onion)
|
||||
ShutdownPeer = Type("ShutdownPeer")
|
||||
|
||||
Shutdown = Type("Shutdown")
|
||||
|
||||
// Error(err)
|
||||
// Error creating peer
|
||||
PeerError = Type("PeerError")
|
||||
|
||||
// Error(err)
|
||||
AppError = Type("AppError")
|
||||
|
||||
GetACNStatus = Type("GetACNStatus")
|
||||
GetACNVersion = Type("GetACNVersion")
|
||||
|
||||
// Progress, Status
|
||||
ACNStatus = Type("ACNStatus")
|
||||
|
||||
// Data
|
||||
ACNVersion = Type("ACNVersion")
|
||||
|
||||
// Network Status
|
||||
// Status: Success || Error
|
||||
// Error: Description of the Error
|
||||
// Onion: the local onion we attempt to check
|
||||
NetworkStatus = Type("NetworkError")
|
||||
|
||||
// Notify the UI that a Server has been added
|
||||
// Onion = Server Onion
|
||||
ServerCreated = Type("ServerAdded")
|
||||
|
||||
// For debugging. Allows test to emit a Syn and get a response Ack(eventID) when the subsystem is done processing a queue
|
||||
Syn = Type("Syn")
|
||||
Ack = Type("Ack")
|
||||
)
|
||||
|
||||
// Field defines common event attributes
|
||||
type Field string
|
||||
|
||||
// Defining Common Field Types
|
||||
const (
|
||||
|
||||
// A peers local onion address
|
||||
Onion = Field("Onion")
|
||||
|
||||
RemotePeer = Field("RemotePeer")
|
||||
Ciphertext = Field("Ciphertext")
|
||||
Signature = Field("Signature")
|
||||
PreviousSignature = Field("PreviousSignature")
|
||||
TimestampSent = Field("TimestampSent")
|
||||
TimestampReceived = Field("TimestampReceived")
|
||||
|
||||
Identity = Field("Identity")
|
||||
|
||||
GroupID = Field("GroupID")
|
||||
GroupServer = Field("GroupServer")
|
||||
ServerTokenY = Field("ServerTokenY")
|
||||
ServerTokenOnion = Field("ServerTokenOnion")
|
||||
GroupInvite = Field("GroupInvite")
|
||||
|
||||
ProfileName = Field("ProfileName")
|
||||
Password = Field("Password")
|
||||
NewPassword = Field("NewPassword")
|
||||
|
||||
Created = Field("Created")
|
||||
|
||||
ConnectionState = Field("ConnectionState")
|
||||
|
||||
Key = Field("Key")
|
||||
Data = Field("Data")
|
||||
Scope = Field("Scope")
|
||||
Path = Field("Path")
|
||||
Exists = Field("Exists")
|
||||
|
||||
Salt = Field("Salt")
|
||||
|
||||
Error = Field("Error")
|
||||
|
||||
Progress = Field("Progress")
|
||||
Status = Field("Status")
|
||||
EventID = Field("EventID")
|
||||
EventContext = Field("EventContext")
|
||||
Index = Field("Index")
|
||||
|
||||
// Handle denotes a contact handle of any type.
|
||||
Handle = Field("Handle")
|
||||
|
||||
// Flags denotes a set of message flags
|
||||
Flags = Field("Flags")
|
||||
|
||||
Authorization = Field("Authorization")
|
||||
|
||||
KeyBundle = Field("KeyBundle")
|
||||
|
||||
// Indicate whether an event was triggered by a user import
|
||||
Imported = Field("Imported")
|
||||
|
||||
Source = Field("Source")
|
||||
)
|
||||
|
||||
// Defining Common errors
|
||||
const (
|
||||
AppErrLoaded0 = "Loaded 0 profiles"
|
||||
)
|
||||
|
||||
// Values to be suplied in event.NewPeer for Status
|
||||
const (
|
||||
StorageRunning = "running"
|
||||
StorageNew = "new"
|
||||
)
|
||||
|
||||
// Defining Protocol Contexts
|
||||
const (
|
||||
ContextAck = "im.cwtch.acknowledgement"
|
||||
ContextInvite = "im.cwtch.invite"
|
||||
ContextRaw = "im.cwtch.raw"
|
||||
ContextGetVal = "im.cwtch.getVal"
|
||||
ContextRetVal = "im.cwtch.retVal"
|
||||
)
|
||||
|
||||
// Define Default Attribute Keys
|
||||
const (
|
||||
SaveHistoryKey = "SavePeerHistory"
|
||||
)
|
||||
|
||||
// Define Default Attribute Values
|
||||
const (
|
||||
// Save History has 3 distinct states. By default we don't save history (DefaultDeleteHistory), if the peer confirms this
|
||||
// we change to DeleteHistoryConfirmed, if they confirm they want to save then this becomes SaveHistoryConfirmed
|
||||
// We use this distinction between default and confirmed to drive UI
|
||||
DeleteHistoryDefault = "DefaultDeleteHistory"
|
||||
SaveHistoryConfirmed = "SaveHistory"
|
||||
DeleteHistoryConfirmed = "DeleteHistoryConfirmed"
|
||||
)
|
||||
|
||||
// Bool strings
|
||||
const (
|
||||
True = "true"
|
||||
False = "false"
|
||||
)
|
|
@ -1,112 +0,0 @@
|
|||
package event
|
||||
|
||||
import (
|
||||
"sync"
|
||||
)
|
||||
|
||||
type queue struct {
|
||||
infChan infiniteChannel
|
||||
lock sync.Mutex
|
||||
closed bool
|
||||
}
|
||||
|
||||
type simpleQueue struct {
|
||||
eventChannel chan Event
|
||||
lock sync.Mutex
|
||||
closed bool
|
||||
}
|
||||
|
||||
// Queue is a wrapper around a channel for handling Events in a consistent way across subsystems.
|
||||
// The expectation is that each subsystem in Cwtch will manage a given an event.Queue fed from
|
||||
// the event.Manager.
|
||||
type Queue interface {
|
||||
Publish(event Event)
|
||||
Next() Event
|
||||
Shutdown()
|
||||
OutChan() <-chan Event
|
||||
Len() int
|
||||
}
|
||||
|
||||
// NewQueue initializes an event.Queue
|
||||
func NewQueue() Queue {
|
||||
queue := &queue{infChan: *newInfiniteChannel()}
|
||||
return queue
|
||||
}
|
||||
|
||||
// NewSimpleQueue initializes an event.Queue of the given buffer size.
|
||||
func NewSimpleQueue(buffer int) Queue {
|
||||
queue := new(simpleQueue)
|
||||
queue.eventChannel = make(chan Event, buffer)
|
||||
return queue
|
||||
}
|
||||
|
||||
func (sq *simpleQueue) inChan() chan<- Event {
|
||||
return sq.eventChannel
|
||||
}
|
||||
|
||||
func (sq *simpleQueue) OutChan() <-chan Event {
|
||||
return sq.eventChannel
|
||||
}
|
||||
|
||||
// Backlog returns the length of the queue backlog
|
||||
func (sq *simpleQueue) Len() int {
|
||||
return len(sq.eventChannel)
|
||||
}
|
||||
|
||||
// Next returns the next available event from the front of the queue
|
||||
func (sq *simpleQueue) Next() Event {
|
||||
event := <-sq.eventChannel
|
||||
return event
|
||||
}
|
||||
|
||||
// Shutdown closes our eventChannel
|
||||
func (sq *simpleQueue) Shutdown() {
|
||||
sq.lock.Lock()
|
||||
sq.closed = true
|
||||
close(sq.eventChannel)
|
||||
sq.lock.Unlock()
|
||||
}
|
||||
|
||||
// Shutdown closes our eventChannel
|
||||
func (sq *simpleQueue) Publish(event Event) {
|
||||
sq.lock.Lock()
|
||||
if !sq.closed {
|
||||
sq.inChan() <- event
|
||||
}
|
||||
sq.lock.Unlock()
|
||||
}
|
||||
|
||||
func (iq *queue) inChan() chan<- Event {
|
||||
return iq.infChan.In()
|
||||
}
|
||||
|
||||
func (iq *queue) OutChan() <-chan Event {
|
||||
return iq.infChan.Out()
|
||||
}
|
||||
|
||||
// Out returns the next available event from the front of the queue
|
||||
func (iq *queue) Next() Event {
|
||||
event := <-iq.infChan.Out()
|
||||
return event
|
||||
}
|
||||
|
||||
func (iq *queue) Len() int {
|
||||
return iq.infChan.Len()
|
||||
}
|
||||
|
||||
// Shutdown closes our eventChannel
|
||||
func (iq *queue) Shutdown() {
|
||||
iq.lock.Lock()
|
||||
iq.closed = true
|
||||
iq.infChan.Close()
|
||||
iq.lock.Unlock()
|
||||
|
||||
}
|
||||
|
||||
func (iq *queue) Publish(event Event) {
|
||||
iq.lock.Lock()
|
||||
if !iq.closed {
|
||||
iq.inChan() <- event
|
||||
}
|
||||
iq.lock.Unlock()
|
||||
}
|
|
@ -1,175 +0,0 @@
|
|||
package event
|
||||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"math"
|
||||
"math/big"
|
||||
"os"
|
||||
"runtime"
|
||||
"strings"
|
||||
"sync"
|
||||
)
|
||||
|
||||
// Event is the core struct type passed around between various subsystems. Events consist of a type which can be
|
||||
// filtered on, an event ID for tracing and a map of Fields to string values.
|
||||
type Event struct {
|
||||
EventType Type
|
||||
EventID string
|
||||
Data map[Field]string
|
||||
}
|
||||
|
||||
// GetRandNumber is a helper function which returns a random integer, this is
|
||||
// currently mostly used to generate messageids
|
||||
func GetRandNumber() *big.Int {
|
||||
num, err := rand.Int(rand.Reader, big.NewInt(math.MaxUint32))
|
||||
// If we can't generate random numbers then panicking is probably
|
||||
// the best option.
|
||||
if err != nil {
|
||||
panic(err.Error())
|
||||
}
|
||||
return num
|
||||
}
|
||||
|
||||
// NewEvent creates a new event object with a unique ID and the given type and data.
|
||||
func NewEvent(eventType Type, data map[Field]string) Event {
|
||||
return Event{EventType: eventType, EventID: GetRandNumber().String(), Data: data}
|
||||
}
|
||||
|
||||
// NewEventList creates a new event object with a unique ID and the given type and data supplied in a list format and composed into a map of Type:string
|
||||
func NewEventList(eventType Type, args ...interface{}) Event {
|
||||
data := map[Field]string{}
|
||||
for i := 0; i < len(args); i += 2 {
|
||||
key, kok := args[i].(Field)
|
||||
val, vok := args[i+1].(string)
|
||||
if kok && vok {
|
||||
data[key] = val
|
||||
}
|
||||
}
|
||||
return Event{EventType: eventType, EventID: GetRandNumber().String(), Data: data}
|
||||
}
|
||||
|
||||
// Manager is an Event Bus which allows subsystems to subscribe to certain EventTypes and publish others.
|
||||
type manager struct {
|
||||
subscribers map[Type][]Queue
|
||||
events chan []byte
|
||||
mapMutex sync.Mutex
|
||||
internal chan bool
|
||||
closed bool
|
||||
trace bool
|
||||
}
|
||||
|
||||
// Manager is an interface for an event bus
|
||||
// FIXME this interface lends itself to race conditions around channels
|
||||
type Manager interface {
|
||||
Subscribe(Type, Queue)
|
||||
Publish(Event)
|
||||
PublishLocal(Event)
|
||||
Shutdown()
|
||||
}
|
||||
|
||||
// NewEventManager returns an initialized EventManager
|
||||
func NewEventManager() Manager {
|
||||
em := &manager{}
|
||||
em.initialize()
|
||||
return em
|
||||
}
|
||||
|
||||
// Initialize sets up the Manager.
|
||||
func (em *manager) initialize() {
|
||||
em.subscribers = make(map[Type][]Queue)
|
||||
em.events = make(chan []byte)
|
||||
em.internal = make(chan bool)
|
||||
em.closed = false
|
||||
|
||||
_, em.trace = os.LookupEnv("CWTCH_EVENT_SOURCE")
|
||||
|
||||
go em.eventBus()
|
||||
}
|
||||
|
||||
// Subscribe takes an eventType and an Channel and associates them in the eventBus. All future events of that type
|
||||
// will be sent to the eventChannel.
|
||||
func (em *manager) Subscribe(eventType Type, queue Queue) {
|
||||
em.mapMutex.Lock()
|
||||
defer em.mapMutex.Unlock()
|
||||
em.subscribers[eventType] = append(em.subscribers[eventType], queue)
|
||||
}
|
||||
|
||||
// Publish takes an Event and sends it to the internal eventBus where it is distributed to all Subscribers
|
||||
func (em *manager) Publish(event Event) {
|
||||
if event.EventType != "" && !em.closed {
|
||||
|
||||
// Debug Events for Tracing, locked behind an environment variable
|
||||
// for now.
|
||||
if em.trace {
|
||||
pc, _, _, _ := runtime.Caller(1)
|
||||
funcName := runtime.FuncForPC(pc).Name()
|
||||
lastSlash := strings.LastIndexByte(funcName, '/')
|
||||
if lastSlash < 0 {
|
||||
lastSlash = 0
|
||||
}
|
||||
lastDot := strings.LastIndexByte(funcName[lastSlash:], '.') + lastSlash
|
||||
event.Data[Source] = fmt.Sprintf("%v.%v", funcName[:lastDot], funcName[lastDot+1:])
|
||||
}
|
||||
|
||||
// Deep Copy the Event...
|
||||
eventJSON, err := json.Marshal(event)
|
||||
if err != nil {
|
||||
log.Errorf("Error serializing event: %v", event)
|
||||
}
|
||||
em.events <- eventJSON
|
||||
}
|
||||
}
|
||||
|
||||
// Publish an event only locally, not going over an IPC bridge if there is one
|
||||
func (em *manager) PublishLocal(event Event) {
|
||||
em.Publish(event)
|
||||
}
|
||||
|
||||
// eventBus is an internal function that is used to distribute events to all subscribers
|
||||
func (em *manager) eventBus() {
|
||||
for {
|
||||
eventJSON := <-em.events
|
||||
|
||||
// In the case on an empty event. Teardown the Queue
|
||||
if len(eventJSON) == 0 {
|
||||
log.Errorf("Received zero length event")
|
||||
break
|
||||
}
|
||||
|
||||
var event Event
|
||||
err := json.Unmarshal(eventJSON, &event)
|
||||
|
||||
if err != nil {
|
||||
log.Errorf("Error on Deep Copy: %v %v", eventJSON, err)
|
||||
}
|
||||
|
||||
// maps aren't thread safe
|
||||
em.mapMutex.Lock()
|
||||
subscribers := em.subscribers[event.EventType]
|
||||
em.mapMutex.Unlock()
|
||||
|
||||
// Send the event to any subscribers to that event type
|
||||
for _, subscriber := range subscribers {
|
||||
// Deep Copy for Each Subscriber
|
||||
var eventCopy Event
|
||||
json.Unmarshal(eventJSON, &eventCopy)
|
||||
subscriber.Publish(eventCopy)
|
||||
}
|
||||
}
|
||||
|
||||
// We are about to exit the eventbus thread, fire off an event internally
|
||||
em.internal <- true
|
||||
}
|
||||
|
||||
// Shutdown triggers, and waits for, the internal eventBus goroutine to finish
|
||||
func (em *manager) Shutdown() {
|
||||
em.events <- []byte{}
|
||||
em.closed = true
|
||||
// wait for eventBus to finish
|
||||
<-em.internal
|
||||
close(em.events)
|
||||
close(em.internal)
|
||||
}
|
|
@ -1,104 +0,0 @@
|
|||
package event
|
||||
|
||||
import (
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"sync"
|
||||
"testing"
|
||||
"time"
|
||||
)
|
||||
|
||||
// Most basic Manager Test, Initialize, Subscribe, Publish, Receive
|
||||
func TestEventManager(t *testing.T) {
|
||||
eventManager := NewEventManager()
|
||||
|
||||
// We need to make this buffer at least 1, otherwise we will log an error!
|
||||
testChan := make(chan Event, 1)
|
||||
simpleQueue := &simpleQueue{testChan, sync.Mutex{}, false}
|
||||
eventManager.Subscribe("TEST", simpleQueue)
|
||||
eventManager.Publish(Event{EventType: "TEST", Data: map[Field]string{"Value": "Hello World"}})
|
||||
|
||||
event := <-testChan
|
||||
if event.EventType == "TEST" && event.Data["Value"] == "Hello World" {
|
||||
|
||||
} else {
|
||||
t.Errorf("Received Invalid Event")
|
||||
}
|
||||
|
||||
eventManager.Shutdown()
|
||||
}
|
||||
|
||||
// Most basic Manager Test, Initialize, Subscribe, Publish, Receive
|
||||
func TestEventManagerOverflow(t *testing.T) {
|
||||
eventManager := NewEventManager()
|
||||
|
||||
// Explicitly setting this to 0 log an error!
|
||||
testChan := make(chan Event)
|
||||
simpleQueue := &simpleQueue{testChan, sync.Mutex{}, false}
|
||||
eventManager.Subscribe("TEST", simpleQueue)
|
||||
eventManager.Publish(Event{EventType: "TEST"})
|
||||
}
|
||||
|
||||
func TestEventManagerMultiple(t *testing.T) {
|
||||
log.SetLevel(log.LevelDebug)
|
||||
eventManager := NewEventManager()
|
||||
|
||||
groupEventQueue := NewQueue()
|
||||
peerEventQueue := NewQueue()
|
||||
allEventQueue := NewQueue()
|
||||
|
||||
eventManager.Subscribe("PeerEvent", peerEventQueue)
|
||||
eventManager.Subscribe("GroupEvent", groupEventQueue)
|
||||
eventManager.Subscribe("PeerEvent", allEventQueue)
|
||||
eventManager.Subscribe("GroupEvent", allEventQueue)
|
||||
eventManager.Subscribe("ErrorEvent", allEventQueue)
|
||||
|
||||
eventManager.Publish(Event{EventType: "PeerEvent", Data: map[Field]string{"Value": "Hello World Peer"}})
|
||||
eventManager.Publish(Event{EventType: "GroupEvent", Data: map[Field]string{"Value": "Hello World Group"}})
|
||||
eventManager.Publish(Event{EventType: "PeerEvent", Data: map[Field]string{"Value": "Hello World Peer"}})
|
||||
eventManager.Publish(Event{EventType: "ErrorEvent", Data: map[Field]string{"Value": "Hello World Error"}})
|
||||
eventManager.Publish(Event{EventType: "NobodyIsSubscribedToThisEvent", Data: map[Field]string{"Value": "Noone should see this!"}})
|
||||
|
||||
assertLength := func(len int, expected int, label string) {
|
||||
if len != expected {
|
||||
t.Errorf("Expected %s to be %v was %v", label, expected, len)
|
||||
}
|
||||
}
|
||||
|
||||
time.Sleep(time.Second)
|
||||
|
||||
assertLength(groupEventQueue.Len(), 1, "Group Event Queue Length")
|
||||
assertLength(peerEventQueue.Len(), 2, "Peer Event Queue Length")
|
||||
assertLength(allEventQueue.Len(), 4, "All Event Queue Length")
|
||||
|
||||
checkEvent := func(eventType Type, expected Type, label string) {
|
||||
if eventType != expected {
|
||||
t.Errorf("Expected %s to be %v was %v", label, expected, eventType)
|
||||
}
|
||||
}
|
||||
|
||||
event := groupEventQueue.Next()
|
||||
checkEvent(event.EventType, "GroupEvent", "First Group Event")
|
||||
|
||||
event = peerEventQueue.Next()
|
||||
checkEvent(event.EventType, "PeerEvent", "First Peer Event")
|
||||
event = peerEventQueue.Next()
|
||||
checkEvent(event.EventType, "PeerEvent", "Second Peer Event")
|
||||
|
||||
event = allEventQueue.Next()
|
||||
checkEvent(event.EventType, "PeerEvent", "ALL: First Peer Event")
|
||||
event = allEventQueue.Next()
|
||||
checkEvent(event.EventType, "GroupEvent", "ALL: First Group Event")
|
||||
event = allEventQueue.Next()
|
||||
checkEvent(event.EventType, "PeerEvent", "ALL: Second Peer Event")
|
||||
event = allEventQueue.Next()
|
||||
checkEvent(event.EventType, "ErrorEvent", "ALL: First Error Event")
|
||||
|
||||
eventManager.Shutdown()
|
||||
groupEventQueue.Shutdown()
|
||||
peerEventQueue.Shutdown()
|
||||
allEventQueue.Shutdown()
|
||||
|
||||
// Reading from a closed queue should result in an instant return and an empty event
|
||||
event = groupEventQueue.Next()
|
||||
checkEvent(event.EventType, "", "Test Next() on Empty Queue")
|
||||
}
|
|
@ -1,38 +0,0 @@
|
|||
package event
|
||||
|
||||
type ipcManager struct {
|
||||
manager Manager
|
||||
|
||||
onion string
|
||||
ipcBridge IPCBridge
|
||||
}
|
||||
|
||||
// NewIPCEventManager returns an EvenetManager that also pipes events over and supplied IPCBridge
|
||||
func NewIPCEventManager(bridge IPCBridge, onion string) Manager {
|
||||
em := &ipcManager{onion: onion, ipcBridge: bridge, manager: NewEventManager()}
|
||||
return em
|
||||
}
|
||||
|
||||
// IPCEventManagerFrom returns an IPCEventManger from the supplied manager and IPCBridge
|
||||
func IPCEventManagerFrom(bridge IPCBridge, onion string, manager Manager) Manager {
|
||||
em := &ipcManager{onion: onion, ipcBridge: bridge, manager: manager}
|
||||
return em
|
||||
}
|
||||
|
||||
func (ipcm *ipcManager) Publish(ev Event) {
|
||||
ipcm.manager.Publish(ev)
|
||||
message := &IPCMessage{Dest: ipcm.onion, Message: ev}
|
||||
ipcm.ipcBridge.Write(message)
|
||||
}
|
||||
|
||||
func (ipcm *ipcManager) PublishLocal(ev Event) {
|
||||
ipcm.manager.Publish(ev)
|
||||
}
|
||||
|
||||
func (ipcm *ipcManager) Subscribe(eventType Type, queue Queue) {
|
||||
ipcm.manager.Subscribe(eventType, queue)
|
||||
}
|
||||
|
||||
func (ipcm *ipcManager) Shutdown() {
|
||||
ipcm.manager.Shutdown()
|
||||
}
|
|
@ -1,72 +0,0 @@
|
|||
package event
|
||||
|
||||
/*
|
||||
This package is taken from https://github.com/eapache/channels
|
||||
as per their suggestion we are not importing the entire package and instead cherry picking and adapting what is needed
|
||||
|
||||
It is covered by the MIT License https://github.com/eapache/channels/blob/master/LICENSE
|
||||
*/
|
||||
|
||||
// infiniteChannel implements the Channel interface with an infinite buffer between the input and the output.
|
||||
type infiniteChannel struct {
|
||||
input, output chan Event
|
||||
length chan int
|
||||
buffer *infiniteQueue
|
||||
}
|
||||
|
||||
func newInfiniteChannel() *infiniteChannel {
|
||||
ch := &infiniteChannel{
|
||||
input: make(chan Event),
|
||||
output: make(chan Event),
|
||||
length: make(chan int),
|
||||
buffer: newInfinitQueue(),
|
||||
}
|
||||
go ch.infiniteBuffer()
|
||||
return ch
|
||||
}
|
||||
func (ch *infiniteChannel) In() chan<- Event {
|
||||
return ch.input
|
||||
}
|
||||
|
||||
func (ch *infiniteChannel) Out() <-chan Event {
|
||||
return ch.output
|
||||
}
|
||||
|
||||
func (ch *infiniteChannel) Len() int {
|
||||
return <-ch.length
|
||||
}
|
||||
|
||||
func (ch *infiniteChannel) Close() {
|
||||
close(ch.input)
|
||||
}
|
||||
|
||||
func (ch *infiniteChannel) infiniteBuffer() {
|
||||
var input, output chan Event
|
||||
var next Event
|
||||
input = ch.input
|
||||
|
||||
for input != nil || output != nil {
|
||||
select {
|
||||
case elem, open := <-input:
|
||||
if open {
|
||||
ch.buffer.Add(elem)
|
||||
} else {
|
||||
input = nil
|
||||
}
|
||||
case output <- next:
|
||||
ch.buffer.Remove()
|
||||
case ch.length <- ch.buffer.Length():
|
||||
}
|
||||
|
||||
if ch.buffer.Length() > 0 {
|
||||
output = ch.output
|
||||
next = ch.buffer.Peek()
|
||||
} else {
|
||||
output = nil
|
||||
//next = nil
|
||||
}
|
||||
}
|
||||
|
||||
close(ch.output)
|
||||
close(ch.length)
|
||||
}
|
|
@ -1,108 +0,0 @@
|
|||
package event
|
||||
|
||||
/*
|
||||
This package is taken from https://github.com/eapache/channels
|
||||
as per their suggestion we are not importing the entire package and instead cherry picking and adapting what is needed
|
||||
|
||||
It is covered by the MIT License https://github.com/eapache/channels/blob/master/LICENSE
|
||||
*/
|
||||
/*
|
||||
Package queue provides a fast, ring-buffer queue based on the version suggested by Dariusz Górecki.
|
||||
Using this instead of other, simpler, queue implementations (slice+append or linked list) provides
|
||||
substantial memory and time benefits, and fewer GC pauses.
|
||||
The queue implemented here is as fast as it is for an additional reason: it is *not* thread-safe.
|
||||
*/
|
||||
|
||||
// minQueueLen is smallest capacity that queue may have.
|
||||
// Must be power of 2 for bitwise modulus: x % n == x & (n - 1).
|
||||
const minQueueLen = 16
|
||||
|
||||
// Queue represents a single instance of the queue data structure.
|
||||
type infiniteQueue struct {
|
||||
buf []Event
|
||||
head, tail, count int
|
||||
}
|
||||
|
||||
// New constructs and returns a new Queue.
|
||||
func newInfinitQueue() *infiniteQueue {
|
||||
return &infiniteQueue{
|
||||
buf: make([]Event, minQueueLen),
|
||||
}
|
||||
}
|
||||
|
||||
// Length returns the number of elements currently stored in the queue.
|
||||
func (q *infiniteQueue) Length() int {
|
||||
return q.count
|
||||
}
|
||||
|
||||
// resizes the queue to fit exactly twice its current contents
|
||||
// this can result in shrinking if the queue is less than half-full
|
||||
func (q *infiniteQueue) resize() {
|
||||
newBuf := make([]Event, q.count<<1)
|
||||
|
||||
if q.tail > q.head {
|
||||
copy(newBuf, q.buf[q.head:q.tail])
|
||||
} else {
|
||||
n := copy(newBuf, q.buf[q.head:])
|
||||
copy(newBuf[n:], q.buf[:q.tail])
|
||||
}
|
||||
|
||||
q.head = 0
|
||||
q.tail = q.count
|
||||
q.buf = newBuf
|
||||
}
|
||||
|
||||
// Add puts an element on the end of the queue.
|
||||
func (q *infiniteQueue) Add(elem Event) {
|
||||
if q.count == len(q.buf) {
|
||||
q.resize()
|
||||
}
|
||||
|
||||
q.buf[q.tail] = elem
|
||||
// bitwise modulus
|
||||
q.tail = (q.tail + 1) & (len(q.buf) - 1)
|
||||
q.count++
|
||||
}
|
||||
|
||||
// Peek returns the element at the head of the queue. This call panics
|
||||
// if the queue is empty.
|
||||
func (q *infiniteQueue) Peek() Event {
|
||||
if q.count <= 0 {
|
||||
panic("queue: Peek() called on empty queue")
|
||||
}
|
||||
return q.buf[q.head]
|
||||
}
|
||||
|
||||
// Get returns the element at index i in the queue. If the index is
|
||||
// invalid, the call will panic. This method accepts both positive and
|
||||
// negative index values. Index 0 refers to the first element, and
|
||||
// index -1 refers to the last.
|
||||
func (q *infiniteQueue) Get(i int) Event {
|
||||
// If indexing backwards, convert to positive index.
|
||||
if i < 0 {
|
||||
i += q.count
|
||||
}
|
||||
if i < 0 || i >= q.count {
|
||||
panic("queue: Get() called with index out of range")
|
||||
}
|
||||
// bitwise modulus
|
||||
return q.buf[(q.head+i)&(len(q.buf)-1)]
|
||||
}
|
||||
|
||||
// Remove removes and returns the element from the front of the queue. If the
|
||||
// queue is empty, the call will panic.
|
||||
func (q *infiniteQueue) Remove() Event {
|
||||
if q.count <= 0 {
|
||||
panic("queue: Remove() called on empty queue")
|
||||
}
|
||||
ret := q.buf[q.head]
|
||||
//q.buf[q.head] = nil
|
||||
// bitwise modulus
|
||||
q.head = (q.head + 1) & (len(q.buf) - 1)
|
||||
q.count--
|
||||
// Resize down if buffer 1/4 full.
|
||||
if len(q.buf) > minQueueLen && (q.count<<2) == len(q.buf) {
|
||||
q.resize()
|
||||
}
|
||||
return ret
|
||||
}
|
14
event/ipc.go
14
event/ipc.go
|
@ -1,14 +0,0 @@
|
|||
package event
|
||||
|
||||
// IPCMessage is a wrapper for a regular eventMessage with a destination (onion|AppDest) so the other side of the bridge can route appropriately
|
||||
type IPCMessage struct {
|
||||
Dest string
|
||||
Message Event
|
||||
}
|
||||
|
||||
// IPCBridge is an interface to a IPC construct used to communicate IPCMessages
|
||||
type IPCBridge interface {
|
||||
Read() (*IPCMessage, bool)
|
||||
Write(message *IPCMessage)
|
||||
Shutdown()
|
||||
}
|
17
go.mod
17
go.mod
|
@ -1,17 +0,0 @@
|
|||
module cwtch.im/cwtch
|
||||
|
||||
go 1.14
|
||||
|
||||
require (
|
||||
git.openprivacy.ca/cwtch.im/tapir v0.4.3
|
||||
git.openprivacy.ca/openprivacy/connectivity v1.4.4
|
||||
git.openprivacy.ca/openprivacy/log v1.0.2
|
||||
github.com/gtank/ristretto255 v0.1.2
|
||||
github.com/niemeyer/pretty v0.0.0-20200227124842-a10e7caefd8e // indirect
|
||||
github.com/struCoder/pidusage v0.1.3
|
||||
golang.org/x/crypto v0.0.0-20201012173705-84dcc777aaee
|
||||
golang.org/x/lint v0.0.0-20210508222113-6edffad5e616 // indirect
|
||||
golang.org/x/net v0.0.0-20210405180319-a5a99cb37ef4
|
||||
golang.org/x/tools v0.1.2 // indirect
|
||||
gopkg.in/check.v1 v1.0.0-20200227125254-8fa46927fb4f // indirect
|
||||
)
|
110
go.sum
110
go.sum
|
@ -1,110 +0,0 @@
|
|||
git.openprivacy.ca/cwtch.im/tapir v0.3.1 h1:+d1dHyPvZ8JmdfFe/oXWJPardzflRIhcdILtkeArkW8=
|
||||
git.openprivacy.ca/cwtch.im/tapir v0.3.1/go.mod h1:q6RMI/TQvRN8SCtRY3GryOawMcB0uG6NjP6M77oSMx8=
|
||||
git.openprivacy.ca/cwtch.im/tapir v0.3.2 h1:thLWqqY1LkirWFcy9Tg6NgWeYbvo9xBm+s2XVnCIvpY=
|
||||
git.openprivacy.ca/cwtch.im/tapir v0.3.2/go.mod h1:q6RMI/TQvRN8SCtRY3GryOawMcB0uG6NjP6M77oSMx8=
|
||||
git.openprivacy.ca/cwtch.im/tapir v0.3.3 h1:Q7F8JijgOMMYSy3IdZl7+r6qkWckEWV1+EY7q6MAkVs=
|
||||
git.openprivacy.ca/cwtch.im/tapir v0.3.3/go.mod h1:ZMg9Jzh0n3Os2aSF4z+bx/n8WBCJBN7KCQESXperYts=
|
||||
git.openprivacy.ca/cwtch.im/tapir v0.3.4 h1:g7yZkfz/vWr/t2tFXa/t0Ebr/w665uIKpxpCZ3lIPCo=
|
||||
git.openprivacy.ca/cwtch.im/tapir v0.3.4/go.mod h1:+Niy2AHhQC351ZTtfhC0uLjViCICyOxCJZsIlGKKNAU=
|
||||
git.openprivacy.ca/cwtch.im/tapir v0.3.5 h1:AlqAhluY4ivznGoHh37Khyxy0u9IbtYskP93wgtmYx8=
|
||||
git.openprivacy.ca/cwtch.im/tapir v0.3.5/go.mod h1:eH6dZxXrhW0C4KZX18ksUa6XJCrEvtg8cJJ/Fy6gv+E=
|
||||
git.openprivacy.ca/cwtch.im/tapir v0.4.0 h1:clG8uORt0NKEhT4P+Dpw1pzyUuYzYBMevGqn2pciKk8=
|
||||
git.openprivacy.ca/cwtch.im/tapir v0.4.0/go.mod h1:eH6dZxXrhW0C4KZX18ksUa6XJCrEvtg8cJJ/Fy6gv+E=
|
||||
git.openprivacy.ca/cwtch.im/tapir v0.4.1 h1:9LMpQX41IzecNNlRc1FZKXHg6wlFss679tFsa3vzb3Y=
|
||||
git.openprivacy.ca/cwtch.im/tapir v0.4.1/go.mod h1:eH6dZxXrhW0C4KZX18ksUa6XJCrEvtg8cJJ/Fy6gv+E=
|
||||
git.openprivacy.ca/cwtch.im/tapir v0.4.2 h1:bxMWZnVJXX4dqqOFS7ELW4iFkVL4GS8wiRkjRv5rJe8=
|
||||
git.openprivacy.ca/cwtch.im/tapir v0.4.2/go.mod h1:eH6dZxXrhW0C4KZX18ksUa6XJCrEvtg8cJJ/Fy6gv+E=
|
||||
git.openprivacy.ca/cwtch.im/tapir v0.4.3 h1:sctSfUXHDIqaHfJPDl+5lHtmoEJolQiHTcHZGAe5Qc4=
|
||||
git.openprivacy.ca/cwtch.im/tapir v0.4.3/go.mod h1:10qEaib5x021zgyZ/97JKWsEpedH5+Vfy2CvB2V+08E=
|
||||
git.openprivacy.ca/openprivacy/bine v0.0.4 h1:CO7EkGyz+jegZ4ap8g5NWRuDHA/56KKvGySR6OBPW+c=
|
||||
git.openprivacy.ca/openprivacy/bine v0.0.4/go.mod h1:13ZqhKyqakDsN/ZkQkIGNULsmLyqtXc46XBcnuXm/mU=
|
||||
git.openprivacy.ca/openprivacy/connectivity v1.4.0 h1:c7AANUCrlA4hIqXxIGDOWMtSe8CpDleD1877PShScbM=
|
||||
git.openprivacy.ca/openprivacy/connectivity v1.4.0/go.mod h1:bR0Myx9nm2YzWtsThRelkNMV4Pp7sPDa123O1qsAbVo=
|
||||
git.openprivacy.ca/openprivacy/connectivity v1.4.1 h1:zoM+j7PFj8mQeUCNiDNMe7Uq9dhcJDOhaZcSANfeDL4=
|
||||
git.openprivacy.ca/openprivacy/connectivity v1.4.1/go.mod h1:bR0Myx9nm2YzWtsThRelkNMV4Pp7sPDa123O1qsAbVo=
|
||||
git.openprivacy.ca/openprivacy/connectivity v1.4.2 h1:rQFIjWunLlRmXL5Efsv+7+1cA70T6Uza6RCy2PRm9zc=
|
||||
git.openprivacy.ca/openprivacy/connectivity v1.4.2/go.mod h1:bR0Myx9nm2YzWtsThRelkNMV4Pp7sPDa123O1qsAbVo=
|
||||
git.openprivacy.ca/openprivacy/connectivity v1.4.3 h1:i2Ad/U9FlL9dKr2bhRck7lJ8NoWyGtoEfUwoCyMT0fU=
|
||||
git.openprivacy.ca/openprivacy/connectivity v1.4.3/go.mod h1:bR0Myx9nm2YzWtsThRelkNMV4Pp7sPDa123O1qsAbVo=
|
||||
git.openprivacy.ca/openprivacy/connectivity v1.4.4 h1:11M3akVCyy/luuhMpZTM1r9Jayl7IHD944Bxsn2FDpU=
|
||||
git.openprivacy.ca/openprivacy/connectivity v1.4.4/go.mod h1:JVRCIdL+lAG6ohBFWiKeC/MN42nnC0sfFszR9XG6vPQ=
|
||||
git.openprivacy.ca/openprivacy/log v1.0.1/go.mod h1:gGYK8xHtndRLDymFtmjkG26GaMQNgyhioNS82m812Iw=
|
||||
git.openprivacy.ca/openprivacy/log v1.0.2 h1:HLP4wsw4ljczFAelYnbObIs821z+jgMPCe8uODPnGQM=
|
||||
git.openprivacy.ca/openprivacy/log v1.0.2/go.mod h1:gGYK8xHtndRLDymFtmjkG26GaMQNgyhioNS82m812Iw=
|
||||
github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
||||
github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||
github.com/gtank/merlin v0.1.1 h1:eQ90iG7K9pOhtereWsmyRJ6RAwcP4tHTDBHXNg+u5is=
|
||||
github.com/gtank/merlin v0.1.1/go.mod h1:T86dnYJhcGOh5BjZFCJWTDeTK7XW8uE+E21Cy/bIQ+s=
|
||||
github.com/gtank/ristretto255 v0.1.2 h1:JEqUCPA1NvLq5DwYtuzigd7ss8fwbYay9fi4/5uMzcc=
|
||||
github.com/gtank/ristretto255 v0.1.2/go.mod h1:Ph5OpO6c7xKUGROZfWVLiJf9icMDwUeIvY4OmlYW69o=
|
||||
github.com/kr/pretty v0.2.0 h1:s5hAObm+yFO5uHYt5dYjxi2rXrsnmRpJx4OYvIWUaQs=
|
||||
github.com/kr/pretty v0.2.0/go.mod h1:ipq/a2n7PKx3OHsz4KJII5eveXtPO4qwEXGdVfWzfnI=
|
||||
github.com/kr/pty v1.1.1 h1:VkoXIwSboBpnk99O/KFauAEILuNHv5DVFKZMBN/gUgw=
|
||||
github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ=
|
||||
github.com/kr/text v0.1.0 h1:45sCR5RtlFHMR4UwH9sdQ5TC8v0qDQCHnXt+kaKSTVE=
|
||||
github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI=
|
||||
github.com/mimoo/StrobeGo v0.0.0-20181016162300-f8f6d4d2b643 h1:hLDRPB66XQT/8+wG9WsDpiCvZf1yKO7sz7scAjSlBa0=
|
||||
github.com/mimoo/StrobeGo v0.0.0-20181016162300-f8f6d4d2b643/go.mod h1:43+3pMjjKimDBf5Kr4ZFNGbLql1zKkbImw+fZbw3geM=
|
||||
github.com/niemeyer/pretty v0.0.0-20200227124842-a10e7caefd8e h1:fD57ERR4JtEqsWbfPhv4DMiApHyliiK5xCTNVSPiaAs=
|
||||
github.com/niemeyer/pretty v0.0.0-20200227124842-a10e7caefd8e/go.mod h1:zD1mROLANZcx1PVRCS0qkT7pwLkGfwJo4zjcN/Tysno=
|
||||
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
||||
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
||||
github.com/stretchr/objx v0.1.0 h1:4G4v2dO3VZwixGIRoQ5Lfboy6nUhCyYzaqnIAPPhYs4=
|
||||
github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
|
||||
github.com/stretchr/testify v1.6.1 h1:hDPOHmpOpP40lSULcqw7IrRb/u7w6RpDC9399XyoNd0=
|
||||
github.com/stretchr/testify v1.6.1/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg=
|
||||
github.com/struCoder/pidusage v0.1.3 h1:pZcSa6asBE38TJtW0Nui6GeCjLTpaT/jAnNP7dUTLSQ=
|
||||
github.com/struCoder/pidusage v0.1.3/go.mod h1:pWBlW3YuSwRl6h7R5KbvA4N8oOqe9LjaKW5CwT1SPjI=
|
||||
github.com/yuin/goldmark v1.3.5 h1:dPmz1Snjq0kmkz159iL7S6WzdahUTHnHB5M56WFVifs=
|
||||
github.com/yuin/goldmark v1.3.5/go.mod h1:mwnBkeHKe2W/ZEtQ+71ViKU8L12m81fl3OWwC1Zlc8k=
|
||||
go.etcd.io/bbolt v1.3.4 h1:hi1bXHMVrlQh6WwxAy+qZCV/SYIlqo+Ushwdpa4tAKg=
|
||||
go.etcd.io/bbolt v1.3.4/go.mod h1:G5EMThwa9y8QZGBClrRx5EY+Yw9kAhnjy3bSjsnlVTQ=
|
||||
golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w=
|
||||
golang.org/x/crypto v0.0.0-20191011191535-87dc89f01550/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI=
|
||||
golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
|
||||
golang.org/x/crypto v0.0.0-20201012173705-84dcc777aaee h1:4yd7jl+vXjalO5ztz6Vc1VADv+S/80LGJmyl1ROJ2AI=
|
||||
golang.org/x/crypto v0.0.0-20201012173705-84dcc777aaee/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
|
||||
golang.org/x/lint v0.0.0-20210508222113-6edffad5e616 h1:VLliZ0d+/avPrXXH+OakdXhpJuEoBZuwh1m2j7U6Iug=
|
||||
golang.org/x/lint v0.0.0-20210508222113-6edffad5e616/go.mod h1:3xt1FjdF8hUf6vQPIChWIBhFzV8gjjsPE/fR3IyQdNY=
|
||||
golang.org/x/mod v0.1.1-0.20191105210325-c90efee705ee/go.mod h1:QqPTAvyqsEbceGzBzNggFXnrqF1CaUcvgkdR5Ot7KZg=
|
||||
golang.org/x/mod v0.4.2 h1:Gz96sIWK3OalVv/I/qNygP42zyoKp3xptRVCWRFEBvo=
|
||||
golang.org/x/mod v0.4.2/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA=
|
||||
golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
|
||||
golang.org/x/net v0.0.0-20190620200207-3b0461eec859/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
|
||||
golang.org/x/net v0.0.0-20201010224723-4f7140c49acb/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU=
|
||||
golang.org/x/net v0.0.0-20210405180319-a5a99cb37ef4 h1:4nGaVu0QrbjT/AK2PRLuQfQuh6DJve+pELhqTdAj3x0=
|
||||
golang.org/x/net v0.0.0-20210405180319-a5a99cb37ef4/go.mod h1:p54w0d4576C0XHj96bSt6lcn1PtDYWL6XObtHCRCNQM=
|
||||
golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sync v0.0.0-20210220032951-036812b2e83c h1:5KslGYwFpkhGh+Q16bwMP3cOontH8FOep7tGV86Y7SQ=
|
||||
golang.org/x/sync v0.0.0-20210220032951-036812b2e83c/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||
golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||
golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20200202164722-d101bd2416d5/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20200930185726-fdedc70b468f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20201119102817-f84b799fce68/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20210330210617-4fbd30eecc44 h1:Bli41pIlzTzf3KEY06n+xnzK/BESIg2ze4Pgfh/aI8c=
|
||||
golang.org/x/sys v0.0.0-20210330210617-4fbd30eecc44/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||
golang.org/x/sys v0.0.0-20210510120138-977fb7262007 h1:gG67DSER+11cZvqIMb8S8bt0vZtiN6xWYARwirrOSfE=
|
||||
golang.org/x/sys v0.0.0-20210510120138-977fb7262007/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
|
||||
golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1 h1:v+OssWQX+hTHEmOBgwxdZxK4zHq3yOs8F9J7mk0PY8E=
|
||||
golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo=
|
||||
golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
|
||||
golang.org/x/text v0.3.3 h1:cokOdA+Jmi5PJGXLlLllQSgYigAEfHXJAERHVMaCc2k=
|
||||
golang.org/x/text v0.3.3/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
|
||||
golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e h1:FDhOuMEY4JVRztM/gsbk+IKUQ8kj74bxZrgw87eMMVc=
|
||||
golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||
golang.org/x/tools v0.0.0-20191119224855-298f0cb1881e/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
|
||||
golang.org/x/tools v0.0.0-20200130002326-2f3ba24bd6e7/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
|
||||
golang.org/x/tools v0.1.2 h1:kRBLX7v7Af8W7Gdbbc908OJcdgtK8bOz9Uaj8/F1ACA=
|
||||
golang.org/x/tools v0.1.2/go.mod h1:o0xws9oXOQQZyjljx8fwUC0k7L1pTE6eaCbjGeHmOkk=
|
||||
golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
|
||||
golang.org/x/xerrors v0.0.0-20191011141410-1b5146add898/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
|
||||
golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1 h1:go1bK/D/BFZV2I8cIQd1NKEZ+0owSTG1fDTci4IqFcE=
|
||||
golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
|
||||
gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
||||
gopkg.in/check.v1 v1.0.0-20190902080502-41f04d3bba15/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
||||
gopkg.in/check.v1 v1.0.0-20200227125254-8fa46927fb4f h1:BLraFXnmrev5lT+xlilqcH8XK9/i0At2xKjWk4p6zsU=
|
||||
gopkg.in/check.v1 v1.0.0-20200227125254-8fa46927fb4f/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
||||
gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c h1:dUUwHk2QECo/6vqA44rthZ8ie2QXMNeKRTHCNY2nXvo=
|
||||
gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
|
|
@ -1,60 +0,0 @@
|
|||
package attr
|
||||
|
||||
import (
|
||||
"strings"
|
||||
)
|
||||
|
||||
/*
|
||||
Scope model for peer attributes and requests
|
||||
|
||||
A local peer "Alice" has a PublicScope that is queryable by getVal requests.
|
||||
By default, for now, other scopes are private, of which we here define SettingsScope
|
||||
|
||||
Alice's peer structs of remote peers such as "Bob" keep the queried
|
||||
PublicScope values in the PeerScope, which can be overridden by the same named
|
||||
values stored in the LocalScope.
|
||||
|
||||
*/
|
||||
|
||||
// scopes for attributes
|
||||
const (
|
||||
// on a peer, local and peer supplied data
|
||||
LocalScope = "local"
|
||||
PeerScope = "peer"
|
||||
|
||||
// on a local profile, public data and private settings
|
||||
PublicScope = "public"
|
||||
SettingsScope = "settings"
|
||||
)
|
||||
|
||||
// Separator for scope and the rest of path
|
||||
const Separator = "."
|
||||
|
||||
// GetPublicScope takes a path and attaches the pubic scope to it
|
||||
func GetPublicScope(path string) string {
|
||||
return PublicScope + Separator + path
|
||||
}
|
||||
|
||||
// GetSettingsScope takes a path and attaches the settings scope to it
|
||||
func GetSettingsScope(path string) string {
|
||||
return SettingsScope + Separator + path
|
||||
}
|
||||
|
||||
// GetLocalScope takes a path and attaches the local scope to it
|
||||
func GetLocalScope(path string) string {
|
||||
return LocalScope + Separator + path
|
||||
}
|
||||
|
||||
// GetPeerScope takes a path and attaches the peer scope to it
|
||||
func GetPeerScope(path string) string {
|
||||
return PeerScope + Separator + path
|
||||
}
|
||||
|
||||
// GetScopePath take a full path and returns the scope and the scope-less path
|
||||
func GetScopePath(fullPath string) (string, string) {
|
||||
parts := strings.SplitN(fullPath, Separator, 1)
|
||||
if len(parts) != 2 {
|
||||
return "", ""
|
||||
}
|
||||
return parts[0], parts[1]
|
||||
}
|
|
@ -1,15 +0,0 @@
|
|||
package model
|
||||
|
||||
// Error models some common errors that need to be handled by applications that use Cwtch
|
||||
type Error string
|
||||
|
||||
// Error is the error interface
|
||||
func (e Error) Error() string {
|
||||
return string(e)
|
||||
}
|
||||
|
||||
// Error definitions
|
||||
const (
|
||||
InvalidEd25519PublicKey = Error("InvalidEd25519PublicKey")
|
||||
InconsistentKeyBundleError = Error("InconsistentKeyBundleError")
|
||||
)
|
273
model/group.go
273
model/group.go
|
@ -1,277 +1,154 @@
|
|||
package model
|
||||
|
||||
import (
|
||||
"crypto/ed25519"
|
||||
"crypto/rand"
|
||||
"crypto/sha512"
|
||||
"cwtch.im/cwtch/model/attr"
|
||||
"cwtch.im/cwtch/protocol/groups"
|
||||
"encoding/base32"
|
||||
"encoding/base64"
|
||||
"encoding/hex"
|
||||
"encoding/json"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"errors"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/openprivacy/connectivity/tor"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"golang.org/x/crypto/nacl/secretbox"
|
||||
"golang.org/x/crypto/pbkdf2"
|
||||
"io"
|
||||
"strings"
|
||||
"log"
|
||||
"sync"
|
||||
"time"
|
||||
)
|
||||
|
||||
// CurrentGroupVersion is used to set the version of newly created groups and make sure group structs stored are correct and up to date
|
||||
const CurrentGroupVersion = 3
|
||||
|
||||
// GroupInvitePrefix identifies a particular string as being a serialized group invite.
|
||||
const GroupInvitePrefix = "torv3"
|
||||
|
||||
// Group defines and encapsulates Cwtch's conception of group chat. Which are sessions
|
||||
// tied to a server under a given group key. Each group has a set of Messages.
|
||||
// tied to a server under a given group key. Each group has a set of messages.
|
||||
type Group struct {
|
||||
// GroupID is now derived from the GroupKey and the GroupServer
|
||||
GroupID string
|
||||
GroupKey [32]byte
|
||||
GroupServer string
|
||||
Timeline Timeline `json:"-"`
|
||||
Accepted bool
|
||||
IsCompromised bool
|
||||
Attributes map[string]string
|
||||
lock sync.Mutex
|
||||
LocalID string
|
||||
State string `json:"-"`
|
||||
UnacknowledgedMessages []Message
|
||||
Version int
|
||||
GroupID string
|
||||
SignedGroupID []byte
|
||||
GroupKey [32]byte
|
||||
GroupServer string
|
||||
Timeline Timeline
|
||||
Accepted bool
|
||||
Owner string
|
||||
IsCompromised bool
|
||||
InitialMessage []byte
|
||||
lock sync.Mutex
|
||||
NewMessage chan Message `json:"-"`
|
||||
}
|
||||
|
||||
// NewGroup initializes a new group associated with a given CwtchServer
|
||||
func NewGroup(server string) (*Group, error) {
|
||||
group := new(Group)
|
||||
group.Version = CurrentGroupVersion
|
||||
group.LocalID = GenerateRandomID()
|
||||
group.Accepted = true // we are starting a group, so we assume we want to connect to it...
|
||||
if !tor.IsValidHostname(server) {
|
||||
return nil, errors.New("server is not a valid v3 onion")
|
||||
}
|
||||
|
||||
group.GroupServer = server
|
||||
|
||||
var groupID [16]byte
|
||||
if _, err := io.ReadFull(rand.Reader, groupID[:]); err != nil {
|
||||
log.Errorf("Cannot read from random: %v\n", err)
|
||||
log.Printf("Error: Cannot read from random: %v\n", err)
|
||||
return nil, err
|
||||
}
|
||||
group.GroupID = fmt.Sprintf("%x", groupID)
|
||||
|
||||
var groupKey [32]byte
|
||||
if _, err := io.ReadFull(rand.Reader, groupKey[:]); err != nil {
|
||||
log.Errorf("Error: Cannot read from random: %v\n", err)
|
||||
log.Printf("Error: Cannot read from random: %v\n", err)
|
||||
return nil, err
|
||||
}
|
||||
copy(group.GroupKey[:], groupKey[:])
|
||||
|
||||
// Derive Group ID from the group key and the server public key. This binds the group to a particular server
|
||||
// and key.
|
||||
group.GroupID = deriveGroupID(groupKey[:], server)
|
||||
|
||||
group.Attributes = make(map[string]string)
|
||||
// By default we set the "name" of the group to a random string, we can override this later, but to simplify the
|
||||
// codes around invite, we assume that this is always set.
|
||||
group.Attributes[attr.GetLocalScope("name")] = group.GroupID
|
||||
group.Owner = "self"
|
||||
return group, nil
|
||||
}
|
||||
|
||||
// CheckGroup returns true only if the ID of the group is cryptographically valid.
|
||||
func (g *Group) CheckGroup() bool {
|
||||
return g.GroupID == deriveGroupID(g.GroupKey[:], g.GroupServer)
|
||||
// SignGroup adds a signature to the group.
|
||||
func (g *Group) SignGroup(signature []byte) {
|
||||
g.SignedGroupID = signature
|
||||
copy(g.Timeline.SignedGroupID[:], g.SignedGroupID)
|
||||
}
|
||||
|
||||
// deriveGroupID hashes together the key and the hostname to create a bound identifier that can later
|
||||
// be referenced and checked by profiles when they receive invites and messages.
|
||||
func deriveGroupID(groupKey []byte, serverHostname string) string {
|
||||
data, _ := base32.StdEncoding.DecodeString(strings.ToUpper(serverHostname))
|
||||
pubkey := data[0:ed25519.PublicKeySize]
|
||||
return hex.EncodeToString(pbkdf2.Key(groupKey, pubkey, 4096, 16, sha512.New))
|
||||
}
|
||||
|
||||
// Compromised should be called if we detect a groupkey leak
|
||||
// Compromised should be called if we detect a a groupkey leak.
|
||||
func (g *Group) Compromised() {
|
||||
g.IsCompromised = true
|
||||
}
|
||||
|
||||
// GetInitialMessage returns the first message of the group, if one was sent with the invite.
|
||||
func (g *Group) GetInitialMessage() []byte {
|
||||
g.lock.Lock()
|
||||
defer g.lock.Unlock()
|
||||
return g.InitialMessage
|
||||
}
|
||||
|
||||
// Invite generates a invitation that can be sent to a cwtch peer
|
||||
func (g *Group) Invite() (string, error) {
|
||||
func (g *Group) Invite(initialMessage []byte) ([]byte, error) {
|
||||
|
||||
gci := &groups.GroupInvite{
|
||||
GroupID: g.GroupID,
|
||||
GroupName: g.Attributes[attr.GetLocalScope("name")],
|
||||
SharedKey: g.GroupKey[:],
|
||||
ServerHost: g.GroupServer,
|
||||
if g.SignedGroupID == nil {
|
||||
return nil, errors.New("group isn't signed")
|
||||
}
|
||||
|
||||
invite, err := json.Marshal(gci)
|
||||
serializedInvite := fmt.Sprintf("%v%v", GroupInvitePrefix, base64.StdEncoding.EncodeToString(invite))
|
||||
return serializedInvite, err
|
||||
}
|
||||
g.InitialMessage = initialMessage[:]
|
||||
|
||||
// AddSentMessage takes a DecryptedGroupMessage and adds it to the Groups Timeline
|
||||
func (g *Group) AddSentMessage(message *groups.DecryptedGroupMessage, sig []byte) Message {
|
||||
g.lock.Lock()
|
||||
defer g.lock.Unlock()
|
||||
timelineMessage := Message{
|
||||
Message: message.Text,
|
||||
Timestamp: time.Unix(int64(message.Timestamp), 0),
|
||||
Received: time.Unix(0, 0),
|
||||
Signature: sig,
|
||||
PeerID: message.Onion,
|
||||
PreviousMessageSig: message.PreviousMessageSig,
|
||||
ReceivedByServer: false,
|
||||
gci := &protocol.GroupChatInvite{
|
||||
GroupName: g.GroupID,
|
||||
GroupSharedKey: g.GroupKey[:],
|
||||
ServerHost: g.GroupServer,
|
||||
SignedGroupId: g.SignedGroupID[:],
|
||||
InitialMessage: initialMessage[:],
|
||||
}
|
||||
g.UnacknowledgedMessages = append(g.UnacknowledgedMessages, timelineMessage)
|
||||
return timelineMessage
|
||||
}
|
||||
|
||||
// ErrorSentMessage removes a sent message from the unacknowledged list and sets its error flag if found, otherwise returns false
|
||||
func (g *Group) ErrorSentMessage(sig []byte, error string) bool {
|
||||
g.lock.Lock()
|
||||
defer g.lock.Unlock()
|
||||
var message *Message
|
||||
|
||||
// Delete the message from the unack'd buffer if it exists
|
||||
for i, unAckedMessage := range g.UnacknowledgedMessages {
|
||||
if compareSignatures(unAckedMessage.Signature, sig) {
|
||||
message = &unAckedMessage
|
||||
g.UnacknowledgedMessages = append(g.UnacknowledgedMessages[:i], g.UnacknowledgedMessages[i+1:]...)
|
||||
|
||||
message.Error = error
|
||||
g.Timeline.Insert(message)
|
||||
return true
|
||||
}
|
||||
cp := &protocol.CwtchPeerPacket{
|
||||
GroupChatInvite: gci,
|
||||
}
|
||||
return false
|
||||
invite, err := proto.Marshal(cp)
|
||||
return invite, err
|
||||
}
|
||||
|
||||
// AddMessage takes a DecryptedGroupMessage and adds it to the Groups Timeline
|
||||
func (g *Group) AddMessage(message *groups.DecryptedGroupMessage, sig []byte) (*Message, bool) {
|
||||
|
||||
func (g *Group) AddMessage(message *protocol.DecryptedGroupMessage, sig []byte) *Message {
|
||||
g.lock.Lock()
|
||||
defer g.lock.Unlock()
|
||||
|
||||
// Delete the message from the unack'd buffer if it exists
|
||||
for i, unAckedMessage := range g.UnacknowledgedMessages {
|
||||
if compareSignatures(unAckedMessage.Signature, sig) {
|
||||
g.UnacknowledgedMessages = append(g.UnacknowledgedMessages[:i], g.UnacknowledgedMessages[i+1:]...)
|
||||
break
|
||||
}
|
||||
}
|
||||
|
||||
timelineMessage := &Message{
|
||||
Message: message.Text,
|
||||
Timestamp: time.Unix(int64(message.Timestamp), 0),
|
||||
Message: message.GetText(),
|
||||
Timestamp: time.Unix(int64(message.GetTimestamp()), 0),
|
||||
Received: time.Now(),
|
||||
Signature: sig,
|
||||
PeerID: message.Onion,
|
||||
PreviousMessageSig: message.PreviousMessageSig,
|
||||
ReceivedByServer: true,
|
||||
Error: "",
|
||||
Acknowledged: true,
|
||||
PeerID: message.GetOnion(),
|
||||
PreviousMessageSig: message.GetPreviousMessageSig(),
|
||||
}
|
||||
seen := g.Timeline.Insert(timelineMessage)
|
||||
g.lock.Unlock()
|
||||
|
||||
return timelineMessage, seen
|
||||
// Send a new Message notification if we have an app that is listening.
|
||||
if g.NewMessage != nil && !seen {
|
||||
g.NewMessage <- *timelineMessage
|
||||
}
|
||||
return timelineMessage
|
||||
}
|
||||
|
||||
// GetTimeline provides a safe copy of the timeline
|
||||
func (g *Group) GetTimeline() (timeline []Message) {
|
||||
// GetTimeline provides a safe copy of the timeline-=
|
||||
func (g *Group) GetTimeline() (t []Message) {
|
||||
g.lock.Lock()
|
||||
defer g.lock.Unlock()
|
||||
return append(g.Timeline.GetMessages(), g.UnacknowledgedMessages...)
|
||||
t = g.Timeline.GetMessages()
|
||||
g.lock.Unlock()
|
||||
return
|
||||
|
||||
}
|
||||
|
||||
//EncryptMessage takes a message and encrypts the message under the group key.
|
||||
func (g *Group) EncryptMessage(message *groups.DecryptedGroupMessage) ([]byte, error) {
|
||||
func (g *Group) EncryptMessage(message *protocol.DecryptedGroupMessage) ([]byte, error) {
|
||||
var nonce [24]byte
|
||||
if _, err := io.ReadFull(rand.Reader, nonce[:]); err != nil {
|
||||
log.Errorf("Cannot read from random: %v\n", err)
|
||||
return nil, err
|
||||
}
|
||||
wire, err := json.Marshal(message)
|
||||
if err != nil {
|
||||
log.Printf("Error: Cannot read from random: %v\n", err)
|
||||
return nil, err
|
||||
}
|
||||
wire, err := proto.Marshal(message)
|
||||
utils.CheckError(err)
|
||||
encrypted := secretbox.Seal(nonce[:], []byte(wire), &nonce, &g.GroupKey)
|
||||
return encrypted, nil
|
||||
}
|
||||
|
||||
// DecryptMessage takes a ciphertext and returns true and the decrypted message if the
|
||||
// cipher text can be successfully decrypted,else false.
|
||||
func (g *Group) DecryptMessage(ciphertext []byte) (bool, *groups.DecryptedGroupMessage) {
|
||||
if len(ciphertext) > 24 {
|
||||
var decryptNonce [24]byte
|
||||
copy(decryptNonce[:], ciphertext[:24])
|
||||
decrypted, ok := secretbox.Open(nil, ciphertext[24:], &decryptNonce, &g.GroupKey)
|
||||
if ok {
|
||||
dm := &groups.DecryptedGroupMessage{}
|
||||
err := json.Unmarshal(decrypted, dm)
|
||||
if err == nil {
|
||||
return true, dm
|
||||
}
|
||||
func (g *Group) DecryptMessage(ciphertext []byte) (bool, *protocol.DecryptedGroupMessage) {
|
||||
var decryptNonce [24]byte
|
||||
copy(decryptNonce[:], ciphertext[:24])
|
||||
decrypted, ok := secretbox.Open(nil, ciphertext[24:], &decryptNonce, &g.GroupKey)
|
||||
if ok {
|
||||
dm := &protocol.DecryptedGroupMessage{}
|
||||
err := proto.Unmarshal(decrypted, dm)
|
||||
if err == nil {
|
||||
return true, dm
|
||||
}
|
||||
}
|
||||
return false, nil
|
||||
}
|
||||
|
||||
// SetAttribute allows applications to store arbitrary configuration info at the group level.
|
||||
func (g *Group) SetAttribute(name string, value string) {
|
||||
g.lock.Lock()
|
||||
defer g.lock.Unlock()
|
||||
g.Attributes[name] = value
|
||||
}
|
||||
|
||||
// GetAttribute returns the value of a value set with SetAttribute. If no such value has been set exists is set to false.
|
||||
func (g *Group) GetAttribute(name string) (value string, exists bool) {
|
||||
g.lock.Lock()
|
||||
defer g.lock.Unlock()
|
||||
value, exists = g.Attributes[name]
|
||||
return
|
||||
}
|
||||
|
||||
// ValidateInvite takes in a serialized invite and returns the invite structure if it is cryptographically valid
|
||||
// and an error if it is not
|
||||
func ValidateInvite(invite string) (*groups.GroupInvite, error) {
|
||||
// We prefix invites for groups with torv3
|
||||
if strings.HasPrefix(invite, GroupInvitePrefix) {
|
||||
data, err := base64.StdEncoding.DecodeString(invite[len(GroupInvitePrefix):])
|
||||
if err == nil {
|
||||
// First attempt to unmarshal the json...
|
||||
var gci groups.GroupInvite
|
||||
err := json.Unmarshal(data, &gci)
|
||||
if err == nil {
|
||||
|
||||
// Validate the Invite by first checking that the server is a valid v3 onion
|
||||
if !tor.IsValidHostname(gci.ServerHost) {
|
||||
return nil, errors.New("server is not a valid v3 onion")
|
||||
}
|
||||
|
||||
// Validate the length of the shared key...
|
||||
if len(gci.SharedKey) != 32 {
|
||||
return nil, errors.New("key length is not 32 bytes")
|
||||
}
|
||||
|
||||
// Derive the servers public key (we can ignore the error checking here because it's already been
|
||||
// done by IsValidHostname, and check that we derive the same groupID...
|
||||
derivedGroupID := deriveGroupID(gci.SharedKey, gci.ServerHost)
|
||||
if derivedGroupID != gci.GroupID {
|
||||
return nil, errors.New("group id is invalid")
|
||||
}
|
||||
|
||||
// Replace the original with the derived, this should be a no-op at this point but defense in depth...
|
||||
gci.GroupID = derivedGroupID
|
||||
return &gci, nil
|
||||
}
|
||||
}
|
||||
}
|
||||
return nil, errors.New("invite has invalid structure")
|
||||
}
|
||||
|
|
|
@ -1,115 +1,27 @@
|
|||
package model
|
||||
|
||||
import (
|
||||
"crypto/sha256"
|
||||
"cwtch.im/cwtch/protocol/groups"
|
||||
"strings"
|
||||
"sync"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"testing"
|
||||
"time"
|
||||
)
|
||||
|
||||
func TestGroup(t *testing.T) {
|
||||
g, _ := NewGroup("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd")
|
||||
dgm := &groups.DecryptedGroupMessage{
|
||||
Onion: "onion",
|
||||
Text: "Hello World!",
|
||||
Timestamp: uint64(time.Now().Unix()),
|
||||
SignedGroupID: []byte{},
|
||||
g, _ := NewGroup("server.onion")
|
||||
dgm := &protocol.DecryptedGroupMessage{
|
||||
Onion: proto.String("onion"),
|
||||
Text: proto.String("Hello World!"),
|
||||
Timestamp: proto.Int32(int32(time.Now().Unix())),
|
||||
SignedGroupId: []byte{},
|
||||
PreviousMessageSig: []byte{},
|
||||
Padding: []byte{},
|
||||
}
|
||||
|
||||
invite, err := g.Invite()
|
||||
|
||||
if err != nil {
|
||||
t.Fatalf("error creating group invite: %v", err)
|
||||
}
|
||||
|
||||
validatedInvite, err := ValidateInvite(invite)
|
||||
|
||||
if err != nil {
|
||||
t.Fatalf("error validating group invite: %v", err)
|
||||
}
|
||||
|
||||
if validatedInvite.GroupID != g.GroupID {
|
||||
t.Fatalf("after validate group invite id should be identical to original: %v", err)
|
||||
}
|
||||
|
||||
encMessage, _ := g.EncryptMessage(dgm)
|
||||
ok, message := g.DecryptMessage(encMessage)
|
||||
if !ok || message.Text != "Hello World!" {
|
||||
if !ok || message.GetText() != "Hello World!" {
|
||||
t.Errorf("group encryption was invalid, or returned wrong message decrypted:%v message:%v", ok, message)
|
||||
return
|
||||
}
|
||||
g.SetAttribute("test", "test_value")
|
||||
value, exists := g.GetAttribute("test")
|
||||
if !exists || value != "test_value" {
|
||||
t.Errorf("Custom Attribute Should have been set, instead %v %v", exists, value)
|
||||
}
|
||||
t.Logf("Got message %v", message)
|
||||
}
|
||||
|
||||
func TestGroupErr(t *testing.T) {
|
||||
_, err := NewGroup("not a real group name")
|
||||
if err == nil {
|
||||
t.Errorf("Group Setup Should Have Failed")
|
||||
}
|
||||
}
|
||||
|
||||
// Test various group invite validation failures...
|
||||
func TestGroupValidation(t *testing.T) {
|
||||
|
||||
group := &Group{
|
||||
GroupID: "",
|
||||
GroupKey: [32]byte{},
|
||||
GroupServer: "",
|
||||
Timeline: Timeline{},
|
||||
Accepted: false,
|
||||
IsCompromised: false,
|
||||
Attributes: nil,
|
||||
lock: sync.Mutex{},
|
||||
LocalID: "",
|
||||
State: "",
|
||||
UnacknowledgedMessages: nil,
|
||||
Version: 0,
|
||||
}
|
||||
|
||||
invite, _ := group.Invite()
|
||||
_, err := ValidateInvite(invite)
|
||||
|
||||
if err == nil {
|
||||
t.Fatalf("Group with empty group id should have been an error")
|
||||
}
|
||||
t.Logf("Error: %v", err)
|
||||
|
||||
// Generate a valid group but replace the group server...
|
||||
group, _ = NewGroup("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd")
|
||||
group.GroupServer = "tcnkoch4nyr3cldkemejtkpqok342rbql6iclnjjs3ndgnjgufzyxvqd"
|
||||
invite, _ = group.Invite()
|
||||
_, err = ValidateInvite(invite)
|
||||
|
||||
if err == nil {
|
||||
t.Fatalf("Group with empty group id should have been an error")
|
||||
}
|
||||
t.Logf("Error: %v", err)
|
||||
|
||||
// Generate a valid group but replace the group key...
|
||||
group, _ = NewGroup("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd")
|
||||
group.GroupKey = sha256.Sum256([]byte{})
|
||||
invite, _ = group.Invite()
|
||||
_, err = ValidateInvite(invite)
|
||||
|
||||
if err == nil {
|
||||
t.Fatalf("Group with different group key should have errored")
|
||||
}
|
||||
t.Logf("Error: %v", err)
|
||||
|
||||
// mangle the invite
|
||||
_, err = ValidateInvite(strings.ReplaceAll(invite, GroupInvitePrefix, ""))
|
||||
if err == nil {
|
||||
t.Fatalf("Group with different group key should have errored")
|
||||
}
|
||||
t.Logf("Error: %v", err)
|
||||
|
||||
}
|
||||
|
|
|
@ -1,103 +0,0 @@
|
|||
package model
|
||||
|
||||
import (
|
||||
"crypto/ed25519"
|
||||
"encoding/base32"
|
||||
"encoding/json"
|
||||
"errors"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives"
|
||||
"strings"
|
||||
)
|
||||
|
||||
// KeyType provides a wrapper for a generic public key type identifier (could be an onion address, a zcash address etc.)
|
||||
type KeyType string
|
||||
|
||||
const (
|
||||
|
||||
// BundleType - the attribute under which the signed server bundle is stored...
|
||||
BundleType = KeyType("server_key_bundle")
|
||||
|
||||
// KeyTypeServerOnion - a cwtch address
|
||||
KeyTypeServerOnion = KeyType("bulletin_board_onion") // bulletin board
|
||||
|
||||
// KeyTypeTokenOnion - a cwtch peer with a PoW based token protocol
|
||||
KeyTypeTokenOnion = KeyType("token_service_onion")
|
||||
|
||||
//KeyTypePrivacyPass - a privacy pass based token server
|
||||
KeyTypePrivacyPass = KeyType("privacy_pass_public_key")
|
||||
)
|
||||
|
||||
// Key provides a wrapper for a generic public key identifier (could be an onion address, a zcash address etc.)
|
||||
type Key string
|
||||
|
||||
// KeyBundle manages a collection of related keys for various different services.
|
||||
type KeyBundle struct {
|
||||
Keys map[KeyType]Key
|
||||
Signature []byte
|
||||
}
|
||||
|
||||
// NewKeyBundle creates a new KeyBundle initialized with no keys.
|
||||
func NewKeyBundle() *KeyBundle {
|
||||
keyBundle := new(KeyBundle)
|
||||
keyBundle.Keys = make(map[KeyType]Key)
|
||||
return keyBundle
|
||||
}
|
||||
|
||||
// HasKeyType returns true if the bundle has a public key of a given type.
|
||||
func (kb *KeyBundle) HasKeyType(keytype KeyType) bool {
|
||||
_, exists := kb.Keys[keytype]
|
||||
return exists
|
||||
}
|
||||
|
||||
// GetKey retrieves a key with a given type from the bundle
|
||||
func (kb *KeyBundle) GetKey(keytype KeyType) (Key, error) {
|
||||
key, exists := kb.Keys[keytype]
|
||||
if exists {
|
||||
return key, nil
|
||||
}
|
||||
return "", errors.New("no such key")
|
||||
}
|
||||
|
||||
// Serialize produces a json encoded byte array.
|
||||
func (kb KeyBundle) Serialize() []byte {
|
||||
// json.Marshal sorts map keys
|
||||
bundle, _ := json.Marshal(kb)
|
||||
return bundle
|
||||
}
|
||||
|
||||
// Sign allows a server to authenticate a key bundle by signing it (this uses the tapir identity interface)
|
||||
func (kb *KeyBundle) Sign(identity primitives.Identity) {
|
||||
kb.Signature = identity.Sign(kb.Serialize())
|
||||
}
|
||||
|
||||
// DeserializeAndVerify takes in a json formatted bundle and only returns a valid key bundle
|
||||
// if it has been signed by the server.
|
||||
func DeserializeAndVerify(bundle []byte) (*KeyBundle, error) {
|
||||
keyBundle := new(KeyBundle)
|
||||
err := json.Unmarshal(bundle, &keyBundle)
|
||||
if err == nil {
|
||||
signature := keyBundle.Signature
|
||||
keyBundle.Signature = nil
|
||||
serverKey, _ := keyBundle.GetKey(KeyTypeServerOnion)
|
||||
|
||||
// We have to do convert the encoded key to a format that can be used to verify the signature
|
||||
var decodedPub []byte
|
||||
decodedPub, err = base32.StdEncoding.DecodeString(strings.ToUpper(string(serverKey)))
|
||||
if err == nil && len(decodedPub) == 35 {
|
||||
if ed25519.Verify(decodedPub[:32], keyBundle.Serialize(), signature) { // == true
|
||||
return keyBundle, nil
|
||||
}
|
||||
}
|
||||
err = InvalidEd25519PublicKey
|
||||
}
|
||||
return nil, err
|
||||
}
|
||||
|
||||
// AttributeBundle returns a map that can be used as part of a peer attribute bundle
|
||||
func (kb *KeyBundle) AttributeBundle() map[string]string {
|
||||
ab := make(map[string]string)
|
||||
for k, v := range kb.Keys {
|
||||
ab[string(k)] = string(v)
|
||||
}
|
||||
return ab
|
||||
}
|
|
@ -1,64 +0,0 @@
|
|||
package model
|
||||
|
||||
import (
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives"
|
||||
"testing"
|
||||
)
|
||||
|
||||
func TestDeserializeAndVerify(t *testing.T) {
|
||||
server, _ := primitives.InitializeEphemeralIdentity()
|
||||
|
||||
serverKeyBundle := NewKeyBundle()
|
||||
|
||||
serverKeyBundle.Keys[KeyTypeServerOnion] = Key(server.Hostname())
|
||||
serverKeyBundle.Keys[KeyTypePrivacyPass] = Key("random 1")
|
||||
serverKeyBundle.Keys[KeyTypeTokenOnion] = Key("random 2")
|
||||
serverKeyBundle.Sign(server)
|
||||
|
||||
//eyeball keys are sorted
|
||||
t.Logf("%s", serverKeyBundle.Serialize())
|
||||
serialize := serverKeyBundle.Serialize()
|
||||
|
||||
newKeyBundle, err := DeserializeAndVerify(serialize)
|
||||
if err != nil {
|
||||
t.Fatalf("Key Bundle did not Deserialize %v", err)
|
||||
}
|
||||
|
||||
if newKeyBundle.Keys[KeyTypeServerOnion] != Key(server.Hostname()) {
|
||||
t.Fatalf("Key Bundle did not Serialize Correctly Actual: %v Expected: %v", newKeyBundle, serverKeyBundle)
|
||||
}
|
||||
}
|
||||
|
||||
func TestDeserializeAndVerifyMaliciousSignShouldFail(t *testing.T) {
|
||||
server, _ := primitives.InitializeEphemeralIdentity()
|
||||
maliciousServer, _ := primitives.InitializeEphemeralIdentity()
|
||||
serverKeyBundle := NewKeyBundle()
|
||||
|
||||
serverKeyBundle.Keys[KeyTypeServerOnion] = Key(server.Hostname())
|
||||
|
||||
// This time we sign with a malicious server
|
||||
serverKeyBundle.Sign(maliciousServer)
|
||||
serialize := serverKeyBundle.Serialize()
|
||||
|
||||
newKeyBundle, err := DeserializeAndVerify(serialize)
|
||||
if err == nil {
|
||||
t.Fatalf("Key Bundle did Deserialize (it should have failed): %v", newKeyBundle)
|
||||
}
|
||||
}
|
||||
|
||||
func TestDeserializeAndVerifyUnsignedShouldFail(t *testing.T) {
|
||||
server, _ := primitives.InitializeEphemeralIdentity()
|
||||
|
||||
serverKeyBundle := NewKeyBundle()
|
||||
|
||||
serverKeyBundle.Keys[KeyTypeServerOnion] = Key(server.Hostname())
|
||||
|
||||
// This time we don't sign
|
||||
// serverKeyBundle.Sign(server)
|
||||
serialize := serverKeyBundle.Serialize()
|
||||
|
||||
newKeyBundle, err := DeserializeAndVerify(serialize)
|
||||
if err == nil {
|
||||
t.Fatalf("Key Bundle did Deserialize (it should have failed): %v", newKeyBundle)
|
||||
}
|
||||
}
|
|
@ -1,13 +1,12 @@
|
|||
package model
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"sort"
|
||||
"sync"
|
||||
"time"
|
||||
)
|
||||
|
||||
// Timeline encapsulates a collection of ordered Messages, and a mechanism to access them
|
||||
// Timeline encapsulates a collection of ordered messages, and a mechanism to access them
|
||||
// in a threadsafe manner.
|
||||
type Timeline struct {
|
||||
Messages []Message
|
||||
|
@ -23,25 +22,18 @@ type Message struct {
|
|||
Message string
|
||||
Signature []byte
|
||||
PreviousMessageSig []byte
|
||||
ReceivedByServer bool // messages sent to a server
|
||||
Acknowledged bool // peer to peer
|
||||
Error string `json:",omitempty"`
|
||||
// Application specific flags, useful for storing small amounts of metadata
|
||||
Flags uint64
|
||||
}
|
||||
|
||||
// MessageBaseSize is a rough estimate of the base number of bytes the struct uses before strings are populated
|
||||
const MessageBaseSize = 104
|
||||
|
||||
func compareSignatures(a []byte, b []byte) bool {
|
||||
if len(a) != len(b) {
|
||||
return false
|
||||
}
|
||||
int d = 0
|
||||
for i := range a {
|
||||
d := d | (a[i] ^ b[i])
|
||||
if a[i] != b[i] {
|
||||
return false
|
||||
}
|
||||
}
|
||||
return d == 0
|
||||
return true
|
||||
}
|
||||
|
||||
// GetMessages returns a copy of the entire timeline
|
||||
|
@ -53,45 +45,23 @@ func (t *Timeline) GetMessages() []Message {
|
|||
return messages
|
||||
}
|
||||
|
||||
// GetCopy returns a duplicate of the Timeline
|
||||
func (t *Timeline) GetCopy() *Timeline {
|
||||
t.lock.Lock()
|
||||
defer t.lock.Unlock()
|
||||
bytes, _ := json.Marshal(t)
|
||||
newt := &Timeline{}
|
||||
json.Unmarshal(bytes, newt)
|
||||
return newt
|
||||
}
|
||||
|
||||
// SetMessages sets the Messages of this timeline. Only to be used in loading/initialization
|
||||
func (t *Timeline) SetMessages(messages []Message) {
|
||||
t.lock.Lock()
|
||||
defer t.lock.Unlock()
|
||||
t.Messages = messages
|
||||
}
|
||||
|
||||
// Len gets the length of the timeline
|
||||
func (t *Timeline) Len() int {
|
||||
return len(t.Messages)
|
||||
}
|
||||
|
||||
// Swap swaps 2 Messages on the timeline.
|
||||
// Swap swaps 2 messages on the timeline.
|
||||
func (t *Timeline) Swap(i, j int) {
|
||||
t.Messages[i], t.Messages[j] = t.Messages[j], t.Messages[i]
|
||||
}
|
||||
|
||||
// Less checks 2 Messages (i and j) in the timeline and returns true if i occurred before j, else false
|
||||
// Less checks 2 messages (i and j) in the timeline and returns true if i occcured before j, else false
|
||||
func (t *Timeline) Less(i, j int) bool {
|
||||
|
||||
if t.Messages[i].Timestamp.Before(t.Messages[j].Timestamp) {
|
||||
return true
|
||||
}
|
||||
|
||||
// Short circuit false if j is before i, signature checks will give a wrong order in this case.
|
||||
if t.Messages[j].Timestamp.Before(t.Messages[i].Timestamp) {
|
||||
return false
|
||||
}
|
||||
|
||||
if compareSignatures(t.Messages[i].PreviousMessageSig, t.SignedGroupID) {
|
||||
return true
|
||||
}
|
||||
|
@ -103,13 +73,6 @@ func (t *Timeline) Less(i, j int) bool {
|
|||
return false
|
||||
}
|
||||
|
||||
// Sort sorts the timeline in a canonical order.
|
||||
func (t *Timeline) Sort() {
|
||||
t.lock.Lock()
|
||||
defer t.lock.Unlock()
|
||||
sort.Sort(t)
|
||||
}
|
||||
|
||||
// Insert inserts a message into the timeline in a thread safe way.
|
||||
func (t *Timeline) Insert(mi *Message) bool {
|
||||
t.lock.Lock()
|
||||
|
|
|
@ -1,6 +1,8 @@
|
|||
package model
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"strconv"
|
||||
"testing"
|
||||
"time"
|
||||
|
@ -14,14 +16,15 @@ func TestMessagePadding(t *testing.T) {
|
|||
sarah.AddContact(alice.Onion, &alice.PublicProfile)
|
||||
alice.AddContact(sarah.Onion, &sarah.PublicProfile)
|
||||
|
||||
gid, invite, _ := alice.StartGroup("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd")
|
||||
gid, invite, _ := alice.StartGroup("aaa.onion")
|
||||
gci := &protocol.CwtchPeerPacket{}
|
||||
proto.Unmarshal(invite, gci)
|
||||
sarah.ProcessInvite(gci.GetGroupChatInvite(), alice.Onion)
|
||||
|
||||
sarah.ProcessInvite(invite)
|
||||
group := alice.GetGroupByGroupID(gid)
|
||||
|
||||
group := alice.GetGroup(gid)
|
||||
|
||||
c1, s1, err := sarah.EncryptMessageToGroup("Hello World 1", group.GroupID)
|
||||
t.Logf("Length of Encrypted Message: %v %v", len(c1), err)
|
||||
c1, s1, _ := sarah.EncryptMessageToGroup("Hello World 1", group.GroupID)
|
||||
t.Logf("Length of Encrypted Message: %v", len(c1))
|
||||
alice.AttemptDecryption(c1, s1)
|
||||
|
||||
c2, s2, _ := alice.EncryptMessageToGroup("Hello World 2", group.GroupID)
|
||||
|
@ -47,14 +50,12 @@ func TestTranscriptConsistency(t *testing.T) {
|
|||
sarah.AddContact(alice.Onion, &alice.PublicProfile)
|
||||
alice.AddContact(sarah.Onion, &sarah.PublicProfile)
|
||||
|
||||
// The lightest weight server entry possible (usually we would import a key bundle...)
|
||||
sarah.AddContact("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd", &PublicProfile{Attributes: map[string]string{string(KeyTypeServerOnion): "2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd"}})
|
||||
gid, invite, _ := alice.StartGroup("aaa.onion")
|
||||
gci := &protocol.CwtchPeerPacket{}
|
||||
proto.Unmarshal(invite, gci)
|
||||
sarah.ProcessInvite(gci.GetGroupChatInvite(), alice.Onion)
|
||||
|
||||
gid, invite, _ := alice.StartGroup("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd")
|
||||
|
||||
sarah.ProcessInvite(invite)
|
||||
|
||||
group := alice.GetGroup(gid)
|
||||
group := alice.GetGroupByGroupID(gid)
|
||||
|
||||
t.Logf("group: %v, sarah %v", group, sarah)
|
||||
|
||||
|
@ -79,14 +80,14 @@ func TestTranscriptConsistency(t *testing.T) {
|
|||
c5, s5, _ := alice.EncryptMessageToGroup("Hello World 5", group.GroupID)
|
||||
t.Logf("Length of Encrypted Message: %v", len(c5))
|
||||
|
||||
_, _, m1, _ := sarah.AttemptDecryption(c1, s1)
|
||||
_, m1 := sarah.AttemptDecryption(c1, s1)
|
||||
sarah.AttemptDecryption(c1, s1) // Try a duplicate
|
||||
_, _, m2, _ := sarah.AttemptDecryption(c2, s2)
|
||||
_, _, m3, _ := sarah.AttemptDecryption(c3, s3)
|
||||
_, _, m4, _ := sarah.AttemptDecryption(c4, s4)
|
||||
_, _, m5, _ := sarah.AttemptDecryption(c5, s5)
|
||||
_, m2 := sarah.AttemptDecryption(c2, s2)
|
||||
_, m3 := sarah.AttemptDecryption(c3, s3)
|
||||
_, m4 := sarah.AttemptDecryption(c4, s4)
|
||||
_, m5 := sarah.AttemptDecryption(c5, s5)
|
||||
|
||||
// Now we simulate a client receiving these Messages completely out of order
|
||||
// Now we simulate a client receiving these messages completely out of order
|
||||
timeline.Insert(m1)
|
||||
timeline.Insert(m5)
|
||||
timeline.Insert(m4)
|
||||
|
|
451
model/profile.go
451
model/profile.go
|
@ -2,47 +2,25 @@ package model
|
|||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"cwtch.im/cwtch/model/attr"
|
||||
"cwtch.im/cwtch/protocol/groups"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"encoding/base32"
|
||||
"encoding/hex"
|
||||
"encoding/json"
|
||||
"errors"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/openprivacy/connectivity/tor"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"golang.org/x/crypto/ed25519"
|
||||
"io"
|
||||
"path/filepath"
|
||||
"strings"
|
||||
"sync"
|
||||
"time"
|
||||
)
|
||||
|
||||
// Authorization is a type determining client assigned authorization to a peer
|
||||
type Authorization string
|
||||
|
||||
const (
|
||||
// AuthUnknown is an initial state for a new unseen peer
|
||||
AuthUnknown Authorization = "unknown"
|
||||
// AuthApproved means the client has approved the peer, it can send messages to us, perform GetVals, etc
|
||||
AuthApproved Authorization = "approved"
|
||||
// AuthBlocked means the client has blocked the peer, it's messages and connections should be rejected
|
||||
AuthBlocked Authorization = "blocked"
|
||||
)
|
||||
|
||||
// PublicProfile is a local copy of a CwtchIdentity
|
||||
type PublicProfile struct {
|
||||
Name string
|
||||
Ed25519PublicKey ed25519.PublicKey
|
||||
Authorization Authorization
|
||||
DeprecatedBlocked bool `json:"Blocked"`
|
||||
Onion string
|
||||
Attributes map[string]string
|
||||
Timeline Timeline `json:"-"`
|
||||
LocalID string // used by storage engine
|
||||
State string `json:"-"`
|
||||
lock sync.Mutex
|
||||
UnacknowledgedMessages map[string]int
|
||||
Name string
|
||||
Ed25519PublicKey ed25519.PublicKey
|
||||
Trusted bool
|
||||
Blocked bool
|
||||
Onion string
|
||||
}
|
||||
|
||||
// Profile encapsulates all the attributes necessary to be a Cwtch Peer.
|
||||
|
@ -51,109 +29,53 @@ type Profile struct {
|
|||
Contacts map[string]*PublicProfile
|
||||
Ed25519PrivateKey ed25519.PrivateKey
|
||||
Groups map[string]*Group
|
||||
}
|
||||
|
||||
// MaxGroupMessageLength is the maximum length of a message posted to a server group.
|
||||
// TODO: Should this be per server?
|
||||
const MaxGroupMessageLength = 1800
|
||||
|
||||
// GenerateRandomID generates a random 16 byte hex id code
|
||||
func GenerateRandomID() string {
|
||||
randBytes := make([]byte, 16)
|
||||
rand.Read(randBytes)
|
||||
return filepath.Join(hex.EncodeToString(randBytes))
|
||||
}
|
||||
|
||||
func (p *PublicProfile) init() {
|
||||
if p.Attributes == nil {
|
||||
p.Attributes = make(map[string]string)
|
||||
}
|
||||
p.UnacknowledgedMessages = make(map[string]int)
|
||||
p.LocalID = GenerateRandomID()
|
||||
}
|
||||
|
||||
// SetAttribute allows applications to store arbitrary configuration info at the profile level.
|
||||
func (p *PublicProfile) SetAttribute(name string, value string) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
p.Attributes[name] = value
|
||||
}
|
||||
|
||||
// IsServer returns true if the profile is associated with a server.
|
||||
func (p *PublicProfile) IsServer() (isServer bool) {
|
||||
_, isServer = p.GetAttribute(string(KeyTypeServerOnion))
|
||||
return
|
||||
}
|
||||
|
||||
// GetAttribute returns the value of a value set with SetCustomAttribute. If no such value has been set exists is set to false.
|
||||
func (p *PublicProfile) GetAttribute(name string) (value string, exists bool) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
value, exists = p.Attributes[name]
|
||||
return
|
||||
Custom map[string]string
|
||||
lock sync.Mutex
|
||||
}
|
||||
|
||||
// GenerateNewProfile creates a new profile, with new encryption and signing keys, and a profile name.
|
||||
func GenerateNewProfile(name string) *Profile {
|
||||
p := new(Profile)
|
||||
p.init()
|
||||
p.Name = name
|
||||
pub, priv, _ := ed25519.GenerateKey(rand.Reader)
|
||||
p.Ed25519PublicKey = pub
|
||||
p.Ed25519PrivateKey = priv
|
||||
p.Onion = tor.GetTorV3Hostname(pub)
|
||||
p.Onion = utils.GetTorV3Hostname(pub)
|
||||
|
||||
p.Contacts = make(map[string]*PublicProfile)
|
||||
p.Contacts[p.Onion] = &p.PublicProfile
|
||||
p.Groups = make(map[string]*Group)
|
||||
p.Custom = make(map[string]string)
|
||||
return p
|
||||
}
|
||||
|
||||
// GetCwtchIdentityPacket returns the wire message for conveying this profiles identity.
|
||||
func (p *Profile) GetCwtchIdentityPacket() (message []byte) {
|
||||
ci := &protocol.CwtchIdentity{
|
||||
Name: p.Name,
|
||||
Ed25519PublicKey: p.Ed25519PublicKey,
|
||||
}
|
||||
cpp := &protocol.CwtchPeerPacket{
|
||||
CwtchIdentify: ci,
|
||||
}
|
||||
message, err := proto.Marshal(cpp)
|
||||
utils.CheckError(err)
|
||||
return
|
||||
}
|
||||
|
||||
// AddCwtchIdentity takes a wire message and if it is a CwtchIdentity message adds the identity as a contact
|
||||
// otherwise returns an error
|
||||
func (p *Profile) AddCwtchIdentity(onion string, ci *protocol.CwtchIdentity) {
|
||||
p.AddContact(onion, &PublicProfile{Name: ci.GetName(), Ed25519PublicKey: ci.GetEd25519PublicKey(), Onion: onion})
|
||||
}
|
||||
|
||||
// AddContact allows direct manipulation of cwtch contacts
|
||||
func (p *Profile) AddContact(onion string, profile *PublicProfile) {
|
||||
p.lock.Lock()
|
||||
profile.init()
|
||||
// We expect callers to verify addresses before we get to this point, so if this isn't a
|
||||
// valid address this is a noop.
|
||||
if tor.IsValidHostname(onion) {
|
||||
decodedPub, err := base32.StdEncoding.DecodeString(strings.ToUpper(onion[:56]))
|
||||
if err == nil {
|
||||
profile.Ed25519PublicKey = ed25519.PublicKey(decodedPub[:32])
|
||||
p.Contacts[onion] = profile
|
||||
}
|
||||
}
|
||||
p.Contacts[onion] = profile
|
||||
p.lock.Unlock()
|
||||
}
|
||||
|
||||
// UpdateMessageFlags updates the flags stored with a message
|
||||
func (p *Profile) UpdateMessageFlags(handle string, mIdx int, flags uint64) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
if contact, exists := p.Contacts[handle]; exists {
|
||||
if len(contact.Timeline.Messages) > mIdx {
|
||||
contact.Timeline.Messages[mIdx].Flags = flags
|
||||
}
|
||||
} else if group, exists := p.Groups[handle]; exists {
|
||||
if len(group.Timeline.Messages) > mIdx {
|
||||
group.Timeline.Messages[mIdx].Flags = flags
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// DeleteContact deletes a peer contact
|
||||
func (p *Profile) DeleteContact(onion string) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
delete(p.Contacts, onion)
|
||||
}
|
||||
|
||||
// DeleteGroup deletes a group
|
||||
func (p *Profile) DeleteGroup(groupID string) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
delete(p.Groups, groupID)
|
||||
}
|
||||
|
||||
// RejectInvite rejects and removes a group invite
|
||||
func (p *Profile) RejectInvite(groupID string) {
|
||||
p.lock.Lock()
|
||||
|
@ -161,88 +83,6 @@ func (p *Profile) RejectInvite(groupID string) {
|
|||
p.lock.Unlock()
|
||||
}
|
||||
|
||||
// AddSentMessageToContactTimeline allows the saving of a message sent via a direct connection chat to the profile.
|
||||
func (p *Profile) AddSentMessageToContactTimeline(onion string, messageTxt string, sent time.Time, eventID string) *Message {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
|
||||
contact, ok := p.Contacts[onion]
|
||||
if ok {
|
||||
now := time.Now()
|
||||
sig := p.SignMessage(onion + messageTxt + sent.String() + now.String())
|
||||
|
||||
message := &Message{PeerID: p.Onion, Message: messageTxt, Timestamp: sent, Received: now, Signature: sig, Acknowledged: false}
|
||||
if contact.UnacknowledgedMessages == nil {
|
||||
contact.UnacknowledgedMessages = make(map[string]int)
|
||||
}
|
||||
contact.Timeline.Insert(message)
|
||||
contact.UnacknowledgedMessages[eventID] = contact.Timeline.Len() - 1
|
||||
return message
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// AddMessageToContactTimeline allows the saving of a message sent via a direct connection chat to the profile.
|
||||
func (p *Profile) AddMessageToContactTimeline(onion string, messageTxt string, sent time.Time) (message *Message) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
contact, ok := p.Contacts[onion]
|
||||
|
||||
// We don't really need a Signature here, but we use it to maintain order
|
||||
now := time.Now()
|
||||
sig := p.SignMessage(onion + messageTxt + sent.String() + now.String())
|
||||
if ok {
|
||||
message = &Message{PeerID: onion, Message: messageTxt, Timestamp: sent, Received: now, Signature: sig, Acknowledged: true}
|
||||
contact.Timeline.Insert(message)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
// ErrorSentMessageToPeer sets a sent message's error message and removes it from the unacknowledged list
|
||||
func (p *Profile) ErrorSentMessageToPeer(onion string, eventID string, error string) int {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
|
||||
contact, ok := p.Contacts[onion]
|
||||
if ok {
|
||||
mIdx, ok := contact.UnacknowledgedMessages[eventID]
|
||||
if ok {
|
||||
contact.Timeline.Messages[mIdx].Error = error
|
||||
delete(contact.UnacknowledgedMessages, eventID)
|
||||
return mIdx
|
||||
}
|
||||
}
|
||||
return -1
|
||||
}
|
||||
|
||||
// AckSentMessageToPeer sets mesage to a peer as acknowledged
|
||||
func (p *Profile) AckSentMessageToPeer(onion string, eventID string) int {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
|
||||
contact, ok := p.Contacts[onion]
|
||||
if ok {
|
||||
mIdx, ok := contact.UnacknowledgedMessages[eventID]
|
||||
if ok {
|
||||
contact.Timeline.Messages[mIdx].Acknowledged = true
|
||||
delete(contact.UnacknowledgedMessages, eventID)
|
||||
return mIdx
|
||||
}
|
||||
}
|
||||
|
||||
return -1
|
||||
}
|
||||
|
||||
// AddGroupSentMessageError searches matching groups for the message by sig and marks it as an error
|
||||
func (p *Profile) AddGroupSentMessageError(groupID string, signature []byte, error string) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
group, exists := p.Groups[groupID]
|
||||
if exists {
|
||||
group.ErrorSentMessage(signature, error)
|
||||
}
|
||||
}
|
||||
|
||||
// AcceptInvite accepts a group invite
|
||||
func (p *Profile) AcceptInvite(groupID string) (err error) {
|
||||
p.lock.Lock()
|
||||
|
@ -267,6 +107,21 @@ func (p *Profile) GetGroups() []string {
|
|||
return keys
|
||||
}
|
||||
|
||||
// SetCustomAttribute allows applications to store arbitrary configuration info at the profile level.
|
||||
func (p *Profile) SetCustomAttribute(name string, value string) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
p.Custom[name] = value
|
||||
}
|
||||
|
||||
// GetCustomAttribute returns the value of a value set with SetCustomAttribute. If no such value has been set exists is set to false.
|
||||
func (p *Profile) GetCustomAttribute(name string) (value string, exists bool) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
value, exists = p.Custom[name]
|
||||
return
|
||||
}
|
||||
|
||||
// GetContacts returns an unordered list of contact onions associated with this profile.
|
||||
func (p *Profile) GetContacts() []string {
|
||||
p.lock.Lock()
|
||||
|
@ -280,38 +135,39 @@ func (p *Profile) GetContacts() []string {
|
|||
return keys
|
||||
}
|
||||
|
||||
// SetContactAuthorization sets the authoirization level of a peer
|
||||
func (p *Profile) SetContactAuthorization(onion string, auth Authorization) (err error) {
|
||||
// BlockPeer blocks a contact
|
||||
func (p *Profile) BlockPeer(onion string) (err error) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
contact, ok := p.Contacts[onion]
|
||||
if ok {
|
||||
contact.Authorization = auth
|
||||
contact.Blocked = true
|
||||
} else {
|
||||
err = errors.New("peer does not exist")
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
// GetContactAuthorization returns the contact's authorization level
|
||||
func (p *Profile) GetContactAuthorization(onion string) Authorization {
|
||||
// TrustPeer sets a contact to trusted
|
||||
func (p *Profile) TrustPeer(onion string) (err error) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
contact, ok := p.Contacts[onion]
|
||||
if ok {
|
||||
return contact.Authorization
|
||||
contact.Trusted = true
|
||||
} else {
|
||||
err = errors.New("peer does not exist")
|
||||
}
|
||||
return AuthUnknown
|
||||
return
|
||||
}
|
||||
|
||||
// ContactsAuthorizations calculates a list of Peers who are at the supplied auth levels
|
||||
func (p *Profile) ContactsAuthorizations(authorizationFilter ...Authorization) map[string]Authorization {
|
||||
authorizations := map[string]Authorization{}
|
||||
for _, contact := range p.GetContacts() {
|
||||
c, _ := p.GetContact(contact)
|
||||
authorizations[c.Onion] = c.Authorization
|
||||
// IsBlocked returns true if the contact has been blocked, false otherwise
|
||||
func (p *Profile) IsBlocked(onion string) bool {
|
||||
contact, ok := p.GetContact(onion)
|
||||
if ok {
|
||||
return contact.Blocked
|
||||
}
|
||||
return authorizations
|
||||
return false
|
||||
}
|
||||
|
||||
// GetContact returns a contact if the profile has it
|
||||
|
@ -322,36 +178,22 @@ func (p *Profile) GetContact(onion string) (*PublicProfile, bool) {
|
|||
return contact, ok
|
||||
}
|
||||
|
||||
// VerifyGroupMessage confirms the authenticity of a message given an sender onion, ciphertext and signature.
|
||||
// The goal of this function is 2-fold:
|
||||
// 1. We confirm that the sender referenced in the group text is the actual sender of the message (or at least
|
||||
// knows the senders private key)
|
||||
// 2. Secondly, we confirm that the sender sent the message to a particular group id on a specific server (it doesn't
|
||||
// matter if we actually received this message from the server or from a hybrid protocol, all that matters is
|
||||
// that the sender and receivers agree that this message was intended for the group
|
||||
// The 2nd point is important as it prevents an attack documented in the original Cwtch paper (and later at
|
||||
// https://docs.openprivacy.ca/cwtch-security-handbook/groups.html) in which a malicious profile sets up 2 groups
|
||||
// on two different servers with the same key and then forwards messages between them to convince the parties in
|
||||
// each group that they are actually in one big group (with the intent to later censor and/or selectively send messages
|
||||
// to each group).
|
||||
func (p *Profile) VerifyGroupMessage(onion string, groupID string, ciphertext []byte, signature []byte) bool {
|
||||
// VerifyGroupMessage confirms the authenticity of a message given an onion, message and signature.
|
||||
func (p *Profile) VerifyGroupMessage(onion string, groupID string, message string, timestamp int32, ciphertext []byte, signature []byte) bool {
|
||||
|
||||
group := p.GetGroup(groupID)
|
||||
group := p.GetGroupByGroupID(groupID)
|
||||
if group == nil {
|
||||
return false
|
||||
}
|
||||
|
||||
// We use our group id, a known reference server and the ciphertext of the message.
|
||||
m := groupID + group.GroupServer + string(ciphertext)
|
||||
|
||||
// If the message is ostensibly from us then we check it against our public key...
|
||||
if onion == p.Onion {
|
||||
m := groupID + group.GroupServer + string(ciphertext)
|
||||
return ed25519.Verify(p.Ed25519PublicKey, []byte(m), signature)
|
||||
}
|
||||
|
||||
// Otherwise we derive the public key from the sender and check it against that.
|
||||
m := groupID + group.GroupServer + string(ciphertext)
|
||||
decodedPub, err := base32.StdEncoding.DecodeString(strings.ToUpper(onion))
|
||||
if err == nil && len(decodedPub) >= 32 {
|
||||
if err == nil {
|
||||
return ed25519.Verify(decodedPub[:32], []byte(m), signature)
|
||||
}
|
||||
return false
|
||||
|
@ -365,160 +207,145 @@ func (p *Profile) SignMessage(message string) []byte {
|
|||
|
||||
// StartGroup when given a server, creates a new Group under this profile and returns the group id an a precomputed
|
||||
// invite which can be sent on the wire.
|
||||
func (p *Profile) StartGroup(server string) (groupID string, invite string, err error) {
|
||||
func (p *Profile) StartGroup(server string) (groupID string, invite []byte, err error) {
|
||||
return p.StartGroupWithMessage(server, []byte{})
|
||||
}
|
||||
|
||||
// StartGroupWithMessage when given a server, and an initial message creates a new Group under this profile and returns the group id an a precomputed
|
||||
// invite which can be sent on the wire.
|
||||
func (p *Profile) StartGroupWithMessage(server string, initialMessage []byte) (groupID string, invite []byte, err error) {
|
||||
group, err := NewGroup(server)
|
||||
if err != nil {
|
||||
return "", "", err
|
||||
return "", nil, err
|
||||
}
|
||||
groupID = group.GroupID
|
||||
invite, err = group.Invite()
|
||||
signedGroupID := p.SignMessage(groupID + server)
|
||||
group.SignGroup(signedGroupID)
|
||||
invite, err = group.Invite(initialMessage)
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
p.Groups[group.GroupID] = group
|
||||
return
|
||||
}
|
||||
|
||||
// GetGroup a pointer to a Group by the group Id, returns nil if no group found.
|
||||
func (p *Profile) GetGroup(groupID string) (g *Group) {
|
||||
// GetGroupByGroupID a pointer to a Group by the group Id, returns nil if no group found.
|
||||
func (p *Profile) GetGroupByGroupID(groupID string) (g *Group) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
g = p.Groups[groupID]
|
||||
return
|
||||
}
|
||||
|
||||
// ProcessInvite validates a group invite and adds a new group invite to the profile if it is valid.
|
||||
// returns the new group ID on success, error on fail.
|
||||
func (p *Profile) ProcessInvite(invite string) (string, error) {
|
||||
gci, err := ValidateInvite(invite)
|
||||
if err == nil {
|
||||
if server, exists := p.GetContact(gci.ServerHost); !exists || !server.IsServer() {
|
||||
return "", fmt.Errorf("unknown server. a server key bundle needs to be imported before this group can be verified")
|
||||
}
|
||||
group := new(Group)
|
||||
group.Version = CurrentGroupVersion
|
||||
group.GroupID = gci.GroupID
|
||||
group.LocalID = GenerateRandomID()
|
||||
copy(group.GroupKey[:], gci.SharedKey[:])
|
||||
group.GroupServer = gci.ServerHost
|
||||
group.Accepted = false
|
||||
group.Attributes = make(map[string]string)
|
||||
group.Attributes[attr.GetLocalScope("name")] = gci.GroupName
|
||||
p.AddGroup(group)
|
||||
return gci.GroupID, nil
|
||||
}
|
||||
return "", err
|
||||
// ProcessInvite adds a new group invite to the profile.
|
||||
func (p *Profile) ProcessInvite(gci *protocol.GroupChatInvite, peerHostname string) {
|
||||
group := new(Group)
|
||||
group.GroupID = gci.GetGroupName()
|
||||
group.SignedGroupID = gci.GetSignedGroupId()
|
||||
copy(group.GroupKey[:], gci.GetGroupSharedKey()[:])
|
||||
group.GroupServer = gci.GetServerHost()
|
||||
group.InitialMessage = gci.GetInitialMessage()[:]
|
||||
group.Accepted = false
|
||||
group.Owner = peerHostname
|
||||
p.AddGroup(group)
|
||||
}
|
||||
|
||||
// AddGroup is a convenience method for adding a group to a profile.
|
||||
func (p *Profile) AddGroup(group *Group) {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
_, exists := p.Groups[group.GroupID]
|
||||
existingGroup, exists := p.Groups[group.GroupID]
|
||||
if !exists {
|
||||
owner, ok := p.GetContact(group.Owner)
|
||||
if ok {
|
||||
valid := ed25519.Verify(owner.Ed25519PublicKey, []byte(group.GroupID+group.GroupServer), group.SignedGroupID)
|
||||
if valid {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
p.Groups[group.GroupID] = group
|
||||
}
|
||||
}
|
||||
} else if exists && existingGroup.Owner == group.Owner {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
p.Groups[group.GroupID] = group
|
||||
}
|
||||
|
||||
// If we are sent an invite or group update by someone who is not an owner
|
||||
// then we reject the group.
|
||||
}
|
||||
|
||||
// AttemptDecryption takes a ciphertext and signature and attempts to decrypt it under known groups.
|
||||
// If successful, adds the message to the group's timeline
|
||||
func (p *Profile) AttemptDecryption(ciphertext []byte, signature []byte) (bool, string, *Message, bool) {
|
||||
func (p *Profile) AttemptDecryption(ciphertext []byte, signature []byte) (bool, *Message) {
|
||||
for _, group := range p.Groups {
|
||||
success, dgm := group.DecryptMessage(ciphertext)
|
||||
if success {
|
||||
verified := p.VerifyGroupMessage(dgm.Onion, group.GroupID, ciphertext, signature)
|
||||
|
||||
// Assert that we know the owner of the group
|
||||
owner, ok := p.Contacts[group.Owner]
|
||||
if ok {
|
||||
valid := ed25519.Verify(owner.Ed25519PublicKey, []byte(group.GroupID+group.GroupServer), dgm.SignedGroupId)
|
||||
// If we can decrypt the message, but the group id is wrong that means that
|
||||
// this message is from someone who was not invited to the group.
|
||||
// As such this group has been compromised, probably by one of the other members.
|
||||
// We set the flag to be handled by the UX and reject the message.
|
||||
if !valid {
|
||||
group.Compromised()
|
||||
return false, nil
|
||||
}
|
||||
}
|
||||
|
||||
verified := p.VerifyGroupMessage(dgm.GetOnion(), group.GroupID, dgm.GetText(), dgm.GetTimestamp(), ciphertext, signature)
|
||||
|
||||
// So we have a message that has a valid group key, but the signature can't be verified.
|
||||
// The most obvious explanation for this is that the group key has been compromised (or we are in an open group and the server is being malicious)
|
||||
// Either way, someone who has the private key is being detectably bad so we are just going to throw this message away and mark the group as Compromised.
|
||||
if !verified {
|
||||
group.Compromised()
|
||||
return false, group.GroupID, nil, false
|
||||
return false, nil
|
||||
}
|
||||
message, seen := group.AddMessage(dgm, signature)
|
||||
return true, group.GroupID, message, seen
|
||||
|
||||
return true, group.AddMessage(dgm, signature)
|
||||
}
|
||||
}
|
||||
|
||||
// If we couldn't find a group to decrypt the message with we just return false. This is an expected case
|
||||
return false, "", nil, false
|
||||
return false, nil
|
||||
}
|
||||
|
||||
func getRandomness(arr *[]byte) {
|
||||
if _, err := io.ReadFull(rand.Reader, (*arr)[:]); err != nil {
|
||||
if err != nil {
|
||||
// If we can't do randomness, just crash something is very very wrong and we are not going
|
||||
// to resolve it here....
|
||||
panic(err.Error())
|
||||
}
|
||||
utils.CheckError(err)
|
||||
}
|
||||
}
|
||||
|
||||
// EncryptMessageToGroup when given a message and a group, encrypts and signs the message under the group and
|
||||
// profile
|
||||
func (p *Profile) EncryptMessageToGroup(message string, groupID string) ([]byte, []byte, error) {
|
||||
|
||||
if len(message) > MaxGroupMessageLength {
|
||||
return nil, nil, errors.New("group message is too long")
|
||||
}
|
||||
|
||||
group := p.GetGroup(groupID)
|
||||
group := p.GetGroupByGroupID(groupID)
|
||||
if group != nil {
|
||||
timestamp := time.Now().Unix()
|
||||
|
||||
// Select the latest message from the timeline as a reference point.
|
||||
var prevSig []byte
|
||||
if len(group.Timeline.Messages) > 0 {
|
||||
prevSig = group.Timeline.Messages[len(group.Timeline.Messages)-1].Signature
|
||||
} else {
|
||||
prevSig = []byte(group.GroupID)
|
||||
prevSig = group.SignedGroupID
|
||||
}
|
||||
|
||||
lenPadding := MaxGroupMessageLength - len(message)
|
||||
lenPadding := 1024 - len(message)
|
||||
padding := make([]byte, lenPadding)
|
||||
getRandomness(&padding)
|
||||
hexGroupID, err := hex.DecodeString(group.GroupID)
|
||||
if err != nil {
|
||||
return nil, nil, err
|
||||
}
|
||||
|
||||
dm := &groups.DecryptedGroupMessage{
|
||||
Onion: p.Onion,
|
||||
Text: message,
|
||||
SignedGroupID: hexGroupID,
|
||||
Timestamp: uint64(timestamp),
|
||||
dm := &protocol.DecryptedGroupMessage{
|
||||
Onion: proto.String(p.Onion),
|
||||
Text: proto.String(message),
|
||||
SignedGroupId: group.SignedGroupID[:],
|
||||
Timestamp: proto.Int32(int32(timestamp)),
|
||||
PreviousMessageSig: prevSig,
|
||||
Padding: padding[:],
|
||||
}
|
||||
|
||||
ciphertext, err := group.EncryptMessage(dm)
|
||||
if err != nil {
|
||||
return nil, nil, err
|
||||
}
|
||||
signature := p.SignMessage(groupID + group.GroupServer + string(ciphertext))
|
||||
group.AddSentMessage(dm, signature)
|
||||
return ciphertext, signature, nil
|
||||
}
|
||||
return nil, nil, errors.New("group does not exist")
|
||||
}
|
||||
|
||||
// GetCopy returns a full deep copy of the Profile struct and its members (timeline inclusion control by arg)
|
||||
func (p *Profile) GetCopy(timeline bool) *Profile {
|
||||
p.lock.Lock()
|
||||
defer p.lock.Unlock()
|
||||
|
||||
newp := new(Profile)
|
||||
bytes, _ := json.Marshal(p)
|
||||
json.Unmarshal(bytes, &newp)
|
||||
|
||||
if timeline {
|
||||
for groupID := range newp.Groups {
|
||||
newp.Groups[groupID].Timeline = *p.Groups[groupID].Timeline.GetCopy()
|
||||
}
|
||||
|
||||
for peerID := range newp.Contacts {
|
||||
newp.Contacts[peerID].Timeline = *p.Contacts[peerID].Timeline.GetCopy()
|
||||
}
|
||||
}
|
||||
|
||||
return newp
|
||||
}
|
||||
|
|
|
@ -1,6 +1,8 @@
|
|||
package model
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"testing"
|
||||
)
|
||||
|
||||
|
@ -8,8 +10,15 @@ func TestProfileIdentity(t *testing.T) {
|
|||
sarah := GenerateNewProfile("Sarah")
|
||||
alice := GenerateNewProfile("Alice")
|
||||
|
||||
alice.AddContact(sarah.Onion, &sarah.PublicProfile)
|
||||
if alice.Contacts[sarah.Onion].Name != "Sarah" {
|
||||
message := sarah.GetCwtchIdentityPacket()
|
||||
|
||||
ci := &protocol.CwtchPeerPacket{}
|
||||
err := proto.Unmarshal(message, ci)
|
||||
if err != nil {
|
||||
t.Errorf("alice should have added sarah as a contact %v", err)
|
||||
}
|
||||
alice.AddCwtchIdentity("sarah.onion", ci.GetCwtchIdentify())
|
||||
if alice.Contacts["sarah.onion"].Name != "Sarah" {
|
||||
t.Errorf("alice should have added sarah as a contact %v", alice.Contacts)
|
||||
}
|
||||
|
||||
|
@ -17,8 +26,8 @@ func TestProfileIdentity(t *testing.T) {
|
|||
t.Errorf("alice should be only contact: %v", alice.GetContacts())
|
||||
}
|
||||
|
||||
alice.SetAttribute("test", "hello world")
|
||||
value, _ := alice.GetAttribute("test")
|
||||
alice.SetCustomAttribute("test", "hello world")
|
||||
value, _ := alice.GetCustomAttribute("test")
|
||||
if value != "hello world" {
|
||||
t.Errorf("value from custom attribute should have been 'hello world', instead was: %v", value)
|
||||
}
|
||||
|
@ -31,9 +40,13 @@ func TestTrustPeer(t *testing.T) {
|
|||
alice := GenerateNewProfile("Alice")
|
||||
sarah.AddContact(alice.Onion, &alice.PublicProfile)
|
||||
alice.AddContact(sarah.Onion, &sarah.PublicProfile)
|
||||
alice.SetContactAuthorization(sarah.Onion, AuthApproved)
|
||||
if alice.GetContactAuthorization(sarah.Onion) != AuthApproved {
|
||||
t.Errorf("peer should be approved")
|
||||
alice.TrustPeer(sarah.Onion)
|
||||
if alice.IsBlocked(sarah.Onion) {
|
||||
t.Errorf("peer should not be blocked")
|
||||
}
|
||||
|
||||
if alice.TrustPeer("") == nil {
|
||||
t.Errorf("trusting a non existent peer should error")
|
||||
}
|
||||
}
|
||||
|
||||
|
@ -42,13 +55,13 @@ func TestBlockPeer(t *testing.T) {
|
|||
alice := GenerateNewProfile("Alice")
|
||||
sarah.AddContact(alice.Onion, &alice.PublicProfile)
|
||||
alice.AddContact(sarah.Onion, &sarah.PublicProfile)
|
||||
alice.SetContactAuthorization(sarah.Onion, AuthBlocked)
|
||||
if alice.GetContactAuthorization(sarah.Onion) != AuthBlocked {
|
||||
t.Errorf("peer should be blocked")
|
||||
alice.BlockPeer(sarah.Onion)
|
||||
if !alice.IsBlocked(sarah.Onion) {
|
||||
t.Errorf("peer should not be blocked")
|
||||
}
|
||||
|
||||
if alice.SetContactAuthorization("", AuthUnknown) == nil {
|
||||
t.Errorf("Seting Auth level of a non existent peer should error")
|
||||
if alice.BlockPeer("") == nil {
|
||||
t.Errorf("blocking a non existent peer should error")
|
||||
}
|
||||
}
|
||||
|
||||
|
@ -62,14 +75,14 @@ func TestRejectGroupInvite(t *testing.T) {
|
|||
alice := GenerateNewProfile("Alice")
|
||||
sarah.AddContact(alice.Onion, &alice.PublicProfile)
|
||||
alice.AddContact(sarah.Onion, &sarah.PublicProfile)
|
||||
// The lightest weight server entry possible (usually we would import a key bundle...)
|
||||
sarah.AddContact("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd", &PublicProfile{Attributes: map[string]string{string(KeyTypeServerOnion): "2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd"}})
|
||||
|
||||
gid, invite, _ := alice.StartGroup("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd")
|
||||
sarah.ProcessInvite(invite)
|
||||
group := alice.GetGroup(gid)
|
||||
gid, invite, _ := alice.StartGroup("aaa.onion")
|
||||
gci := &protocol.CwtchPeerPacket{}
|
||||
proto.Unmarshal(invite, gci)
|
||||
sarah.ProcessInvite(gci.GetGroupChatInvite(), alice.Onion)
|
||||
group := alice.GetGroupByGroupID(gid)
|
||||
if len(sarah.Groups) == 1 {
|
||||
if sarah.GetGroup(group.GroupID).Accepted {
|
||||
if sarah.GetGroupByGroupID(group.GroupID).Accepted {
|
||||
t.Errorf("Group should not be accepted")
|
||||
}
|
||||
sarah.RejectInvite(group.GroupID)
|
||||
|
@ -87,48 +100,47 @@ func TestProfileGroup(t *testing.T) {
|
|||
sarah.AddContact(alice.Onion, &alice.PublicProfile)
|
||||
alice.AddContact(sarah.Onion, &sarah.PublicProfile)
|
||||
|
||||
gid, invite, _ := alice.StartGroup("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd")
|
||||
|
||||
// The lightest weight server entry possible (usually we would import a key bundle...)
|
||||
sarah.AddContact("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd", &PublicProfile{Attributes: map[string]string{string(KeyTypeServerOnion): "2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd"}})
|
||||
sarah.ProcessInvite(invite)
|
||||
gid, invite, _ := alice.StartGroupWithMessage("aaa.onion", []byte("Hello World"))
|
||||
gci := &protocol.CwtchPeerPacket{}
|
||||
proto.Unmarshal(invite, gci)
|
||||
sarah.ProcessInvite(gci.GetGroupChatInvite(), alice.Onion)
|
||||
if len(sarah.GetGroups()) != 1 {
|
||||
t.Errorf("sarah should only be in 1 group instead: %v", sarah.GetGroups())
|
||||
}
|
||||
|
||||
group := alice.GetGroup(gid)
|
||||
group := alice.GetGroupByGroupID(gid)
|
||||
sarah.AcceptInvite(group.GroupID)
|
||||
c, s1, _ := sarah.EncryptMessageToGroup("Hello World", group.GroupID)
|
||||
alice.AttemptDecryption(c, s1)
|
||||
|
||||
gid2, invite2, _ := alice.StartGroup("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd")
|
||||
sarah.ProcessInvite(invite2)
|
||||
group2 := alice.GetGroup(gid2)
|
||||
gid2, invite2, _ := alice.StartGroup("bbb.onion")
|
||||
gci2 := &protocol.CwtchPeerPacket{}
|
||||
proto.Unmarshal(invite2, gci2)
|
||||
sarah.ProcessInvite(gci2.GetGroupChatInvite(), alice.Onion)
|
||||
group2 := alice.GetGroupByGroupID(gid2)
|
||||
c2, s2, _ := sarah.EncryptMessageToGroup("Hello World", group2.GroupID)
|
||||
alice.AttemptDecryption(c2, s2)
|
||||
|
||||
_, _, err := sarah.EncryptMessageToGroup(string(make([]byte, MaxGroupMessageLength*2)), group2.GroupID)
|
||||
if err == nil {
|
||||
t.Errorf("Overly long message should have returned an error")
|
||||
sarahGroup := sarah.GetGroupByGroupID(group.GroupID)
|
||||
im := sarahGroup.GetInitialMessage()
|
||||
if string(im) != "Hello World" {
|
||||
t.Errorf("Initial Message was not stored properly: %v", im)
|
||||
}
|
||||
|
||||
bob := GenerateNewProfile("bob")
|
||||
bob.AddContact(alice.Onion, &alice.PublicProfile)
|
||||
// The lightest weight server entry possible (usually we would import a key bundle...)
|
||||
bob.AddContact("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd", &PublicProfile{Attributes: map[string]string{string(KeyTypeServerOnion): "2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd"}})
|
||||
|
||||
bob.ProcessInvite(invite2)
|
||||
bob.ProcessInvite(gci2.GetGroupChatInvite(), alice.Onion)
|
||||
c3, s3, err := bob.EncryptMessageToGroup("Bobs Message", group2.GroupID)
|
||||
if err == nil {
|
||||
ok, _, message, _ := alice.AttemptDecryption(c3, s3)
|
||||
ok, message := alice.AttemptDecryption(c3, s3)
|
||||
if !ok {
|
||||
t.Errorf("Bobs message to the group should be decrypted %v %v", message, ok)
|
||||
}
|
||||
|
||||
eve := GenerateNewProfile("eve")
|
||||
ok, _, _, _ = eve.AttemptDecryption(c3, s3)
|
||||
ok, _ = eve.AttemptDecryption(c3, s3)
|
||||
if ok {
|
||||
t.Errorf("Eves hould not be able to decrypt Messages!")
|
||||
t.Errorf("Eves hould not be able to decrypt messages!")
|
||||
}
|
||||
} else {
|
||||
t.Errorf("Bob failed to encrypt a message to the group")
|
||||
|
|
|
@ -0,0 +1,149 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"sync"
|
||||
"time"
|
||||
)
|
||||
|
||||
// Manager encapsulates all the logic necessary to manage outgoing peer and server connections.
|
||||
type Manager struct {
|
||||
peerConnections map[string]*PeerPeerConnection
|
||||
serverConnections map[string]*PeerServerConnection
|
||||
lock sync.Mutex
|
||||
breakChannel chan bool
|
||||
}
|
||||
|
||||
// NewConnectionsManager creates a new instance of Manager.
|
||||
func NewConnectionsManager() *Manager {
|
||||
m := new(Manager)
|
||||
m.peerConnections = make(map[string]*PeerPeerConnection)
|
||||
m.serverConnections = make(map[string]*PeerServerConnection)
|
||||
m.breakChannel = make(chan bool)
|
||||
return m
|
||||
}
|
||||
|
||||
// ManagePeerConnection creates a new PeerConnection for the given Host and Profile.
|
||||
func (m *Manager) ManagePeerConnection(host string, profile *model.Profile, dataHandler func(string, []byte) []byte) *PeerPeerConnection {
|
||||
m.lock.Lock()
|
||||
defer m.lock.Unlock()
|
||||
|
||||
_, exists := m.peerConnections[host]
|
||||
if !exists {
|
||||
ppc := NewPeerPeerConnection(host, profile, dataHandler)
|
||||
go ppc.Run()
|
||||
m.peerConnections[host] = ppc
|
||||
return ppc
|
||||
}
|
||||
return m.peerConnections[host]
|
||||
}
|
||||
|
||||
// ManageServerConnection creates a new ServerConnection for Host with the given callback handler.
|
||||
func (m *Manager) ManageServerConnection(host string, handler func(string, *protocol.GroupMessage)) {
|
||||
m.lock.Lock()
|
||||
|
||||
_, exists := m.serverConnections[host]
|
||||
if !exists {
|
||||
psc := NewPeerServerConnection(host)
|
||||
go psc.Run()
|
||||
psc.GroupMessageHandler = handler
|
||||
m.serverConnections[host] = psc
|
||||
}
|
||||
m.lock.Unlock()
|
||||
}
|
||||
|
||||
// GetPeers returns a map of all peer connections with their state
|
||||
func (m *Manager) GetPeers() map[string]ConnectionState {
|
||||
rm := make(map[string]ConnectionState)
|
||||
m.lock.Lock()
|
||||
for onion, ppc := range m.peerConnections {
|
||||
rm[onion] = ppc.GetState()
|
||||
}
|
||||
m.lock.Unlock()
|
||||
return rm
|
||||
}
|
||||
|
||||
// GetServers returns a map of all server connections with their state.
|
||||
func (m *Manager) GetServers() map[string]ConnectionState {
|
||||
rm := make(map[string]ConnectionState)
|
||||
m.lock.Lock()
|
||||
for onion, psc := range m.serverConnections {
|
||||
rm[onion] = psc.GetState()
|
||||
}
|
||||
m.lock.Unlock()
|
||||
return rm
|
||||
}
|
||||
|
||||
// GetPeerPeerConnectionForOnion safely returns a given peer connection
|
||||
func (m *Manager) GetPeerPeerConnectionForOnion(host string) (ppc *PeerPeerConnection) {
|
||||
m.lock.Lock()
|
||||
ppc = m.peerConnections[host]
|
||||
m.lock.Unlock()
|
||||
return
|
||||
}
|
||||
|
||||
// GetPeerServerConnectionForOnion safely returns a given host connection
|
||||
func (m *Manager) GetPeerServerConnectionForOnion(host string) (psc *PeerServerConnection) {
|
||||
m.lock.Lock()
|
||||
psc = m.serverConnections[host]
|
||||
m.lock.Unlock()
|
||||
return
|
||||
}
|
||||
|
||||
// AttemptReconnections repeatedly attempts to reconnect with failed peers and servers.
|
||||
func (m *Manager) AttemptReconnections() {
|
||||
timeout := time.Duration(0) // first pass right away
|
||||
|
||||
for {
|
||||
select {
|
||||
case <-time.After(timeout):
|
||||
m.lock.Lock()
|
||||
for _, ppc := range m.peerConnections {
|
||||
if ppc.GetState() == FAILED {
|
||||
go ppc.Run()
|
||||
}
|
||||
}
|
||||
m.lock.Unlock()
|
||||
|
||||
m.lock.Lock()
|
||||
for _, psc := range m.serverConnections {
|
||||
if psc.GetState() == FAILED {
|
||||
go psc.Run()
|
||||
}
|
||||
}
|
||||
m.lock.Unlock()
|
||||
|
||||
// Launch Another Run In 30 Seconds
|
||||
timeout = time.Duration(30 * time.Second)
|
||||
case <-m.breakChannel:
|
||||
return
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// ClosePeerConnection closes an existing peer connection
|
||||
func (m *Manager) ClosePeerConnection(onion string) {
|
||||
m.lock.Lock()
|
||||
pc, ok := m.peerConnections[onion]
|
||||
if ok {
|
||||
pc.Close()
|
||||
delete(m.peerConnections, onion)
|
||||
}
|
||||
m.lock.Unlock()
|
||||
}
|
||||
|
||||
// Shutdown closes all connections under managment (freeing their goroutines)
|
||||
func (m *Manager) Shutdown() {
|
||||
m.breakChannel <- true
|
||||
m.lock.Lock()
|
||||
for onion, ppc := range m.peerConnections {
|
||||
ppc.Close()
|
||||
delete(m.peerConnections, onion)
|
||||
}
|
||||
for onion, psc := range m.serverConnections {
|
||||
psc.Close()
|
||||
delete(m.serverConnections, onion)
|
||||
}
|
||||
m.lock.Unlock()
|
||||
}
|
|
@ -0,0 +1,10 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"testing"
|
||||
)
|
||||
|
||||
func TestConnectionsManager(t *testing.T) {
|
||||
// TODO We need to encapsulate connections behind a well defined interface for tesintg
|
||||
NewConnectionsManager()
|
||||
}
|
|
@ -0,0 +1,151 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/peer/peer"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connection"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/identity"
|
||||
"log"
|
||||
"time"
|
||||
)
|
||||
|
||||
// PeerPeerConnection encapsulates a single outgoing Peer->Peer connection
|
||||
type PeerPeerConnection struct {
|
||||
connection.AutoConnectionHandler
|
||||
PeerHostname string
|
||||
state ConnectionState
|
||||
connection *connection.Connection
|
||||
profile *model.Profile
|
||||
dataHandler func(string, []byte) []byte
|
||||
}
|
||||
|
||||
// NewPeerPeerConnection creates a new peer connection for the given hostname and profile.
|
||||
func NewPeerPeerConnection(peerhostname string, profile *model.Profile, dataHandler func(string, []byte) []byte) *PeerPeerConnection {
|
||||
ppc := new(PeerPeerConnection)
|
||||
ppc.PeerHostname = peerhostname
|
||||
ppc.profile = profile
|
||||
ppc.dataHandler = dataHandler
|
||||
ppc.Init()
|
||||
return ppc
|
||||
}
|
||||
|
||||
// GetState returns the current connection state
|
||||
func (ppc *PeerPeerConnection) GetState() ConnectionState {
|
||||
return ppc.state
|
||||
}
|
||||
|
||||
// ClientIdentity passes the given CwtchIdentity packet to the profile.
|
||||
func (ppc *PeerPeerConnection) ClientIdentity(ci *protocol.CwtchIdentity) {
|
||||
ppc.profile.AddCwtchIdentity(ppc.PeerHostname, ci)
|
||||
}
|
||||
|
||||
// HandleGroupInvite passes the given group invite tothe profile
|
||||
func (ppc *PeerPeerConnection) HandleGroupInvite(gci *protocol.GroupChatInvite) {
|
||||
ppc.profile.ProcessInvite(gci, ppc.PeerHostname)
|
||||
}
|
||||
|
||||
// GetClientIdentityPacket returns nil to avoid peers constantly sending identity packets to eachother.
|
||||
func (ppc *PeerPeerConnection) GetClientIdentityPacket() []byte {
|
||||
return nil
|
||||
}
|
||||
|
||||
// HandlePacket handles data packets on the optional data channel
|
||||
func (ppc *PeerPeerConnection) HandlePacket(data []byte) []byte {
|
||||
return ppc.dataHandler(ppc.PeerHostname, data)
|
||||
}
|
||||
|
||||
// SendPacket sends data packets on the optional data channel
|
||||
func (ppc *PeerPeerConnection) SendPacket(data []byte) {
|
||||
ppc.WaitTilAuthenticated()
|
||||
ppc.connection.Do(func() error {
|
||||
channel := ppc.connection.Channel("im.cwtch.peer.data", channels.Outbound)
|
||||
if channel != nil {
|
||||
peerchannel, ok := channel.Handler.(*peer.CwtchPeerDataChannel)
|
||||
if ok {
|
||||
log.Printf("Sending packet\n")
|
||||
peerchannel.SendMessage(data)
|
||||
}
|
||||
}
|
||||
return nil
|
||||
})
|
||||
}
|
||||
|
||||
// SendGroupInvite sends the given serialized invite packet to the Peer
|
||||
func (ppc *PeerPeerConnection) SendGroupInvite(invite []byte) {
|
||||
ppc.WaitTilAuthenticated()
|
||||
ppc.connection.Do(func() error {
|
||||
channel := ppc.connection.Channel("im.cwtch.peer", channels.Outbound)
|
||||
if channel != nil {
|
||||
peerchannel, ok := channel.Handler.(*peer.CwtchPeerChannel)
|
||||
if ok {
|
||||
log.Printf("Sending group invite packet\n")
|
||||
peerchannel.SendMessage(invite)
|
||||
}
|
||||
}
|
||||
return nil
|
||||
})
|
||||
}
|
||||
|
||||
// WaitTilAuthenticated waits until the underlying connection is authenticated
|
||||
func (ppc *PeerPeerConnection) WaitTilAuthenticated() {
|
||||
for {
|
||||
if ppc.GetState() == AUTHENTICATED {
|
||||
break
|
||||
}
|
||||
time.Sleep(time.Second * 5)
|
||||
}
|
||||
}
|
||||
|
||||
// Run manages the setup and teardown of a peer->peer connection
|
||||
func (ppc *PeerPeerConnection) Run() error {
|
||||
ppc.state = CONNECTING
|
||||
rc, err := goricochet.Open(ppc.PeerHostname)
|
||||
if err == nil {
|
||||
rc.TraceLog(false)
|
||||
ppc.connection = rc
|
||||
ppc.state = CONNECTED
|
||||
_, err := connection.HandleOutboundConnection(ppc.connection).ProcessAuthAsV3Client(identity.InitializeV3(ppc.profile.Name, &ppc.profile.Ed25519PrivateKey, &ppc.profile.Ed25519PublicKey))
|
||||
if err == nil {
|
||||
ppc.state = AUTHENTICATED
|
||||
go func() {
|
||||
ppc.connection.Do(func() error {
|
||||
ppc.connection.RequestOpenChannel("im.cwtch.peer", &peer.CwtchPeerChannel{Handler: ppc})
|
||||
return nil
|
||||
})
|
||||
|
||||
if ppc.dataHandler != nil {
|
||||
ppc.connection.Do(func() error {
|
||||
ppc.connection.RequestOpenChannel("im.cwtch.peer.data", &peer.CwtchPeerDataChannel{Handler: ppc})
|
||||
return nil
|
||||
})
|
||||
}
|
||||
|
||||
time.Sleep(time.Second * 1)
|
||||
ppc.connection.Do(func() error {
|
||||
channel := ppc.connection.Channel("im.cwtch.peer", channels.Outbound)
|
||||
if channel != nil {
|
||||
peerchannel, ok := channel.Handler.(*peer.CwtchPeerChannel)
|
||||
if ok {
|
||||
peerchannel.SendMessage(ppc.profile.GetCwtchIdentityPacket())
|
||||
}
|
||||
}
|
||||
return nil
|
||||
})
|
||||
|
||||
}()
|
||||
|
||||
ppc.connection.Process(ppc)
|
||||
}
|
||||
}
|
||||
ppc.state = FAILED
|
||||
return err
|
||||
}
|
||||
|
||||
// Close closes the connection
|
||||
func (ppc *PeerPeerConnection) Close() {
|
||||
ppc.state = KILLED
|
||||
ppc.connection.Conn.Close()
|
||||
}
|
|
@ -0,0 +1,111 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/peer/peer"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connection"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/identity"
|
||||
"golang.org/x/crypto/ed25519"
|
||||
"net"
|
||||
"testing"
|
||||
"time"
|
||||
)
|
||||
|
||||
func PeerAuthValid(hostname string, key ed25519.PublicKey) (allowed, known bool) {
|
||||
return true, true
|
||||
}
|
||||
|
||||
func runtestpeer(t *testing.T, tp *TestPeer, identity identity.Identity) {
|
||||
ln, _ := net.Listen("tcp", "127.0.0.1:5452")
|
||||
conn, _ := ln.Accept()
|
||||
defer conn.Close()
|
||||
|
||||
rc, err := goricochet.NegotiateVersionInbound(conn)
|
||||
if err != nil {
|
||||
t.Errorf("Negotiate Version Error: %v", err)
|
||||
}
|
||||
rc.TraceLog(true)
|
||||
err = connection.HandleInboundConnection(rc).ProcessAuthAsV3Server(identity, PeerAuthValid)
|
||||
if err != nil {
|
||||
t.Errorf("ServerAuth Error: %v", err)
|
||||
}
|
||||
tp.RegisterChannelHandler("im.cwtch.peer", func() channels.Handler {
|
||||
cpc := new(peer.CwtchPeerChannel)
|
||||
cpc.Handler = tp
|
||||
return cpc
|
||||
})
|
||||
|
||||
go func() {
|
||||
alice := model.GenerateNewProfile("alice")
|
||||
time.Sleep(time.Second * 1)
|
||||
rc.Do(func() error {
|
||||
channel := rc.Channel("im.cwtch.peer", channels.Inbound)
|
||||
if channel != nil {
|
||||
peerchannel, ok := channel.Handler.(*peer.CwtchPeerChannel)
|
||||
if ok {
|
||||
peerchannel.SendMessage(alice.GetCwtchIdentityPacket())
|
||||
}
|
||||
}
|
||||
return nil
|
||||
})
|
||||
}()
|
||||
|
||||
rc.Process(tp)
|
||||
}
|
||||
|
||||
type TestPeer struct {
|
||||
connection.AutoConnectionHandler
|
||||
ReceivedIdentityPacket bool
|
||||
ReceivedGroupInvite bool
|
||||
}
|
||||
|
||||
func (tp *TestPeer) ClientIdentity(ci *protocol.CwtchIdentity) {
|
||||
tp.ReceivedIdentityPacket = true
|
||||
}
|
||||
|
||||
func (tp *TestPeer) HandleGroupInvite(gci *protocol.GroupChatInvite) {
|
||||
tp.ReceivedGroupInvite = true
|
||||
}
|
||||
|
||||
func (tp *TestPeer) GetClientIdentityPacket() []byte {
|
||||
return nil
|
||||
}
|
||||
|
||||
func TestPeerPeerConnection(t *testing.T) {
|
||||
pub, priv, _ := ed25519.GenerateKey(rand.Reader)
|
||||
identity := identity.InitializeV3("", &priv, &pub)
|
||||
|
||||
profile := model.GenerateNewProfile("alice")
|
||||
hostname := identity.Hostname()
|
||||
ppc := NewPeerPeerConnection("127.0.0.1:5452|"+hostname, profile, nil)
|
||||
|
||||
tp := new(TestPeer)
|
||||
tp.Init()
|
||||
go runtestpeer(t, tp, identity)
|
||||
state := ppc.GetState()
|
||||
if state != DISCONNECTED {
|
||||
t.Errorf("new connections should start in disconnected state")
|
||||
}
|
||||
go ppc.Run()
|
||||
time.Sleep(time.Second * 5)
|
||||
state = ppc.GetState()
|
||||
if state != AUTHENTICATED {
|
||||
t.Errorf("connection state should be authenticated(3), was instead %v", state)
|
||||
}
|
||||
|
||||
if tp.ReceivedIdentityPacket == false {
|
||||
t.Errorf("should have received an identity packet")
|
||||
}
|
||||
|
||||
_, invite, _ := profile.StartGroup("aaa.onion")
|
||||
ppc.SendGroupInvite(invite)
|
||||
time.Sleep(time.Second * 3)
|
||||
if tp.ReceivedGroupInvite == false {
|
||||
t.Errorf("should have received an group invite packet")
|
||||
}
|
||||
|
||||
}
|
|
@ -0,0 +1,126 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"cwtch.im/cwtch/peer/fetch"
|
||||
"cwtch.im/cwtch/peer/listen"
|
||||
"cwtch.im/cwtch/peer/send"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"errors"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connection"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/identity"
|
||||
"golang.org/x/crypto/ed25519"
|
||||
"log"
|
||||
"time"
|
||||
)
|
||||
|
||||
// PeerServerConnection encapsulates a single Peer->Server connection
|
||||
type PeerServerConnection struct {
|
||||
connection.AutoConnectionHandler
|
||||
Server string
|
||||
state ConnectionState
|
||||
connection *connection.Connection
|
||||
|
||||
GroupMessageHandler func(string, *protocol.GroupMessage)
|
||||
}
|
||||
|
||||
// NewPeerServerConnection creates a new Peer->Server outbound connection
|
||||
func NewPeerServerConnection(serverhostname string) *PeerServerConnection {
|
||||
psc := new(PeerServerConnection)
|
||||
psc.Server = serverhostname
|
||||
psc.Init()
|
||||
return psc
|
||||
}
|
||||
|
||||
// GetState returns the current connection state
|
||||
func (psc *PeerServerConnection) GetState() ConnectionState {
|
||||
return psc.state
|
||||
}
|
||||
|
||||
// Run manages the setup and teardown of a peer server connection
|
||||
func (psc *PeerServerConnection) Run() error {
|
||||
log.Printf("Connecting to %v", psc.Server)
|
||||
rc, err := goricochet.Open(psc.Server)
|
||||
if err == nil {
|
||||
rc.TraceLog(true)
|
||||
psc.connection = rc
|
||||
psc.state = CONNECTED
|
||||
pub, priv, _ := ed25519.GenerateKey(rand.Reader)
|
||||
if err == nil {
|
||||
_, err := connection.HandleOutboundConnection(psc.connection).ProcessAuthAsV3Client(identity.InitializeV3("cwtchpeer", &priv, &pub))
|
||||
if err == nil {
|
||||
psc.state = AUTHENTICATED
|
||||
|
||||
go func() {
|
||||
psc.connection.Do(func() error {
|
||||
psc.connection.RequestOpenChannel("im.cwtch.server.fetch", &fetch.CwtchPeerFetchChannel{Handler: psc})
|
||||
return nil
|
||||
})
|
||||
|
||||
psc.connection.Do(func() error {
|
||||
psc.connection.RequestOpenChannel("im.cwtch.server.listen", &listen.CwtchPeerListenChannel{Handler: psc})
|
||||
return nil
|
||||
})
|
||||
}()
|
||||
psc.connection.Process(psc)
|
||||
}
|
||||
}
|
||||
}
|
||||
psc.state = FAILED
|
||||
return err
|
||||
}
|
||||
|
||||
// Break makes Run() return and prevents processing, but doesn't close the connection.
|
||||
func (psc *PeerServerConnection) Break() error {
|
||||
return psc.connection.Break()
|
||||
}
|
||||
|
||||
// SendGroupMessage sends the given protocol message to the Server.
|
||||
func (psc *PeerServerConnection) SendGroupMessage(gm *protocol.GroupMessage) error {
|
||||
if psc.state != AUTHENTICATED {
|
||||
return errors.New("peer is not yet connected & authenticated to server cannot send message")
|
||||
}
|
||||
|
||||
err := psc.connection.Do(func() error {
|
||||
psc.connection.RequestOpenChannel("im.cwtch.server.send", &send.CwtchPeerSendChannel{})
|
||||
return nil
|
||||
})
|
||||
|
||||
errCount := 0
|
||||
for errCount < 5 {
|
||||
time.Sleep(time.Second * 1)
|
||||
err = psc.connection.Do(func() error {
|
||||
channel := psc.connection.Channel("im.cwtch.server.send", channels.Outbound)
|
||||
if channel == nil {
|
||||
return errors.New("no channel found")
|
||||
}
|
||||
sendchannel, ok := channel.Handler.(*send.CwtchPeerSendChannel)
|
||||
if ok {
|
||||
return sendchannel.SendGroupMessage(gm)
|
||||
}
|
||||
return errors.New("channel is not a peer send channel (this should definitely not happen)")
|
||||
})
|
||||
|
||||
if err != nil {
|
||||
errCount++
|
||||
} else {
|
||||
return nil
|
||||
}
|
||||
}
|
||||
|
||||
return err
|
||||
}
|
||||
|
||||
// Close shuts down the connection (freeing the handler goroutines)
|
||||
func (psc *PeerServerConnection) Close() {
|
||||
psc.state = KILLED
|
||||
psc.connection.Conn.Close()
|
||||
}
|
||||
|
||||
// HandleGroupMessage passes the given group message back to the profile.
|
||||
func (psc *PeerServerConnection) HandleGroupMessage(gm *protocol.GroupMessage) {
|
||||
log.Printf("Received Group Message: %v", gm)
|
||||
psc.GroupMessageHandler(psc.Server, gm)
|
||||
}
|
|
@ -0,0 +1,103 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"cwtch.im/cwtch/server/fetch"
|
||||
"cwtch.im/cwtch/server/send"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/connection"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/identity"
|
||||
"golang.org/x/crypto/ed25519"
|
||||
"net"
|
||||
"testing"
|
||||
"time"
|
||||
)
|
||||
|
||||
func ServerAuthValid(hostname string, key ed25519.PublicKey) (allowed, known bool) {
|
||||
return true, true
|
||||
}
|
||||
|
||||
type TestServer struct {
|
||||
connection.AutoConnectionHandler
|
||||
Received bool
|
||||
}
|
||||
|
||||
func (ts *TestServer) HandleGroupMessage(gm *protocol.GroupMessage) {
|
||||
ts.Received = true
|
||||
}
|
||||
|
||||
func (ts *TestServer) HandleFetchRequest() []*protocol.GroupMessage {
|
||||
return []*protocol.GroupMessage{{Ciphertext: []byte("hello"), Signature: []byte{}, Spamguard: []byte{}}, {Ciphertext: []byte("hello"), Signature: []byte{}, Spamguard: []byte{}}}
|
||||
}
|
||||
|
||||
func runtestserver(t *testing.T, ts *TestServer, identity identity.Identity) {
|
||||
ln, _ := net.Listen("tcp", "127.0.0.1:5451")
|
||||
conn, _ := ln.Accept()
|
||||
defer conn.Close()
|
||||
|
||||
rc, err := goricochet.NegotiateVersionInbound(conn)
|
||||
if err != nil {
|
||||
t.Errorf("Negotiate Version Error: %v", err)
|
||||
}
|
||||
rc.TraceLog(true)
|
||||
err = connection.HandleInboundConnection(rc).ProcessAuthAsV3Server(identity, ServerAuthValid)
|
||||
if err != nil {
|
||||
t.Errorf("ServerAuth Error: %v", err)
|
||||
}
|
||||
|
||||
ts.RegisterChannelHandler("im.cwtch.server.send", func() channels.Handler {
|
||||
server := new(send.CwtchServerSendChannel)
|
||||
server.Handler = ts
|
||||
return server
|
||||
})
|
||||
|
||||
ts.RegisterChannelHandler("im.cwtch.server.fetch", func() channels.Handler {
|
||||
server := new(fetch.CwtchServerFetchChannel)
|
||||
server.Handler = ts
|
||||
return server
|
||||
})
|
||||
|
||||
rc.Process(ts)
|
||||
}
|
||||
|
||||
func TestPeerServerConnection(t *testing.T) {
|
||||
pub, priv, _ := ed25519.GenerateKey(rand.Reader)
|
||||
|
||||
identity := identity.InitializeV3("", &priv, &pub)
|
||||
|
||||
ts := new(TestServer)
|
||||
ts.Init()
|
||||
go runtestserver(t, ts, identity)
|
||||
onionAddr := identity.Hostname()
|
||||
|
||||
psc := NewPeerServerConnection("127.0.0.1:5451|" + onionAddr)
|
||||
numcalls := 0
|
||||
psc.GroupMessageHandler = func(s string, gm *protocol.GroupMessage) {
|
||||
numcalls++
|
||||
}
|
||||
state := psc.GetState()
|
||||
if state != DISCONNECTED {
|
||||
t.Errorf("new connections should start in disconnected state")
|
||||
}
|
||||
time.Sleep(time.Second * 1)
|
||||
go psc.Run()
|
||||
time.Sleep(time.Second * 2)
|
||||
state = psc.GetState()
|
||||
if state != AUTHENTICATED {
|
||||
t.Errorf("connection should now be authed(%v), instead was %v", AUTHENTICATED, state)
|
||||
}
|
||||
|
||||
gm := &protocol.GroupMessage{Ciphertext: []byte("hello"), Signature: []byte{}}
|
||||
psc.SendGroupMessage(gm)
|
||||
time.Sleep(time.Second * 2)
|
||||
if ts.Received == false {
|
||||
t.Errorf("Should have received a group message in test server")
|
||||
}
|
||||
|
||||
if numcalls != 2 {
|
||||
t.Errorf("Should have received 2 calls from fetch request, instead received %v", numcalls)
|
||||
}
|
||||
|
||||
}
|
|
@ -7,25 +7,17 @@ type ConnectionState int
|
|||
// DISCONNECTED - No existing connection has been made, or all attempts have failed
|
||||
// CONNECTING - We are in the process of attempting to connect to a given endpoint
|
||||
// CONNECTED - We have connected but not yet authenticated
|
||||
// AUTHENTICATED - im.ricochet.auth-hidden-server has succeeded on the connection.
|
||||
// SYNCED - we have pulled all the messages for groups from the server and are ready to send
|
||||
// AUTHENTICATED - im.ricochet.auth-hidden-server has succeeded on thec onnection.
|
||||
const (
|
||||
DISCONNECTED ConnectionState = iota
|
||||
CONNECTING
|
||||
CONNECTED
|
||||
AUTHENTICATED
|
||||
SYNCED
|
||||
FAILED
|
||||
KILLED
|
||||
)
|
||||
|
||||
var (
|
||||
// ConnectionStateName allows conversion of states to their string representations
|
||||
ConnectionStateName = []string{"Disconnected", "Connecting", "Connected", "Authenticated", "Synced", "Failed", "Killed"}
|
||||
// ConnectionStateName allows conversaion of states to their string representations
|
||||
ConnectionStateName = []string{"Disconnected", "Connecting", "Connected", "Authenticated", "Failed", "Killed"}
|
||||
)
|
||||
|
||||
// ConnectionStateToType allows conversion of strings to their state type
|
||||
func ConnectionStateToType() map[string]ConnectionState {
|
||||
return map[string]ConnectionState{"Disconnected": DISCONNECTED, "Connecting": CONNECTING,
|
||||
"Connected": CONNECTED, "Authenticated": AUTHENTICATED, "Synced": SYNCED, "Failed": FAILED, "Killed": KILLED}
|
||||
}
|
1092
peer/cwtch_peer.go
1092
peer/cwtch_peer.go
File diff suppressed because it is too large
Load Diff
|
@ -0,0 +1,74 @@
|
|||
package peer
|
||||
|
||||
import (
|
||||
"testing"
|
||||
)
|
||||
|
||||
func TestCwtchPeerGenerate(t *testing.T) {
|
||||
|
||||
alice, _ := NewCwtchPeer("alice", "testpass", "./alice.json")
|
||||
alice.Save()
|
||||
|
||||
aliceLoaded, err := LoadCwtchPeer("./alice.json", "testpass")
|
||||
if err != nil || aliceLoaded.GetProfile().Name != "alice" {
|
||||
t.Errorf("something went wrong saving and loading profiles %v %v", err, aliceLoaded)
|
||||
}
|
||||
|
||||
groupID, _, _ := aliceLoaded.StartGroup("test.server")
|
||||
exportedGroup, _ := aliceLoaded.ExportGroup(groupID)
|
||||
t.Logf("Exported Group: %v from %v", exportedGroup, aliceLoaded.GetProfile().Onion)
|
||||
|
||||
importedGroupID, err := alice.ImportGroup(exportedGroup)
|
||||
group := alice.GetGroup(importedGroupID)
|
||||
t.Logf("Imported Group: %v, err := %v %v", group, err, importedGroupID)
|
||||
|
||||
}
|
||||
|
||||
func TestTrustPeer(t *testing.T) {
|
||||
groupName := "test.server"
|
||||
alice, _ := NewCwtchPeer("alice", "alicepass", "")
|
||||
bob, _ := NewCwtchPeer("bob", "bobpass", "")
|
||||
|
||||
bobOnion := bob.GetProfile().Onion
|
||||
aliceOnion := alice.GetProfile().Onion
|
||||
|
||||
groupID, _, err := alice.StartGroup(groupName)
|
||||
if err != nil {
|
||||
t.Error(err)
|
||||
}
|
||||
|
||||
groupAlice := alice.GetGroup(groupID)
|
||||
if groupAlice.GroupID != groupID {
|
||||
t.Errorf("Alice should be part of group %v, got %v instead", groupID, groupAlice)
|
||||
}
|
||||
|
||||
exportedGroup, err := alice.ExportGroup(groupID)
|
||||
if err != nil {
|
||||
t.Error(err)
|
||||
}
|
||||
|
||||
err = alice.InviteOnionToGroup(bobOnion, groupID)
|
||||
if err == nil {
|
||||
t.Errorf("onion invitation should fail since alice does no trust bob")
|
||||
}
|
||||
|
||||
err = alice.TrustPeer(bobOnion)
|
||||
if err == nil {
|
||||
t.Errorf("trust peer should fail since alice does not know about bob")
|
||||
}
|
||||
|
||||
// bob adds alice contact by importing serialized group created by alice
|
||||
_, err = bob.ImportGroup(exportedGroup)
|
||||
if err != nil {
|
||||
t.Error(err)
|
||||
}
|
||||
err = bob.TrustPeer(aliceOnion)
|
||||
if err != nil {
|
||||
t.Errorf("bob must be able to trust alice, got %v", err)
|
||||
}
|
||||
|
||||
err = bob.InviteOnionToGroup(aliceOnion, groupID)
|
||||
if err == nil {
|
||||
t.Errorf("bob trusts alice but peer connection is not ready yet. should not be able to invite her to group, instead got: %v", err)
|
||||
}
|
||||
}
|
|
@ -0,0 +1,103 @@
|
|||
package fetch
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"errors"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
)
|
||||
|
||||
// CwtchPeerFetchChannel is the peer implementation of the im.cwtch.server.fetch
|
||||
// channel.
|
||||
type CwtchPeerFetchChannel struct {
|
||||
channel *channels.Channel
|
||||
Handler CwtchPeerFetchChannelHandler
|
||||
}
|
||||
|
||||
// CwtchPeerFetchChannelHandler should be implemented by peers to receive new messages.
|
||||
type CwtchPeerFetchChannelHandler interface {
|
||||
HandleGroupMessage(*protocol.GroupMessage)
|
||||
}
|
||||
|
||||
// Type returns the type string for this channel, e.g. "im.ricochet.server.fetch)
|
||||
func (cpfc *CwtchPeerFetchChannel) Type() string {
|
||||
return "im.cwtch.server.fetch"
|
||||
}
|
||||
|
||||
// Closed is called when the channel is closed for any reason.
|
||||
func (cpfc *CwtchPeerFetchChannel) Closed(err error) {
|
||||
|
||||
}
|
||||
|
||||
// OnlyClientCanOpen - for Cwtch server channels only client can open
|
||||
func (cpfc *CwtchPeerFetchChannel) OnlyClientCanOpen() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// Singleton - for Cwtch channels there can only be one instance per direction
|
||||
func (cpfc *CwtchPeerFetchChannel) Singleton() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// Bidirectional - for Cwtch channels are not bidrectional
|
||||
func (cpfc *CwtchPeerFetchChannel) Bidirectional() bool {
|
||||
return false
|
||||
}
|
||||
|
||||
// RequiresAuthentication - Cwtch server channels require no auth.
|
||||
func (cpfc *CwtchPeerFetchChannel) RequiresAuthentication() string {
|
||||
return "none"
|
||||
}
|
||||
|
||||
// OpenInbound - cwtch server peer implementations shouldnever respond to inbound requests
|
||||
func (cpfc *CwtchPeerFetchChannel) OpenInbound(channel *channels.Channel, raw *Protocol_Data_Control.OpenChannel) ([]byte, error) {
|
||||
return nil, errors.New("client does not receive inbound listen channels")
|
||||
}
|
||||
|
||||
// OpenOutbound sets up a new cwtch fetch channel
|
||||
func (cpfc *CwtchPeerFetchChannel) OpenOutbound(channel *channels.Channel) ([]byte, error) {
|
||||
cpfc.channel = channel
|
||||
messageBuilder := new(utils.MessageBuilder)
|
||||
return messageBuilder.OpenChannel(channel.ID, cpfc.Type()), nil
|
||||
}
|
||||
|
||||
// OpenOutboundResult confirms a previous open channel request
|
||||
func (cpfc *CwtchPeerFetchChannel) OpenOutboundResult(err error, crm *Protocol_Data_Control.ChannelResult) {
|
||||
if err == nil {
|
||||
if crm.GetOpened() {
|
||||
cpfc.channel.Pending = false
|
||||
cpfc.FetchRequest()
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// FetchRequest sends a FetchMessage to the Server.
|
||||
func (cpfc *CwtchPeerFetchChannel) FetchRequest() error {
|
||||
if cpfc.channel.Pending == false {
|
||||
fm := &protocol.FetchMessage{}
|
||||
csp := &protocol.CwtchServerPacket{
|
||||
FetchMessage: fm,
|
||||
}
|
||||
packet, _ := proto.Marshal(csp)
|
||||
cpfc.channel.SendMessage(packet)
|
||||
} else {
|
||||
return errors.New("channel isn't set up yet")
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// Packet is called for each raw packet received on this channel.
|
||||
func (cpfc *CwtchPeerFetchChannel) Packet(data []byte) {
|
||||
csp := &protocol.CwtchServerPacket{}
|
||||
err := proto.Unmarshal(data, csp)
|
||||
if err == nil {
|
||||
if csp.GetGroupMessage() != nil {
|
||||
gm := csp.GetGroupMessage()
|
||||
// We create a new go routine here to avoid leaking any information about processing time
|
||||
// TODO Server can probably try to use this to DoS a peer
|
||||
go cpfc.Handler.HandleGroupMessage(gm)
|
||||
}
|
||||
}
|
||||
}
|
|
@ -0,0 +1,92 @@
|
|||
package fetch
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"testing"
|
||||
"time"
|
||||
)
|
||||
|
||||
type TestHandler struct {
|
||||
Received bool
|
||||
}
|
||||
|
||||
func (th *TestHandler) HandleGroupMessage(m *protocol.GroupMessage) {
|
||||
th.Received = true
|
||||
}
|
||||
|
||||
func TestPeerFetchChannelAttributes(t *testing.T) {
|
||||
cssc := new(CwtchPeerFetchChannel)
|
||||
if cssc.Type() != "im.cwtch.server.fetch" {
|
||||
t.Errorf("cwtch channel type is incorrect %v", cssc.Type())
|
||||
}
|
||||
|
||||
if !cssc.OnlyClientCanOpen() {
|
||||
t.Errorf("only clients should be able to open im.cwtch.server.Fetch channel")
|
||||
}
|
||||
|
||||
if cssc.Bidirectional() {
|
||||
t.Errorf("im.cwtch.server.fetch should not be bidirectional")
|
||||
}
|
||||
|
||||
if !cssc.Singleton() {
|
||||
t.Errorf("im.cwtch.server.fetch should be a Singleton")
|
||||
}
|
||||
|
||||
if cssc.RequiresAuthentication() != "none" {
|
||||
t.Errorf("cwtch channel required auth is incorrect %v", cssc.RequiresAuthentication())
|
||||
}
|
||||
|
||||
}
|
||||
func TestPeerFetchChannelOpenInbound(t *testing.T) {
|
||||
cssc := new(CwtchPeerFetchChannel)
|
||||
channel := new(channels.Channel)
|
||||
_, err := cssc.OpenInbound(channel, nil)
|
||||
if err == nil {
|
||||
t.Errorf("client implementation of im.cwtch.server.Fetch should never open an inbound channel")
|
||||
}
|
||||
}
|
||||
|
||||
func TestPeerFetchChannel(t *testing.T) {
|
||||
pfc := new(CwtchPeerFetchChannel)
|
||||
th := new(TestHandler)
|
||||
pfc.Handler = th
|
||||
channel := new(channels.Channel)
|
||||
channel.ID = 3
|
||||
channel.SendMessage = func([]byte) {}
|
||||
channel.CloseChannel = func() {}
|
||||
result, err := pfc.OpenOutbound(channel)
|
||||
if err != nil {
|
||||
t.Errorf("expected result but also got non-nil error: result:%v, err: %v", result, err)
|
||||
}
|
||||
|
||||
cr := &Protocol_Data_Control.ChannelResult{
|
||||
ChannelIdentifier: proto.Int32(3),
|
||||
Opened: proto.Bool(true),
|
||||
}
|
||||
|
||||
pfc.OpenOutboundResult(nil, cr)
|
||||
if channel.Pending {
|
||||
t.Errorf("once opened channel should no longer be pending")
|
||||
}
|
||||
|
||||
csp := &protocol.CwtchServerPacket{
|
||||
GroupMessage: &protocol.GroupMessage{
|
||||
Ciphertext: []byte("hello"), Signature: []byte{}, Spamguard: []byte{},
|
||||
},
|
||||
}
|
||||
packet, _ := proto.Marshal(csp)
|
||||
|
||||
pfc.Packet(packet)
|
||||
|
||||
time.Sleep(time.Second * 2)
|
||||
|
||||
if th.Received != true {
|
||||
t.Errorf("group message should not have been received")
|
||||
}
|
||||
|
||||
pfc.Closed(nil)
|
||||
|
||||
}
|
|
@ -0,0 +1,86 @@
|
|||
package listen
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"errors"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
)
|
||||
|
||||
// CwtchPeerListenChannel is the peer implementation of im.cwtch.server.listen
|
||||
type CwtchPeerListenChannel struct {
|
||||
channel *channels.Channel
|
||||
Handler CwtchPeerSendChannelHandler
|
||||
}
|
||||
|
||||
// CwtchPeerSendChannelHandler is implemented by peers who want to listen to new messages
|
||||
type CwtchPeerSendChannelHandler interface {
|
||||
HandleGroupMessage(*protocol.GroupMessage)
|
||||
}
|
||||
|
||||
// Type returns the type string for this channel, e.g. "im.ricochet.server.listen".
|
||||
func (cplc *CwtchPeerListenChannel) Type() string {
|
||||
return "im.cwtch.server.listen"
|
||||
}
|
||||
|
||||
// Closed is called when the channel is closed for any reason.
|
||||
func (cplc *CwtchPeerListenChannel) Closed(err error) {
|
||||
|
||||
}
|
||||
|
||||
// OnlyClientCanOpen - for Cwtch server channels can only be opened by peers
|
||||
func (cplc *CwtchPeerListenChannel) OnlyClientCanOpen() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// Singleton - for Cwtch channels there can only be one instance per direction
|
||||
func (cplc *CwtchPeerListenChannel) Singleton() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// Bidirectional - for Cwtch channels are not bidrectional
|
||||
func (cplc *CwtchPeerListenChannel) Bidirectional() bool {
|
||||
return false
|
||||
}
|
||||
|
||||
// RequiresAuthentication - Cwtch channels require no auth channels
|
||||
func (cplc *CwtchPeerListenChannel) RequiresAuthentication() string {
|
||||
return "none"
|
||||
}
|
||||
|
||||
// OpenInbound - peers should never respond to open inbound requests from servers
|
||||
func (cplc *CwtchPeerListenChannel) OpenInbound(channel *channels.Channel, raw *Protocol_Data_Control.OpenChannel) ([]byte, error) {
|
||||
return nil, errors.New("client does not receive inbound listen channels")
|
||||
}
|
||||
|
||||
// OpenOutbound sets up a new server listen channel
|
||||
func (cplc *CwtchPeerListenChannel) OpenOutbound(channel *channels.Channel) ([]byte, error) {
|
||||
cplc.channel = channel
|
||||
messageBuilder := new(utils.MessageBuilder)
|
||||
return messageBuilder.OpenChannel(channel.ID, cplc.Type()), nil
|
||||
}
|
||||
|
||||
// OpenOutboundResult confirms a previous open channel request
|
||||
func (cplc *CwtchPeerListenChannel) OpenOutboundResult(err error, crm *Protocol_Data_Control.ChannelResult) {
|
||||
if err == nil {
|
||||
if crm.GetOpened() {
|
||||
cplc.channel.Pending = false
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Packet is called for each server packet received on this channel.
|
||||
func (cplc *CwtchPeerListenChannel) Packet(data []byte) {
|
||||
csp := &protocol.CwtchServerPacket{}
|
||||
err := proto.Unmarshal(data, csp)
|
||||
if err == nil {
|
||||
if csp.GetGroupMessage() != nil {
|
||||
gm := csp.GetGroupMessage()
|
||||
// We create a new go routine here to avoid leaking any information about processing time
|
||||
// TODO Server can probably try to use this to DoS a peer
|
||||
go cplc.Handler.HandleGroupMessage(gm)
|
||||
}
|
||||
}
|
||||
}
|
|
@ -0,0 +1,89 @@
|
|||
package listen
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"testing"
|
||||
"time"
|
||||
)
|
||||
|
||||
type TestHandler struct {
|
||||
Received bool
|
||||
}
|
||||
|
||||
func (th *TestHandler) HandleGroupMessage(m *protocol.GroupMessage) {
|
||||
th.Received = true
|
||||
}
|
||||
|
||||
func TestPeerListenChannelAttributes(t *testing.T) {
|
||||
cssc := new(CwtchPeerListenChannel)
|
||||
if cssc.Type() != "im.cwtch.server.listen" {
|
||||
t.Errorf("cwtch channel type is incorrect %v", cssc.Type())
|
||||
}
|
||||
|
||||
if !cssc.OnlyClientCanOpen() {
|
||||
t.Errorf("only clients should be able to open im.cwtch.server.listen channel")
|
||||
}
|
||||
|
||||
if cssc.Bidirectional() {
|
||||
t.Errorf("im.cwtch.server.listen should not be bidirectional")
|
||||
}
|
||||
|
||||
if !cssc.Singleton() {
|
||||
t.Errorf("im.cwtch.server.listen should be a Singleton")
|
||||
}
|
||||
|
||||
if cssc.RequiresAuthentication() != "none" {
|
||||
t.Errorf("cwtch channel required auth is incorrect %v", cssc.RequiresAuthentication())
|
||||
}
|
||||
|
||||
}
|
||||
func TestPeerListenChannelOpenInbound(t *testing.T) {
|
||||
cssc := new(CwtchPeerListenChannel)
|
||||
channel := new(channels.Channel)
|
||||
_, err := cssc.OpenInbound(channel, nil)
|
||||
if err == nil {
|
||||
t.Errorf("client implementation of im.cwtch.server.Listen should never open an inbound channel")
|
||||
}
|
||||
}
|
||||
|
||||
func TestPeerListenChannel(t *testing.T) {
|
||||
pfc := new(CwtchPeerListenChannel)
|
||||
th := new(TestHandler)
|
||||
pfc.Handler = th
|
||||
channel := new(channels.Channel)
|
||||
channel.ID = 3
|
||||
result, err := pfc.OpenOutbound(channel)
|
||||
if err != nil {
|
||||
t.Errorf("expected result but also got non-nil error: result:%v, err: %v", result, err)
|
||||
}
|
||||
|
||||
cr := &Protocol_Data_Control.ChannelResult{
|
||||
ChannelIdentifier: proto.Int32(3),
|
||||
Opened: proto.Bool(true),
|
||||
}
|
||||
|
||||
pfc.OpenOutboundResult(nil, cr)
|
||||
if channel.Pending {
|
||||
t.Errorf("once opened channel should no longer be pending")
|
||||
}
|
||||
|
||||
csp := &protocol.CwtchServerPacket{
|
||||
GroupMessage: &protocol.GroupMessage{Ciphertext: []byte("hello"), Signature: []byte{}, Spamguard: []byte{}},
|
||||
}
|
||||
packet, _ := proto.Marshal(csp)
|
||||
|
||||
pfc.Packet(packet)
|
||||
|
||||
// Wait for goroutine to run
|
||||
time.Sleep(time.Second * 1)
|
||||
|
||||
if !th.Received {
|
||||
t.Errorf("group message should have been received")
|
||||
}
|
||||
|
||||
pfc.Closed(nil)
|
||||
|
||||
}
|
|
@ -0,0 +1,114 @@
|
|||
package peer
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"log"
|
||||
)
|
||||
|
||||
// CwtchPeerChannel implements the ChannelHandler interface for a channel of
|
||||
// type "im.ricochet.Cwtch". The channel may be inbound or outbound.
|
||||
//
|
||||
// CwtchPeerChannel implements protocol-level sanity and state validation, but
|
||||
// does not handle or acknowledge Cwtch messages. The application must provide
|
||||
// a CwtchPeerChannelHandler implementation to handle Cwtch events.
|
||||
type CwtchPeerChannel struct {
|
||||
// Methods of Handler are called for Cwtch events on this channel
|
||||
Handler CwtchPeerChannelHandler
|
||||
channel *channels.Channel
|
||||
}
|
||||
|
||||
// CwtchPeerChannelHandler is implemented by an application type to receive
|
||||
// events from a CwtchPeerChannel.
|
||||
type CwtchPeerChannelHandler interface {
|
||||
ClientIdentity(*protocol.CwtchIdentity)
|
||||
HandleGroupInvite(*protocol.GroupChatInvite)
|
||||
GetClientIdentityPacket() []byte
|
||||
}
|
||||
|
||||
// SendMessage sends a raw message on this channel
|
||||
func (cpc *CwtchPeerChannel) SendMessage(data []byte) {
|
||||
cpc.channel.SendMessage(data)
|
||||
}
|
||||
|
||||
// Type returns the type string for this channel, e.g. "im.ricochet.Cwtch".
|
||||
func (cpc *CwtchPeerChannel) Type() string {
|
||||
return "im.cwtch.peer"
|
||||
}
|
||||
|
||||
// Closed is called when the channel is closed for any reason.
|
||||
func (cpc *CwtchPeerChannel) Closed(err error) {
|
||||
|
||||
}
|
||||
|
||||
// OnlyClientCanOpen - for Cwtch channels any side can open
|
||||
func (cpc *CwtchPeerChannel) OnlyClientCanOpen() bool {
|
||||
return false
|
||||
}
|
||||
|
||||
// Singleton - for Cwtch channels there can only be one instance per direction
|
||||
func (cpc *CwtchPeerChannel) Singleton() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// Bidirectional - for Cwtch channels are not bidrectional
|
||||
func (cpc *CwtchPeerChannel) Bidirectional() bool {
|
||||
return false
|
||||
}
|
||||
|
||||
// RequiresAuthentication - Cwtch channels require hidden service auth
|
||||
func (cpc *CwtchPeerChannel) RequiresAuthentication() string {
|
||||
return "im.ricochet.auth.3dh"
|
||||
}
|
||||
|
||||
// OpenInbound is the first method called for an inbound channel request.
|
||||
// If an error is returned, the channel is rejected. If a RawMessage is
|
||||
// returned, it will be sent as the ChannelResult message.
|
||||
func (cpc *CwtchPeerChannel) OpenInbound(channel *channels.Channel, raw *Protocol_Data_Control.OpenChannel) ([]byte, error) {
|
||||
cpc.channel = channel
|
||||
messageBuilder := new(utils.MessageBuilder)
|
||||
return messageBuilder.AckOpenChannel(channel.ID), nil
|
||||
}
|
||||
|
||||
// OpenOutbound is the first method called for an outbound channel request.
|
||||
// If an error is returned, the channel is not opened. If a RawMessage is
|
||||
// returned, it will be sent as the OpenChannel message.
|
||||
func (cpc *CwtchPeerChannel) OpenOutbound(channel *channels.Channel) ([]byte, error) {
|
||||
cpc.channel = channel
|
||||
messageBuilder := new(utils.MessageBuilder)
|
||||
return messageBuilder.OpenChannel(channel.ID, cpc.Type()), nil
|
||||
}
|
||||
|
||||
// OpenOutboundResult is called when a response is received for an
|
||||
// outbound OpenChannel request. If `err` is non-nil, the channel was
|
||||
// rejected and Closed will be called immediately afterwards. `raw`
|
||||
// contains the raw protocol message including any extension data.
|
||||
func (cpc *CwtchPeerChannel) OpenOutboundResult(err error, crm *Protocol_Data_Control.ChannelResult) {
|
||||
if err == nil {
|
||||
if crm.GetOpened() {
|
||||
cpc.channel.Pending = false
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Packet is called for each raw packet received on this channel.
|
||||
func (cpc *CwtchPeerChannel) Packet(data []byte) {
|
||||
cpp := &protocol.CwtchPeerPacket{}
|
||||
err := proto.Unmarshal(data, cpp)
|
||||
if err == nil {
|
||||
if cpp.GetCwtchIdentify() != nil {
|
||||
cpc.Handler.ClientIdentity(cpp.GetCwtchIdentify())
|
||||
pkt := cpc.Handler.GetClientIdentityPacket()
|
||||
if pkt != nil {
|
||||
cpc.SendMessage(pkt)
|
||||
}
|
||||
} else if cpp.GetGroupChatInvite() != nil {
|
||||
cpc.Handler.HandleGroupInvite(cpp.GetGroupChatInvite())
|
||||
}
|
||||
} else {
|
||||
log.Printf("Error Receivng Packet %v\n", err)
|
||||
}
|
||||
}
|
|
@ -0,0 +1,121 @@
|
|||
package peer
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"testing"
|
||||
)
|
||||
|
||||
func TestPeerChannelAttributes(t *testing.T) {
|
||||
cssc := new(CwtchPeerChannel)
|
||||
if cssc.Type() != "im.cwtch.peer" {
|
||||
t.Errorf("cwtch channel type is incorrect %v", cssc.Type())
|
||||
}
|
||||
|
||||
if cssc.OnlyClientCanOpen() {
|
||||
t.Errorf("either side should be able to open im.cwtch.peer channel")
|
||||
}
|
||||
|
||||
if cssc.Bidirectional() {
|
||||
t.Errorf("im.cwtch.peer should not be bidirectional")
|
||||
}
|
||||
|
||||
if !cssc.Singleton() {
|
||||
t.Errorf("im.cwtch.server.listen should be a Singleton")
|
||||
}
|
||||
|
||||
if cssc.RequiresAuthentication() != "im.ricochet.auth.3dh" {
|
||||
t.Errorf("cwtch channel required auth is incorrect %v", cssc.RequiresAuthentication())
|
||||
}
|
||||
}
|
||||
|
||||
type TestHandler struct {
|
||||
Received bool
|
||||
ReceviedGroupInvite bool
|
||||
}
|
||||
|
||||
func (th *TestHandler) ClientIdentity(ci *protocol.CwtchIdentity) {
|
||||
if ci.GetName() == "hello" {
|
||||
th.Received = true
|
||||
}
|
||||
}
|
||||
|
||||
func (th *TestHandler) HandleGroupInvite(ci *protocol.GroupChatInvite) {
|
||||
///if ci.GetName() == "hello" {
|
||||
th.ReceviedGroupInvite = true
|
||||
//}
|
||||
}
|
||||
|
||||
func (th *TestHandler) GetClientIdentityPacket() []byte {
|
||||
return nil
|
||||
}
|
||||
|
||||
func TestPeerChannel(t *testing.T) {
|
||||
th := new(TestHandler)
|
||||
cpc := new(CwtchPeerChannel)
|
||||
cpc.Handler = th
|
||||
channel := new(channels.Channel)
|
||||
channel.ID = 3
|
||||
result, err := cpc.OpenOutbound(channel)
|
||||
if err != nil {
|
||||
t.Errorf("should have send open channel request instead %v, %v", result, err)
|
||||
}
|
||||
|
||||
cpc2 := new(CwtchPeerChannel)
|
||||
channel2 := new(channels.Channel)
|
||||
channel2.ID = 3
|
||||
sent := false
|
||||
channel2.SendMessage = func(message []byte) {
|
||||
sent = true
|
||||
}
|
||||
|
||||
control := new(Protocol_Data_Control.Packet)
|
||||
proto.Unmarshal(result[:], control)
|
||||
ack, err := cpc2.OpenInbound(channel2, control.GetOpenChannel())
|
||||
if err != nil {
|
||||
t.Errorf("should have ack open channel request instead %v, %v", ack, err)
|
||||
}
|
||||
|
||||
ackpacket := new(Protocol_Data_Control.Packet)
|
||||
proto.Unmarshal(ack[:], ackpacket)
|
||||
cpc.OpenOutboundResult(nil, ackpacket.GetChannelResult())
|
||||
if channel.Pending != false {
|
||||
t.Errorf("Channel should no longer be pending")
|
||||
}
|
||||
|
||||
gm := &protocol.CwtchIdentity{
|
||||
Name: "hello",
|
||||
Ed25519PublicKey: []byte{},
|
||||
}
|
||||
|
||||
cpp := &protocol.CwtchPeerPacket{
|
||||
CwtchIdentify: gm,
|
||||
}
|
||||
packet, _ := proto.Marshal(cpp)
|
||||
cpc.Packet(packet)
|
||||
if th.Received == false {
|
||||
t.Errorf("Should have sent packet to handler")
|
||||
}
|
||||
|
||||
cpc2.SendMessage(packet)
|
||||
if sent == false {
|
||||
t.Errorf("Should have sent packet to channel")
|
||||
}
|
||||
|
||||
gci := &protocol.GroupChatInvite{
|
||||
GroupName: "hello",
|
||||
GroupSharedKey: []byte{},
|
||||
ServerHost: "abc.onion",
|
||||
}
|
||||
|
||||
cpp = &protocol.CwtchPeerPacket{
|
||||
GroupChatInvite: gci,
|
||||
}
|
||||
packet, _ = proto.Marshal(cpp)
|
||||
cpc.Packet(packet)
|
||||
if th.ReceviedGroupInvite == false {
|
||||
t.Errorf("Should have sent invite packet to handler")
|
||||
}
|
||||
}
|
|
@ -0,0 +1,98 @@
|
|||
package peer
|
||||
|
||||
import (
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
)
|
||||
|
||||
// CwtchPeerDataChannel implements the ChannelHandler interface for a channel of
|
||||
// type "im.cwtch.peer.data The channel may be inbound or outbound.
|
||||
//
|
||||
// CwtchPeerChannel implements protocol-level sanity and state validation, but
|
||||
// does not handle or acknowledge Cwtch messages. The application must provide
|
||||
// a CwtchPeerChannelHandler implementation to handle Cwtch events.
|
||||
type CwtchPeerDataChannel struct {
|
||||
// Methods of Handler are called for Cwtch events on this channel
|
||||
Handler CwtchPeerDataHandler
|
||||
channel *channels.Channel
|
||||
}
|
||||
|
||||
// CwtchPeerDataHandler is implemented by an application type to receive
|
||||
// events from a CwtchPeerChannel.
|
||||
type CwtchPeerDataHandler interface {
|
||||
HandlePacket([]byte) []byte
|
||||
}
|
||||
|
||||
// SendMessage sends a raw message on this channel
|
||||
func (cpc *CwtchPeerDataChannel) SendMessage(data []byte) {
|
||||
cpc.channel.SendMessage(data)
|
||||
}
|
||||
|
||||
// Type returns the type string for this channel, e.g. "im.ricochet.Cwtch".
|
||||
func (cpc *CwtchPeerDataChannel) Type() string {
|
||||
return "im.cwtch.peer.data"
|
||||
}
|
||||
|
||||
// Closed is called when the channel is closed for any reason.
|
||||
func (cpc *CwtchPeerDataChannel) Closed(err error) {
|
||||
|
||||
}
|
||||
|
||||
// OnlyClientCanOpen - for Cwtch channels any side can open
|
||||
func (cpc *CwtchPeerDataChannel) OnlyClientCanOpen() bool {
|
||||
return false
|
||||
}
|
||||
|
||||
// Singleton - for Cwtch channels there can only be one instance per direction
|
||||
func (cpc *CwtchPeerDataChannel) Singleton() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// Bidirectional - for Cwtch channels are bidirectional
|
||||
func (cpc *CwtchPeerDataChannel) Bidirectional() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// RequiresAuthentication - Cwtch channels require hidden service auth
|
||||
func (cpc *CwtchPeerDataChannel) RequiresAuthentication() string {
|
||||
return "im.ricochet.auth.3dh"
|
||||
}
|
||||
|
||||
// OpenInbound is the first method called for an inbound channel request.
|
||||
// If an error is returned, the channel is rejected. If a RawMessage is
|
||||
// returned, it will be sent as the ChannelResult message.
|
||||
func (cpc *CwtchPeerDataChannel) OpenInbound(channel *channels.Channel, raw *Protocol_Data_Control.OpenChannel) ([]byte, error) {
|
||||
cpc.channel = channel
|
||||
messageBuilder := new(utils.MessageBuilder)
|
||||
return messageBuilder.AckOpenChannel(channel.ID), nil
|
||||
}
|
||||
|
||||
// OpenOutbound is the first method called for an outbound channel request.
|
||||
// If an error is returned, the channel is not opened. If a RawMessage is
|
||||
// returned, it will be sent as the OpenChannel message.
|
||||
func (cpc *CwtchPeerDataChannel) OpenOutbound(channel *channels.Channel) ([]byte, error) {
|
||||
cpc.channel = channel
|
||||
messageBuilder := new(utils.MessageBuilder)
|
||||
return messageBuilder.OpenChannel(channel.ID, cpc.Type()), nil
|
||||
}
|
||||
|
||||
// OpenOutboundResult is called when a response is received for an
|
||||
// outbound OpenChannel request. If `err` is non-nil, the channel was
|
||||
// rejected and Closed will be called immediately afterwards. `raw`
|
||||
// contains the raw protocol message including any extension data.
|
||||
func (cpc *CwtchPeerDataChannel) OpenOutboundResult(err error, crm *Protocol_Data_Control.ChannelResult) {
|
||||
if err == nil {
|
||||
if crm.GetOpened() {
|
||||
cpc.channel.Pending = false
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Packet is called for each raw packet received on this channel.
|
||||
func (cpc *CwtchPeerDataChannel) Packet(data []byte) {
|
||||
ret := cpc.Handler.HandlePacket(data)
|
||||
if len(ret) >= 0 {
|
||||
cpc.channel.SendMessage(ret)
|
||||
}
|
||||
}
|
|
@ -0,0 +1,95 @@
|
|||
package send
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"cwtch.im/cwtch/protocol/spam"
|
||||
"errors"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
)
|
||||
|
||||
// CwtchPeerSendChannel is the peer implementation of im.cwtch.server.send
|
||||
type CwtchPeerSendChannel struct {
|
||||
channel *channels.Channel
|
||||
spamGuard spam.Guard
|
||||
challenge []byte
|
||||
}
|
||||
|
||||
// Type returns the type string for this channel, e.g. "im.ricochet.server.send".
|
||||
func (cpsc *CwtchPeerSendChannel) Type() string {
|
||||
return "im.cwtch.server.send"
|
||||
}
|
||||
|
||||
// Closed is called when the channel is closed for any reason.
|
||||
func (cpsc *CwtchPeerSendChannel) Closed(err error) {
|
||||
|
||||
}
|
||||
|
||||
// OnlyClientCanOpen - for Cwtch server channels only peers may open.
|
||||
func (cpsc *CwtchPeerSendChannel) OnlyClientCanOpen() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// Singleton - for Cwtch channels there can only be one instance per direction
|
||||
func (cpsc *CwtchPeerSendChannel) Singleton() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// Bidirectional - for Cwtch channels are not bidrectional
|
||||
func (cpsc *CwtchPeerSendChannel) Bidirectional() bool {
|
||||
return false
|
||||
}
|
||||
|
||||
// RequiresAuthentication - Cwtch channels require no auth
|
||||
func (cpsc *CwtchPeerSendChannel) RequiresAuthentication() string {
|
||||
return "none"
|
||||
}
|
||||
|
||||
// OpenInbound should never be called on peers.
|
||||
func (cpsc *CwtchPeerSendChannel) OpenInbound(channel *channels.Channel, raw *Protocol_Data_Control.OpenChannel) ([]byte, error) {
|
||||
return nil, errors.New("client does not receive inbound listen channels")
|
||||
}
|
||||
|
||||
// OpenOutbound is used to set up a new send channel and initialize spamguard
|
||||
func (cpsc *CwtchPeerSendChannel) OpenOutbound(channel *channels.Channel) ([]byte, error) {
|
||||
cpsc.spamGuard.Difficulty = 2
|
||||
cpsc.channel = channel
|
||||
messageBuilder := new(utils.MessageBuilder)
|
||||
return messageBuilder.OpenChannel(channel.ID, cpsc.Type()), nil
|
||||
}
|
||||
|
||||
// OpenOutboundResult confirms the open channel request and sets the spamguard challenge
|
||||
func (cpsc *CwtchPeerSendChannel) OpenOutboundResult(err error, crm *Protocol_Data_Control.ChannelResult) {
|
||||
if err == nil {
|
||||
if crm.GetOpened() {
|
||||
ce, _ := proto.GetExtension(crm, protocol.E_ServerNonce)
|
||||
cpsc.challenge = ce.([]byte)[:]
|
||||
cpsc.channel.Pending = false
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// SendGroupMessage performs the spamguard proof of work and sends a message.
|
||||
func (cpsc *CwtchPeerSendChannel) SendGroupMessage(gm *protocol.GroupMessage) error {
|
||||
if cpsc.channel.Pending == false {
|
||||
sgsolve := cpsc.spamGuard.SolveChallenge(cpsc.challenge, gm.GetCiphertext())
|
||||
gm.Spamguard = sgsolve[:]
|
||||
csp := &protocol.CwtchServerPacket{
|
||||
GroupMessage: gm,
|
||||
}
|
||||
packet, _ := proto.Marshal(csp)
|
||||
cpsc.channel.SendMessage(packet)
|
||||
cpsc.channel.CloseChannel()
|
||||
} else {
|
||||
return errors.New("channel isn't set up yet")
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// Packet should never be
|
||||
func (cpsc *CwtchPeerSendChannel) Packet(data []byte) {
|
||||
// If we receive a packet on this channel, close the connection
|
||||
cpsc.channel.CloseChannel()
|
||||
}
|
|
@ -0,0 +1,108 @@
|
|||
package send
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"cwtch.im/cwtch/protocol/spam"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"testing"
|
||||
)
|
||||
|
||||
func TestPeerSendChannelAttributes(t *testing.T) {
|
||||
cssc := new(CwtchPeerSendChannel)
|
||||
if cssc.Type() != "im.cwtch.server.send" {
|
||||
t.Errorf("cwtch channel type is incorrect %v", cssc.Type())
|
||||
}
|
||||
|
||||
if !cssc.OnlyClientCanOpen() {
|
||||
t.Errorf("only clients should be able to open im.cwtch.server.send channel")
|
||||
}
|
||||
|
||||
if cssc.Bidirectional() {
|
||||
t.Errorf("im.cwtch.server.listen should not be bidirectional")
|
||||
}
|
||||
|
||||
if !cssc.Singleton() {
|
||||
t.Errorf("im.cwtch.server.listen should be a Singleton")
|
||||
}
|
||||
|
||||
if cssc.RequiresAuthentication() != "none" {
|
||||
t.Errorf("cwtch channel required auth is incorrect %v", cssc.RequiresAuthentication())
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
func TestPeerSendChannelOpenInbound(t *testing.T) {
|
||||
cssc := new(CwtchPeerSendChannel)
|
||||
channel := new(channels.Channel)
|
||||
_, err := cssc.OpenInbound(channel, nil)
|
||||
if err == nil {
|
||||
t.Errorf("client implementation of im.cwtch.server.Listen should never open an inbound channel")
|
||||
}
|
||||
}
|
||||
|
||||
func TestPeerSendChannelClosesOnPacket(t *testing.T) {
|
||||
pfc := new(CwtchPeerSendChannel)
|
||||
channel := new(channels.Channel)
|
||||
closed := false
|
||||
channel.CloseChannel = func() {
|
||||
closed = true
|
||||
}
|
||||
|
||||
pfc.OpenOutbound(channel)
|
||||
pfc.Packet([]byte{})
|
||||
if !closed {
|
||||
t.Errorf("send channel should close if server attempts to send packets")
|
||||
}
|
||||
}
|
||||
|
||||
func TestPeerSendChannel(t *testing.T) {
|
||||
pfc := new(CwtchPeerSendChannel)
|
||||
|
||||
channel := new(channels.Channel)
|
||||
channel.ID = 3
|
||||
success := false
|
||||
|
||||
var sg spam.Guard
|
||||
sg.Difficulty = 2
|
||||
|
||||
closed := false
|
||||
channel.CloseChannel = func() {
|
||||
closed = true
|
||||
}
|
||||
|
||||
channel.SendMessage = func(message []byte) {
|
||||
packet := new(protocol.CwtchServerPacket)
|
||||
proto.Unmarshal(message[:], packet)
|
||||
if packet.GetGroupMessage() != nil {
|
||||
success = sg.ValidateChallenge(packet.GetGroupMessage().GetCiphertext(), packet.GetGroupMessage().GetSpamguard())
|
||||
}
|
||||
}
|
||||
result, err := pfc.OpenOutbound(channel)
|
||||
if err != nil {
|
||||
t.Errorf("expected result but also got non-nil error: result:%v, err: %v", result, err)
|
||||
}
|
||||
|
||||
challenge := sg.GenerateChallenge(3)
|
||||
control := new(Protocol_Data_Control.Packet)
|
||||
proto.Unmarshal(challenge[:], control)
|
||||
|
||||
pfc.OpenOutboundResult(nil, control.GetChannelResult())
|
||||
if channel.Pending {
|
||||
t.Errorf("once opened channel should no longer be pending")
|
||||
}
|
||||
|
||||
gm := &protocol.GroupMessage{Ciphertext: []byte("hello")}
|
||||
pfc.SendGroupMessage(gm)
|
||||
if !success {
|
||||
t.Errorf("send channel should have successfully sent a valid group message")
|
||||
}
|
||||
|
||||
if !closed {
|
||||
t.Errorf("send channel should have successfully closed after a valid group message")
|
||||
}
|
||||
|
||||
pfc.Closed(nil)
|
||||
|
||||
}
|
|
@ -0,0 +1,325 @@
|
|||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// source: ControlChannel.proto
|
||||
|
||||
/*
|
||||
Package protocol is a generated protocol buffer package.
|
||||
|
||||
It is generated from these files:
|
||||
ControlChannel.proto
|
||||
cwtch-profile.proto
|
||||
group_message.proto
|
||||
|
||||
It has these top-level messages:
|
||||
Packet
|
||||
OpenChannel
|
||||
ChannelResult
|
||||
KeepAlive
|
||||
EnableFeatures
|
||||
FeaturesEnabled
|
||||
CwtchPeerPacket
|
||||
CwtchIdentity
|
||||
GroupChatInvite
|
||||
CwtchServerPacket
|
||||
FetchMessage
|
||||
GroupMessage
|
||||
DecryptedGroupMessage
|
||||
*/
|
||||
package protocol
|
||||
|
||||
import proto "github.com/golang/protobuf/proto"
|
||||
import fmt "fmt"
|
||||
import math "math"
|
||||
|
||||
// Reference imports to suppress errors if they are not otherwise used.
|
||||
var _ = proto.Marshal
|
||||
var _ = fmt.Errorf
|
||||
var _ = math.Inf
|
||||
|
||||
// This is a compile-time assertion to ensure that this generated file
|
||||
// is compatible with the proto package it is being compiled against.
|
||||
// A compilation error at this line likely means your copy of the
|
||||
// proto package needs to be updated.
|
||||
const _ = proto.ProtoPackageIsVersion2 // please upgrade the proto package
|
||||
|
||||
type ChannelResult_CommonError int32
|
||||
|
||||
const (
|
||||
ChannelResult_GenericError ChannelResult_CommonError = 0
|
||||
ChannelResult_UnknownTypeError ChannelResult_CommonError = 1
|
||||
ChannelResult_UnauthorizedError ChannelResult_CommonError = 2
|
||||
ChannelResult_BadUsageError ChannelResult_CommonError = 3
|
||||
ChannelResult_FailedError ChannelResult_CommonError = 4
|
||||
)
|
||||
|
||||
var ChannelResult_CommonError_name = map[int32]string{
|
||||
0: "GenericError",
|
||||
1: "UnknownTypeError",
|
||||
2: "UnauthorizedError",
|
||||
3: "BadUsageError",
|
||||
4: "FailedError",
|
||||
}
|
||||
var ChannelResult_CommonError_value = map[string]int32{
|
||||
"GenericError": 0,
|
||||
"UnknownTypeError": 1,
|
||||
"UnauthorizedError": 2,
|
||||
"BadUsageError": 3,
|
||||
"FailedError": 4,
|
||||
}
|
||||
|
||||
func (x ChannelResult_CommonError) Enum() *ChannelResult_CommonError {
|
||||
p := new(ChannelResult_CommonError)
|
||||
*p = x
|
||||
return p
|
||||
}
|
||||
func (x ChannelResult_CommonError) String() string {
|
||||
return proto.EnumName(ChannelResult_CommonError_name, int32(x))
|
||||
}
|
||||
func (x *ChannelResult_CommonError) UnmarshalJSON(data []byte) error {
|
||||
value, err := proto.UnmarshalJSONEnum(ChannelResult_CommonError_value, data, "ChannelResult_CommonError")
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
*x = ChannelResult_CommonError(value)
|
||||
return nil
|
||||
}
|
||||
func (ChannelResult_CommonError) EnumDescriptor() ([]byte, []int) { return fileDescriptor0, []int{2, 0} }
|
||||
|
||||
type Packet struct {
|
||||
// Must contain exactly one field
|
||||
OpenChannel *OpenChannel `protobuf:"bytes,1,opt,name=open_channel,json=openChannel" json:"open_channel,omitempty"`
|
||||
ChannelResult *ChannelResult `protobuf:"bytes,2,opt,name=channel_result,json=channelResult" json:"channel_result,omitempty"`
|
||||
KeepAlive *KeepAlive `protobuf:"bytes,3,opt,name=keep_alive,json=keepAlive" json:"keep_alive,omitempty"`
|
||||
EnableFeatures *EnableFeatures `protobuf:"bytes,4,opt,name=enable_features,json=enableFeatures" json:"enable_features,omitempty"`
|
||||
FeaturesEnabled *FeaturesEnabled `protobuf:"bytes,5,opt,name=features_enabled,json=featuresEnabled" json:"features_enabled,omitempty"`
|
||||
XXX_unrecognized []byte `json:"-"`
|
||||
}
|
||||
|
||||
func (m *Packet) Reset() { *m = Packet{} }
|
||||
func (m *Packet) String() string { return proto.CompactTextString(m) }
|
||||
func (*Packet) ProtoMessage() {}
|
||||
func (*Packet) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{0} }
|
||||
|
||||
func (m *Packet) GetOpenChannel() *OpenChannel {
|
||||
if m != nil {
|
||||
return m.OpenChannel
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *Packet) GetChannelResult() *ChannelResult {
|
||||
if m != nil {
|
||||
return m.ChannelResult
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *Packet) GetKeepAlive() *KeepAlive {
|
||||
if m != nil {
|
||||
return m.KeepAlive
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *Packet) GetEnableFeatures() *EnableFeatures {
|
||||
if m != nil {
|
||||
return m.EnableFeatures
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *Packet) GetFeaturesEnabled() *FeaturesEnabled {
|
||||
if m != nil {
|
||||
return m.FeaturesEnabled
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
type OpenChannel struct {
|
||||
ChannelIdentifier *int32 `protobuf:"varint,1,req,name=channel_identifier,json=channelIdentifier" json:"channel_identifier,omitempty"`
|
||||
ChannelType *string `protobuf:"bytes,2,req,name=channel_type,json=channelType" json:"channel_type,omitempty"`
|
||||
proto.XXX_InternalExtensions `json:"-"`
|
||||
XXX_unrecognized []byte `json:"-"`
|
||||
}
|
||||
|
||||
func (m *OpenChannel) Reset() { *m = OpenChannel{} }
|
||||
func (m *OpenChannel) String() string { return proto.CompactTextString(m) }
|
||||
func (*OpenChannel) ProtoMessage() {}
|
||||
func (*OpenChannel) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{1} }
|
||||
|
||||
var extRange_OpenChannel = []proto.ExtensionRange{
|
||||
{Start: 100, End: 536870911},
|
||||
}
|
||||
|
||||
func (*OpenChannel) ExtensionRangeArray() []proto.ExtensionRange {
|
||||
return extRange_OpenChannel
|
||||
}
|
||||
|
||||
func (m *OpenChannel) GetChannelIdentifier() int32 {
|
||||
if m != nil && m.ChannelIdentifier != nil {
|
||||
return *m.ChannelIdentifier
|
||||
}
|
||||
return 0
|
||||
}
|
||||
|
||||
func (m *OpenChannel) GetChannelType() string {
|
||||
if m != nil && m.ChannelType != nil {
|
||||
return *m.ChannelType
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
type ChannelResult struct {
|
||||
ChannelIdentifier *int32 `protobuf:"varint,1,req,name=channel_identifier,json=channelIdentifier" json:"channel_identifier,omitempty"`
|
||||
Opened *bool `protobuf:"varint,2,req,name=opened" json:"opened,omitempty"`
|
||||
CommonError *ChannelResult_CommonError `protobuf:"varint,3,opt,name=common_error,json=commonError,enum=protocol.ChannelResult_CommonError" json:"common_error,omitempty"`
|
||||
proto.XXX_InternalExtensions `json:"-"`
|
||||
XXX_unrecognized []byte `json:"-"`
|
||||
}
|
||||
|
||||
func (m *ChannelResult) Reset() { *m = ChannelResult{} }
|
||||
func (m *ChannelResult) String() string { return proto.CompactTextString(m) }
|
||||
func (*ChannelResult) ProtoMessage() {}
|
||||
func (*ChannelResult) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{2} }
|
||||
|
||||
var extRange_ChannelResult = []proto.ExtensionRange{
|
||||
{Start: 100, End: 536870911},
|
||||
}
|
||||
|
||||
func (*ChannelResult) ExtensionRangeArray() []proto.ExtensionRange {
|
||||
return extRange_ChannelResult
|
||||
}
|
||||
|
||||
func (m *ChannelResult) GetChannelIdentifier() int32 {
|
||||
if m != nil && m.ChannelIdentifier != nil {
|
||||
return *m.ChannelIdentifier
|
||||
}
|
||||
return 0
|
||||
}
|
||||
|
||||
func (m *ChannelResult) GetOpened() bool {
|
||||
if m != nil && m.Opened != nil {
|
||||
return *m.Opened
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
func (m *ChannelResult) GetCommonError() ChannelResult_CommonError {
|
||||
if m != nil && m.CommonError != nil {
|
||||
return *m.CommonError
|
||||
}
|
||||
return ChannelResult_GenericError
|
||||
}
|
||||
|
||||
type KeepAlive struct {
|
||||
ResponseRequested *bool `protobuf:"varint,1,req,name=response_requested,json=responseRequested" json:"response_requested,omitempty"`
|
||||
XXX_unrecognized []byte `json:"-"`
|
||||
}
|
||||
|
||||
func (m *KeepAlive) Reset() { *m = KeepAlive{} }
|
||||
func (m *KeepAlive) String() string { return proto.CompactTextString(m) }
|
||||
func (*KeepAlive) ProtoMessage() {}
|
||||
func (*KeepAlive) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{3} }
|
||||
|
||||
func (m *KeepAlive) GetResponseRequested() bool {
|
||||
if m != nil && m.ResponseRequested != nil {
|
||||
return *m.ResponseRequested
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
type EnableFeatures struct {
|
||||
Feature []string `protobuf:"bytes,1,rep,name=feature" json:"feature,omitempty"`
|
||||
proto.XXX_InternalExtensions `json:"-"`
|
||||
XXX_unrecognized []byte `json:"-"`
|
||||
}
|
||||
|
||||
func (m *EnableFeatures) Reset() { *m = EnableFeatures{} }
|
||||
func (m *EnableFeatures) String() string { return proto.CompactTextString(m) }
|
||||
func (*EnableFeatures) ProtoMessage() {}
|
||||
func (*EnableFeatures) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{4} }
|
||||
|
||||
var extRange_EnableFeatures = []proto.ExtensionRange{
|
||||
{Start: 100, End: 536870911},
|
||||
}
|
||||
|
||||
func (*EnableFeatures) ExtensionRangeArray() []proto.ExtensionRange {
|
||||
return extRange_EnableFeatures
|
||||
}
|
||||
|
||||
func (m *EnableFeatures) GetFeature() []string {
|
||||
if m != nil {
|
||||
return m.Feature
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
type FeaturesEnabled struct {
|
||||
Feature []string `protobuf:"bytes,1,rep,name=feature" json:"feature,omitempty"`
|
||||
proto.XXX_InternalExtensions `json:"-"`
|
||||
XXX_unrecognized []byte `json:"-"`
|
||||
}
|
||||
|
||||
func (m *FeaturesEnabled) Reset() { *m = FeaturesEnabled{} }
|
||||
func (m *FeaturesEnabled) String() string { return proto.CompactTextString(m) }
|
||||
func (*FeaturesEnabled) ProtoMessage() {}
|
||||
func (*FeaturesEnabled) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{5} }
|
||||
|
||||
var extRange_FeaturesEnabled = []proto.ExtensionRange{
|
||||
{Start: 100, End: 536870911},
|
||||
}
|
||||
|
||||
func (*FeaturesEnabled) ExtensionRangeArray() []proto.ExtensionRange {
|
||||
return extRange_FeaturesEnabled
|
||||
}
|
||||
|
||||
func (m *FeaturesEnabled) GetFeature() []string {
|
||||
if m != nil {
|
||||
return m.Feature
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func init() {
|
||||
proto.RegisterType((*Packet)(nil), "protocol.Packet")
|
||||
proto.RegisterType((*OpenChannel)(nil), "protocol.OpenChannel")
|
||||
proto.RegisterType((*ChannelResult)(nil), "protocol.ChannelResult")
|
||||
proto.RegisterType((*KeepAlive)(nil), "protocol.KeepAlive")
|
||||
proto.RegisterType((*EnableFeatures)(nil), "protocol.EnableFeatures")
|
||||
proto.RegisterType((*FeaturesEnabled)(nil), "protocol.FeaturesEnabled")
|
||||
proto.RegisterEnum("protocol.ChannelResult_CommonError", ChannelResult_CommonError_name, ChannelResult_CommonError_value)
|
||||
}
|
||||
|
||||
func init() { proto.RegisterFile("ControlChannel.proto", fileDescriptor0) }
|
||||
|
||||
var fileDescriptor0 = []byte{
|
||||
// 461 bytes of a gzipped FileDescriptorProto
|
||||
0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x94, 0x52, 0x4d, 0x8f, 0xd3, 0x30,
|
||||
0x10, 0x25, 0xe9, 0xee, 0x92, 0x4e, 0xfa, 0x91, 0x9a, 0x5d, 0x30, 0xb7, 0x12, 0x2e, 0x15, 0x12,
|
||||
0x3d, 0x54, 0x20, 0x21, 0x0e, 0x48, 0x4b, 0xd9, 0x22, 0xc4, 0x01, 0x64, 0xd1, 0x73, 0x64, 0x92,
|
||||
0x29, 0x1b, 0x35, 0x6b, 0x1b, 0xc7, 0x05, 0x2d, 0xa7, 0xfe, 0x0e, 0xfe, 0x0c, 0x7f, 0x0d, 0xc5,
|
||||
0x89, 0x9b, 0x14, 0x09, 0x09, 0x4e, 0xc9, 0x9b, 0xf7, 0xde, 0x8c, 0xfc, 0x66, 0xe0, 0x7c, 0x29,
|
||||
0x85, 0xd1, 0xb2, 0x58, 0x5e, 0x73, 0x21, 0xb0, 0x98, 0x2b, 0x2d, 0x8d, 0x24, 0x81, 0xfd, 0xa4,
|
||||
0xb2, 0x88, 0x7f, 0xf9, 0x70, 0xf6, 0x91, 0xa7, 0x5b, 0x34, 0xe4, 0x05, 0x0c, 0xa4, 0x42, 0x91,
|
||||
0xa4, 0xb5, 0x94, 0x7a, 0x53, 0x6f, 0x16, 0x2e, 0x2e, 0xe6, 0x4e, 0x3b, 0xff, 0xa0, 0x50, 0x34,
|
||||
0x7d, 0x58, 0x28, 0x5b, 0x40, 0x5e, 0xc1, 0xa8, 0x31, 0x25, 0x1a, 0xcb, 0x5d, 0x61, 0xa8, 0x6f,
|
||||
0xbd, 0x0f, 0x5a, 0xaf, 0xf3, 0x59, 0x9a, 0x0d, 0xd3, 0x2e, 0x24, 0x0b, 0x80, 0x2d, 0xa2, 0x4a,
|
||||
0x78, 0x91, 0x7f, 0x43, 0xda, 0xb3, 0xde, 0x7b, 0xad, 0xf7, 0x3d, 0xa2, 0xba, 0xac, 0x28, 0xd6,
|
||||
0xdf, 0xba, 0x5f, 0x72, 0x09, 0x63, 0x14, 0xfc, 0x73, 0x81, 0xc9, 0x06, 0xb9, 0xd9, 0x69, 0x2c,
|
||||
0xe9, 0x89, 0x35, 0xd2, 0xd6, 0x78, 0x65, 0x05, 0xab, 0x86, 0x67, 0x23, 0x3c, 0xc2, 0xe4, 0x0d,
|
||||
0x44, 0xce, 0x9b, 0xd4, 0x54, 0x46, 0x4f, 0x6d, 0x8f, 0x87, 0x6d, 0x0f, 0xa7, 0xae, 0x7b, 0x65,
|
||||
0x6c, 0xbc, 0x39, 0x2e, 0xc4, 0x39, 0x84, 0x9d, 0x60, 0xc8, 0x53, 0x20, 0x2e, 0x8b, 0x3c, 0x43,
|
||||
0x61, 0xf2, 0x4d, 0x8e, 0x9a, 0x7a, 0x53, 0x7f, 0x76, 0xca, 0x26, 0x0d, 0xf3, 0xee, 0x40, 0x90,
|
||||
0x47, 0x30, 0x70, 0x72, 0x73, 0xab, 0x90, 0xfa, 0x53, 0x7f, 0xd6, 0x67, 0x61, 0x53, 0xfb, 0x74,
|
||||
0xab, 0xf0, 0x49, 0x10, 0x64, 0xd1, 0x7e, 0xbf, 0xdf, 0xfb, 0xf1, 0x4f, 0x1f, 0x86, 0x47, 0x41,
|
||||
0xfe, 0xef, 0xb4, 0xfb, 0x70, 0x56, 0xed, 0x0d, 0x33, 0x3b, 0x27, 0x60, 0x0d, 0x22, 0x2b, 0x18,
|
||||
0xa4, 0xf2, 0xe6, 0x46, 0x8a, 0x04, 0xb5, 0x96, 0xda, 0xae, 0x60, 0xb4, 0x78, 0xfc, 0x97, 0xf5,
|
||||
0xcd, 0x97, 0x56, 0x7b, 0x55, 0x49, 0x59, 0x98, 0xb6, 0x20, 0x56, 0x10, 0x76, 0x38, 0x12, 0xc1,
|
||||
0xe0, 0x2d, 0x0a, 0xd4, 0x79, 0x6a, 0x71, 0x74, 0x87, 0x9c, 0x43, 0xb4, 0x16, 0x5b, 0x21, 0xbf,
|
||||
0x8b, 0xea, 0x69, 0x75, 0xd5, 0x23, 0x17, 0x30, 0x59, 0x0b, 0xbe, 0x33, 0xd7, 0x52, 0xe7, 0x3f,
|
||||
0x30, 0xab, 0xcb, 0x3e, 0x99, 0xc0, 0xf0, 0x35, 0xcf, 0xd6, 0x25, 0xff, 0xd2, 0x28, 0x7b, 0x64,
|
||||
0x0c, 0xe1, 0x8a, 0xe7, 0x85, 0xd3, 0x9c, 0x74, 0xc2, 0x79, 0x09, 0xfd, 0xc3, 0xa1, 0x54, 0xb9,
|
||||
0x68, 0x2c, 0x95, 0x14, 0x25, 0x26, 0x1a, 0xbf, 0xee, 0xb0, 0x34, 0x98, 0xd9, 0x5c, 0x02, 0x36,
|
||||
0x71, 0x0c, 0x73, 0x44, 0xfc, 0x0c, 0x46, 0xc7, 0xb7, 0x42, 0x28, 0xdc, 0x6d, 0x16, 0x4d, 0xbd,
|
||||
0x69, 0x6f, 0xd6, 0x67, 0x0e, 0x76, 0x26, 0x3e, 0x87, 0xf1, 0x1f, 0xd7, 0xf1, 0x2f, 0xb6, 0xdf,
|
||||
0x01, 0x00, 0x00, 0xff, 0xff, 0x9d, 0x32, 0x16, 0x1e, 0x93, 0x03, 0x00, 0x00,
|
||||
}
|
|
@ -0,0 +1,53 @@
|
|||
syntax = "proto2";
|
||||
package protocol;
|
||||
|
||||
message Packet {
|
||||
// Must contain exactly one field
|
||||
optional OpenChannel open_channel = 1;
|
||||
optional ChannelResult channel_result = 2;
|
||||
optional KeepAlive keep_alive = 3;
|
||||
optional EnableFeatures enable_features = 4;
|
||||
optional FeaturesEnabled features_enabled = 5;
|
||||
}
|
||||
|
||||
message OpenChannel {
|
||||
required int32 channel_identifier = 1; // Arbitrary unique identifier for this channel instance
|
||||
required string channel_type = 2; // String identifying channel type; e.g. im.ricochet.chat
|
||||
|
||||
// It is valid to extend the OpenChannel message to add fields specific
|
||||
// to the requested channel_type.
|
||||
extensions 100 to max;
|
||||
}
|
||||
|
||||
message ChannelResult {
|
||||
required int32 channel_identifier = 1; // Matching the value from OpenChannel
|
||||
required bool opened = 2; // If the channel is now open
|
||||
|
||||
enum CommonError {
|
||||
GenericError = 0;
|
||||
UnknownTypeError = 1;
|
||||
UnauthorizedError = 2;
|
||||
BadUsageError = 3;
|
||||
FailedError = 4;
|
||||
}
|
||||
|
||||
optional CommonError common_error = 3;
|
||||
|
||||
// As with OpenChannel, it is valid to extend this message with fields specific
|
||||
// to the channel type.
|
||||
extensions 100 to max;
|
||||
}
|
||||
|
||||
message KeepAlive {
|
||||
required bool response_requested = 1;
|
||||
}
|
||||
|
||||
message EnableFeatures {
|
||||
repeated string feature = 1;
|
||||
extensions 100 to max;
|
||||
}
|
||||
|
||||
message FeaturesEnabled {
|
||||
repeated string feature = 1;
|
||||
extensions 100 to max;
|
||||
}
|
|
@ -1,515 +0,0 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/protocol/groups"
|
||||
"encoding/base64"
|
||||
"encoding/json"
|
||||
"errors"
|
||||
"git.openprivacy.ca/cwtch.im/tapir"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/networks/tor"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives"
|
||||
"git.openprivacy.ca/openprivacy/connectivity"
|
||||
torProvider "git.openprivacy.ca/openprivacy/connectivity/tor"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"github.com/gtank/ristretto255"
|
||||
"golang.org/x/crypto/ed25519"
|
||||
"strconv"
|
||||
"sync"
|
||||
"time"
|
||||
)
|
||||
|
||||
type engine struct {
|
||||
queue event.Queue
|
||||
|
||||
// Engine Attributes
|
||||
identity primitives.Identity
|
||||
acn connectivity.ACN
|
||||
|
||||
// Authorization list of contacts to authorization status
|
||||
authorizations sync.Map // string(onion) => model.Authorization
|
||||
|
||||
// Block Unknown Contacts
|
||||
blockUnknownContacts bool
|
||||
|
||||
// Pointer to the Global Event Manager
|
||||
eventManager event.Manager
|
||||
|
||||
// Nextgen Tapir Service
|
||||
service tapir.Service
|
||||
|
||||
// Nextgen Tapir Service
|
||||
ephemeralServices sync.Map // string(onion) => tapir.Service
|
||||
|
||||
// Required for listen(), inaccessible from identity
|
||||
privateKey ed25519.PrivateKey
|
||||
|
||||
shuttingDown bool
|
||||
}
|
||||
|
||||
// Engine (ProtocolEngine) encapsulates the logic necessary to make and receive Cwtch connections.
|
||||
// Note: ProtocolEngine doesn't have access to any information necessary to encrypt or decrypt GroupMessages
|
||||
// Protocol Engine *can* associate Group Identifiers with Group Servers, although we don't currently make use of this fact
|
||||
// other than to route errors back to the UI.
|
||||
type Engine interface {
|
||||
ACN() connectivity.ACN
|
||||
EventManager() event.Manager
|
||||
Shutdown()
|
||||
}
|
||||
|
||||
// NewProtocolEngine initializes a new engine that runs Cwtch using the given parameters
|
||||
func NewProtocolEngine(identity primitives.Identity, privateKey ed25519.PrivateKey, acn connectivity.ACN, eventManager event.Manager, peerAuthorizations map[string]model.Authorization) Engine {
|
||||
engine := new(engine)
|
||||
engine.identity = identity
|
||||
engine.privateKey = privateKey
|
||||
engine.queue = event.NewQueue()
|
||||
go engine.eventHandler()
|
||||
|
||||
engine.acn = acn
|
||||
|
||||
// Init the Server running the Simple App.
|
||||
engine.service = new(tor.BaseOnionService)
|
||||
engine.service.Init(acn, privateKey, &identity)
|
||||
|
||||
engine.eventManager = eventManager
|
||||
|
||||
engine.eventManager.Subscribe(event.ProtocolEngineStartListen, engine.queue)
|
||||
engine.eventManager.Subscribe(event.PeerRequest, engine.queue)
|
||||
engine.eventManager.Subscribe(event.RetryPeerRequest, engine.queue)
|
||||
engine.eventManager.Subscribe(event.InvitePeerToGroup, engine.queue)
|
||||
engine.eventManager.Subscribe(event.JoinServer, engine.queue)
|
||||
engine.eventManager.Subscribe(event.LeaveServer, engine.queue)
|
||||
engine.eventManager.Subscribe(event.SendMessageToGroup, engine.queue)
|
||||
engine.eventManager.Subscribe(event.SendMessageToPeer, engine.queue)
|
||||
engine.eventManager.Subscribe(event.SendGetValMessageToPeer, engine.queue)
|
||||
engine.eventManager.Subscribe(event.SendRetValMessageToPeer, engine.queue)
|
||||
engine.eventManager.Subscribe(event.DeleteContact, engine.queue)
|
||||
engine.eventManager.Subscribe(event.DeleteGroup, engine.queue)
|
||||
|
||||
engine.eventManager.Subscribe(event.SetPeerAuthorization, engine.queue)
|
||||
engine.eventManager.Subscribe(event.BlockUnknownPeers, engine.queue)
|
||||
engine.eventManager.Subscribe(event.AllowUnknownPeers, engine.queue)
|
||||
|
||||
for peer, authorization := range peerAuthorizations {
|
||||
engine.authorizations.Store(peer, authorization)
|
||||
}
|
||||
return engine
|
||||
}
|
||||
|
||||
func (e *engine) ACN() connectivity.ACN {
|
||||
return e.acn
|
||||
}
|
||||
|
||||
func (e *engine) EventManager() event.Manager {
|
||||
return e.eventManager
|
||||
}
|
||||
|
||||
// eventHandler process events from other subsystems
|
||||
func (e *engine) eventHandler() {
|
||||
for {
|
||||
ev := e.queue.Next()
|
||||
switch ev.EventType {
|
||||
case event.StatusRequest:
|
||||
e.eventManager.Publish(event.Event{EventType: event.ProtocolEngineStatus, EventID: ev.EventID})
|
||||
case event.PeerRequest:
|
||||
if torProvider.IsValidHostname(ev.Data[event.RemotePeer]) {
|
||||
go e.peerWithOnion(ev.Data[event.RemotePeer])
|
||||
}
|
||||
case event.RetryPeerRequest:
|
||||
// This event allows engine to treat (automated) retry peering requests differently to user-specified
|
||||
// peer events
|
||||
if torProvider.IsValidHostname(ev.Data[event.RemotePeer]) {
|
||||
log.Debugf("Retrying Peer Request: %v", ev.Data[event.RemotePeer])
|
||||
go e.peerWithOnion(ev.Data[event.RemotePeer])
|
||||
}
|
||||
case event.InvitePeerToGroup:
|
||||
e.sendMessageToPeer(ev.EventID, ev.Data[event.RemotePeer], event.ContextInvite, []byte(ev.Data[event.GroupInvite]))
|
||||
case event.JoinServer:
|
||||
signature, err := base64.StdEncoding.DecodeString(ev.Data[event.Signature])
|
||||
if err != nil {
|
||||
// will result in a full sync
|
||||
signature = []byte{}
|
||||
}
|
||||
go e.peerWithTokenServer(ev.Data[event.GroupServer], ev.Data[event.ServerTokenOnion], ev.Data[event.ServerTokenY], signature)
|
||||
case event.LeaveServer:
|
||||
e.leaveServer(ev.Data[event.GroupServer])
|
||||
case event.DeleteContact:
|
||||
onion := ev.Data[event.RemotePeer]
|
||||
// We remove this peer from out blocklist which will prevent them from contacting us if we have "block unknown peers" turned on.
|
||||
e.authorizations.Delete(ev.Data[event.RemotePeer])
|
||||
e.deleteConnection(onion)
|
||||
case event.DeleteGroup:
|
||||
// TODO: There isn't a way here to determine if other Groups are using a server connection...
|
||||
case event.SendMessageToGroup:
|
||||
ciphertext, _ := base64.StdEncoding.DecodeString(ev.Data[event.Ciphertext])
|
||||
signature, _ := base64.StdEncoding.DecodeString(ev.Data[event.Signature])
|
||||
go e.sendMessageToGroup(ev.Data[event.GroupID], ev.Data[event.GroupServer], ciphertext, signature)
|
||||
case event.SendMessageToPeer:
|
||||
// TODO: remove this passthrough once the UI is integrated.
|
||||
context, ok := ev.Data[event.EventContext]
|
||||
if !ok {
|
||||
context = event.ContextRaw
|
||||
}
|
||||
err := e.sendMessageToPeer(ev.EventID, ev.Data[event.RemotePeer], context, []byte(ev.Data[event.Data]))
|
||||
if err != nil {
|
||||
e.eventManager.Publish(event.NewEvent(event.SendMessageToPeerError, map[event.Field]string{event.RemotePeer: ev.Data[event.RemotePeer], event.EventID: ev.EventID, event.Error: "peer is offline or the connection has yet to finalize"}))
|
||||
}
|
||||
case event.SendGetValMessageToPeer:
|
||||
e.sendGetValToPeer(ev.EventID, ev.Data[event.RemotePeer], ev.Data[event.Scope], ev.Data[event.Path])
|
||||
case event.SendRetValMessageToPeer:
|
||||
e.sendRetValToPeer(ev.EventID, ev.Data[event.RemotePeer], ev.Data[event.Data], ev.Data[event.Exists])
|
||||
case event.SetPeerAuthorization:
|
||||
auth := model.Authorization(ev.Data[event.Authorization])
|
||||
e.authorizations.Store(ev.Data[event.RemotePeer], auth)
|
||||
if auth == model.AuthBlocked {
|
||||
connection, err := e.service.GetConnection(ev.Data[event.RemotePeer])
|
||||
if connection != nil && err == nil {
|
||||
connection.Close()
|
||||
}
|
||||
// Explicitly send a disconnected event (if we don't do this here then the UI can wait for a while before
|
||||
// an ongoing Open() connection fails and so the user will see a blocked peer as still connecting (because
|
||||
// there isn't an active connection and we are stuck waiting for tor to time out)
|
||||
e.peerDisconnected(ev.Data[event.RemotePeer])
|
||||
}
|
||||
case event.AllowUnknownPeers:
|
||||
log.Debugf("%v now allows unknown connections", e.identity.Hostname())
|
||||
e.blockUnknownContacts = false
|
||||
case event.BlockUnknownPeers:
|
||||
log.Debugf("%v now forbids unknown connections", e.identity.Hostname())
|
||||
e.blockUnknownContacts = true
|
||||
case event.ProtocolEngineStartListen:
|
||||
go e.listenFn()
|
||||
default:
|
||||
return
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (e *engine) isBlocked(onion string) bool {
|
||||
authorization, known := e.authorizations.Load(onion)
|
||||
if !known {
|
||||
// if we block unknown peers we will block this contact
|
||||
return e.blockUnknownContacts
|
||||
}
|
||||
return authorization.(model.Authorization) == model.AuthBlocked
|
||||
}
|
||||
|
||||
func (e *engine) isAllowed(onion string) bool {
|
||||
authorization, known := e.authorizations.Load(onion)
|
||||
if !known {
|
||||
log.Errorf("attempted to lookup authorization of onion not in map...that should never happen")
|
||||
return false
|
||||
}
|
||||
if e.blockUnknownContacts {
|
||||
return authorization.(model.Authorization) == model.AuthApproved
|
||||
}
|
||||
return authorization.(model.Authorization) != model.AuthBlocked
|
||||
}
|
||||
|
||||
func (e *engine) createPeerTemplate() *PeerApp {
|
||||
peerAppTemplate := new(PeerApp)
|
||||
peerAppTemplate.IsBlocked = e.isBlocked
|
||||
peerAppTemplate.IsAllowed = e.isAllowed
|
||||
peerAppTemplate.MessageHandler = e.handlePeerMessage
|
||||
peerAppTemplate.OnAcknowledgement = e.ignoreOnShutdown2(e.peerAck)
|
||||
peerAppTemplate.OnAuth = e.ignoreOnShutdown(e.peerAuthed)
|
||||
peerAppTemplate.OnConnecting = e.ignoreOnShutdown(e.peerConnecting)
|
||||
peerAppTemplate.OnClose = e.ignoreOnShutdown(e.peerDisconnected)
|
||||
peerAppTemplate.RetValHandler = e.handlePeerRetVal
|
||||
return peerAppTemplate
|
||||
}
|
||||
|
||||
// Listen sets up an onion listener to process incoming cwtch messages
|
||||
func (e *engine) listenFn() {
|
||||
err := e.service.Listen(e.createPeerTemplate())
|
||||
if !e.shuttingDown {
|
||||
e.eventManager.Publish(event.NewEvent(event.ProtocolEngineStopped, map[event.Field]string{event.Identity: e.identity.Hostname(), event.Error: err.Error()}))
|
||||
}
|
||||
}
|
||||
|
||||
// Shutdown tears down the eventHandler goroutine
|
||||
func (e *engine) Shutdown() {
|
||||
e.shuttingDown = true
|
||||
e.service.Shutdown()
|
||||
e.queue.Shutdown()
|
||||
}
|
||||
|
||||
// peerWithOnion is the entry point for cwtchPeer relationships
|
||||
// needs to be run in a goroutine as will block on Open.
|
||||
func (e *engine) peerWithOnion(onion string) {
|
||||
log.Debugf("Called PeerWithOnion for %v", onion)
|
||||
if !e.isBlocked(onion) {
|
||||
e.ignoreOnShutdown(e.peerConnecting)(onion)
|
||||
connected, err := e.service.Connect(onion, e.createPeerTemplate())
|
||||
|
||||
// If we are already connected...check if we are authed and issue an auth event
|
||||
// (This allows the ui to be stateless)
|
||||
if connected && err != nil {
|
||||
conn, err := e.service.GetConnection(onion)
|
||||
if err == nil {
|
||||
if conn.HasCapability(cwtchCapability) {
|
||||
e.ignoreOnShutdown(e.peerAuthed)(onion)
|
||||
return
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Only issue a disconnected error if we are disconnected (Connect will fail if a connection already exists)
|
||||
if !connected && err != nil {
|
||||
e.ignoreOnShutdown(e.peerDisconnected)(onion)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// peerWithTokenServer is the entry point for cwtchPeer - server relationships
|
||||
// needs to be run in a goroutine as will block on Open.
|
||||
func (e *engine) peerWithTokenServer(onion string, tokenServerOnion string, tokenServerY string, lastKnownSignature []byte) {
|
||||
|
||||
service, exists := e.ephemeralServices.Load(onion)
|
||||
if exists {
|
||||
connection := service.(*tor.BaseOnionService)
|
||||
if conn, err := connection.GetConnection(onion); err == nil {
|
||||
// We are already peered and synced so return...
|
||||
// This will only not-trigger it lastKnownSignature has been wiped, which only happens when ResyncServer is called
|
||||
// in CwtchPeer.
|
||||
if !conn.IsClosed() && len(lastKnownSignature) != 0 {
|
||||
return
|
||||
}
|
||||
// Otherwise...we are going to rebuild the connection(which will result in a bandwidth heavy resync)...
|
||||
e.leaveServer(onion)
|
||||
}
|
||||
// Otherwise...let's reconnect
|
||||
}
|
||||
|
||||
log.Debugf("Peering with Token Server %v %v", onion, tokenServerOnion)
|
||||
e.ignoreOnShutdown(e.serverConnecting)(onion)
|
||||
// Create a new ephemeral service for this connection
|
||||
ephemeralService := new(tor.BaseOnionService)
|
||||
eid, epk := primitives.InitializeEphemeralIdentity()
|
||||
ephemeralService.Init(e.acn, epk, &eid)
|
||||
|
||||
Y := ristretto255.NewElement()
|
||||
Y.UnmarshalText([]byte(tokenServerY))
|
||||
connected, err := ephemeralService.Connect(onion, NewTokenBoardClient(e.acn, Y, tokenServerOnion, lastKnownSignature, e.receiveGroupMessage, e.serverSynced, e.serverDisconnected))
|
||||
e.ephemeralServices.Store(onion, ephemeralService)
|
||||
// If we are already connected...check if we are authed and issue an auth event
|
||||
// (This allows the ui to be stateless)
|
||||
if connected && err != nil {
|
||||
conn, err := ephemeralService.GetConnection(onion)
|
||||
if err == nil {
|
||||
if conn.HasCapability(groups.CwtchServerSyncedCapability) {
|
||||
e.ignoreOnShutdown(e.serverConnected)(onion)
|
||||
return
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Only issue a disconnected error if we are disconnected (Connect will fail if a connection already exists)
|
||||
if !connected && err != nil {
|
||||
e.ignoreOnShutdown(e.serverDisconnected)(onion)
|
||||
}
|
||||
}
|
||||
|
||||
func (e *engine) ignoreOnShutdown(f func(string)) func(string) {
|
||||
return func(x string) {
|
||||
if !e.shuttingDown {
|
||||
f(x)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (e *engine) ignoreOnShutdown2(f func(string, string)) func(string, string) {
|
||||
return func(x, y string) {
|
||||
if !e.shuttingDown {
|
||||
f(x, y)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (e *engine) peerAuthed(onion string) {
|
||||
_, known := e.authorizations.Load(onion)
|
||||
if !known {
|
||||
e.authorizations.Store(onion, model.AuthUnknown)
|
||||
}
|
||||
e.eventManager.Publish(event.NewEvent(event.PeerStateChange, map[event.Field]string{
|
||||
event.RemotePeer: string(onion),
|
||||
event.ConnectionState: ConnectionStateName[AUTHENTICATED],
|
||||
}))
|
||||
}
|
||||
|
||||
func (e *engine) peerConnecting(onion string) {
|
||||
e.eventManager.Publish(event.NewEvent(event.PeerStateChange, map[event.Field]string{
|
||||
event.RemotePeer: string(onion),
|
||||
event.ConnectionState: ConnectionStateName[CONNECTING],
|
||||
}))
|
||||
}
|
||||
|
||||
func (e *engine) serverConnecting(onion string) {
|
||||
e.eventManager.Publish(event.NewEvent(event.ServerStateChange, map[event.Field]string{
|
||||
event.GroupServer: string(onion),
|
||||
event.ConnectionState: ConnectionStateName[CONNECTING],
|
||||
}))
|
||||
}
|
||||
|
||||
func (e *engine) serverConnected(onion string) {
|
||||
e.eventManager.Publish(event.NewEvent(event.ServerStateChange, map[event.Field]string{
|
||||
event.GroupServer: onion,
|
||||
event.ConnectionState: ConnectionStateName[CONNECTED],
|
||||
}))
|
||||
}
|
||||
|
||||
func (e *engine) serverSynced(onion string) {
|
||||
e.eventManager.Publish(event.NewEvent(event.ServerStateChange, map[event.Field]string{
|
||||
event.GroupServer: onion,
|
||||
event.ConnectionState: ConnectionStateName[SYNCED],
|
||||
}))
|
||||
}
|
||||
|
||||
func (e *engine) serverDisconnected(onion string) {
|
||||
e.eventManager.Publish(event.NewEvent(event.ServerStateChange, map[event.Field]string{
|
||||
event.GroupServer: onion,
|
||||
event.ConnectionState: ConnectionStateName[DISCONNECTED],
|
||||
}))
|
||||
}
|
||||
|
||||
func (e *engine) peerAck(onion string, eventID string) {
|
||||
e.eventManager.Publish(event.NewEvent(event.PeerAcknowledgement, map[event.Field]string{
|
||||
event.EventID: eventID,
|
||||
event.RemotePeer: onion,
|
||||
}))
|
||||
}
|
||||
|
||||
func (e *engine) peerDisconnected(onion string) {
|
||||
e.eventManager.Publish(event.NewEvent(event.PeerStateChange, map[event.Field]string{
|
||||
event.RemotePeer: string(onion),
|
||||
event.ConnectionState: ConnectionStateName[DISCONNECTED],
|
||||
}))
|
||||
}
|
||||
|
||||
// sendMessageToPeer sends a message to a peer under a given context
|
||||
func (e *engine) sendMessageToPeer(eventID string, onion string, context string, message []byte) error {
|
||||
conn, err := e.service.WaitForCapabilityOrClose(onion, cwtchCapability)
|
||||
if err == nil {
|
||||
peerApp, ok := (conn.App()).(*PeerApp)
|
||||
if ok {
|
||||
peerApp.SendMessage(PeerMessage{eventID, context, message})
|
||||
return nil
|
||||
}
|
||||
return errors.New("failed type assertion conn.App != PeerApp")
|
||||
}
|
||||
return err
|
||||
}
|
||||
|
||||
func (e *engine) sendGetValToPeer(eventID, onion, scope, path string) error {
|
||||
log.Debugf("sendGetValMessage to peer %v %v%v\n", onion, scope, path)
|
||||
getVal := peerGetVal{Scope: scope, Path: path}
|
||||
message, err := json.Marshal(getVal)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return e.sendMessageToPeer(eventID, onion, event.ContextGetVal, message)
|
||||
}
|
||||
|
||||
func (e *engine) sendRetValToPeer(eventID, onion, val, existsStr string) error {
|
||||
log.Debugf("sendRetValMessage to peer %v (%v) %v %v\n", onion, eventID, val, existsStr)
|
||||
exists, _ := strconv.ParseBool(existsStr)
|
||||
retVal := peerRetVal{Val: val, Exists: exists}
|
||||
message, err := json.Marshal(retVal)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
return e.sendMessageToPeer(eventID, onion, event.ContextRetVal, message)
|
||||
}
|
||||
|
||||
func (e *engine) deleteConnection(id string) {
|
||||
conn, err := e.service.GetConnection(id)
|
||||
if err == nil {
|
||||
conn.Close()
|
||||
}
|
||||
}
|
||||
|
||||
// receiveGroupMessage is a callback function that processes GroupMessages from a given server
|
||||
func (e *engine) receiveGroupMessage(server string, gm *groups.EncryptedGroupMessage) {
|
||||
// Publish Event so that a Profile Engine can deal with it.
|
||||
// Note: This technically means that *multiple* Profile Engines could listen to the same ProtocolEngine!
|
||||
e.eventManager.Publish(event.NewEvent(event.EncryptedGroupMessage, map[event.Field]string{event.GroupServer: server, event.Ciphertext: base64.StdEncoding.EncodeToString(gm.Ciphertext), event.Signature: base64.StdEncoding.EncodeToString(gm.Signature)}))
|
||||
}
|
||||
|
||||
// sendMessageToGroup attempts to sent the given message to the given group id.
|
||||
func (e *engine) sendMessageToGroup(groupID string, server string, ct []byte, sig []byte) {
|
||||
|
||||
es, ok := e.ephemeralServices.Load(server)
|
||||
if es == nil || !ok {
|
||||
e.eventManager.Publish(event.NewEvent(event.SendMessageToGroupError, map[event.Field]string{event.GroupID: groupID, event.GroupServer: server, event.Error: "server-not-found", event.Signature: base64.StdEncoding.EncodeToString(sig)}))
|
||||
return
|
||||
}
|
||||
ephemeralService := es.(tapir.Service)
|
||||
|
||||
conn, err := ephemeralService.WaitForCapabilityOrClose(server, groups.CwtchServerSyncedCapability)
|
||||
if err == nil {
|
||||
tokenApp, ok := (conn.App()).(*TokenBoardClient)
|
||||
if ok {
|
||||
if spent, numtokens := tokenApp.Post(ct, sig); !spent {
|
||||
// TODO: while this works for the spam guard, it won't work for other forms of payment...
|
||||
// Make an -inline- payment, this will hold the goroutine
|
||||
if err := tokenApp.MakePayment(); err == nil {
|
||||
// This really shouldn't fail since we now know we have the required tokens...
|
||||
if spent, _ := tokenApp.Post(ct, sig); !spent {
|
||||
e.eventManager.Publish(event.NewEvent(event.SendMessageToGroupError, map[event.Field]string{event.GroupID: groupID, event.GroupServer: server, event.Error: err.Error(), event.Signature: base64.StdEncoding.EncodeToString(sig)}))
|
||||
}
|
||||
} else {
|
||||
// Broadast the token error
|
||||
e.eventManager.Publish(event.NewEvent(event.SendMessageToGroupError, map[event.Field]string{event.GroupID: groupID, event.GroupServer: server, event.Error: err.Error(), event.Signature: base64.StdEncoding.EncodeToString(sig)}))
|
||||
}
|
||||
} else if numtokens < 5 {
|
||||
go tokenApp.MakePayment()
|
||||
}
|
||||
// regardless we return....
|
||||
return
|
||||
}
|
||||
}
|
||||
e.eventManager.Publish(event.NewEvent(event.SendMessageToGroupError, map[event.Field]string{event.GroupID: groupID, event.GroupServer: server, event.Error: "server-connection-not-valid", event.Signature: base64.StdEncoding.EncodeToString(sig)}))
|
||||
}
|
||||
|
||||
func (e *engine) handlePeerMessage(hostname string, eventID string, context string, message []byte) {
|
||||
log.Debugf("New message from peer: %v %v", hostname, context)
|
||||
if context == event.ContextGetVal {
|
||||
var getVal peerGetVal
|
||||
err := json.Unmarshal(message, &getVal)
|
||||
if err == nil {
|
||||
ev := event.NewEventList(event.NewGetValMessageFromPeer, event.RemotePeer, hostname, event.Scope, getVal.Scope, event.Path, getVal.Path)
|
||||
ev.EventID = eventID
|
||||
e.eventManager.Publish(ev)
|
||||
}
|
||||
} else {
|
||||
e.eventManager.Publish(event.NewEvent(event.NewMessageFromPeer, map[event.Field]string{event.TimestampReceived: time.Now().Format(time.RFC3339Nano), event.RemotePeer: hostname, event.Data: string(message)}))
|
||||
}
|
||||
}
|
||||
|
||||
func (e *engine) handlePeerRetVal(hostname string, getValData, retValData []byte) {
|
||||
var getVal peerGetVal
|
||||
var retVal peerRetVal
|
||||
|
||||
err := json.Unmarshal(getValData, &getVal)
|
||||
if err != nil {
|
||||
log.Errorf("Unmarshalling our own getVal request: %v\n", err)
|
||||
return
|
||||
}
|
||||
err = json.Unmarshal(retValData, &retVal)
|
||||
if err != nil {
|
||||
log.Errorf("Unmarshalling peer response to getVal request")
|
||||
return
|
||||
}
|
||||
|
||||
e.eventManager.Publish(event.NewEventList(event.NewRetValMessageFromPeer, event.RemotePeer, hostname, event.Scope, getVal.Scope, event.Path, getVal.Path, event.Exists, strconv.FormatBool(retVal.Exists), event.Data, retVal.Val))
|
||||
}
|
||||
|
||||
func (e *engine) leaveServer(server string) {
|
||||
es, ok := e.ephemeralServices.Load(server)
|
||||
if ok {
|
||||
ephemeralService := es.(tapir.Service)
|
||||
ephemeralService.Shutdown()
|
||||
e.ephemeralServices.Delete(server)
|
||||
}
|
||||
}
|
|
@ -1,126 +0,0 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"encoding/json"
|
||||
"git.openprivacy.ca/cwtch.im/tapir"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/applications"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"sync"
|
||||
)
|
||||
|
||||
const cwtchCapability = tapir.Capability("cwtchCapability")
|
||||
|
||||
// PeerApp encapsulates the behaviour of a Cwtch Peer
|
||||
type PeerApp struct {
|
||||
applications.AuthApp
|
||||
connection tapir.Connection
|
||||
MessageHandler func(string, string, string, []byte)
|
||||
RetValHandler func(string, []byte, []byte)
|
||||
IsBlocked func(string) bool
|
||||
IsAllowed func(string) bool
|
||||
OnAcknowledgement func(string, string)
|
||||
OnAuth func(string)
|
||||
OnClose func(string)
|
||||
OnConnecting func(string)
|
||||
|
||||
getValRequests sync.Map // [string]string eventID:Data
|
||||
}
|
||||
|
||||
// PeerMessage is an encapsulation that can be used by higher level applications
|
||||
type PeerMessage struct {
|
||||
ID string // A unique Message ID (primarily used for acknowledgments)
|
||||
Context string // A unique context identifier i.e. im.cwtch.chat
|
||||
Data []byte // The serialized data packet.
|
||||
}
|
||||
|
||||
type peerGetVal struct {
|
||||
Scope, Path string
|
||||
}
|
||||
|
||||
type peerRetVal struct {
|
||||
Val string
|
||||
Exists bool
|
||||
}
|
||||
|
||||
// NewInstance should always return a new instantiation of the application.
|
||||
func (pa *PeerApp) NewInstance() tapir.Application {
|
||||
newApp := new(PeerApp)
|
||||
newApp.MessageHandler = pa.MessageHandler
|
||||
newApp.IsBlocked = pa.IsBlocked
|
||||
newApp.IsAllowed = pa.IsAllowed
|
||||
newApp.OnAcknowledgement = pa.OnAcknowledgement
|
||||
newApp.OnAuth = pa.OnAuth
|
||||
newApp.OnClose = pa.OnClose
|
||||
newApp.OnConnecting = pa.OnConnecting
|
||||
newApp.RetValHandler = pa.RetValHandler
|
||||
return newApp
|
||||
}
|
||||
|
||||
// Init is run when the connection is first started.
|
||||
func (pa *PeerApp) Init(connection tapir.Connection) {
|
||||
// First run the Authentication App
|
||||
pa.AuthApp.Init(connection)
|
||||
|
||||
if connection.HasCapability(applications.AuthCapability) {
|
||||
|
||||
pa.connection = connection
|
||||
connection.SetCapability(cwtchCapability)
|
||||
|
||||
if pa.IsBlocked(connection.Hostname()) {
|
||||
pa.connection.Close()
|
||||
pa.OnClose(connection.Hostname())
|
||||
} else {
|
||||
pa.OnAuth(connection.Hostname())
|
||||
go pa.listen()
|
||||
}
|
||||
} else {
|
||||
// The auth protocol wasn't completed, we can safely shutdown the connection
|
||||
connection.Close()
|
||||
}
|
||||
}
|
||||
|
||||
func (pa *PeerApp) listen() {
|
||||
for {
|
||||
message := pa.connection.Expect()
|
||||
if len(message) == 0 {
|
||||
log.Debugf("0 byte read, socket has likely failed. Closing the listen goroutine")
|
||||
pa.OnClose(pa.connection.Hostname())
|
||||
return
|
||||
}
|
||||
var peerMessage PeerMessage
|
||||
err := json.Unmarshal(message, &peerMessage)
|
||||
if err == nil {
|
||||
switch peerMessage.Context {
|
||||
case event.ContextAck:
|
||||
pa.OnAcknowledgement(pa.connection.Hostname(), peerMessage.ID)
|
||||
case event.ContextRetVal:
|
||||
req, ok := pa.getValRequests.Load(peerMessage.ID)
|
||||
if ok {
|
||||
reqStr := []byte(req.(string))
|
||||
pa.RetValHandler(pa.connection.Hostname(), reqStr, peerMessage.Data)
|
||||
pa.getValRequests.Delete(peerMessage.ID)
|
||||
}
|
||||
default:
|
||||
if pa.IsAllowed(pa.connection.Hostname()) {
|
||||
pa.MessageHandler(pa.connection.Hostname(), peerMessage.ID, peerMessage.Context, peerMessage.Data)
|
||||
|
||||
// Acknowledge the message
|
||||
pa.SendMessage(PeerMessage{peerMessage.ID, event.ContextAck, []byte{}})
|
||||
}
|
||||
}
|
||||
} else {
|
||||
log.Errorf("Error unmarshalling PeerMessage package: %x %v", message, err)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// SendMessage sends the peer a preformatted message
|
||||
// NOTE: This is a stub, we will likely want to extend this to better reflect the desired protocol
|
||||
func (pa *PeerApp) SendMessage(message PeerMessage) {
|
||||
if message.Context == event.ContextGetVal {
|
||||
pa.getValRequests.Store(message.ID, string(message.Data))
|
||||
}
|
||||
serialized, _ := json.Marshal(message)
|
||||
pa.connection.Send(serialized)
|
||||
}
|
|
@ -1,209 +0,0 @@
|
|||
package connections
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol/groups"
|
||||
"encoding/json"
|
||||
"errors"
|
||||
"git.openprivacy.ca/cwtch.im/tapir"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/applications"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/networks/tor"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives/privacypass"
|
||||
"git.openprivacy.ca/openprivacy/connectivity"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"github.com/gtank/ristretto255"
|
||||
"sync"
|
||||
)
|
||||
|
||||
// NewTokenBoardClient generates a new Client for Token Board
|
||||
func NewTokenBoardClient(acn connectivity.ACN, Y *ristretto255.Element, tokenServiceOnion string, lastKnownSignature []byte, groupMessageHandler func(server string, gm *groups.EncryptedGroupMessage), serverSyncedHandler func(server string), serverClosedHandler func(server string)) tapir.Application {
|
||||
tba := new(TokenBoardClient)
|
||||
tba.acn = acn
|
||||
tba.tokenService = privacypass.NewTokenServer()
|
||||
tba.tokenService.Y = Y
|
||||
tba.tokenServiceOnion = tokenServiceOnion
|
||||
tba.receiveGroupMessageHandler = groupMessageHandler
|
||||
tba.serverSyncedHandler = serverSyncedHandler
|
||||
tba.serverClosedHandler = serverClosedHandler
|
||||
tba.lastKnownSignature = lastKnownSignature
|
||||
return tba
|
||||
}
|
||||
|
||||
// TokenBoardClient defines a client for the TokenBoard server
|
||||
type TokenBoardClient struct {
|
||||
applications.AuthApp
|
||||
connection tapir.Connection
|
||||
receiveGroupMessageHandler func(server string, gm *groups.EncryptedGroupMessage)
|
||||
serverSyncedHandler func(server string)
|
||||
serverClosedHandler func(server string)
|
||||
|
||||
// Token service handling
|
||||
acn connectivity.ACN
|
||||
tokens []*privacypass.Token
|
||||
tokenLock sync.Mutex
|
||||
tokenService *privacypass.TokenServer
|
||||
tokenServiceOnion string
|
||||
lastKnownSignature []byte
|
||||
}
|
||||
|
||||
// NewInstance Client a new TokenBoardApp
|
||||
func (ta *TokenBoardClient) NewInstance() tapir.Application {
|
||||
tba := new(TokenBoardClient)
|
||||
tba.serverSyncedHandler = ta.serverSyncedHandler
|
||||
tba.serverClosedHandler = ta.serverClosedHandler
|
||||
tba.receiveGroupMessageHandler = ta.receiveGroupMessageHandler
|
||||
tba.acn = ta.acn
|
||||
tba.tokenService = ta.tokenService
|
||||
tba.tokenServiceOnion = ta.tokenServiceOnion
|
||||
tba.lastKnownSignature = ta.lastKnownSignature
|
||||
return tba
|
||||
}
|
||||
|
||||
// Init initializes the cryptographic TokenBoardApp
|
||||
func (ta *TokenBoardClient) Init(connection tapir.Connection) {
|
||||
ta.AuthApp.Init(connection)
|
||||
if connection.HasCapability(applications.AuthCapability) {
|
||||
ta.connection = connection
|
||||
ta.connection.SetCapability(groups.CwtchServerSyncedCapability)
|
||||
log.Debugf("Successfully Initialized Connection")
|
||||
go ta.Listen()
|
||||
// Optimistically acquire many tokens for this server...
|
||||
go ta.MakePayment()
|
||||
go ta.MakePayment()
|
||||
ta.Replay()
|
||||
} else {
|
||||
connection.Close()
|
||||
}
|
||||
}
|
||||
|
||||
// Listen processes the messages for this application
|
||||
func (ta *TokenBoardClient) Listen() {
|
||||
for {
|
||||
log.Debugf("Client waiting...")
|
||||
data := ta.connection.Expect()
|
||||
if len(data) == 0 {
|
||||
log.Debugf("Server closed the connection...")
|
||||
ta.serverClosedHandler(ta.connection.Hostname())
|
||||
return // connection is closed
|
||||
}
|
||||
|
||||
// We always expect the server to follow protocol, and the second it doesn't we close the connection
|
||||
var message groups.Message
|
||||
if err := json.Unmarshal(data, &message); err != nil {
|
||||
log.Debugf("Server sent an unexpected message, closing the connection: %v", err)
|
||||
ta.serverClosedHandler(ta.connection.Hostname())
|
||||
ta.connection.Close()
|
||||
return
|
||||
}
|
||||
|
||||
switch message.MessageType {
|
||||
case groups.NewMessageMessage:
|
||||
if message.NewMessage != nil {
|
||||
ta.receiveGroupMessageHandler(ta.connection.Hostname(), &message.NewMessage.EGM)
|
||||
} else {
|
||||
log.Debugf("Server sent an unexpected NewMessage, closing the connection: %s", data)
|
||||
ta.serverClosedHandler(ta.connection.Hostname())
|
||||
ta.connection.Close()
|
||||
return
|
||||
}
|
||||
case groups.PostResultMessage:
|
||||
// TODO handle failure
|
||||
case groups.ReplayResultMessage:
|
||||
if message.ReplayResult != nil {
|
||||
log.Debugf("Replaying %v Messages...", message.ReplayResult.NumMessages)
|
||||
for i := 0; i < message.ReplayResult.NumMessages; i++ {
|
||||
data := ta.connection.Expect()
|
||||
|
||||
if len(data) == 0 {
|
||||
log.Debugf("Server sent an unexpected EncryptedGroupMessage, closing the connection")
|
||||
ta.serverClosedHandler(ta.connection.Hostname())
|
||||
ta.connection.Close()
|
||||
return
|
||||
}
|
||||
|
||||
egm := &groups.EncryptedGroupMessage{}
|
||||
if err := json.Unmarshal(data, egm); err == nil {
|
||||
ta.receiveGroupMessageHandler(ta.connection.Hostname(), egm)
|
||||
ta.lastKnownSignature = egm.Signature
|
||||
} else {
|
||||
log.Debugf("Server sent an unexpected EncryptedGroupMessage, closing the connection: %v", err)
|
||||
ta.serverClosedHandler(ta.connection.Hostname())
|
||||
ta.connection.Close()
|
||||
return
|
||||
}
|
||||
}
|
||||
ta.serverSyncedHandler(ta.connection.Hostname())
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Replay posts a Replay Message to the server.
|
||||
func (ta *TokenBoardClient) Replay() {
|
||||
data, _ := json.Marshal(groups.Message{MessageType: groups.ReplayRequestMessage, ReplayRequest: &groups.ReplayRequest{LastCommit: ta.lastKnownSignature}})
|
||||
ta.connection.Send(data)
|
||||
}
|
||||
|
||||
// PurchaseTokens purchases the given number of tokens from the server (using the provided payment handler)
|
||||
func (ta *TokenBoardClient) PurchaseTokens() {
|
||||
ta.MakePayment()
|
||||
}
|
||||
|
||||
// Post sends a Post Request to the server
|
||||
func (ta *TokenBoardClient) Post(ct []byte, sig []byte) (bool, int) {
|
||||
egm := groups.EncryptedGroupMessage{Ciphertext: ct, Signature: sig}
|
||||
token, numTokens, err := ta.NextToken(egm.ToBytes(), ta.connection.Hostname())
|
||||
if err == nil {
|
||||
data, _ := json.Marshal(groups.Message{MessageType: groups.PostRequestMessage, PostRequest: &groups.PostRequest{EGM: egm, Token: token}})
|
||||
log.Debugf("Message Length: %s %v", data, len(data))
|
||||
ta.connection.Send(data)
|
||||
return true, numTokens
|
||||
}
|
||||
log.Debugf("No Valid Tokens: %v", err)
|
||||
return false, numTokens
|
||||
}
|
||||
|
||||
// MakePayment uses the PoW based token protocol to obtain more tokens
|
||||
func (ta *TokenBoardClient) MakePayment() error {
|
||||
log.Debugf("Making a Payment %v", ta)
|
||||
id, sk := primitives.InitializeEphemeralIdentity()
|
||||
client := new(tor.BaseOnionService)
|
||||
client.Init(ta.acn, sk, &id)
|
||||
|
||||
tokenApplication := new(applications.TokenApplication)
|
||||
tokenApplication.TokenService = ta.tokenService
|
||||
powTokenApp := new(applications.ApplicationChain).
|
||||
ChainApplication(new(applications.ProofOfWorkApplication), applications.SuccessfulProofOfWorkCapability).
|
||||
ChainApplication(tokenApplication, applications.HasTokensCapability)
|
||||
client.Connect(ta.tokenServiceOnion, powTokenApp)
|
||||
log.Debugf("Waiting for successful PoW Auth...")
|
||||
conn, err := client.WaitForCapabilityOrClose(ta.tokenServiceOnion, applications.HasTokensCapability)
|
||||
if err == nil {
|
||||
powtapp, _ := conn.App().(*applications.TokenApplication)
|
||||
// Update tokens...we need a lock here to prevent SpendToken from modifying the tokens
|
||||
// during this process..
|
||||
log.Debugf("Updating Tokens")
|
||||
ta.tokenLock.Lock()
|
||||
ta.tokens = append(ta.tokens, powtapp.Tokens...)
|
||||
ta.tokenLock.Unlock()
|
||||
log.Debugf("Transcript: %v", powtapp.Transcript().OutputTranscriptToAudit())
|
||||
conn.Close()
|
||||
return nil
|
||||
}
|
||||
log.Debugf("Error making payment: to %v %v", ta.tokenServiceOnion, err)
|
||||
return err
|
||||
}
|
||||
|
||||
// NextToken retrieves the next token
|
||||
func (ta *TokenBoardClient) NextToken(data []byte, hostname string) (privacypass.SpentToken, int, error) {
|
||||
// Taken the first new token, we need a lock here because tokens can be appended by MakePayment
|
||||
// which could result in weird behaviour...
|
||||
ta.tokenLock.Lock()
|
||||
defer ta.tokenLock.Unlock()
|
||||
if len(ta.tokens) == 0 {
|
||||
return privacypass.SpentToken{}, len(ta.tokens), errors.New("no more tokens")
|
||||
}
|
||||
token := ta.tokens[0]
|
||||
ta.tokens = ta.tokens[1:]
|
||||
return token.SpendToken(append(data, hostname...)), len(ta.tokens), nil
|
||||
}
|
|
@ -0,0 +1,135 @@
|
|||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// source: cwtch-profile.proto
|
||||
|
||||
/*
|
||||
Package protocol is a generated protocol buffer package.
|
||||
|
||||
It is generated from these files:
|
||||
cwtch-profile.proto
|
||||
|
||||
It has these top-level messages:
|
||||
CwtchPeerPacket
|
||||
CwtchIdentity
|
||||
GroupChatInvite
|
||||
*/
|
||||
package protocol
|
||||
|
||||
import proto "github.com/golang/protobuf/proto"
|
||||
import fmt "fmt"
|
||||
import math "math"
|
||||
|
||||
// Reference imports to suppress errors if they are not otherwise used.
|
||||
var _ = proto.Marshal
|
||||
var _ = fmt.Errorf
|
||||
var _ = math.Inf
|
||||
|
||||
// This is a compile-time assertion to ensure that this generated file
|
||||
// is compatible with the proto package it is being compiled against.
|
||||
// A compilation error at this line likely means your copy of the
|
||||
// proto package needs to be updated.
|
||||
const _ = proto.ProtoPackageIsVersion2 // please upgrade the proto package
|
||||
|
||||
type CwtchPeerPacket struct {
|
||||
CwtchIdentify *CwtchIdentity `protobuf:"bytes,1,opt,name=cwtch_identify,json=cwtchIdentify" json:"cwtch_identify,omitempty"`
|
||||
GroupChatInvite *GroupChatInvite `protobuf:"bytes,2,opt,name=group_chat_invite,json=groupChatInvite" json:"group_chat_invite,omitempty"`
|
||||
}
|
||||
|
||||
func (m *CwtchPeerPacket) Reset() { *m = CwtchPeerPacket{} }
|
||||
func (m *CwtchPeerPacket) String() string { return proto.CompactTextString(m) }
|
||||
func (*CwtchPeerPacket) ProtoMessage() {}
|
||||
func (*CwtchPeerPacket) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{0} }
|
||||
|
||||
func (m *CwtchPeerPacket) GetCwtchIdentify() *CwtchIdentity {
|
||||
if m != nil {
|
||||
return m.CwtchIdentify
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *CwtchPeerPacket) GetGroupChatInvite() *GroupChatInvite {
|
||||
if m != nil {
|
||||
return m.GroupChatInvite
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
type CwtchIdentity struct {
|
||||
Name string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"`
|
||||
Ed25519PublicKey []byte `protobuf:"bytes,2,opt,name=ed25519_public_key,json=ed25519PublicKey,proto3" json:"ed25519_public_key,omitempty"`
|
||||
}
|
||||
|
||||
func (m *CwtchIdentity) Reset() { *m = CwtchIdentity{} }
|
||||
func (m *CwtchIdentity) String() string { return proto.CompactTextString(m) }
|
||||
func (*CwtchIdentity) ProtoMessage() {}
|
||||
func (*CwtchIdentity) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{1} }
|
||||
|
||||
func (m *CwtchIdentity) GetName() string {
|
||||
if m != nil {
|
||||
return m.Name
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
func (m *CwtchIdentity) GetEd25519PublicKey() []byte {
|
||||
if m != nil {
|
||||
return m.Ed25519PublicKey
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// [name] has invited you to join a group chat: [message]
|
||||
type GroupChatInvite struct {
|
||||
GroupName string `protobuf:"bytes,1,opt,name=group_name,json=groupName" json:"group_name,omitempty"`
|
||||
GroupSharedKey []byte `protobuf:"bytes,2,opt,name=group_shared_key,json=groupSharedKey,proto3" json:"group_shared_key,omitempty"`
|
||||
ServerHost string `protobuf:"bytes,3,opt,name=server_host,json=serverHost" json:"server_host,omitempty"`
|
||||
SignedGroupId []byte `protobuf:"bytes,4,opt,name=signed_group_id,json=signedGroupId,proto3" json:"signed_group_id,omitempty"`
|
||||
InitialMessage []byte `protobuf:"bytes,5,opt,name=initial_message,json=initialMessage,proto3" json:"initial_message,omitempty"`
|
||||
}
|
||||
|
||||
func (m *GroupChatInvite) Reset() { *m = GroupChatInvite{} }
|
||||
func (m *GroupChatInvite) String() string { return proto.CompactTextString(m) }
|
||||
func (*GroupChatInvite) ProtoMessage() {}
|
||||
func (*GroupChatInvite) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{2} }
|
||||
|
||||
func (m *GroupChatInvite) GetGroupName() string {
|
||||
if m != nil {
|
||||
return m.GroupName
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
func (m *GroupChatInvite) GetGroupSharedKey() []byte {
|
||||
if m != nil {
|
||||
return m.GroupSharedKey
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *GroupChatInvite) GetServerHost() string {
|
||||
if m != nil {
|
||||
return m.ServerHost
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
func (m *GroupChatInvite) GetSignedGroupId() []byte {
|
||||
if m != nil {
|
||||
return m.SignedGroupId
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *GroupChatInvite) GetInitialMessage() []byte {
|
||||
if m != nil {
|
||||
return m.InitialMessage
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func init() {
|
||||
proto.RegisterType((*CwtchPeerPacket)(nil), "protocol.CwtchPeerPacket")
|
||||
proto.RegisterType((*CwtchIdentity)(nil), "protocol.CwtchIdentity")
|
||||
proto.RegisterType((*GroupChatInvite)(nil), "protocol.GroupChatInvite")
|
||||
}
|
||||
|
||||
func init() { proto.RegisterFile("cwtch-profile.proto", fileDescriptor0) }
|
|
@ -0,0 +1,21 @@
|
|||
syntax = "proto3";
|
||||
package protocol;
|
||||
|
||||
message CwtchPeerPacket {
|
||||
CwtchIdentity cwtch_identify = 1;
|
||||
GroupChatInvite group_chat_invite = 2;
|
||||
}
|
||||
|
||||
message CwtchIdentity {
|
||||
string name = 1;
|
||||
bytes ed25519_public_key = 2;
|
||||
}
|
||||
|
||||
// [name] has invited you to join a group chat: [message]
|
||||
message GroupChatInvite {
|
||||
string group_name = 1;
|
||||
bytes group_shared_key = 2;
|
||||
string server_host = 3;
|
||||
bytes signed_group_id = 4;
|
||||
bytes initial_message = 5;
|
||||
}
|
|
@ -0,0 +1,188 @@
|
|||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// source: group_message.proto
|
||||
|
||||
package protocol
|
||||
|
||||
import proto "github.com/golang/protobuf/proto"
|
||||
import fmt "fmt"
|
||||
import math "math"
|
||||
import control "git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
|
||||
// Reference imports to suppress errors if they are not otherwise used.
|
||||
var _ = proto.Marshal
|
||||
var _ = fmt.Errorf
|
||||
var _ = math.Inf
|
||||
|
||||
type CwtchServerPacket struct {
|
||||
GroupMessage *GroupMessage `protobuf:"bytes,1,opt,name=group_message,json=groupMessage" json:"group_message,omitempty"`
|
||||
FetchMessage *FetchMessage `protobuf:"bytes,2,opt,name=fetch_message,json=fetchMessage" json:"fetch_message,omitempty"`
|
||||
XXX_unrecognized []byte `json:"-"`
|
||||
}
|
||||
|
||||
func (m *CwtchServerPacket) Reset() { *m = CwtchServerPacket{} }
|
||||
func (m *CwtchServerPacket) String() string { return proto.CompactTextString(m) }
|
||||
func (*CwtchServerPacket) ProtoMessage() {}
|
||||
func (*CwtchServerPacket) Descriptor() ([]byte, []int) { return fileDescriptor2, []int{0} }
|
||||
|
||||
func (m *CwtchServerPacket) GetGroupMessage() *GroupMessage {
|
||||
if m != nil {
|
||||
return m.GroupMessage
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *CwtchServerPacket) GetFetchMessage() *FetchMessage {
|
||||
if m != nil {
|
||||
return m.FetchMessage
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
type FetchMessage struct {
|
||||
XXX_unrecognized []byte `json:"-"`
|
||||
}
|
||||
|
||||
func (m *FetchMessage) Reset() { *m = FetchMessage{} }
|
||||
func (m *FetchMessage) String() string { return proto.CompactTextString(m) }
|
||||
func (*FetchMessage) ProtoMessage() {}
|
||||
func (*FetchMessage) Descriptor() ([]byte, []int) { return fileDescriptor2, []int{1} }
|
||||
|
||||
type GroupMessage struct {
|
||||
Ciphertext []byte `protobuf:"bytes,1,req,name=ciphertext" json:"ciphertext,omitempty"`
|
||||
Spamguard []byte `protobuf:"bytes,2,req,name=spamguard" json:"spamguard,omitempty"`
|
||||
Signature []byte `protobuf:"bytes,3,req,name=signature" json:"signature,omitempty"`
|
||||
XXX_unrecognized []byte `json:"-"`
|
||||
}
|
||||
|
||||
func (m *GroupMessage) Reset() { *m = GroupMessage{} }
|
||||
func (m *GroupMessage) String() string { return proto.CompactTextString(m) }
|
||||
func (*GroupMessage) ProtoMessage() {}
|
||||
func (*GroupMessage) Descriptor() ([]byte, []int) { return fileDescriptor2, []int{2} }
|
||||
|
||||
func (m *GroupMessage) GetCiphertext() []byte {
|
||||
if m != nil {
|
||||
return m.Ciphertext
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *GroupMessage) GetSpamguard() []byte {
|
||||
if m != nil {
|
||||
return m.Spamguard
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *GroupMessage) GetSignature() []byte {
|
||||
if m != nil {
|
||||
return m.Signature
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// DecryptedGroupMessage is *never* sent in the clear on the wire
|
||||
// and is only ever sent when encrypted in the ciphertext parameter of
|
||||
// GroupMessage
|
||||
type DecryptedGroupMessage struct {
|
||||
Onion *string `protobuf:"bytes,1,req,name=onion" json:"onion,omitempty"`
|
||||
Timestamp *int32 `protobuf:"varint,2,req,name=timestamp" json:"timestamp,omitempty"`
|
||||
Text *string `protobuf:"bytes,3,req,name=text" json:"text,omitempty"`
|
||||
SignedGroupId []byte `protobuf:"bytes,4,req,name=signed_group_id,json=signedGroupId" json:"signed_group_id,omitempty"`
|
||||
PreviousMessageSig []byte `protobuf:"bytes,5,req,name=previous_message_sig,json=previousMessageSig" json:"previous_message_sig,omitempty"`
|
||||
// Used to prevent analysis on text length, length is 1024 - len(text)
|
||||
Padding []byte `protobuf:"bytes,6,req,name=padding" json:"padding,omitempty"`
|
||||
XXX_unrecognized []byte `json:"-"`
|
||||
}
|
||||
|
||||
func (m *DecryptedGroupMessage) Reset() { *m = DecryptedGroupMessage{} }
|
||||
func (m *DecryptedGroupMessage) String() string { return proto.CompactTextString(m) }
|
||||
func (*DecryptedGroupMessage) ProtoMessage() {}
|
||||
func (*DecryptedGroupMessage) Descriptor() ([]byte, []int) { return fileDescriptor2, []int{3} }
|
||||
|
||||
func (m *DecryptedGroupMessage) GetOnion() string {
|
||||
if m != nil && m.Onion != nil {
|
||||
return *m.Onion
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
func (m *DecryptedGroupMessage) GetTimestamp() int32 {
|
||||
if m != nil && m.Timestamp != nil {
|
||||
return *m.Timestamp
|
||||
}
|
||||
return 0
|
||||
}
|
||||
|
||||
func (m *DecryptedGroupMessage) GetText() string {
|
||||
if m != nil && m.Text != nil {
|
||||
return *m.Text
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
func (m *DecryptedGroupMessage) GetSignedGroupId() []byte {
|
||||
if m != nil {
|
||||
return m.SignedGroupId
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *DecryptedGroupMessage) GetPreviousMessageSig() []byte {
|
||||
if m != nil {
|
||||
return m.PreviousMessageSig
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *DecryptedGroupMessage) GetPadding() []byte {
|
||||
if m != nil {
|
||||
return m.Padding
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
var E_ServerNonce = &proto.ExtensionDesc{
|
||||
ExtendedType: (*control.ChannelResult)(nil),
|
||||
ExtensionType: ([]byte)(nil),
|
||||
Field: 8200,
|
||||
Name: "protocol.server_nonce",
|
||||
Tag: "bytes,8200,opt,name=server_nonce,json=serverNonce",
|
||||
Filename: "group_message.proto",
|
||||
}
|
||||
|
||||
func init() {
|
||||
proto.RegisterType((*CwtchServerPacket)(nil), "protocol.CwtchServerPacket")
|
||||
proto.RegisterType((*FetchMessage)(nil), "protocol.FetchMessage")
|
||||
proto.RegisterType((*GroupMessage)(nil), "protocol.GroupMessage")
|
||||
proto.RegisterType((*DecryptedGroupMessage)(nil), "protocol.DecryptedGroupMessage")
|
||||
proto.RegisterExtension(E_ServerNonce)
|
||||
}
|
||||
|
||||
func init() { proto.RegisterFile("group_message.proto", fileDescriptor2) }
|
||||
|
||||
var fileDescriptor2 = []byte{
|
||||
// 360 bytes of a gzipped FileDescriptorProto
|
||||
0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x5c, 0x92, 0x4d, 0x6e, 0xdb, 0x30,
|
||||
0x10, 0x85, 0x21, 0xff, 0xb4, 0xf5, 0x58, 0x6e, 0x51, 0xd6, 0x6d, 0x89, 0xa2, 0x28, 0x0c, 0x2d,
|
||||
0x0a, 0xaf, 0x8c, 0x20, 0xcb, 0x78, 0x13, 0xc0, 0x41, 0x82, 0x2c, 0x12, 0x04, 0xf2, 0x01, 0x04,
|
||||
0x42, 0x1a, 0x53, 0x4c, 0x24, 0x92, 0x20, 0x29, 0x27, 0xb9, 0x41, 0x36, 0x39, 0x5d, 0x2e, 0x14,
|
||||
0x88, 0xb2, 0x6c, 0x39, 0x2b, 0x69, 0xde, 0x37, 0x6f, 0xde, 0x80, 0x24, 0xfc, 0xe0, 0x46, 0x55,
|
||||
0x3a, 0x29, 0xd1, 0x5a, 0xc6, 0x71, 0xa1, 0x8d, 0x72, 0x8a, 0x7c, 0xf1, 0x9f, 0x54, 0x15, 0x7f,
|
||||
0xa6, 0x2b, 0x25, 0x9d, 0x51, 0xc5, 0x2a, 0x67, 0x52, 0x62, 0xd1, 0xf0, 0xe8, 0x35, 0x80, 0xef,
|
||||
0xab, 0x47, 0x97, 0xe6, 0x6b, 0x34, 0x5b, 0x34, 0x77, 0x2c, 0x7d, 0x40, 0x47, 0x96, 0x30, 0x39,
|
||||
0x1a, 0x46, 0x83, 0x59, 0x30, 0x1f, 0x9f, 0xfe, 0x5a, 0xb4, 0xd3, 0x16, 0x57, 0x35, 0xbe, 0x69,
|
||||
0x68, 0x1c, 0xf2, 0x4e, 0x55, 0x9b, 0x37, 0xe8, 0xd2, 0x7c, 0x6f, 0xee, 0x7d, 0x34, 0x5f, 0xd6,
|
||||
0x78, 0x6f, 0xde, 0x74, 0xaa, 0xe8, 0x2b, 0x84, 0x5d, 0x1a, 0xdd, 0x43, 0xd8, 0x8d, 0x22, 0xff,
|
||||
0x00, 0x52, 0xa1, 0x73, 0x34, 0x0e, 0x9f, 0x1c, 0x0d, 0x66, 0xbd, 0x79, 0x18, 0x77, 0x14, 0xf2,
|
||||
0x17, 0x46, 0x56, 0xb3, 0x92, 0x57, 0xcc, 0x64, 0xb4, 0xe7, 0xf1, 0x41, 0xf0, 0x54, 0x70, 0xc9,
|
||||
0x5c, 0x65, 0x90, 0xf6, 0x77, 0xb4, 0x15, 0xa2, 0xb7, 0x00, 0x7e, 0x5e, 0x60, 0x6a, 0x9e, 0xb5,
|
||||
0xc3, 0xec, 0x28, 0x75, 0x0a, 0x43, 0x25, 0x85, 0x92, 0x3e, 0x70, 0x14, 0x37, 0x45, 0x3d, 0xcd,
|
||||
0x89, 0x12, 0xad, 0x63, 0xa5, 0xf6, 0x59, 0xc3, 0xf8, 0x20, 0x10, 0x02, 0x03, 0xbf, 0x63, 0xdf,
|
||||
0x5b, 0xfc, 0x3f, 0xf9, 0x0f, 0xdf, 0xea, 0x38, 0xcc, 0x92, 0xe6, 0x78, 0x45, 0x46, 0x07, 0x7e,
|
||||
0x8b, 0x49, 0x23, 0xfb, 0xd0, 0xeb, 0x8c, 0x9c, 0xc0, 0x54, 0x1b, 0xdc, 0x0a, 0x55, 0xd9, 0xf6,
|
||||
0x14, 0x13, 0x2b, 0x38, 0x1d, 0xfa, 0x66, 0xd2, 0xb2, 0xdd, 0x7a, 0x6b, 0xc1, 0x09, 0x85, 0xcf,
|
||||
0x9a, 0x65, 0x99, 0x90, 0x9c, 0x7e, 0xf2, 0x4d, 0x6d, 0x79, 0xb6, 0x84, 0xd0, 0xfa, 0xbb, 0x4d,
|
||||
0xa4, 0x92, 0x29, 0x92, 0xdf, 0x87, 0x7b, 0xd8, 0x3d, 0x85, 0x18, 0x6d, 0x55, 0x38, 0xfa, 0x72,
|
||||
0x3e, 0x0b, 0xe6, 0x61, 0x3c, 0x6e, 0xba, 0x6f, 0xeb, 0xe6, 0xf7, 0x00, 0x00, 0x00, 0xff, 0xff,
|
||||
0x33, 0x30, 0xca, 0x8b, 0x54, 0x02, 0x00, 0x00,
|
||||
}
|
|
@ -0,0 +1,35 @@
|
|||
syntax = "proto2";
|
||||
package protocol;
|
||||
|
||||
import "ControlChannel.proto";
|
||||
|
||||
message CwtchServerPacket {
|
||||
optional GroupMessage group_message = 1;
|
||||
optional FetchMessage fetch_message = 2;
|
||||
}
|
||||
|
||||
extend protocol.ChannelResult {
|
||||
optional bytes server_nonce = 8200; // 32 random bytes
|
||||
}
|
||||
|
||||
message FetchMessage {
|
||||
}
|
||||
|
||||
message GroupMessage {
|
||||
required bytes ciphertext = 1;
|
||||
required bytes spamguard = 2;
|
||||
required bytes signature = 3;
|
||||
}
|
||||
|
||||
// DecryptedGroupMessage is *never* sent in the clear on the wire
|
||||
// and is only ever sent when encrypted in the ciphertext parameter of
|
||||
// GroupMessage
|
||||
message DecryptedGroupMessage {
|
||||
required string onion = 1;
|
||||
required int32 timestamp = 2;
|
||||
required string text = 3;
|
||||
required bytes signed_group_id = 4;
|
||||
required bytes previous_message_sig =5;
|
||||
// Used to prevent analysis on text length, length is 1024 - len(text)
|
||||
required bytes padding = 6;
|
||||
}
|
|
@ -1,95 +0,0 @@
|
|||
package groups
|
||||
|
||||
import (
|
||||
"encoding/json"
|
||||
"git.openprivacy.ca/cwtch.im/tapir"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives/privacypass"
|
||||
)
|
||||
|
||||
// CwtchServerSyncedCapability is used to indicate that a given cwtch server is synced
|
||||
const CwtchServerSyncedCapability = tapir.Capability("CwtchServerSyncedCapability")
|
||||
|
||||
// GroupInvite provides a structured type for communicating group information to peers
|
||||
type GroupInvite struct {
|
||||
GroupID string
|
||||
GroupName string
|
||||
SignedGroupID []byte
|
||||
Timestamp uint64
|
||||
SharedKey []byte
|
||||
ServerHost string
|
||||
}
|
||||
|
||||
// DecryptedGroupMessage is the main encapsulation of group message data
|
||||
type DecryptedGroupMessage struct {
|
||||
Text string
|
||||
Onion string
|
||||
Timestamp uint64
|
||||
// NOTE: SignedGroupID is now a misnomer, the only way this is signed is indirectly via the signed encrypted group messages
|
||||
// We now treat GroupID as binding to a server/key rather than an "owner" - additional validation logic (to e.g.
|
||||
// respect particular group constitutions) can be built on top of group messages, but the underlying groups are
|
||||
// now agnostic to those models.
|
||||
SignedGroupID []byte
|
||||
PreviousMessageSig []byte
|
||||
Padding []byte
|
||||
}
|
||||
|
||||
// EncryptedGroupMessage provides an encapsulation of the encrypted group message stored on the server
|
||||
type EncryptedGroupMessage struct {
|
||||
Ciphertext []byte
|
||||
Signature []byte
|
||||
}
|
||||
|
||||
// ToBytes converts the encrypted group message to a set of bytes for serialization
|
||||
func (egm EncryptedGroupMessage) ToBytes() []byte {
|
||||
data, _ := json.Marshal(egm)
|
||||
return data
|
||||
}
|
||||
|
||||
// MessageType defines the enum for TokenBoard messages
|
||||
type MessageType int
|
||||
|
||||
// Message Types
|
||||
const (
|
||||
ReplayRequestMessage MessageType = iota
|
||||
ReplayResultMessage
|
||||
PostRequestMessage
|
||||
PostResultMessage
|
||||
NewMessageMessage
|
||||
)
|
||||
|
||||
// Message encapsulates the application protocol
|
||||
type Message struct {
|
||||
MessageType MessageType
|
||||
PostRequest *PostRequest `json:",omitempty"`
|
||||
PostResult *PostResult `json:",omitempty"`
|
||||
NewMessage *NewMessage `json:",omitempty"`
|
||||
ReplayRequest *ReplayRequest `json:",omitempty"`
|
||||
ReplayResult *ReplayResult `json:",omitempty"`
|
||||
}
|
||||
|
||||
// ReplayRequest requests a reply from the given Commit
|
||||
type ReplayRequest struct {
|
||||
LastCommit []byte
|
||||
}
|
||||
|
||||
// PostRequest requests to post the message to the board with the given token
|
||||
type PostRequest struct {
|
||||
Token privacypass.SpentToken
|
||||
EGM EncryptedGroupMessage
|
||||
}
|
||||
|
||||
// PostResult returns the success of a given post attempt
|
||||
type PostResult struct {
|
||||
Success bool
|
||||
}
|
||||
|
||||
// ReplayResult is sent by the server before a stream of replayed messages
|
||||
type ReplayResult struct {
|
||||
NumMessages int
|
||||
}
|
||||
|
||||
// NewMessage is used to send a new bulletin board message to interested peers.
|
||||
type NewMessage struct {
|
||||
//Token privacypass.SpentToken
|
||||
EGM EncryptedGroupMessage
|
||||
}
|
|
@ -0,0 +1,100 @@
|
|||
package spam
|
||||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"crypto/sha256"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"io"
|
||||
//"fmt"
|
||||
)
|
||||
|
||||
// Guard implements a spam protection mechanism for Cwtch Servers.
|
||||
type Guard struct {
|
||||
Difficulty int
|
||||
nonce [24]byte
|
||||
}
|
||||
|
||||
func getRandomness(arr *[24]byte) {
|
||||
if _, err := io.ReadFull(rand.Reader, arr[:]); err != nil {
|
||||
utils.CheckError(err)
|
||||
}
|
||||
}
|
||||
|
||||
//GenerateChallenge returns a channel result packet with a spamguard challenge nonce
|
||||
func (sg *Guard) GenerateChallenge(channelID int32) []byte {
|
||||
|
||||
cr := &Protocol_Data_Control.ChannelResult{
|
||||
ChannelIdentifier: proto.Int32(channelID),
|
||||
Opened: proto.Bool(true),
|
||||
}
|
||||
|
||||
var nonce [24]byte
|
||||
getRandomness(&nonce)
|
||||
sg.nonce = nonce
|
||||
err := proto.SetExtension(cr, protocol.E_ServerNonce, sg.nonce[:])
|
||||
utils.CheckError(err)
|
||||
|
||||
pc := &Protocol_Data_Control.Packet{
|
||||
ChannelResult: cr,
|
||||
}
|
||||
ret, err := proto.Marshal(pc)
|
||||
utils.CheckError(err)
|
||||
return ret
|
||||
}
|
||||
|
||||
// SolveChallenge takes in a challenge and a message and returns a solution
|
||||
// The solution is a 24 byte nonce which when hashed with the challenge and the message
|
||||
// produces a sha256 hash with Difficulty leading 0s
|
||||
func (sg *Guard) SolveChallenge(challenge []byte, message []byte) []byte {
|
||||
solved := false
|
||||
var spamguard [24]byte
|
||||
sum := sha256.Sum256([]byte{})
|
||||
solve := make([]byte, len(challenge)+len(message)+len(spamguard))
|
||||
for !solved {
|
||||
|
||||
getRandomness(&spamguard)
|
||||
|
||||
copy(solve[0:], challenge[:])
|
||||
copy(solve[len(challenge):], message[:])
|
||||
copy(solve[len(challenge)+len(message):], spamguard[:])
|
||||
|
||||
sum = sha256.Sum256(solve)
|
||||
|
||||
solved = true
|
||||
for i := 0; i < sg.Difficulty; i++ {
|
||||
if sum[i] != 0x00 {
|
||||
solved = false
|
||||
}
|
||||
}
|
||||
}
|
||||
//fmt.Printf("[SOLVED] %x\n",sha256.Sum256(solve))
|
||||
return spamguard[:]
|
||||
}
|
||||
|
||||
// ValidateChallenge returns true if the message and spamguard pass the challenge
|
||||
func (sg *Guard) ValidateChallenge(message []byte, spamguard []byte) bool {
|
||||
if len(spamguard) != 24 {
|
||||
return false
|
||||
}
|
||||
|
||||
// If the message is too large just throw it away.
|
||||
if len(message) > 2048 {
|
||||
return false
|
||||
}
|
||||
|
||||
solve := make([]byte, len(sg.nonce)+len(message)+len(spamguard))
|
||||
copy(solve[0:], sg.nonce[:])
|
||||
copy(solve[len(sg.nonce):], message[:])
|
||||
copy(solve[len(sg.nonce)+len(message):], spamguard[:])
|
||||
sum := sha256.Sum256(solve)
|
||||
|
||||
for i := 0; i < sg.Difficulty; i++ {
|
||||
if sum[i] != 0x00 {
|
||||
return false
|
||||
}
|
||||
}
|
||||
return true
|
||||
}
|
|
@ -0,0 +1,69 @@
|
|||
package spam
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"testing"
|
||||
)
|
||||
|
||||
func TestSpamGuard(t *testing.T) {
|
||||
var spamGuard Guard
|
||||
spamGuard.Difficulty = 2
|
||||
challenge := spamGuard.GenerateChallenge(3)
|
||||
|
||||
control := new(Protocol_Data_Control.Packet)
|
||||
proto.Unmarshal(challenge[:], control)
|
||||
|
||||
if control.GetChannelResult() != nil {
|
||||
ce, _ := proto.GetExtension(control.GetChannelResult(), protocol.E_ServerNonce)
|
||||
challenge := ce.([]byte)[:]
|
||||
|
||||
sgsolve := spamGuard.SolveChallenge(challenge, []byte("Hello"))
|
||||
t.Logf("Solved: %v %v", challenge, sgsolve)
|
||||
result := spamGuard.ValidateChallenge([]byte("Hello"), sgsolve)
|
||||
if result != true {
|
||||
t.Errorf("Validating Guard Failed")
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
t.Errorf("Failed SpamGaurd")
|
||||
|
||||
}
|
||||
|
||||
func TestSpamGuardBadLength(t *testing.T) {
|
||||
var spamGuard Guard
|
||||
spamGuard.Difficulty = 2
|
||||
spamGuard.GenerateChallenge(3)
|
||||
result := spamGuard.ValidateChallenge([]byte("test"), []byte{0x00, 0x00})
|
||||
if result {
|
||||
t.Errorf("Validating Guard should have failed")
|
||||
}
|
||||
}
|
||||
|
||||
func TestSpamGuardFail(t *testing.T) {
|
||||
var spamGuard Guard
|
||||
spamGuard.Difficulty = 2
|
||||
challenge := spamGuard.GenerateChallenge(3)
|
||||
|
||||
control := new(Protocol_Data_Control.Packet)
|
||||
proto.Unmarshal(challenge[:], control)
|
||||
|
||||
if control.GetChannelResult() != nil {
|
||||
ce, _ := proto.GetExtension(control.GetChannelResult(), protocol.E_ServerNonce)
|
||||
challenge := ce.([]byte)[:]
|
||||
|
||||
var spamGuard2 Guard
|
||||
spamGuard2.Difficulty = 1
|
||||
sgsolve := spamGuard2.SolveChallenge(challenge, []byte("Hello"))
|
||||
t.Logf("Solved: %v %v", challenge, sgsolve)
|
||||
result := spamGuard.ValidateChallenge([]byte("Hello"), sgsolve)
|
||||
if result {
|
||||
t.Errorf("Validating Guard successes")
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
t.Errorf("Failed SpamGaurd")
|
||||
}
|
|
@ -1,18 +1,8 @@
|
|||
package main
|
||||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"cwtch.im/cwtch/model"
|
||||
cwtchserver "cwtch.im/cwtch/server"
|
||||
"encoding/base64"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives"
|
||||
"git.openprivacy.ca/openprivacy/connectivity/tor"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
mrand "math/rand"
|
||||
"os"
|
||||
"os/signal"
|
||||
"syscall"
|
||||
"time"
|
||||
"log"
|
||||
)
|
||||
|
||||
const (
|
||||
|
@ -20,81 +10,11 @@ const (
|
|||
)
|
||||
|
||||
func main() {
|
||||
log.AddEverythingFromPattern("server/app/main")
|
||||
log.AddEverythingFromPattern("server/server")
|
||||
log.SetLevel(log.LevelDebug)
|
||||
configDir := os.Getenv("CWTCH_CONFIG_DIR")
|
||||
|
||||
if len(os.Args) == 2 && os.Args[1] == "gen1" {
|
||||
config := new(cwtchserver.Config)
|
||||
id, pk := primitives.InitializeEphemeralIdentity()
|
||||
tid, tpk := primitives.InitializeEphemeralIdentity()
|
||||
config.PrivateKey = pk
|
||||
config.PublicKey = id.PublicKey()
|
||||
config.TokenServerPrivateKey = tpk
|
||||
config.TokenServerPublicKey = tid.PublicKey()
|
||||
config.MaxBufferLines = 100000
|
||||
config.ServerReporting = cwtchserver.Reporting{
|
||||
LogMetricsToFile: true,
|
||||
ReportingGroupID: "",
|
||||
ReportingServerAddr: "",
|
||||
}
|
||||
config.Save(".", "serverConfig.json")
|
||||
return
|
||||
}
|
||||
|
||||
serverConfig := cwtchserver.LoadConfig(configDir, serverConfigFile)
|
||||
|
||||
// we don't need real randomness for the port, just to avoid a possible conflict...
|
||||
mrand.Seed(int64(time.Now().Nanosecond()))
|
||||
controlPort := mrand.Intn(1000) + 9052
|
||||
|
||||
// generate a random password
|
||||
key := make([]byte, 64)
|
||||
_, err := rand.Read(key)
|
||||
if err != nil {
|
||||
panic(err)
|
||||
}
|
||||
|
||||
os.MkdirAll("tordir/tor", 0700)
|
||||
tor.NewTorrc().WithHashedPassword(base64.StdEncoding.EncodeToString(key)).WithControlPort(controlPort).Build("./tordir/tor/torrc")
|
||||
acn, err := tor.NewTorACNWithAuth("tordir", "", controlPort, tor.HashedPasswordAuthenticator{Password: base64.StdEncoding.EncodeToString(key)})
|
||||
|
||||
if err != nil {
|
||||
log.Errorf("\nError connecting to Tor: %v\n", err)
|
||||
os.Exit(1)
|
||||
}
|
||||
defer acn.Close()
|
||||
serverConfig := cwtchserver.LoadConfig(serverConfigFile)
|
||||
|
||||
server := new(cwtchserver.Server)
|
||||
log.Infoln("starting cwtch server...")
|
||||
log.Printf("starting cwtch server...")
|
||||
|
||||
server.Setup(serverConfig)
|
||||
|
||||
// TODO create a random group for testing
|
||||
group, _ := model.NewGroup(tor.GetTorV3Hostname(serverConfig.PublicKey))
|
||||
invite, err := group.Invite()
|
||||
if err != nil {
|
||||
panic(err)
|
||||
}
|
||||
|
||||
bundle := server.KeyBundle().Serialize()
|
||||
log.Infof("Server Config: server:%s", base64.StdEncoding.EncodeToString(bundle))
|
||||
|
||||
log.Infof("Server Tofu Bundle: tofubundle:server:%s||%s", base64.StdEncoding.EncodeToString(bundle), invite)
|
||||
|
||||
// Graceful Shutdown
|
||||
c := make(chan os.Signal, 1)
|
||||
signal.Notify(c, os.Interrupt, syscall.SIGTERM)
|
||||
go func() {
|
||||
<-c
|
||||
acn.Close()
|
||||
server.Close()
|
||||
os.Exit(1)
|
||||
}()
|
||||
|
||||
server.Run(acn)
|
||||
for {
|
||||
time.Sleep(time.Second)
|
||||
}
|
||||
// TODO load params from .cwtch/server.conf or command line flag
|
||||
server.Run(serverConfig)
|
||||
}
|
||||
|
|
|
@ -1,33 +0,0 @@
|
|||
#!/bin/sh
|
||||
set -o errexit
|
||||
|
||||
chmod_files() { find $2 -type f -exec chmod -v $1 {} \;
|
||||
}
|
||||
chmod_dirs() { find $2 -type d -exec chmod -v $1 {} \;
|
||||
}
|
||||
|
||||
chown ${TOR_USER}:${TOR_USER} /run/tor/
|
||||
chmod 770 /run/tor
|
||||
|
||||
chown -Rv ${TOR_USER}:${TOR_USER} /var/lib/tor
|
||||
chmod_dirs 700 /var/lib/tor
|
||||
chmod_files 600 /var/lib/tor
|
||||
|
||||
echo -e "\n========================================================"
|
||||
# Display OS version, Tor version & torrc in log
|
||||
echo -e "Alpine Version: \c" && cat /etc/alpine-release
|
||||
tor --version
|
||||
#cat /etc/tor/torrc
|
||||
echo -e "========================================================\n"
|
||||
|
||||
tor -f /etc/tor/torrc
|
||||
|
||||
#Cwtch will crash and burn if 9051 isn't ready
|
||||
sleep 15
|
||||
|
||||
if [ -z "${CWTCH_CONFIG_DIR}" ]; then
|
||||
CWTCH_CONFIG_DIR=/etc/cwtch/
|
||||
fi
|
||||
|
||||
#Run cwtch (or whatever the user passed)
|
||||
CWTCH_CONFIG_DIR=$CWTCH_CONFIG_DIR exec "$@"
|
|
@ -1,27 +0,0 @@
|
|||
User _tor
|
||||
DataDirectory /var/lib/tor
|
||||
|
||||
ORPort 0
|
||||
ExitRelay 0
|
||||
IPv6Exit 0
|
||||
|
||||
#We need this running in the background as the server doesn't launch it itself
|
||||
RunAsDaemon 1
|
||||
|
||||
ClientOnly 1
|
||||
SocksPort 9050
|
||||
|
||||
ControlPort 9051
|
||||
ControlSocket /run/tor/control
|
||||
ControlSocketsGroupWritable 1
|
||||
CookieAuthentication 1
|
||||
CookieAuthFile /run/tor/control.authcookie
|
||||
CookieAuthFileGroupReadable 1
|
||||
#HashedControlPassword 16:B4C8EE980C085EE460AEA9094350DAA9C2B5F841400E9BBA247368400A
|
||||
|
||||
# Run as a relay only (change policy to enable exit node)
|
||||
ExitPolicy reject *:* # no exits allowed
|
||||
ExitPolicy reject6 *:*
|
||||
|
||||
# Additional config built by the entrypoint will go here
|
||||
|
|
@ -0,0 +1,100 @@
|
|||
package fetch
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"errors"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
)
|
||||
|
||||
// CwtchServerFetchChannel implements the ChannelHandler interface for a channel of
|
||||
// type "im.cwtch.server.fetch" - this implementation only handles server side logic.
|
||||
type CwtchServerFetchChannel struct {
|
||||
Handler CwtchServerFetchHandler
|
||||
channel *channels.Channel
|
||||
}
|
||||
|
||||
// CwtchServerFetchHandler defines the interface for interacting with this Channel
|
||||
type CwtchServerFetchHandler interface {
|
||||
HandleFetchRequest() []*protocol.GroupMessage
|
||||
}
|
||||
|
||||
// Type returns the type string for this channel, e.g. "im.ricochet.Cwtch".
|
||||
func (cc *CwtchServerFetchChannel) Type() string {
|
||||
return "im.cwtch.server.fetch"
|
||||
}
|
||||
|
||||
// Closed is called when the channel is closed for any reason.
|
||||
func (cc *CwtchServerFetchChannel) Closed(err error) {
|
||||
|
||||
}
|
||||
|
||||
// OnlyClientCanOpen - for Cwtch channels any side can open
|
||||
func (cc *CwtchServerFetchChannel) OnlyClientCanOpen() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// Singleton - for Cwtch channels there can only be one instance per direction
|
||||
func (cc *CwtchServerFetchChannel) Singleton() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// Bidirectional - for Cwtch channels are not bidrectional
|
||||
func (cc *CwtchServerFetchChannel) Bidirectional() bool {
|
||||
return false
|
||||
}
|
||||
|
||||
// RequiresAuthentication - Cwtch channels require hidden service auth
|
||||
func (cc *CwtchServerFetchChannel) RequiresAuthentication() string {
|
||||
return "none"
|
||||
}
|
||||
|
||||
// OpenInbound is the first method called for an inbound channel request.
|
||||
// If an error is returned, the channel is rejected. If a RawMessage is
|
||||
// returned, it will be sent as the ChannelResult message.
|
||||
func (cc *CwtchServerFetchChannel) OpenInbound(channel *channels.Channel, raw *Protocol_Data_Control.OpenChannel) ([]byte, error) {
|
||||
cc.channel = channel
|
||||
messageBuilder := new(utils.MessageBuilder)
|
||||
return messageBuilder.AckOpenChannel(channel.ID), nil
|
||||
}
|
||||
|
||||
// OpenOutbound is the first method called for an outbound channel request.
|
||||
// If an error is returned, the channel is not opened. If a RawMessage is
|
||||
// returned, it will be sent as the OpenChannel message.
|
||||
func (cc *CwtchServerFetchChannel) OpenOutbound(channel *channels.Channel) ([]byte, error) {
|
||||
return nil, errors.New("server does not open Fetch channels")
|
||||
}
|
||||
|
||||
// OpenOutboundResult is called when a response is received for an
|
||||
// outbound OpenChannel request. If `err` is non-nil, the channel was
|
||||
// rejected and Closed will be called immediately afterwards. `raw`
|
||||
// contains the raw protocol message including any extension data.
|
||||
func (cc *CwtchServerFetchChannel) OpenOutboundResult(err error, crm *Protocol_Data_Control.ChannelResult) {
|
||||
// NOTE: Should never be called
|
||||
}
|
||||
|
||||
// SendGroupMessages sends a series of group messages to the client.
|
||||
func (cc *CwtchServerFetchChannel) SendGroupMessages(gms []*protocol.GroupMessage) {
|
||||
for _, gm := range gms {
|
||||
csp := &protocol.CwtchServerPacket{
|
||||
GroupMessage: gm,
|
||||
}
|
||||
packet, _ := proto.Marshal(csp)
|
||||
cc.channel.SendMessage(packet)
|
||||
}
|
||||
}
|
||||
|
||||
// Packet is called for each raw packet received on this channel.
|
||||
func (cc *CwtchServerFetchChannel) Packet(data []byte) {
|
||||
csp := &protocol.CwtchServerPacket{}
|
||||
err := proto.Unmarshal(data, csp)
|
||||
if err == nil {
|
||||
if csp.GetFetchMessage() != nil {
|
||||
cc.SendGroupMessages(cc.Handler.HandleFetchRequest())
|
||||
}
|
||||
}
|
||||
// If we receive a packet on this channel, close the connection
|
||||
cc.channel.CloseChannel()
|
||||
}
|
|
@ -0,0 +1,109 @@
|
|||
package fetch
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"testing"
|
||||
)
|
||||
|
||||
func TestServerFetchChannelAttributes(t *testing.T) {
|
||||
cslc := new(CwtchServerFetchChannel)
|
||||
if cslc.Type() != "im.cwtch.server.fetch" {
|
||||
t.Errorf("cwtch channel type is incorrect %v", cslc.Type())
|
||||
}
|
||||
|
||||
if !cslc.OnlyClientCanOpen() {
|
||||
t.Errorf("only clients should be able to open im.cwtch.server.fetch channel")
|
||||
}
|
||||
|
||||
if cslc.Bidirectional() {
|
||||
t.Errorf("im.cwtch.server.fetch should not be bidirectional")
|
||||
}
|
||||
|
||||
if !cslc.Singleton() {
|
||||
t.Errorf("im.cwtch.server.fetch should be a Singleton")
|
||||
}
|
||||
|
||||
if cslc.RequiresAuthentication() != "none" {
|
||||
t.Errorf("cwtch channel required auth is incorrect %v", cslc.RequiresAuthentication())
|
||||
}
|
||||
|
||||
}
|
||||
func TestServerFetchChannelOpenOutbound(t *testing.T) {
|
||||
cslc := new(CwtchServerFetchChannel)
|
||||
channel := new(channels.Channel)
|
||||
_, err := cslc.OpenOutbound(channel)
|
||||
if err == nil {
|
||||
t.Errorf("server implementation of im.cwtch.server.fetch should never open an outbound channel")
|
||||
}
|
||||
}
|
||||
|
||||
type TestHandler struct {
|
||||
}
|
||||
|
||||
func (th *TestHandler) HandleFetchRequest() []*protocol.GroupMessage {
|
||||
gm := &protocol.GroupMessage{
|
||||
Ciphertext: []byte("Hello"),
|
||||
Spamguard: []byte{},
|
||||
}
|
||||
return []*protocol.GroupMessage{gm}
|
||||
}
|
||||
|
||||
func TestServerFetchChannel(t *testing.T) {
|
||||
cslc := new(CwtchServerFetchChannel)
|
||||
th := new(TestHandler)
|
||||
cslc.Handler = th
|
||||
channel := new(channels.Channel)
|
||||
channel.ID = 1
|
||||
closed := false
|
||||
channel.CloseChannel = func() {
|
||||
closed = true
|
||||
}
|
||||
gotgm := false
|
||||
channel.SendMessage = func([]byte) {
|
||||
gotgm = true
|
||||
}
|
||||
|
||||
oc := &Protocol_Data_Control.OpenChannel{
|
||||
ChannelIdentifier: proto.Int32(1),
|
||||
ChannelType: proto.String(cslc.Type()),
|
||||
}
|
||||
|
||||
resp, err := cslc.OpenInbound(channel, oc)
|
||||
if err != nil {
|
||||
t.Errorf("OpenInbound for im.cwtch.server.Fetch should have succeeded, instead: %v", err)
|
||||
}
|
||||
|
||||
control := new(Protocol_Data_Control.Packet)
|
||||
proto.Unmarshal(resp[:], control)
|
||||
|
||||
if control.GetChannelResult() != nil {
|
||||
|
||||
fm := &protocol.FetchMessage{}
|
||||
|
||||
csp := &protocol.CwtchServerPacket{
|
||||
FetchMessage: fm,
|
||||
}
|
||||
|
||||
packet, _ := proto.Marshal(csp)
|
||||
cslc.Packet(packet)
|
||||
|
||||
if !gotgm {
|
||||
t.Errorf("Did not receive packet on wire as expected in Fetch channel")
|
||||
}
|
||||
|
||||
if !closed {
|
||||
t.Errorf("Fetch channel should be cosed")
|
||||
}
|
||||
|
||||
if !closed {
|
||||
t.Errorf("Fetch channel should be closed after incorrect packet received")
|
||||
}
|
||||
|
||||
} else {
|
||||
t.Errorf("Expected ChannelResult from im.cwtch.server.Fetch, instead: %v", control)
|
||||
}
|
||||
|
||||
}
|
|
@ -0,0 +1,85 @@
|
|||
package listen
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"errors"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
)
|
||||
|
||||
// CwtchServerListenChannel implements the ChannelHandler interface for a channel of
|
||||
// type "im.cwtch.server.listen" - this implementation only handles server side logic.
|
||||
type CwtchServerListenChannel struct {
|
||||
channel *channels.Channel
|
||||
}
|
||||
|
||||
// Type returns the type string for this channel, e.g. "im.ricochet.Cwtch".
|
||||
func (cc *CwtchServerListenChannel) Type() string {
|
||||
return "im.cwtch.server.listen"
|
||||
}
|
||||
|
||||
// Closed is called when the channel is closed for any reason.
|
||||
func (cc *CwtchServerListenChannel) Closed(err error) {
|
||||
|
||||
}
|
||||
|
||||
// OnlyClientCanOpen - for Cwtch channels any side can open
|
||||
func (cc *CwtchServerListenChannel) OnlyClientCanOpen() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// Singleton - for Cwtch channels there can only be one instance per direction
|
||||
func (cc *CwtchServerListenChannel) Singleton() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// Bidirectional - for Cwtch channels are not bidrectional
|
||||
func (cc *CwtchServerListenChannel) Bidirectional() bool {
|
||||
return false
|
||||
}
|
||||
|
||||
// RequiresAuthentication - Cwtch channels require hidden service auth
|
||||
func (cc *CwtchServerListenChannel) RequiresAuthentication() string {
|
||||
return "none"
|
||||
}
|
||||
|
||||
// OpenInbound is the first method called for an inbound channel request.
|
||||
// If an error is returned, the channel is rejected. If a RawMessage is
|
||||
// returned, it will be sent as the ChannelResult message.
|
||||
func (cc *CwtchServerListenChannel) OpenInbound(channel *channels.Channel, raw *Protocol_Data_Control.OpenChannel) ([]byte, error) {
|
||||
cc.channel = channel
|
||||
messageBuilder := new(utils.MessageBuilder)
|
||||
return messageBuilder.AckOpenChannel(channel.ID), nil
|
||||
}
|
||||
|
||||
// OpenOutbound is the first method called for an outbound channel request.
|
||||
// If an error is returned, the channel is not opened. If a RawMessage is
|
||||
// returned, it will be sent as the OpenChannel message.
|
||||
func (cc *CwtchServerListenChannel) OpenOutbound(channel *channels.Channel) ([]byte, error) {
|
||||
return nil, errors.New("server does not open listen channels")
|
||||
}
|
||||
|
||||
// OpenOutboundResult is called when a response is received for an
|
||||
// outbound OpenChannel request. If `err` is non-nil, the channel was
|
||||
// rejected and Closed will be called immediately afterwards. `raw`
|
||||
// contains the raw protocol message including any extension data.
|
||||
func (cc *CwtchServerListenChannel) OpenOutboundResult(err error, crm *Protocol_Data_Control.ChannelResult) {
|
||||
// NOTE: Should never be called
|
||||
}
|
||||
|
||||
// SendGroupMessage sends a single group message to the peer
|
||||
func (cc *CwtchServerListenChannel) SendGroupMessage(gm *protocol.GroupMessage) {
|
||||
csp := &protocol.CwtchServerPacket{
|
||||
GroupMessage: gm,
|
||||
}
|
||||
packet, _ := proto.Marshal(csp)
|
||||
cc.channel.SendMessage(packet)
|
||||
}
|
||||
|
||||
// Packet is called for each raw packet received on this channel.
|
||||
func (cc *CwtchServerListenChannel) Packet(data []byte) {
|
||||
// If we receive a packet on this channel, close the connection
|
||||
cc.channel.CloseChannel()
|
||||
}
|
|
@ -0,0 +1,94 @@
|
|||
package listen
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"testing"
|
||||
)
|
||||
|
||||
func TestServerListenChannelAttributes(t *testing.T) {
|
||||
cslc := new(CwtchServerListenChannel)
|
||||
if cslc.Type() != "im.cwtch.server.listen" {
|
||||
t.Errorf("cwtch channel type is incorrect %v", cslc.Type())
|
||||
}
|
||||
|
||||
if !cslc.OnlyClientCanOpen() {
|
||||
t.Errorf("only clients should be able to open im.cwtch.server.listen channel")
|
||||
}
|
||||
|
||||
if cslc.Bidirectional() {
|
||||
t.Errorf("im.cwtch.server.listen should not be bidirectional")
|
||||
}
|
||||
|
||||
if !cslc.Singleton() {
|
||||
t.Errorf("im.cwtch.server.listen should be a Singleton")
|
||||
}
|
||||
|
||||
if cslc.RequiresAuthentication() != "none" {
|
||||
t.Errorf("cwtch channel required auth is incorrect %v", cslc.RequiresAuthentication())
|
||||
}
|
||||
|
||||
}
|
||||
func TestServerListenChannelOpenOutbound(t *testing.T) {
|
||||
cslc := new(CwtchServerListenChannel)
|
||||
channel := new(channels.Channel)
|
||||
_, err := cslc.OpenOutbound(channel)
|
||||
if err == nil {
|
||||
t.Errorf("server implementation of im.cwtch.server.listen should never open an outbound channel")
|
||||
}
|
||||
}
|
||||
|
||||
func TestServerListenChannel(t *testing.T) {
|
||||
cslc := new(CwtchServerListenChannel)
|
||||
channel := new(channels.Channel)
|
||||
channel.ID = 1
|
||||
closed := false
|
||||
channel.CloseChannel = func() {
|
||||
closed = true
|
||||
}
|
||||
gotgm := false
|
||||
channel.SendMessage = func([]byte) {
|
||||
gotgm = true
|
||||
}
|
||||
|
||||
oc := &Protocol_Data_Control.OpenChannel{
|
||||
ChannelIdentifier: proto.Int32(1),
|
||||
ChannelType: proto.String(cslc.Type()),
|
||||
}
|
||||
|
||||
resp, err := cslc.OpenInbound(channel, oc)
|
||||
if err != nil {
|
||||
t.Errorf("OpenInbound for im.cwtch.server.listen should have succeeded, instead: %v", err)
|
||||
}
|
||||
|
||||
control := new(Protocol_Data_Control.Packet)
|
||||
proto.Unmarshal(resp[:], control)
|
||||
|
||||
if control.GetChannelResult() != nil {
|
||||
gm := &protocol.GroupMessage{
|
||||
Ciphertext: []byte("Hello"),
|
||||
Signature: []byte{},
|
||||
Spamguard: []byte{},
|
||||
}
|
||||
cslc.SendGroupMessage(gm)
|
||||
if !gotgm {
|
||||
t.Errorf("Did not receive packet on wire as expected in listen channel")
|
||||
}
|
||||
|
||||
if closed {
|
||||
t.Errorf("listen channel should not be cosed")
|
||||
}
|
||||
|
||||
cslc.Packet(nil)
|
||||
|
||||
if !closed {
|
||||
t.Errorf("listen channel should be closed after incorrect packet received")
|
||||
}
|
||||
|
||||
} else {
|
||||
t.Errorf("Expected ChannelResult from im.cwtch.server.listen, instead: %v", control)
|
||||
}
|
||||
|
||||
}
|
|
@ -12,7 +12,6 @@ import (
|
|||
type counter struct {
|
||||
startTime time.Time
|
||||
count uint64
|
||||
total uint64
|
||||
}
|
||||
|
||||
// Counter providers a threadsafe counter to use for storing long running counts
|
||||
|
@ -26,7 +25,7 @@ type Counter interface {
|
|||
|
||||
// NewCounter initializes a counter starting at time.Now() and a count of 0 and returns it
|
||||
func NewCounter() Counter {
|
||||
c := &counter{startTime: time.Now(), count: 0, total: 0}
|
||||
c := &counter{startTime: time.Now(), count: 0}
|
||||
return c
|
||||
}
|
||||
|
||||
|
@ -152,13 +151,11 @@ func (mh *monitorHistory) Months() []float64 {
|
|||
}
|
||||
|
||||
func (mh *monitorHistory) Report(w *bufio.Writer) {
|
||||
mh.lock.Lock()
|
||||
fmt.Fprintln(w, "Minutes:", reportLine(mh.monitorType, mh.perMinutePerHour[:]))
|
||||
fmt.Fprintln(w, "Hours: ", reportLine(mh.monitorType, mh.perHourForDay[:]))
|
||||
fmt.Fprintln(w, "Days: ", reportLine(mh.monitorType, mh.perDayForWeek[:]))
|
||||
fmt.Fprintln(w, "Weeks: ", reportLine(mh.monitorType, mh.perWeekForMonth[:]))
|
||||
fmt.Fprintln(w, "Months: ", reportLine(mh.monitorType, mh.perMonthForYear[:]))
|
||||
mh.lock.Unlock()
|
||||
}
|
||||
|
||||
func reportLine(t MonitorType, array []float64) string {
|
||||
|
|
|
@ -9,20 +9,13 @@ func TestCounter(t *testing.T) {
|
|||
starttime := time.Now()
|
||||
c := NewCounter()
|
||||
|
||||
max := 100
|
||||
done := make(chan bool, max)
|
||||
|
||||
// slightly stress test atomic nature of metric by flooding with threads Add()ing
|
||||
for i := 0; i < max; i++ {
|
||||
for i := 0; i < 100; i++ {
|
||||
go func() {
|
||||
c.Add(1)
|
||||
done <- true
|
||||
}()
|
||||
}
|
||||
|
||||
for i := 0; i < max; i++ {
|
||||
<-done
|
||||
}
|
||||
time.Sleep(2 * time.Second)
|
||||
|
||||
val := c.Count()
|
||||
if val != 100 {
|
||||
|
@ -32,6 +25,6 @@ func TestCounter(t *testing.T) {
|
|||
counterStart := c.GetStarttime()
|
||||
|
||||
if counterStart.Sub(starttime) > time.Millisecond {
|
||||
t.Errorf("counter's starttime was innaccurate %v", counterStart.Sub(starttime))
|
||||
t.Error("counter's starttime was innaccurate")
|
||||
}
|
||||
}
|
||||
|
|
|
@ -3,12 +3,10 @@ package metrics
|
|||
import (
|
||||
"bufio"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/cwtch.im/tapir"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/application"
|
||||
"github.com/struCoder/pidusage"
|
||||
"log"
|
||||
"os"
|
||||
"path"
|
||||
"sync"
|
||||
"time"
|
||||
)
|
||||
|
||||
|
@ -18,51 +16,26 @@ const (
|
|||
|
||||
// Monitors is a package of metrics for a Cwtch Server including message count, CPU, Mem, and conns
|
||||
type Monitors struct {
|
||||
MessageCounter Counter
|
||||
TotalMessageCounter Counter
|
||||
Messages MonitorHistory
|
||||
CPU MonitorHistory
|
||||
Memory MonitorHistory
|
||||
ClientConns MonitorHistory
|
||||
starttime time.Time
|
||||
breakChannel chan bool
|
||||
log bool
|
||||
configDir string
|
||||
MessageCounter Counter
|
||||
Messages MonitorHistory
|
||||
CPU MonitorHistory
|
||||
Memory MonitorHistory
|
||||
ClientConns MonitorHistory
|
||||
starttime time.Time
|
||||
breakChannel chan bool
|
||||
log bool
|
||||
}
|
||||
|
||||
// Start initializes a Monitors's monitors
|
||||
func (mp *Monitors) Start(ts tapir.Service, configDir string, log bool) {
|
||||
func (mp *Monitors) Start(ra *application.RicochetApplication, log bool) {
|
||||
mp.log = log
|
||||
mp.configDir = configDir
|
||||
mp.starttime = time.Now()
|
||||
mp.breakChannel = make(chan bool)
|
||||
mp.MessageCounter = NewCounter()
|
||||
|
||||
// Maintain a count of total messages
|
||||
mp.TotalMessageCounter = NewCounter()
|
||||
mp.Messages = NewMonitorHistory(Count, Cumulative, func() (c float64) {
|
||||
c = float64(mp.MessageCounter.Count())
|
||||
mp.TotalMessageCounter.Add(int(c))
|
||||
mp.MessageCounter.Reset()
|
||||
return
|
||||
})
|
||||
|
||||
var pidUsageLock sync.Mutex
|
||||
mp.CPU = NewMonitorHistory(Percent, Average, func() float64 {
|
||||
pidUsageLock.Lock()
|
||||
defer pidUsageLock.Unlock()
|
||||
sysInfo, _ := pidusage.GetStat(os.Getpid())
|
||||
return float64(sysInfo.CPU)
|
||||
})
|
||||
mp.Memory = NewMonitorHistory(MegaBytes, Average, func() float64 {
|
||||
pidUsageLock.Lock()
|
||||
defer pidUsageLock.Unlock()
|
||||
sysInfo, _ := pidusage.GetStat(os.Getpid())
|
||||
return float64(sysInfo.Memory)
|
||||
})
|
||||
|
||||
// TODO: replace with ts.
|
||||
mp.ClientConns = NewMonitorHistory(Count, Average, func() float64 { return float64(ts.Metrics().ConnectionCount) })
|
||||
mp.Messages = NewMonitorHistory(Count, Cumulative, func() (c float64) { c = float64(mp.MessageCounter.Count()); mp.MessageCounter.Reset(); return })
|
||||
mp.CPU = NewMonitorHistory(Percent, Average, func() float64 { sysInfo, _ := pidusage.GetStat(os.Getpid()); return float64(sysInfo.CPU) })
|
||||
mp.Memory = NewMonitorHistory(MegaBytes, Average, func() float64 { sysInfo, _ := pidusage.GetStat(os.Getpid()); return float64(sysInfo.Memory) })
|
||||
mp.ClientConns = NewMonitorHistory(Count, Average, func() float64 { return float64(ra.ConnectionCount()) })
|
||||
|
||||
if mp.log {
|
||||
go mp.run()
|
||||
|
@ -81,9 +54,9 @@ func (mp *Monitors) run() {
|
|||
}
|
||||
|
||||
func (mp *Monitors) report() {
|
||||
f, err := os.Create(path.Join(mp.configDir, reportFile))
|
||||
f, err := os.Create(reportFile)
|
||||
if err != nil {
|
||||
log.Errorf("Could not open monitor reporting file: %v", err)
|
||||
log.Println("ERROR: Could not open monitor reporting file: ", err)
|
||||
return
|
||||
}
|
||||
defer f.Close()
|
||||
|
@ -92,7 +65,7 @@ func (mp *Monitors) report() {
|
|||
|
||||
fmt.Fprintf(w, "Uptime: %v\n\n", time.Now().Sub(mp.starttime))
|
||||
|
||||
fmt.Fprintln(w, "messages:")
|
||||
fmt.Fprintln(w, "Messages:")
|
||||
mp.Messages.Report(w)
|
||||
|
||||
fmt.Fprintln(w, "\nClient Connections:")
|
||||
|
|
|
@ -0,0 +1,99 @@
|
|||
package send
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"cwtch.im/cwtch/protocol/spam"
|
||||
"errors"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"log"
|
||||
)
|
||||
|
||||
// CwtchServerSendChannel implements the ChannelHandler interface for a channel of
|
||||
// type "im.cwtch.server.send - this implementation only handles server-side logic.
|
||||
type CwtchServerSendChannel struct {
|
||||
// Methods of Handler are called for Cwtch events on this channel
|
||||
Handler CwtchServerSendChannelHandler
|
||||
channel *channels.Channel
|
||||
spamguard spam.Guard
|
||||
}
|
||||
|
||||
// CwtchServerSendChannelHandler defines the interface needed to interact with this channel
|
||||
type CwtchServerSendChannelHandler interface {
|
||||
HandleGroupMessage(*protocol.GroupMessage)
|
||||
}
|
||||
|
||||
// Type returns the type string for this channel, e.g. "im.ricochet.Cwtch".
|
||||
func (cc *CwtchServerSendChannel) Type() string {
|
||||
return "im.cwtch.server.send"
|
||||
}
|
||||
|
||||
// Closed is called when the channel is closed for any reason.
|
||||
func (cc *CwtchServerSendChannel) Closed(err error) {
|
||||
|
||||
}
|
||||
|
||||
// OnlyClientCanOpen - for Cwtch channels any side can open
|
||||
func (cc *CwtchServerSendChannel) OnlyClientCanOpen() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// Singleton - for Cwtch channels there can only be one instance per direction
|
||||
func (cc *CwtchServerSendChannel) Singleton() bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// Bidirectional - for Cwtch channels are not bidrectional
|
||||
func (cc *CwtchServerSendChannel) Bidirectional() bool {
|
||||
return false
|
||||
}
|
||||
|
||||
// RequiresAuthentication - Cwtch channels require hidden service auth
|
||||
func (cc *CwtchServerSendChannel) RequiresAuthentication() string {
|
||||
return "none"
|
||||
}
|
||||
|
||||
// OpenInbound is the first method called for an inbound channel request.
|
||||
// If an error is returned, the channel is rejected. If a RawMessage is
|
||||
// returned, it will be sent as the ChannelResult message.
|
||||
func (cc *CwtchServerSendChannel) OpenInbound(channel *channels.Channel, raw *Protocol_Data_Control.OpenChannel) ([]byte, error) {
|
||||
cc.channel = channel
|
||||
cc.spamguard.Difficulty = 2
|
||||
return cc.spamguard.GenerateChallenge(channel.ID), nil
|
||||
}
|
||||
|
||||
// OpenOutbound is the first method called for an outbound channel request.
|
||||
// If an error is returned, the channel is not opened. If a RawMessage is
|
||||
// returned, it will be sent as the OpenChannel message.
|
||||
func (cc *CwtchServerSendChannel) OpenOutbound(channel *channels.Channel) ([]byte, error) {
|
||||
return nil, errors.New("server does not open send channel")
|
||||
}
|
||||
|
||||
// OpenOutboundResult is called when a response is received for an
|
||||
// outbound OpenChannel request. If `err` is non-nil, the channel was
|
||||
// rejected and Closed will be called immediately afterwards. `raw`
|
||||
// contains the raw protocol message including any extension data.
|
||||
func (cc *CwtchServerSendChannel) OpenOutboundResult(err error, crm *Protocol_Data_Control.ChannelResult) {
|
||||
// NOTE: Should never be called
|
||||
}
|
||||
|
||||
// Packet is called for each raw packet received on this channel.
|
||||
func (cc *CwtchServerSendChannel) Packet(data []byte) {
|
||||
csp := &protocol.CwtchServerPacket{}
|
||||
err := proto.Unmarshal(data, csp)
|
||||
if err == nil {
|
||||
if csp.GetGroupMessage() != nil {
|
||||
gm := csp.GetGroupMessage()
|
||||
ok := cc.spamguard.ValidateChallenge(gm.GetCiphertext(), gm.GetSpamguard())
|
||||
if ok {
|
||||
cc.Handler.HandleGroupMessage(gm)
|
||||
} else {
|
||||
log.Printf("[ERROR] Failed to validate spamguard %v\n", gm)
|
||||
}
|
||||
}
|
||||
} else {
|
||||
log.Printf("[ERROR] Failed to decode packet on SEND channel %v\n", err)
|
||||
}
|
||||
cc.channel.CloseChannel()
|
||||
}
|
|
@ -0,0 +1,174 @@
|
|||
package send
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"cwtch.im/cwtch/protocol/spam"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/wire/control"
|
||||
"github.com/golang/protobuf/proto"
|
||||
"testing"
|
||||
)
|
||||
|
||||
type TestHandler struct {
|
||||
Received bool
|
||||
}
|
||||
|
||||
func (th *TestHandler) HandleGroupMessage(m *protocol.GroupMessage) {
|
||||
th.Received = true
|
||||
}
|
||||
|
||||
func TestServerSendChannelAttributes(t *testing.T) {
|
||||
cssc := new(CwtchServerSendChannel)
|
||||
if cssc.Type() != "im.cwtch.server.send" {
|
||||
t.Errorf("cwtch channel type is incorrect %v", cssc.Type())
|
||||
}
|
||||
|
||||
if !cssc.OnlyClientCanOpen() {
|
||||
t.Errorf("only clients should be able to open im.cwtch.server.send channel")
|
||||
}
|
||||
|
||||
if cssc.Bidirectional() {
|
||||
t.Errorf("im.cwtch.server.send should not be bidirectional")
|
||||
}
|
||||
|
||||
if !cssc.Singleton() {
|
||||
t.Errorf("im.cwtch.server.send should be a Singleton")
|
||||
}
|
||||
|
||||
if cssc.RequiresAuthentication() != "none" {
|
||||
t.Errorf("cwtch channel required auth is incorrect %v", cssc.RequiresAuthentication())
|
||||
}
|
||||
|
||||
}
|
||||
func TestServerSendChannelOpenOutbound(t *testing.T) {
|
||||
cssc := new(CwtchServerSendChannel)
|
||||
channel := new(channels.Channel)
|
||||
_, err := cssc.OpenOutbound(channel)
|
||||
if err == nil {
|
||||
t.Errorf("server implementation of im.cwtch.server.send should never open an outbound channel")
|
||||
}
|
||||
}
|
||||
|
||||
func TestServerSendChannel(t *testing.T) {
|
||||
cssc := new(CwtchServerSendChannel)
|
||||
th := new(TestHandler)
|
||||
cssc.Handler = th
|
||||
channel := new(channels.Channel)
|
||||
channel.ID = 1
|
||||
closed := false
|
||||
channel.CloseChannel = func() {
|
||||
closed = true
|
||||
}
|
||||
|
||||
oc := &Protocol_Data_Control.OpenChannel{
|
||||
ChannelIdentifier: proto.Int32(1),
|
||||
ChannelType: proto.String(cssc.Type()),
|
||||
}
|
||||
|
||||
resp, err := cssc.OpenInbound(channel, oc)
|
||||
if err != nil {
|
||||
t.Errorf("OpenInbound for im.cwtch.server.send should have succeeded, instead: %v", err)
|
||||
}
|
||||
|
||||
control := new(Protocol_Data_Control.Packet)
|
||||
proto.Unmarshal(resp[:], control)
|
||||
|
||||
if control.GetChannelResult() != nil {
|
||||
|
||||
var spamguard spam.Guard
|
||||
spamguard.Difficulty = 2
|
||||
|
||||
ce, _ := proto.GetExtension(control.GetChannelResult(), protocol.E_ServerNonce)
|
||||
challenge := ce.([]byte)[:]
|
||||
|
||||
sgsolve := spamguard.SolveChallenge(challenge, []byte("Hello"))
|
||||
//t.Logf("Solved: %x", sgsolve)
|
||||
|
||||
gm := &protocol.GroupMessage{
|
||||
Ciphertext: []byte("Hello"),
|
||||
Signature: []byte{},
|
||||
Spamguard: sgsolve,
|
||||
}
|
||||
|
||||
csp := &protocol.CwtchServerPacket{
|
||||
GroupMessage: gm,
|
||||
}
|
||||
packet, _ := proto.Marshal(csp)
|
||||
|
||||
cssc.Packet(packet)
|
||||
|
||||
if !th.Received {
|
||||
t.Errorf("group message should have been received")
|
||||
}
|
||||
|
||||
if !closed {
|
||||
t.Errorf("im.cwtch.server.send should have been closed after use")
|
||||
}
|
||||
} else {
|
||||
t.Errorf("Expected ChannelResult from im.cwtch.server.send, instead: %v", control)
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
func TestServerSendChannelNoSpamGuard(t *testing.T) {
|
||||
cssc := new(CwtchServerSendChannel)
|
||||
th := new(TestHandler)
|
||||
th.Received = false
|
||||
cssc.Handler = th
|
||||
channel := new(channels.Channel)
|
||||
channel.ID = 1
|
||||
closed := false
|
||||
channel.CloseChannel = func() {
|
||||
closed = true
|
||||
}
|
||||
|
||||
oc := &Protocol_Data_Control.OpenChannel{
|
||||
ChannelIdentifier: proto.Int32(1),
|
||||
ChannelType: proto.String(cssc.Type()),
|
||||
}
|
||||
|
||||
resp, err := cssc.OpenInbound(channel, oc)
|
||||
if err != nil {
|
||||
t.Errorf("OpenInbound for im.cwtch.server.send should have succeeded, instead: %v", err)
|
||||
}
|
||||
|
||||
control := new(Protocol_Data_Control.Packet)
|
||||
proto.Unmarshal(resp[:], control)
|
||||
|
||||
if control.GetChannelResult() != nil {
|
||||
|
||||
var spamguard spam.Guard
|
||||
spamguard.Difficulty = 2
|
||||
|
||||
ce, _ := proto.GetExtension(control.GetChannelResult(), protocol.E_ServerNonce)
|
||||
challenge := ce.([]byte)[:]
|
||||
|
||||
sgsolve := spamguard.SolveChallenge(challenge, []byte("4234"))
|
||||
//t.Logf("Solved: %x", sgsolve)
|
||||
|
||||
gm := &protocol.GroupMessage{
|
||||
Ciphertext: []byte("hello"),
|
||||
Signature: []byte{},
|
||||
Spamguard: sgsolve,
|
||||
}
|
||||
|
||||
csp := &protocol.CwtchServerPacket{
|
||||
GroupMessage: gm,
|
||||
}
|
||||
packet, _ := proto.Marshal(csp)
|
||||
|
||||
cssc.Packet(packet)
|
||||
|
||||
if th.Received == true {
|
||||
t.Errorf("group message should not have been received")
|
||||
}
|
||||
|
||||
if !closed {
|
||||
t.Errorf("im.cwtch.server.send should have been closed after use")
|
||||
}
|
||||
|
||||
} else {
|
||||
t.Errorf("Expected ChannelResult from im.cwtch.server.send, instead: %v", control)
|
||||
}
|
||||
|
||||
}
|
196
server/server.go
196
server/server.go
|
@ -1,161 +1,79 @@
|
|||
package server
|
||||
|
||||
import (
|
||||
"crypto/ed25519"
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/server/fetch"
|
||||
"cwtch.im/cwtch/server/listen"
|
||||
"cwtch.im/cwtch/server/metrics"
|
||||
"cwtch.im/cwtch/server/storage"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/cwtch.im/tapir"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/applications"
|
||||
tor2 "git.openprivacy.ca/cwtch.im/tapir/networks/tor"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/persistence"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives/privacypass"
|
||||
"git.openprivacy.ca/openprivacy/connectivity"
|
||||
"git.openprivacy.ca/openprivacy/connectivity/tor"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"path"
|
||||
"sync"
|
||||
"cwtch.im/cwtch/server/send"
|
||||
"cwtch.im/cwtch/storage"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/application"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
"log"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/utils"
|
||||
)
|
||||
|
||||
// Server encapsulates a complete, compliant Cwtch server.
|
||||
type Server struct {
|
||||
service tapir.Service
|
||||
config Config
|
||||
metricsPack metrics.Monitors
|
||||
tokenTapirService tapir.Service
|
||||
tokenServer *privacypass.TokenServer
|
||||
tokenService primitives.Identity
|
||||
tokenServicePrivKey ed25519.PrivateKey
|
||||
tokenServiceStopped bool
|
||||
onionServiceStopped bool
|
||||
running bool
|
||||
existingMessageCount int
|
||||
lock sync.RWMutex
|
||||
}
|
||||
|
||||
// Setup initialized a server from a given configuration
|
||||
func (s *Server) Setup(serverConfig Config) {
|
||||
s.config = serverConfig
|
||||
bs := new(persistence.BoltPersistence)
|
||||
bs.Open(path.Join(serverConfig.ConfigDir, "tokens.db"))
|
||||
s.tokenServer = privacypass.NewTokenServerFromStore(&serverConfig.TokenServiceK, bs)
|
||||
log.Infof("Y: %v", s.tokenServer.Y)
|
||||
s.tokenService = s.config.TokenServiceIdentity()
|
||||
s.tokenServicePrivKey = s.config.TokenServerPrivateKey
|
||||
}
|
||||
|
||||
// Identity returns the main onion identity of the server
|
||||
func (s *Server) Identity() primitives.Identity {
|
||||
return s.config.Identity()
|
||||
app *application.RicochetApplication
|
||||
config Config
|
||||
metricsPack metrics.Monitors
|
||||
}
|
||||
|
||||
// Run starts a server with the given privateKey
|
||||
func (s *Server) Run(acn connectivity.ACN) error {
|
||||
addressIdentity := tor.GetTorV3Hostname(s.config.PublicKey)
|
||||
identity := primitives.InitializeIdentity("", &s.config.PrivateKey, &s.config.PublicKey)
|
||||
var service tapir.Service
|
||||
service = new(tor2.BaseOnionService)
|
||||
service.Init(acn, s.config.PrivateKey, &identity)
|
||||
s.service = service
|
||||
log.Infof("cwtch server running on cwtch:%s\n", addressIdentity+".onion:")
|
||||
s.metricsPack.Start(service, s.config.ConfigDir, s.config.ServerReporting.LogMetricsToFile)
|
||||
// TODO: surface errors
|
||||
func (s *Server) Run(serverConfig Config) {
|
||||
s.config = serverConfig
|
||||
cwtchserver := new(application.RicochetApplication)
|
||||
s.metricsPack.Start(cwtchserver, s.config.ServerReporting.LogMetricsToFile)
|
||||
|
||||
l, err := application.SetupOnionV3("127.0.0.1:9051", "tcp4", "", s.config.PrivateKey, utils.GetTorV3Hostname(s.config.PublicKey), 9878)
|
||||
|
||||
ms := new(storage.MessageStore)
|
||||
err := ms.Init(s.config.ConfigDir, s.config.MaxBufferLines, s.metricsPack.MessageCounter)
|
||||
if err != nil {
|
||||
return err
|
||||
log.Fatalf("error setting up onion service: %v", err)
|
||||
}
|
||||
|
||||
// Needed because we only collect metrics on a per-session basis
|
||||
// TODO fix metrics so they persist across sessions?
|
||||
s.existingMessageCount = len(ms.FetchMessages())
|
||||
|
||||
s.tokenTapirService = new(tor2.BaseOnionService)
|
||||
s.tokenTapirService.Init(acn, s.tokenServicePrivKey, &s.tokenService)
|
||||
tokenApplication := new(applications.TokenApplication)
|
||||
tokenApplication.TokenService = s.tokenServer
|
||||
powTokenApp := new(applications.ApplicationChain).
|
||||
ChainApplication(new(applications.ProofOfWorkApplication), applications.SuccessfulProofOfWorkCapability).
|
||||
ChainApplication(tokenApplication, applications.HasTokensCapability)
|
||||
go func() {
|
||||
s.tokenTapirService.Listen(powTokenApp)
|
||||
s.tokenServiceStopped = true
|
||||
}()
|
||||
go func() {
|
||||
s.service.Listen(NewTokenBoardServer(ms, s.tokenServer))
|
||||
s.onionServiceStopped = true
|
||||
}()
|
||||
|
||||
s.lock.Lock()
|
||||
s.running = true
|
||||
s.lock.Unlock()
|
||||
return nil
|
||||
}
|
||||
|
||||
// KeyBundle provides the signed keybundle of the server
|
||||
func (s *Server) KeyBundle() *model.KeyBundle {
|
||||
kb := model.NewKeyBundle()
|
||||
identity := s.config.Identity()
|
||||
kb.Keys[model.KeyTypeServerOnion] = model.Key(identity.Hostname())
|
||||
kb.Keys[model.KeyTypeTokenOnion] = model.Key(s.tokenService.Hostname())
|
||||
kb.Keys[model.KeyTypePrivacyPass] = model.Key(s.tokenServer.Y.String())
|
||||
kb.Sign(identity)
|
||||
return kb
|
||||
}
|
||||
|
||||
// CheckStatus returns true if the server is running and/or an error if any part of the server needs to be restarted.
|
||||
func (s *Server) CheckStatus() (bool, error) {
|
||||
s.lock.RLock()
|
||||
defer s.lock.RUnlock()
|
||||
if s.onionServiceStopped == true || s.tokenServiceStopped == true {
|
||||
return s.running, fmt.Errorf("one of more server components are down: onion:%v token service: %v", s.onionServiceStopped, s.tokenServiceStopped)
|
||||
af := application.ApplicationInstanceFactory{}
|
||||
af.Init()
|
||||
ms := new(storage.MessageStore)
|
||||
err = ms.Init(".", s.config.MaxBufferLines, s.metricsPack.MessageCounter)
|
||||
if err != nil {
|
||||
log.Fatal(err)
|
||||
}
|
||||
return s.running, nil
|
||||
af.AddHandler("im.cwtch.server.listen", func(rai *application.ApplicationInstance) func() channels.Handler {
|
||||
return func() channels.Handler {
|
||||
cslc := new(listen.CwtchServerListenChannel)
|
||||
return cslc
|
||||
}
|
||||
})
|
||||
|
||||
af.AddHandler("im.cwtch.server.fetch", func(rai *application.ApplicationInstance) func() channels.Handler {
|
||||
si := new(Instance)
|
||||
si.Init(rai, cwtchserver, ms)
|
||||
return func() channels.Handler {
|
||||
cssc := new(fetch.CwtchServerFetchChannel)
|
||||
cssc.Handler = si
|
||||
return cssc
|
||||
}
|
||||
})
|
||||
|
||||
af.AddHandler("im.cwtch.server.send", func(rai *application.ApplicationInstance) func() channels.Handler {
|
||||
si := new(Instance)
|
||||
si.Init(rai, cwtchserver, ms)
|
||||
return func() channels.Handler {
|
||||
cssc := new(send.CwtchServerSendChannel)
|
||||
cssc.Handler = si
|
||||
return cssc
|
||||
}
|
||||
})
|
||||
|
||||
cwtchserver.InitV3("cwtch server for "+l.Addr().String(), s.config.Identity(), af, new(application.AcceptAllContactManager))
|
||||
log.Printf("cwtch server running on cwtch:%s", l.Addr().String())
|
||||
s.app = cwtchserver
|
||||
s.app.Run(l)
|
||||
}
|
||||
|
||||
// Shutdown kills the app closing all connections and freeing all goroutines
|
||||
func (s *Server) Shutdown() {
|
||||
s.lock.Lock()
|
||||
defer s.lock.Unlock()
|
||||
s.service.Shutdown()
|
||||
s.tokenTapirService.Shutdown()
|
||||
s.app.Shutdown()
|
||||
s.metricsPack.Stop()
|
||||
s.running = true
|
||||
|
||||
}
|
||||
|
||||
// Statistics is an encapsulation of information about the server that an operator might want to know at a glance.
|
||||
type Statistics struct {
|
||||
TotalMessages int
|
||||
}
|
||||
|
||||
// GetStatistics is a stub method for providing some high level information about
|
||||
// the server operation to bundling applications (e.g. the UI)
|
||||
func (s *Server) GetStatistics() Statistics {
|
||||
// TODO Statistics from Metrics is very awkward. Metrics needs an overhaul to make safe
|
||||
total := s.existingMessageCount
|
||||
if s.metricsPack.TotalMessageCounter != nil {
|
||||
total += s.metricsPack.TotalMessageCounter.Count()
|
||||
}
|
||||
|
||||
return Statistics{
|
||||
TotalMessages: total,
|
||||
}
|
||||
}
|
||||
|
||||
// ConfigureAutostart sets whether this server should autostart (in the Cwtch UI/bundling application)
|
||||
func (s *Server) ConfigureAutostart(autostart bool) {
|
||||
s.config.AutoStart = autostart
|
||||
s.config.Save(s.config.ConfigDir, s.config.FilePath)
|
||||
}
|
||||
|
||||
// Close shuts down the cwtch server in a safe way.
|
||||
func (s *Server) Close() {
|
||||
log.Infof("Shutting down server")
|
||||
s.lock.Lock()
|
||||
defer s.lock.Unlock()
|
||||
log.Infof("Closing Token Server Database...")
|
||||
s.tokenServer.Close()
|
||||
}
|
||||
|
|
|
@ -3,12 +3,10 @@ package server
|
|||
import (
|
||||
"crypto/rand"
|
||||
"encoding/json"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"github.com/gtank/ristretto255"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/identity"
|
||||
"golang.org/x/crypto/ed25519"
|
||||
"io/ioutil"
|
||||
"path"
|
||||
"log"
|
||||
)
|
||||
|
||||
// Reporting is a struct for storing a the config a server needs to be a peer, and connect to a group to report
|
||||
|
@ -20,79 +18,42 @@ type Reporting struct {
|
|||
|
||||
// Config is a struct for storing basic server configuration
|
||||
type Config struct {
|
||||
ConfigDir string `json:"-"`
|
||||
FilePath string `json:"-"`
|
||||
MaxBufferLines int `json:"maxBufferLines"`
|
||||
|
||||
PublicKey ed25519.PublicKey `json:"publicKey"`
|
||||
PrivateKey ed25519.PrivateKey `json:"privateKey"`
|
||||
|
||||
TokenServerPublicKey ed25519.PublicKey `json:"tokenServerPublicKey"`
|
||||
TokenServerPrivateKey ed25519.PrivateKey `json:"tokenServerPrivateKey"`
|
||||
|
||||
TokenServiceK ristretto255.Scalar `json:"tokenServiceK"`
|
||||
|
||||
ServerReporting Reporting `json:"serverReporting"`
|
||||
AutoStart bool `json:"autostart"`
|
||||
MaxBufferLines int `json:"maxBufferLines"`
|
||||
PublicKey ed25519.PublicKey `json:"publicKey"`
|
||||
PrivateKey ed25519.PrivateKey `json:"privateKey"`
|
||||
ServerReporting Reporting `json:"serverReporting"`
|
||||
}
|
||||
|
||||
// Identity returns an encapsulation of the servers keys
|
||||
func (config *Config) Identity() primitives.Identity {
|
||||
return primitives.InitializeIdentity("", &config.PrivateKey, &config.PublicKey)
|
||||
}
|
||||
|
||||
// TokenServiceIdentity returns an encapsulation of the servers token server (experimental)
|
||||
func (config *Config) TokenServiceIdentity() primitives.Identity {
|
||||
return primitives.InitializeIdentity("", &config.TokenServerPrivateKey, &config.TokenServerPublicKey)
|
||||
// Identity returns an encapsulation of the servers keys for running ricochet
|
||||
func (config *Config) Identity() identity.Identity {
|
||||
return identity.InitializeV3("", &config.PrivateKey, &config.PublicKey)
|
||||
}
|
||||
|
||||
// Save dumps the latest version of the config to a json file given by filename
|
||||
func (config *Config) Save(dir, filename string) {
|
||||
log.Infof("Saving config to %s\n", path.Join(dir, filename))
|
||||
func (config *Config) Save(filename string) {
|
||||
bytes, _ := json.MarshalIndent(config, "", "\t")
|
||||
ioutil.WriteFile(path.Join(dir, filename), bytes, 0600)
|
||||
ioutil.WriteFile(filename, bytes, 0600)
|
||||
}
|
||||
|
||||
// LoadConfig loads a Config from a json file specified by filename
|
||||
func LoadConfig(configDir, filename string) Config {
|
||||
log.Infof("Loading config from %s\n", path.Join(configDir, filename))
|
||||
func LoadConfig(filename string) Config {
|
||||
config := Config{}
|
||||
|
||||
id, pk := primitives.InitializeEphemeralIdentity()
|
||||
tid, tpk := primitives.InitializeEphemeralIdentity()
|
||||
config.PrivateKey = pk
|
||||
config.PublicKey = id.PublicKey()
|
||||
config.TokenServerPrivateKey = tpk
|
||||
config.TokenServerPublicKey = tid.PublicKey()
|
||||
config.MaxBufferLines = 100000
|
||||
config.ServerReporting = Reporting{
|
||||
LogMetricsToFile: true,
|
||||
ReportingGroupID: "",
|
||||
ReportingServerAddr: "",
|
||||
}
|
||||
config.AutoStart = false
|
||||
config.ConfigDir = configDir
|
||||
config.FilePath = filename
|
||||
|
||||
k := new(ristretto255.Scalar)
|
||||
b := make([]byte, 64)
|
||||
_, err := rand.Read(b)
|
||||
if err != nil {
|
||||
// unable to generate secure random numbers
|
||||
panic("unable to generate secure random numbers")
|
||||
}
|
||||
k.FromUniformBytes(b)
|
||||
config.TokenServiceK = *k
|
||||
|
||||
raw, err := ioutil.ReadFile(path.Join(configDir, filename))
|
||||
config.ServerReporting.LogMetricsToFile = false
|
||||
raw, err := ioutil.ReadFile(filename)
|
||||
if err == nil {
|
||||
err = json.Unmarshal(raw, &config)
|
||||
|
||||
if err != nil {
|
||||
log.Errorf("reading config: %v", err)
|
||||
log.Println("Error reading config: ", err)
|
||||
}
|
||||
}
|
||||
|
||||
if config.PrivateKey == nil {
|
||||
config.PublicKey, config.PrivateKey, _ = ed25519.GenerateKey(rand.Reader)
|
||||
}
|
||||
|
||||
// Always save (first time generation, new version with new variables populated)
|
||||
config.Save(configDir, filename)
|
||||
config.Save(filename)
|
||||
return config
|
||||
}
|
||||
|
|
|
@ -0,0 +1,45 @@
|
|||
package server
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"cwtch.im/cwtch/server/listen"
|
||||
"cwtch.im/cwtch/storage"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/application"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/channels"
|
||||
)
|
||||
|
||||
// Instance encapsulates the Ricochet application.
|
||||
type Instance struct {
|
||||
rai *application.ApplicationInstance
|
||||
ra *application.RicochetApplication
|
||||
msi storage.MessageStoreInterface
|
||||
}
|
||||
|
||||
// Init sets up a Server Instance
|
||||
func (si *Instance) Init(rai *application.ApplicationInstance, ra *application.RicochetApplication, msi storage.MessageStoreInterface) {
|
||||
si.rai = rai
|
||||
si.ra = ra
|
||||
si.msi = msi
|
||||
}
|
||||
|
||||
// HandleFetchRequest returns a list of all messages in the servers buffer
|
||||
func (si *Instance) HandleFetchRequest() []*protocol.GroupMessage {
|
||||
return si.msi.FetchMessages()
|
||||
}
|
||||
|
||||
// HandleGroupMessage takes in a group message and distributes it to all listening peers
|
||||
func (si *Instance) HandleGroupMessage(gm *protocol.GroupMessage) {
|
||||
si.msi.AddMessage(*gm)
|
||||
go si.ra.Broadcast(func(rai *application.ApplicationInstance) {
|
||||
rai.Connection.Do(func() error {
|
||||
channel := rai.Connection.Channel("im.cwtch.server.listen", channels.Inbound)
|
||||
if channel != nil {
|
||||
cslc, ok := channel.Handler.(*listen.CwtchServerListenChannel)
|
||||
if ok {
|
||||
cslc.SendGroupMessage(gm)
|
||||
}
|
||||
}
|
||||
return nil
|
||||
})
|
||||
})
|
||||
}
|
|
@ -0,0 +1,37 @@
|
|||
package server
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"cwtch.im/cwtch/server/metrics"
|
||||
"cwtch.im/cwtch/storage"
|
||||
"git.openprivacy.ca/openprivacy/libricochet-go/application"
|
||||
"os"
|
||||
"testing"
|
||||
"time"
|
||||
)
|
||||
|
||||
func TestServerInstance(t *testing.T) {
|
||||
si := new(Instance)
|
||||
ai := new(application.ApplicationInstance)
|
||||
ra := new(application.RicochetApplication)
|
||||
msi := new(storage.MessageStore)
|
||||
os.RemoveAll("messages")
|
||||
msi.Init(".", 5, metrics.NewCounter())
|
||||
gm := protocol.GroupMessage{
|
||||
Ciphertext: []byte("Hello this is a fairly average length message that we are writing here."),
|
||||
Spamguard: []byte{},
|
||||
}
|
||||
|
||||
si.Init(ai, ra, msi)
|
||||
msi.AddMessage(gm)
|
||||
res := si.HandleFetchRequest()
|
||||
|
||||
if len(res) != 1 {
|
||||
t.Errorf("Expected 1 Group Messages Instead got %v", res)
|
||||
}
|
||||
|
||||
// ra.HandleApplicationInstance(ai)
|
||||
si.HandleGroupMessage(&gm)
|
||||
|
||||
time.Sleep(time.Second * 2)
|
||||
}
|
|
@ -1,118 +0,0 @@
|
|||
package server
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol/groups"
|
||||
"cwtch.im/cwtch/server/storage"
|
||||
"encoding/json"
|
||||
"git.openprivacy.ca/cwtch.im/tapir"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/applications"
|
||||
"git.openprivacy.ca/cwtch.im/tapir/primitives/privacypass"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
)
|
||||
|
||||
// NewTokenBoardServer generates new Server for Token Board
|
||||
func NewTokenBoardServer(store storage.MessageStoreInterface, tokenService *privacypass.TokenServer) tapir.Application {
|
||||
tba := new(TokenboardServer)
|
||||
tba.TokenService = tokenService
|
||||
tba.LegacyMessageStore = store
|
||||
return tba
|
||||
}
|
||||
|
||||
// TokenboardServer defines the token board server
|
||||
type TokenboardServer struct {
|
||||
applications.AuthApp
|
||||
connection tapir.Connection
|
||||
TokenService *privacypass.TokenServer
|
||||
LegacyMessageStore storage.MessageStoreInterface
|
||||
}
|
||||
|
||||
// NewInstance creates a new TokenBoardApp
|
||||
func (ta *TokenboardServer) NewInstance() tapir.Application {
|
||||
tba := new(TokenboardServer)
|
||||
tba.TokenService = ta.TokenService
|
||||
tba.LegacyMessageStore = ta.LegacyMessageStore
|
||||
return tba
|
||||
}
|
||||
|
||||
// Init initializes the cryptographic TokenBoardApp
|
||||
func (ta *TokenboardServer) Init(connection tapir.Connection) {
|
||||
ta.AuthApp.Init(connection)
|
||||
if connection.HasCapability(applications.AuthCapability) {
|
||||
ta.connection = connection
|
||||
go ta.Listen()
|
||||
} else {
|
||||
connection.Close()
|
||||
}
|
||||
}
|
||||
|
||||
// Listen processes the messages for this application
|
||||
func (ta *TokenboardServer) Listen() {
|
||||
for {
|
||||
data := ta.connection.Expect()
|
||||
if len(data) == 0 {
|
||||
log.Debugf("Server Closing Connection")
|
||||
ta.connection.Close()
|
||||
return // connection is closed
|
||||
}
|
||||
|
||||
var message groups.Message
|
||||
if err := json.Unmarshal(data, &message); err != nil {
|
||||
log.Debugf("Server Closing Connection Because of Malformed Client Packet %v", err)
|
||||
ta.connection.Close()
|
||||
return // connection is closed
|
||||
}
|
||||
|
||||
switch message.MessageType {
|
||||
case groups.PostRequestMessage:
|
||||
if message.PostRequest != nil {
|
||||
postrequest := *message.PostRequest
|
||||
log.Debugf("Received a Post Message Request: %v", ta.connection.Hostname())
|
||||
ta.postMessageRequest(postrequest)
|
||||
} else {
|
||||
log.Debugf("Server Closing Connection Because of PostRequestMessage Client Packet")
|
||||
ta.connection.Close()
|
||||
return // connection is closed
|
||||
}
|
||||
case groups.ReplayRequestMessage:
|
||||
if message.ReplayRequest != nil {
|
||||
log.Debugf("Received Replay Request %v", message.ReplayRequest)
|
||||
messages := ta.LegacyMessageStore.FetchMessages()
|
||||
response, _ := json.Marshal(groups.Message{MessageType: groups.ReplayResultMessage, ReplayResult: &groups.ReplayResult{NumMessages: len(messages)}})
|
||||
log.Debugf("Sending Replay Response %v", groups.ReplayResult{NumMessages: len(messages)})
|
||||
ta.connection.Send(response)
|
||||
for _, message := range messages {
|
||||
data, _ = json.Marshal(message)
|
||||
ta.connection.Send(data)
|
||||
}
|
||||
// Set sync and then send any new messages that might have happened while we were syncing
|
||||
ta.connection.SetCapability(groups.CwtchServerSyncedCapability)
|
||||
newMessages := ta.LegacyMessageStore.FetchMessages()
|
||||
if len(newMessages) > len(messages) {
|
||||
for _, message := range newMessages[len(messages):] {
|
||||
data, _ = json.Marshal(groups.Message{MessageType: groups.NewMessageMessage, NewMessage: &groups.NewMessage{EGM: *message}})
|
||||
ta.connection.Send(data)
|
||||
}
|
||||
}
|
||||
} else {
|
||||
log.Debugf("Server Closing Connection Because of Malformed ReplayRequestMessage Packet")
|
||||
ta.connection.Close()
|
||||
return // connection is closed
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func (ta *TokenboardServer) postMessageRequest(pr groups.PostRequest) {
|
||||
if err := ta.TokenService.SpendToken(pr.Token, append(pr.EGM.ToBytes(), ta.connection.ID().Hostname()...)); err == nil {
|
||||
log.Debugf("Token is valid")
|
||||
ta.LegacyMessageStore.AddMessage(pr.EGM)
|
||||
data, _ := json.Marshal(groups.Message{MessageType: groups.PostResultMessage, PostResult: &groups.PostResult{Success: true}})
|
||||
ta.connection.Send(data)
|
||||
data, _ = json.Marshal(groups.Message{MessageType: groups.NewMessageMessage, NewMessage: &groups.NewMessage{EGM: pr.EGM}})
|
||||
ta.connection.Broadcast(data, groups.CwtchServerSyncedCapability)
|
||||
} else {
|
||||
log.Debugf("Attempt to spend an invalid token: %v", err)
|
||||
data, _ := json.Marshal(groups.Message{MessageType: groups.PostResultMessage, PostResult: &groups.PostResult{Success: false}})
|
||||
ta.connection.Send(data)
|
||||
}
|
||||
}
|
|
@ -2,13 +2,12 @@ package storage
|
|||
|
||||
import (
|
||||
"bufio"
|
||||
"cwtch.im/cwtch/protocol/groups"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"cwtch.im/cwtch/server/metrics"
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"log"
|
||||
"os"
|
||||
"path"
|
||||
"sync"
|
||||
)
|
||||
|
||||
|
@ -20,8 +19,8 @@ const (
|
|||
|
||||
// MessageStoreInterface defines an interface to interact with a store of cwtch messages.
|
||||
type MessageStoreInterface interface {
|
||||
AddMessage(groups.EncryptedGroupMessage)
|
||||
FetchMessages() []*groups.EncryptedGroupMessage
|
||||
AddMessage(protocol.GroupMessage)
|
||||
FetchMessages() []*protocol.GroupMessage
|
||||
}
|
||||
|
||||
// MessageStore is a file-backed implementation of MessageStoreInterface
|
||||
|
@ -30,7 +29,7 @@ type MessageStore struct {
|
|||
filePos int
|
||||
storeDirectory string
|
||||
lock sync.Mutex
|
||||
messages []*groups.EncryptedGroupMessage
|
||||
messages []*protocol.GroupMessage
|
||||
messageCounter metrics.Counter
|
||||
maxBufferLines int
|
||||
bufferPos int
|
||||
|
@ -45,7 +44,7 @@ func (ms *MessageStore) Close() {
|
|||
ms.lock.Unlock()
|
||||
}
|
||||
|
||||
func (ms *MessageStore) updateBuffer(gm *groups.EncryptedGroupMessage) {
|
||||
func (ms *MessageStore) updateBuffer(gm *protocol.GroupMessage) {
|
||||
ms.messages[ms.bufferPos] = gm
|
||||
ms.bufferPos++
|
||||
if ms.bufferPos == ms.maxBufferLines {
|
||||
|
@ -58,10 +57,10 @@ func (ms *MessageStore) initAndLoadFiles() error {
|
|||
ms.activeLogFile = nil
|
||||
for i := fileStorePartitions - 1; i >= 0; i-- {
|
||||
ms.filePos = 0
|
||||
filename := path.Join(ms.storeDirectory, fmt.Sprintf("%s.%d", fileStoreFilename, i))
|
||||
filename := fmt.Sprintf("%s%s.%d", ms.storeDirectory, fileStoreFilename, i)
|
||||
f, err := os.OpenFile(filename, os.O_CREATE|os.O_APPEND|os.O_RDWR, 0600)
|
||||
if err != nil {
|
||||
log.Errorf("MessageStore could not open: %v: %v", filename, err)
|
||||
log.Printf("Error: MessageStore could not open: %v: %v", filename, err)
|
||||
continue
|
||||
}
|
||||
ms.activeLogFile = f
|
||||
|
@ -70,7 +69,7 @@ func (ms *MessageStore) initAndLoadFiles() error {
|
|||
for scanner.Scan() {
|
||||
gms := scanner.Text()
|
||||
ms.filePos++
|
||||
gm := &groups.EncryptedGroupMessage{}
|
||||
gm := &protocol.GroupMessage{}
|
||||
err := json.Unmarshal([]byte(gms), gm)
|
||||
if err == nil {
|
||||
ms.updateBuffer(gm)
|
||||
|
@ -83,10 +82,10 @@ func (ms *MessageStore) initAndLoadFiles() error {
|
|||
return nil
|
||||
}
|
||||
|
||||
func (ms *MessageStore) updateFile(gm *groups.EncryptedGroupMessage) {
|
||||
func (ms *MessageStore) updateFile(gm *protocol.GroupMessage) {
|
||||
s, err := json.Marshal(gm)
|
||||
if err != nil {
|
||||
log.Errorf("Failed to unmarshal group message %v\n", err)
|
||||
log.Printf("[ERROR] Failed to unmarshal group message %v\n", err)
|
||||
}
|
||||
fmt.Fprintf(ms.activeLogFile, "%s\n", s)
|
||||
ms.filePos++
|
||||
|
@ -97,15 +96,15 @@ func (ms *MessageStore) updateFile(gm *groups.EncryptedGroupMessage) {
|
|||
|
||||
func (ms *MessageStore) rotateFileStore() {
|
||||
ms.activeLogFile.Close()
|
||||
os.Remove(path.Join(ms.storeDirectory, fmt.Sprintf("%s.%d", fileStoreFilename, fileStorePartitions-1)))
|
||||
os.Remove(fmt.Sprintf("%s%s.%d", ms.storeDirectory, fileStoreFilename, fileStorePartitions-1))
|
||||
|
||||
for i := fileStorePartitions - 2; i >= 0; i-- {
|
||||
os.Rename(path.Join(ms.storeDirectory, fmt.Sprintf("%s.%d", fileStoreFilename, i)), path.Join(ms.storeDirectory, fmt.Sprintf("%s.%d", fileStoreFilename, i+1)))
|
||||
os.Rename(fmt.Sprintf("%s%s.%d", ms.storeDirectory, fileStoreFilename, i), fmt.Sprintf("%s%s.%d", ms.storeDirectory, fileStoreFilename, i+1))
|
||||
}
|
||||
|
||||
f, err := os.OpenFile(path.Join(ms.storeDirectory, fmt.Sprintf("%s.%d", fileStoreFilename, 0)), os.O_CREATE|os.O_APPEND|os.O_RDWR, 0600)
|
||||
f, err := os.OpenFile(fmt.Sprintf("%s%s.%d", ms.storeDirectory, fileStoreFilename, 0), os.O_CREATE|os.O_APPEND|os.O_RDWR, 0600)
|
||||
if err != nil {
|
||||
log.Errorf("Could not open new message store file in: %s", ms.storeDirectory)
|
||||
log.Printf("ERROR: Could not open new message store file in: %s", ms.storeDirectory)
|
||||
}
|
||||
ms.filePos = 0
|
||||
ms.activeLogFile = f
|
||||
|
@ -113,12 +112,12 @@ func (ms *MessageStore) rotateFileStore() {
|
|||
|
||||
// Init sets up a MessageStore of size maxBufferLines (# of messages) backed by filename
|
||||
func (ms *MessageStore) Init(appDirectory string, maxBufferLines int, messageCounter metrics.Counter) error {
|
||||
ms.storeDirectory = path.Join(appDirectory, directory)
|
||||
ms.storeDirectory = appDirectory + "/" + directory + "/"
|
||||
os.Mkdir(ms.storeDirectory, 0700)
|
||||
|
||||
ms.bufferPos = 0
|
||||
ms.maxBufferLines = maxBufferLines
|
||||
ms.messages = make([]*groups.EncryptedGroupMessage, maxBufferLines)
|
||||
ms.messages = make([]*protocol.GroupMessage, maxBufferLines)
|
||||
ms.bufferRotated = false
|
||||
ms.messageCounter = messageCounter
|
||||
|
||||
|
@ -127,13 +126,13 @@ func (ms *MessageStore) Init(appDirectory string, maxBufferLines int, messageCou
|
|||
}
|
||||
|
||||
// FetchMessages returns all messages from the backing file.
|
||||
func (ms *MessageStore) FetchMessages() (messages []*groups.EncryptedGroupMessage) {
|
||||
func (ms *MessageStore) FetchMessages() (messages []*protocol.GroupMessage) {
|
||||
ms.lock.Lock()
|
||||
if !ms.bufferRotated {
|
||||
messages = make([]*groups.EncryptedGroupMessage, ms.bufferPos)
|
||||
messages = make([]*protocol.GroupMessage, ms.bufferPos)
|
||||
copy(messages, ms.messages[0:ms.bufferPos])
|
||||
} else {
|
||||
messages = make([]*groups.EncryptedGroupMessage, ms.maxBufferLines)
|
||||
messages = make([]*protocol.GroupMessage, ms.maxBufferLines)
|
||||
copy(messages, ms.messages[ms.bufferPos:ms.maxBufferLines])
|
||||
copy(messages[ms.bufferPos:], ms.messages[0:ms.bufferPos])
|
||||
}
|
||||
|
@ -142,7 +141,7 @@ func (ms *MessageStore) FetchMessages() (messages []*groups.EncryptedGroupMessag
|
|||
}
|
||||
|
||||
// AddMessage adds a GroupMessage to the store
|
||||
func (ms *MessageStore) AddMessage(gm groups.EncryptedGroupMessage) {
|
||||
func (ms *MessageStore) AddMessage(gm protocol.GroupMessage) {
|
||||
ms.messageCounter.Add(1)
|
||||
ms.lock.Lock()
|
||||
ms.updateBuffer(&gm)
|
|
@ -1,7 +1,7 @@
|
|||
package storage
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/protocol/groups"
|
||||
"cwtch.im/cwtch/protocol"
|
||||
"cwtch.im/cwtch/server/metrics"
|
||||
"os"
|
||||
"strconv"
|
||||
|
@ -14,8 +14,9 @@ func TestMessageStore(t *testing.T) {
|
|||
counter := metrics.NewCounter()
|
||||
ms.Init("./", 1000, counter)
|
||||
for i := 0; i < 499; i++ {
|
||||
gm := groups.EncryptedGroupMessage{
|
||||
gm := protocol.GroupMessage{
|
||||
Ciphertext: []byte("Hello this is a fairly average length message that we are writing here. " + strconv.Itoa(i)),
|
||||
Spamguard: []byte{},
|
||||
}
|
||||
ms.AddMessage(gm)
|
||||
}
|
||||
|
@ -32,8 +33,9 @@ func TestMessageStore(t *testing.T) {
|
|||
counter.Reset()
|
||||
|
||||
for i := 0; i < 1000; i++ {
|
||||
gm := groups.EncryptedGroupMessage{
|
||||
gm := protocol.GroupMessage{
|
||||
Ciphertext: []byte("Hello this is a fairly average length message that we are writing here. " + strconv.Itoa(i)),
|
||||
Spamguard: []byte{},
|
||||
}
|
||||
ms.AddMessage(gm)
|
||||
}
|
|
@ -1,93 +1 @@
|
|||
package storage
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/storage/v0"
|
||||
"cwtch.im/cwtch/storage/v1"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"io/ioutil"
|
||||
"path"
|
||||
"strconv"
|
||||
)
|
||||
|
||||
const profileFilename = "profile"
|
||||
const versionFile = "VERSION"
|
||||
const currentVersion = 1
|
||||
|
||||
// ProfileStore is an interface to managing the storage of Cwtch Profiles
|
||||
type ProfileStore interface {
|
||||
Shutdown()
|
||||
Delete()
|
||||
GetProfileCopy(timeline bool) *model.Profile
|
||||
GetNewPeerMessage() *event.Event
|
||||
GetStatusMessages() []*event.Event
|
||||
}
|
||||
|
||||
// CreateProfileWriterStore creates a profile store backed by a filestore listening for events and saving them
|
||||
// directory should be $appDir/profiles/$rand
|
||||
func CreateProfileWriterStore(eventManager event.Manager, directory, password string, profile *model.Profile) ProfileStore {
|
||||
return v1.CreateProfileWriterStore(eventManager, directory, password, profile)
|
||||
}
|
||||
|
||||
// LoadProfileWriterStore loads a profile store from filestore listening for events and saving them
|
||||
// directory should be $appDir/profiles/$rand
|
||||
func LoadProfileWriterStore(eventManager event.Manager, directory, password string) (ProfileStore, error) {
|
||||
versionCheckUpgrade(directory, password)
|
||||
|
||||
return v1.LoadProfileWriterStore(eventManager, directory, password)
|
||||
}
|
||||
|
||||
// ReadProfile reads a profile from storage and returns the profile
|
||||
// Should only be called for cache refresh of the profile after a ProfileWriterStore has opened
|
||||
// (and upgraded) the store, and thus supplied the key/salt
|
||||
func ReadProfile(directory string, key [32]byte, salt [128]byte) (*model.Profile, error) {
|
||||
return v1.ReadProfile(directory, key, salt)
|
||||
}
|
||||
|
||||
// NewProfile creates a new profile for use in the profile store.
|
||||
func NewProfile(name string) *model.Profile {
|
||||
profile := model.GenerateNewProfile(name)
|
||||
return profile
|
||||
}
|
||||
|
||||
// ********* Versioning and upgrade **********
|
||||
|
||||
func detectVersion(directory string) int {
|
||||
vnumberStr, err := ioutil.ReadFile(path.Join(directory, versionFile))
|
||||
if err != nil {
|
||||
return 0
|
||||
}
|
||||
vnumber, err := strconv.Atoi(string(vnumberStr))
|
||||
if err != nil {
|
||||
log.Errorf("Could not parse VERSION file contents: '%v' - %v\n", vnumber, err)
|
||||
return -1
|
||||
}
|
||||
return vnumber
|
||||
}
|
||||
|
||||
func upgradeV0ToV1(directory, password string) error {
|
||||
log.Debugln("Attempting storage v0 to v1: Reading v0 profile...")
|
||||
profile, err := v0.ReadProfile(directory, password)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
log.Debugln("Attempting storage v0 to v1: Writing v1 profile...")
|
||||
return v1.UpgradeV0Profile(profile, directory, password)
|
||||
}
|
||||
|
||||
func versionCheckUpgrade(directory, password string) {
|
||||
version := detectVersion(directory)
|
||||
log.Debugf("versionCheck: %v\n", version)
|
||||
if version == -1 {
|
||||
return
|
||||
}
|
||||
if version == 0 {
|
||||
err := upgradeV0ToV1(directory, password)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
//version = 1
|
||||
}
|
||||
}
|
||||
|
|
|
@ -1,76 +0,0 @@
|
|||
// Known race issue with event bus channel closure
|
||||
|
||||
package storage
|
||||
|
||||
import (
|
||||
"cwtch.im/cwtch/event"
|
||||
"cwtch.im/cwtch/model"
|
||||
"cwtch.im/cwtch/storage/v0"
|
||||
"fmt"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"os"
|
||||
"testing"
|
||||
"time"
|
||||
)
|
||||
|
||||
const testingDir = "./testing"
|
||||
const filenameBase = "testStream"
|
||||
const password = "asdfqwer"
|
||||
const line1 = "Hello from storage!"
|
||||
const testProfileName = "Alice"
|
||||
const testKey = "key"
|
||||
const testVal = "value"
|
||||
const testInitialMessage = "howdy"
|
||||
const testMessage = "Hello from storage"
|
||||
|
||||
func TestProfileStoreUpgradeV0toV1(t *testing.T) {
|
||||
log.SetLevel(log.LevelDebug)
|
||||
os.RemoveAll(testingDir)
|
||||
eventBus := event.NewEventManager()
|
||||
|
||||
queue := event.NewQueue()
|
||||
eventBus.Subscribe(event.ChangePasswordSuccess, queue)
|
||||
|
||||
fmt.Println("Creating and initializing v0 profile and store...")
|
||||
profile := NewProfile(testProfileName)
|
||||
profile.AddContact("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd", &model.PublicProfile{Attributes: map[string]string{string(model.KeyTypeServerOnion): "2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd"}})
|
||||
|
||||
ps1 := v0.NewProfileWriterStore(eventBus, testingDir, password, profile)
|
||||
|
||||
groupid, invite, err := profile.StartGroup("2c3kmoobnyghj2zw6pwv7d57yzld753auo3ugauezzpvfak3ahc4bdyd")
|
||||
if err != nil {
|
||||
t.Errorf("Creating group: %v\n", err)
|
||||
}
|
||||
if err != nil {
|
||||
t.Errorf("Creating group invite: %v\n", err)
|
||||
}
|
||||
|
||||
ps1.AddGroup(invite)
|
||||
|
||||
fmt.Println("Sending 200 messages...")
|
||||
|
||||
for i := 0; i < 200; i++ {
|
||||
ps1.AddGroupMessage(groupid, time.Now().Format(time.RFC3339Nano), time.Now().Format(time.RFC3339Nano), profile.Onion, testMessage)
|
||||
}
|
||||
|
||||
fmt.Println("Shutdown v0 profile store...")
|
||||
ps1.Shutdown()
|
||||
|
||||
fmt.Println("New v1 Profile store...")
|
||||
ps2, err := LoadProfileWriterStore(eventBus, testingDir, password)
|
||||
if err != nil {
|
||||
t.Errorf("Error createing new profileStore with new password: %v\n", err)
|
||||
return
|
||||
}
|
||||
|
||||
profile2 := ps2.GetProfileCopy(true)
|
||||
|
||||
if profile2.Groups[groupid] == nil {
|
||||
t.Errorf("Failed to load group %v\n", groupid)
|
||||
return
|
||||
}
|
||||
|
||||
if len(profile2.Groups[groupid].Timeline.Messages) != 200 {
|
||||
t.Errorf("Failed to load group's 200 messages, instead got %v\n", len(profile2.Groups[groupid].Timeline.Messages))
|
||||
}
|
||||
}
|
|
@ -1,70 +0,0 @@
|
|||
package v0
|
||||
|
||||
import (
|
||||
"crypto/rand"
|
||||
"errors"
|
||||
"git.openprivacy.ca/openprivacy/log"
|
||||
"golang.org/x/crypto/nacl/secretbox"
|
||||
"golang.org/x/crypto/pbkdf2"
|
||||
"golang.org/x/crypto/sha3"
|
||||
"io"
|
||||
"io/ioutil"
|
||||
"path"
|
||||
)
|
||||
|
||||
// createKey derives a key from a password
|
||||
func createKey(password string) ([32]byte, [128]byte, error) {
|
||||
var salt [128]byte
|
||||
if _, err := io.ReadFull(rand.Reader, salt[:]); err != nil {
|
||||
log.Errorf("Cannot read from random: %v\n", err)
|
||||
return [32]byte{}, salt, err
|
||||
}
|
||||
dk := pbkdf2.Key([]byte(password), salt[:], 4096, 32, sha3.New512)
|
||||
|
||||
var dkr [32]byte
|
||||
copy(dkr[:], dk)
|
||||
return dkr, salt, nil
|
||||
}
|
||||
|
||||
//encryptFileData encrypts the cwtchPeer via the specified key.
|
||||
func encryptFileData(data []byte, key [32]byte) ([]byte, error) {
|
||||
var nonce [24]byte
|
||||
|
||||
if _, err := io.ReadFull(rand.Reader, nonce[:]); err != nil {
|
||||
log.Errorf("Cannot read from random: %v\n", err)
|
||||
return nil, err
|
||||
}
|
||||
|
||||
encrypted := secretbox.Seal(nonce[:], data, &nonce, &key)
|
||||
return encrypted, nil
|
||||
}
|
||||
|
||||
//decryptFile decrypts the passed ciphertext into a cwtchPeer via the specified key.
|
||||
func decryptFile(ciphertext []byte, key [32]byte) ([]byte, error) {
|
||||
var decryptNonce [24]byte
|
||||
copy(decryptNonce[:], ciphertext[:24])
|
||||
decrypted, ok := secretbox.Open(nil, ciphertext[24:], &decryptNonce, &key)
|
||||
if ok {
|
||||
return decrypted, nil
|
||||
}
|
||||
return nil, errors.New("Failed to decrypt")
|
||||
}
|
||||
|
||||
// Load instantiates a cwtchPeer from the file store
|
||||
func readEncryptedFile(directory, filename, password string) ([]byte, error) {
|
||||
encryptedbytes, err := ioutil.ReadFile(path.Join(directory, filename))
|
||||
if err == nil && len(encryptedbytes) > 128 {
|
||||
var dkr [32]byte
|
||||
//Separate the salt from the encrypted bytes, then generate the derived key
|
||||
salt, encryptedbytes := encryptedbytes[0:128], encryptedbytes[128:]
|
||||
dk := pbkdf2.Key([]byte(password), salt, 4096, 32, sha3.New512)
|
||||
copy(dkr[:], dk)
|
||||
|
||||
data, err := decryptFile(encryptedbytes, dkr)
|
||||
if err == nil {
|
||||
return data, nil
|
||||
}
|
||||
return nil, err
|
||||
}
|
||||
return nil, err
|
||||
}
|
|
@ -1,46 +0,0 @@
|
|||
package v0
|
||||
|
||||
import (
|
||||
"io/ioutil"
|
||||
"path"
|
||||
)
|
||||
|
||||
// fileStore stores a cwtchPeer in an encrypted file
|
||||
type fileStore struct {
|
||||
directory string
|
||||
filename string
|
||||
password string
|
||||
}
|
||||
|
||||
// FileStore is a primitive around storing encrypted files
|
||||
type FileStore interface {
|
||||
Read() ([]byte, error)
|
||||
Write(data []byte) error
|
||||
}
|
||||
|
||||
// NewFileStore instantiates a fileStore given a filename and a password
|
||||
func NewFileStore(directory string, filename string, password string) FileStore {
|
||||
filestore := new(fileStore)
|
||||
filestore.password = password
|
||||
filestore.filename = filename
|
||||
filestore.directory = directory
|
||||
return filestore
|
||||
}
|
||||
|
||||
func (fps *fileStore) Read() ([]byte, error) {
|
||||
return readEncryptedFile(fps.directory, fps.filename, fps.password)
|
||||
}
|
||||
|
||||
// write serializes a cwtchPeer to a file
|
||||
func (fps *fileStore) Write(data []byte) error {
|
||||
key, salt, _ := createKey(fps.password)
|
||||
encryptedbytes, err := encryptFileData(data, key)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
// the salt for the derived key is appended to the front of the file
|
||||
encryptedbytes = append(salt[:], encryptedbytes...)
|
||||
err = ioutil.WriteFile(path.Join(fps.directory, fps.filename), encryptedbytes, 0600)
|
||||
return err
|
||||
}
|
Some files were not shown because too many files have changed in this diff Show More
Loading…
Reference in New Issue